diff --git a/README.md b/README.md index a2ab00c944e40485025a4f49fc33146f2c7cddef..5fe20581168f9b60710ca90c04f95383678c8537 100644 --- a/README.md +++ b/README.md @@ -28,9 +28,15 @@ DIY is a header-only library. It does not need to be built; you can simply include it in your project. The examples can be built using `cmake` from the top-level directory. +## Development + +Development happens in the [DIY repo](https://gitlab.kitware.com/diatomic/diy) +on Kitware's GitLab. Please submit merge requests there. Issues should +be submitted in the GitHub repo. + ## Documentation -[Doxygen pages](https://diatomic.github.io/diy) +[DIY project](https://diatomic.github.io/diy) ## Example diff --git a/include/vtkdiy2/algorithms.hpp b/include/vtkdiy2/algorithms.hpp index 13a9b0ee737f733bd4d15aa5689a88d393214e67..588a17835f34cf40b830e80319201d965ae85f10 100644 --- a/include/vtkdiy2/algorithms.hpp +++ b/include/vtkdiy2/algorithms.hpp @@ -8,10 +8,13 @@ #include "reduce.hpp" #include "reduce-operations.hpp" #include "partners/swap.hpp" +#include "resolve.hpp" #include "detail/algorithms/sort.hpp" #include "detail/algorithms/kdtree.hpp" #include "detail/algorithms/kdtree-sampling.hpp" +#include "detail/algorithms/load-balance-collective.hpp" +#include "detail/algorithms/load-balance-sampling.hpp" #include "log.hpp" @@ -86,7 +89,7 @@ namespace diy typedef diy::RegularContinuousLink RCLink; - for (size_t i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) { RCLink* link = static_cast<RCLink*>(master.link(i)); *link = RCLink(dim, domain, domain); @@ -122,7 +125,7 @@ namespace diy // update master.expected to match the links int expected = 0; - for (size_t i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) expected += master.link(i)->size_unique(); master.set_expected(expected); } @@ -146,7 +149,7 @@ namespace diy typedef diy::RegularContinuousLink RCLink; - for (size_t i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) { RCLink* link = static_cast<RCLink*>(master.link(i)); *link = RCLink(dim, domain, domain); @@ -182,10 +185,114 @@ namespace diy // update master.expected to match the links int expected = 0; - for (size_t i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) expected += master.link(i)->size_unique(); master.set_expected(expected); } + + template<class B> + using LBCallback = std::function<Work(B*, int)>; + + // load balancing using collective method + template<class Callback> + void load_balance_collective( + diy::Master& master, // diy master + diy::DynamicAssigner& dynamic_assigner, // diy dynamic assigner + const Callback& f) // callback to get work for a block + { + // assert that master.destroyer() exists, will be needed for moving blocks + if (!master.destroyer()) + { + fmt::print(stderr, "DIY error: Master must have a block destroyer function in order to use load balancing. Please define one.\n"); + abort(); + } + + using Block = typename detail::block_traits<Callback>::type; + const LBCallback<Block>& f_ = f; + + // compile my work info + diy::detail::WorkInfo my_work_info = { master.communicator().rank(), -1, 0, 0, static_cast<int>(master.size()) }; + for (auto i = 0; i < master.size(); i++) + { + Block* block = static_cast<Block*>(master.block(i)); + Work w = f_(block, master.gid(i)); + my_work_info.proc_work += w; + if (my_work_info.top_gid == -1 || my_work_info.top_work < w) + { + my_work_info.top_gid = master.gid(i); + my_work_info.top_work = w; + } + } + + // exchange info about load balance + std::vector<diy::detail::WorkInfo> all_work_info; // work info collected from all mpi processes + diy::detail::exchange_work_info(master, my_work_info, all_work_info); + + // decide what to move where + std::vector<diy::detail::MoveInfo> all_move_info; // move info for all moves + diy::detail::decide_move_info(all_work_info, all_move_info); + + // move blocks from src to dst proc + for (auto i = 0; i < all_move_info.size(); i++) + diy::detail::move_block(master, all_move_info[i]); + + // fix links + diy::fix_links(master, dynamic_assigner); + } + + // load balancing using sampling method + template<class Callback> + void load_balance_sampling( + diy::Master& master, + diy::DynamicAssigner& dynamic_assigner, // diy dynamic assigner + const Callback& f, // callback to get work for a block + float sample_frac = 0.5, // fraction of procs to sample 0.0 < sample_size <= 1.0 + float quantile = 0.8) // quantile cutoff above which to move blocks (0.0 - 1.0) + { + // assert that master.destroyer() exists, will be needed for moving blocks + if (!master.destroyer()) + { + fmt::print(stderr, "DIY error: Master must have a block destroyer function in order to use load balancing. Please define one.\n"); + abort(); + } + + using Block = typename detail::block_traits<Callback>::type; + const LBCallback<Block>& f_ = f; + + // compile my work info + diy::detail::WorkInfo my_work_info = { master.communicator().rank(), -1, 0, 0, static_cast<int>(master.size()) }; + for (auto i = 0; i < master.size(); i++) + { + Block* block = static_cast<Block*>(master.block(i)); + Work w = f_(block, master.gid(i)); + my_work_info.proc_work += w; + if (my_work_info.top_gid == -1 || my_work_info.top_work < w) + { + my_work_info.top_gid = master.gid(i); + my_work_info.top_work = w; + } + } + + // "auxiliary" master and decomposer for using rexchange for load balancing, 1 block per process + diy::Master aux_master(master.communicator(), 1, -1, &diy::detail::AuxBlock::create, &diy::detail::AuxBlock::destroy); + diy::ContiguousAssigner aux_assigner(aux_master.communicator().size(), aux_master.communicator().size()); + diy::DiscreteBounds aux_domain(1); // any fake domain + aux_domain.min[0] = 0; + aux_domain.max[0] = aux_master.communicator().size() + 1; + diy::RegularDecomposer<diy::DiscreteBounds> aux_decomposer(1, aux_domain, aux_master.communicator().size()); + aux_decomposer.decompose(aux_master.communicator().rank(), aux_assigner, aux_master); + + // exchange info about load balance + std::vector<diy::detail::WorkInfo> sample_work_info; // work info collecting from sampling other mpi processes + diy::detail::exchange_sample_work_info(master, aux_master, sample_frac, my_work_info, sample_work_info); + + // move blocks + diy::detail::move_sample_blocks(master, aux_master, sample_work_info, my_work_info, quantile); + + // fix links + diy::fix_links(master, dynamic_assigner); + } + } #endif diff --git a/include/vtkdiy2/assigner.hpp b/include/vtkdiy2/assigner.hpp index 955a7a6f2f4c8c734a04b0cbe27b7b225b41a39a..d117919bae5604065a5535f02e0d9609679bf8fc 100644 --- a/include/vtkdiy2/assigner.hpp +++ b/include/vtkdiy2/assigner.hpp @@ -109,7 +109,7 @@ namespace diy Assigner(size__, nblocks__), comm_(comm), div_(nblocks__ / size__ + ((nblocks__ % size__) == 0 ? 0 : 1)), // NB: same size window everywhere means the last rank may allocate extra space - rank_map_(comm_, div_) { rank_map_.lock_all(MPI_MODE_NOCHECK); } + rank_map_(comm_, div_) { rank_map_.lock_all(mpi::nocheck); } ~DynamicAssigner() { rank_map_.unlock_all(); } inline @@ -189,7 +189,7 @@ set_nblocks(int nblocks__) rank_map_.unlock_all(); rank_map_ = mpi::window<int>(comm_, div_); - rank_map_.lock_all(MPI_MODE_NOCHECK); + rank_map_.lock_all(mpi::nocheck); } std::tuple<bool,int> diff --git a/include/vtkdiy2/collection.hpp b/include/vtkdiy2/collection.hpp index c327d7ab50929f825bcae7e7143d127c6f34ed07..61390f560f4e2720a5116533b9c91e07571236d4 100644 --- a/include/vtkdiy2/collection.hpp +++ b/include/vtkdiy2/collection.hpp @@ -17,10 +17,10 @@ namespace diy typedef std::vector<Element> Elements; typedef critical_resource<int, recursive_mutex> CInt; - typedef void* (*Create)(); - typedef void (*Destroy)(void*); - typedef detail::Save Save; - typedef detail::Load Load; + using Create = std::function<void*()>; + using Destroy = std::function<void(void*)>; + using Save = detail::Save; + using Load = detail::Load; public: Collection(Create create__, @@ -40,9 +40,10 @@ namespace diy inline void clear(); int add(Element e) { elements_.push_back(e); external_.push_back(-1); ++(*in_memory_.access()); return static_cast<int>(elements_.size()) - 1; } - void* release(int i) { void* e = get(i); elements_[static_cast<size_t>(i)] = 0; return e; } + inline void* release(int i); void* find(int i) const { return elements_[static_cast<size_t>(i)]; } // possibly returns 0, if the element is unloaded + void* const& reference(int i) const { return elements_[static_cast<size_t>(i)]; } void* get(int i) { if (!find(i)) load(i); return find(i); } // loads the element first, and then returns its address int available() const { int i = 0; for (; i < (int)size(); ++i) if (find(i) != 0) break; return i; } @@ -87,6 +88,23 @@ clear() *in_memory_.access() = 0; } +void* +diy::Collection:: +release(int i) +{ + void* e = get(i); + + elements_[static_cast<size_t>(i)] = 0; + std::swap(elements_[static_cast<size_t>(i)], elements_.back()); + elements_.pop_back(); + + std::swap(external_[static_cast<size_t>(i)], external_.back()); + external_.pop_back(); + --(*in_memory_.access()); + + return e; +} + void diy::Collection:: unload(int i) diff --git a/include/vtkdiy2/coroutine.hpp b/include/vtkdiy2/coroutine.hpp new file mode 100644 index 0000000000000000000000000000000000000000..aecb57ec6a14d31b2799c7a425cf27e0f955eab6 --- /dev/null +++ b/include/vtkdiy2/coroutine.hpp @@ -0,0 +1,41 @@ +#ifndef DIY_COROUTINE_HPP +#define DIY_COROUTINE_HPP + +/* + * Derived from libco v20 (2019-10-16) + * author: byuu (https://byuu.org/) + * license: ISC + */ + +namespace diy +{ + +namespace coroutine +{ + +using cothread_t = void*; + + +inline cothread_t co_active(); +inline cothread_t co_create(unsigned int, void (*)(void)); +inline void co_delete(cothread_t); +inline void co_switch(cothread_t); + +// "global variable" to pass an argument +inline void*& argument() +{ + static thread_local void* x; + return x; +} + +} + +} + +#if defined(_WIN32) +#include "coroutine/fiber.hpp" +#else +#include "coroutine/sjlj.hpp" +#endif + +#endif diff --git a/include/vtkdiy2/coroutine/fiber.hpp b/include/vtkdiy2/coroutine/fiber.hpp new file mode 100644 index 0000000000000000000000000000000000000000..c83604cbbaa01917b86f1b3d7f3eb7ecf1f5127c --- /dev/null +++ b/include/vtkdiy2/coroutine/fiber.hpp @@ -0,0 +1,50 @@ +#include <windows.h> + +namespace diy +{ + +namespace coroutine +{ + +/********************** + * "Global varialbes" * + **********************/ +inline cothread_t& co_active_() +{ + static thread_local cothread_t x = 0; + return x; +} +/**********************/ + +static void __stdcall co_thunk(void* coentry) { + ((void (*)(void))coentry)(); +} + +cothread_t co_active() { + if(!co_active_()) { + ConvertThreadToFiber(0); + co_active_() = GetCurrentFiber(); + } + return co_active_(); +} + +cothread_t co_create(unsigned int heapsize, void (*coentry)(void)) { + if(!co_active_()) { + ConvertThreadToFiber(0); + co_active_() = GetCurrentFiber(); + } + return (cothread_t)CreateFiber(heapsize, co_thunk, (void*)coentry); +} + +void co_delete(cothread_t cothread) { + DeleteFiber(cothread); +} + +void co_switch(cothread_t cothread) { + co_active_() = cothread; + SwitchToFiber(cothread); +} + +} + +} diff --git a/include/vtkdiy2/coroutine/sjlj.hpp b/include/vtkdiy2/coroutine/sjlj.hpp new file mode 100644 index 0000000000000000000000000000000000000000..3c116561aa61d8572c6606225bcc41cc68747650 --- /dev/null +++ b/include/vtkdiy2/coroutine/sjlj.hpp @@ -0,0 +1,129 @@ +/* + note this was designed for UNIX systems. Based on ideas expressed in a paper by Ralf Engelschall. + for SJLJ on other systems, one would want to rewrite springboard() and co_create() and hack the jmb_buf stack pointer. +*/ + +#if __USE_FORTIFY_LEVEL +#define DIY_USE_FORTIFY_LEVEL __USE_FORTIFY_LEVEL +#undef __USE_FORTIFY_LEVEL +#warning "diy::coroutine (sjlj.hpp) cannot be compiled with _FORTIFY_SOURCE; disabling." +#endif + + +//#define _BSD_SOURCE +//#define _XOPEN_SOURCE 500 +#include <stdlib.h> +#include <signal.h> +#include <setjmp.h> + +namespace diy +{ + +namespace coroutine +{ + +struct cothread_struct +{ + sigjmp_buf context; + void (*coentry)(void); + void* stack; +}; + +/********************** + * "Global varialbes" * + **********************/ +inline cothread_struct& co_primary() +{ + static thread_local cothread_struct x; + return x; +} + +inline cothread_struct*& creating() +{ + static thread_local cothread_struct* x; + return x; +} + +inline cothread_struct*& co_running() +{ + static thread_local cothread_struct* x = 0; + return x; +} +/**********************/ + +static void springboard(int) { + if(sigsetjmp(creating()->context, 0)) { + co_running()->coentry(); + } +} + +cothread_t co_active() { + if(!co_running()) co_running() = &co_primary(); + return (cothread_t)co_running(); +} + +cothread_t co_create(unsigned int size, void (*coentry)(void)) { + if(!co_running()) co_running() = &co_primary(); + + cothread_struct* thread = (cothread_struct*)malloc(sizeof(cothread_struct)); + if(thread) { + struct sigaction handler; + struct sigaction old_handler; + + stack_t stack; + stack_t old_stack; + + thread->coentry = 0; + thread->stack = 0; + + stack.ss_flags = 0; + stack.ss_size = size; + thread->stack = stack.ss_sp = malloc(size); + if(stack.ss_sp && !sigaltstack(&stack, &old_stack)) { + handler.sa_handler = springboard; + handler.sa_flags = SA_ONSTACK; + sigemptyset(&handler.sa_mask); + creating() = thread; + + if(!sigaction(SIGUSR1, &handler, &old_handler)) { + if(!raise(SIGUSR1)) { + thread->coentry = coentry; + } + sigaltstack(&old_stack, 0); + sigaction(SIGUSR1, &old_handler, 0); + } + } + + if(thread->coentry != coentry) { + co_delete(thread); + thread = 0; + } + } + + return (cothread_t)thread; +} + +void co_delete(cothread_t cothread) { + if(cothread) { + if(((cothread_struct*)cothread)->stack) { + free(((cothread_struct*)cothread)->stack); + } + free(cothread); + } +} + +void co_switch(cothread_t cothread) { + if(!sigsetjmp(co_running()->context, 0)) { + co_running() = (cothread_struct*)cothread; + siglongjmp(co_running()->context, 1); + } +} + +} + +} + +#if DIY_USE_FORTIFY_LEVEL +#define __USE_FORTIFY_LEVEL DIY_USE_FORTIFY_LEVEL +#undef DIY_USE_FORTIFY_LEVEL +#endif diff --git a/include/vtkdiy2/critical-resource.hpp b/include/vtkdiy2/critical-resource.hpp index 45c5ccadc4a04047ba355c2ac8a3478c5bf35a80..e6dd5047e133f3eaa5d4a3de9c5d15a8d440e1e8 100644 --- a/include/vtkdiy2/critical-resource.hpp +++ b/include/vtkdiy2/critical-resource.hpp @@ -17,6 +17,9 @@ namespace diy const T& operator*() const { return x_; } const T* operator->() const { return &x_; } + void lock() { lock_.lock(); } + void unlock() { lock_.unlock(); } + private: T& x_; lock_guard<Mutex> lock_; @@ -33,6 +36,8 @@ namespace diy critical_resource() {} critical_resource(const T& x): x_(x) {} + critical_resource(T&& x): + x_(std::move(x)) {} accessor access() { return accessor(x_, m_); } const_accessor const_access() const { return const_accessor(x_, m_); } diff --git a/include/vtkdiy2/decomposition.hpp b/include/vtkdiy2/decomposition.hpp index e1d624ca9592f5f1c09f91d4085f2f9421d93f51..12f86437c5cf13b514ac700504ce63ab585770c1 100644 --- a/include/vtkdiy2/decomposition.hpp +++ b/include/vtkdiy2/decomposition.hpp @@ -63,8 +63,8 @@ namespace detail static Coordinate from(int i, int n, Coordinate min, Coordinate max, bool) { return min + (max - min)/n * i; } static Coordinate to (int i, int n, Coordinate min, Coordinate max, bool) { return min + (max - min)/n * (i+1); } - static int lower(Coordinate x, int n, Coordinate min, Coordinate max, bool) { Coordinate width = (max - min)/n; Coordinate res = std::floor((x - min)/width); if (min + res*width == x) return (res - 1); else return res; } - static int upper(Coordinate x, int n, Coordinate min, Coordinate max, bool) { Coordinate width = (max - min)/n; Coordinate res = std::ceil ((x - min)/width); if (min + res*width == x) return (res + 1); else return res; } + static int lower(Coordinate x, int n, Coordinate min, Coordinate max, bool) { Coordinate width = (max - min)/n; auto res = static_cast<int>(std::floor((x - min)/width)); if (min + res*width == x) return (res - 1); else return res; } + static int upper(Coordinate x, int n, Coordinate min, Coordinate max, bool) { Coordinate width = (max - min)/n; auto res = static_cast<int>(std::ceil ((x - min)/width)); if (min + res*width == x) return (res + 1); else return res; } }; } @@ -123,6 +123,7 @@ namespace detail template<class Point> int lowest_gid(const Point& p) const; + DivisionsVector gid_to_coords(int gid) const { DivisionsVector coords; gid_to_coords(gid, coords); return coords; } void gid_to_coords(int gid, DivisionsVector& coords) const { gid_to_coords(gid, coords, divisions); } int coords_to_gid(const DivisionsVector& coords) const { return coords_to_gid(coords, divisions); } void fill_divisions(std::vector<int>& divisions) const; @@ -131,8 +132,8 @@ namespace detail void fill_bounds(Bounds& bounds, int gid, bool add_ghosts = false) const; static bool all(const std::vector<int>& v, int x); - static void gid_to_coords(int gid, DivisionsVector& coords, const DivisionsVector& divisions); - static int coords_to_gid(const DivisionsVector& coords, const DivisionsVector& divisions); + static void gid_to_coords(int gid, DivisionsVector& coords, const DivisionsVector& divs); + static int coords_to_gid(const DivisionsVector& coords, const DivisionsVector& divs); static void factor(std::vector<unsigned>& factors, int n); @@ -409,25 +410,25 @@ all(const std::vector<int>& v, int x) template<class Bounds> void diy::RegularDecomposer<Bounds>:: -gid_to_coords(int gid, DivisionsVector& coords, const DivisionsVector& divisions) +gid_to_coords(int gid, DivisionsVector& coords, const DivisionsVector& divs) { - int dim = static_cast<int>(divisions.size()); - for (int i = 0; i < dim; ++i) + coords.clear(); + for (int i = 0; i < static_cast<int>(divs.size()); ++i) { - coords.push_back(gid % divisions[i]); - gid /= divisions[i]; + coords.push_back(gid % divs[i]); + gid /= divs[i]; } } template<class Bounds> int diy::RegularDecomposer<Bounds>:: -coords_to_gid(const DivisionsVector& coords, const DivisionsVector& divisions) +coords_to_gid(const DivisionsVector& coords, const DivisionsVector& divs) { int gid = 0; for (int i = static_cast<int>(coords.size()) - 1; i >= 0; --i) { - gid *= divisions[i]; + gid *= divs[i]; gid += coords[i]; } return gid; @@ -552,8 +553,7 @@ fill_divisions(std::vector<int>& divisions_) const } // iterate over factorization of number of blocks (factors are sorted smallest to largest) - // NB: using int instead of size_t because must be negative in order to break out of loop - for (int i = factors.size() - 1; i >= 0; --i) + for (auto f = factors.rbegin(); f != factors.rend(); ++f) { // fill in missing divs by dividing dimension w/ largest block size // except when this would be illegal (resulting in bounds.max < bounds.min; @@ -565,19 +565,19 @@ fill_divisions(std::vector<int>& divisions_) const // split the dimension with the largest block size (first element in vector) Coordinate min = detail::BoundsHelper<Bounds>::from(0, - missing_divs[0].nb * factors[i], + missing_divs[0].nb * (*f), domain.min[missing_divs[0].dim], domain.max[missing_divs[0].dim], share_face[missing_divs[0].dim]); Coordinate max = detail::BoundsHelper<Bounds>::to(0, - missing_divs[0].nb * factors[i], + missing_divs[0].nb * (*f), domain.min[missing_divs[0].dim], domain.max[missing_divs[0].dim], share_face[missing_divs[0].dim]); if (max >= min) { - missing_divs[0].nb *= factors[i]; + missing_divs[0].nb *= (*f); missing_divs[0].b_size = max - min; } else diff --git a/include/vtkdiy2/detail/algorithms/kdtree-sampling.hpp b/include/vtkdiy2/detail/algorithms/kdtree-sampling.hpp index 2a99ced517536e3c3a1826a71c18cbc0973c6721..6b3cf382376d74f71e9fb2fa8a1b8b7696b5b7c3 100644 --- a/include/vtkdiy2/detail/algorithms/kdtree-sampling.hpp +++ b/include/vtkdiy2/detail/algorithms/kdtree-sampling.hpp @@ -74,7 +74,7 @@ operator()(Block* b, const diy::ReduceProxy& srp, const KDTreePartners& partners dim = partners.dim(srp.round() - 1); if (srp.round() == partners.rounds()) - update_links(b, srp, dim, partners.sub_round(srp.round() - 2), partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round + update_links(b, srp, dim, partners.sub_round((int)srp.round() - 2), (int)partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round else if (partners.swap_round(srp.round()) && partners.sub_round(srp.round()) < 0) // link round { dequeue_exchange(b, srp, dim); // from the swap round @@ -92,7 +92,7 @@ operator()(Block* b, const diy::ReduceProxy& srp, const KDTreePartners& partners int prev_dim = dim - 1; if (prev_dim < 0) prev_dim += dim_; - update_links(b, srp, prev_dim, partners.sub_round(srp.round() - 2), partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round + update_links(b, srp, prev_dim, partners.sub_round((int)srp.round() - 2), (int)partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round } compute_local_samples(b, srp, dim); @@ -134,7 +134,7 @@ divide_gid(int gid, bool lower, int round, int rounds) const template<class Block, class Point> void diy::detail::KDTreeSamplingPartition<Block,Point>:: -update_links(Block* b, const diy::ReduceProxy& srp, int dim, int round, int rounds, bool wrap, const Bounds& domain) const +update_links(Block*, const diy::ReduceProxy& srp, int dim, int round, int rounds, bool wrap, const Bounds& domain) const { auto log = get_logger(); int gid = srp.gid(); @@ -253,7 +253,7 @@ update_links(Block* b, const diy::ReduceProxy& srp, int dim, int round, int roun template<class Block, class Point> void diy::detail::KDTreeSamplingPartition<Block,Point>:: -split_to_neighbors(Block* b, const diy::ReduceProxy& srp, int dim) const +split_to_neighbors(Block*, const diy::ReduceProxy& srp, int) const { int lid = srp.master()->lid(srp.gid()); RCLink* link = static_cast<RCLink*>(srp.master()->link(lid)); @@ -290,7 +290,7 @@ compute_local_samples(Block* b, const diy::ReduceProxy& srp, int dim) const template<class Block, class Point> void diy::detail::KDTreeSamplingPartition<Block,Point>:: -add_samples(Block* b, const diy::ReduceProxy& srp, Samples& samples) const +add_samples(Block*, const diy::ReduceProxy& srp, Samples& samples) const { // dequeue and combine the samples for (int i = 0; i < srp.in_link().size(); ++i) @@ -307,7 +307,7 @@ add_samples(Block* b, const diy::ReduceProxy& srp, Samples& samples) const template<class Block, class Point> void diy::detail::KDTreeSamplingPartition<Block,Point>:: -receive_samples(Block* b, const diy::ReduceProxy& srp, Samples& samples) const +receive_samples(Block*, const diy::ReduceProxy& srp, Samples& samples) const { srp.dequeue(srp.in_link().target(0).gid, samples); } @@ -315,7 +315,7 @@ receive_samples(Block* b, const diy::ReduceProxy& srp, Samples& samples) const template<class Block, class Point> void diy::detail::KDTreeSamplingPartition<Block,Point>:: -forward_samples(Block* b, const diy::ReduceProxy& srp, const Samples& samples) const +forward_samples(Block*, const diy::ReduceProxy& srp, const Samples& samples) const { for (int i = 0; i < srp.out_link().size(); ++i) srp.enqueue(srp.out_link().target(i), samples); diff --git a/include/vtkdiy2/detail/algorithms/kdtree.hpp b/include/vtkdiy2/detail/algorithms/kdtree.hpp index 2a46c400100904bec841f12d35f5465050df8b67..3754c868cb9c24072859ce828725b79d2f25503f 100644 --- a/include/vtkdiy2/detail/algorithms/kdtree.hpp +++ b/include/vtkdiy2/detail/algorithms/kdtree.hpp @@ -68,10 +68,10 @@ struct diy::detail::KDTreePartners wrap(wrap_), domain(domain_) { - for (unsigned i = 0; i < swap.rounds(); ++i) + for (int i = 0; i < swap.rounds(); ++i) { // fill histogram rounds - for (unsigned j = 0; j < histogram.rounds(); ++j) + for (int j = 0; j < histogram.rounds(); ++j) { rounds_.push_back(std::make_pair(false, j)); dim_.push_back(i % dim); @@ -115,7 +115,7 @@ struct diy::detail::KDTreePartners else if (swap_round(round) && sub_round(round) < 0) // link round swap.incoming(sub_round(round - 1) + 1, gid, partners, m); else if (swap_round(round)) - histogram.incoming(histogram.rounds(), gid, partners, m); + histogram.incoming(static_cast<int>(histogram.rounds()), gid, partners, m); else { if (round > 0 && sub_round(round) == 0) @@ -177,7 +177,7 @@ operator()(Block* b, const diy::ReduceProxy& srp, const KDTreePartners& partners dim = partners.dim(srp.round() - 1); if (srp.round() == partners.rounds()) - update_links(b, srp, dim, partners.sub_round(srp.round() - 2), partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round + update_links(b, srp, dim, partners.sub_round((int)srp.round() - 2), (int)partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round else if (partners.swap_round(srp.round()) && partners.sub_round(srp.round()) < 0) // link round { dequeue_exchange(b, srp, dim); // from the swap round @@ -195,7 +195,7 @@ operator()(Block* b, const diy::ReduceProxy& srp, const KDTreePartners& partners int prev_dim = dim - 1; if (prev_dim < 0) prev_dim += dim_; - update_links(b, srp, prev_dim, partners.sub_round(srp.round() - 2), partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round + update_links(b, srp, prev_dim, partners.sub_round((int)srp.round() - 2), (int)partners.swap_rounds(), partners.wrap, partners.domain); // -1 would be the "uninformative" link round } compute_local_histogram(b, srp, dim); @@ -229,7 +229,7 @@ divide_gid(int gid, bool lower, int round, int rounds) const template<class Block, class Point> void diy::detail::KDTreePartition<Block,Point>:: -update_links(Block* b, const diy::ReduceProxy& srp, int dim, int round, int rounds, bool wrap, const Bounds& domain) const +update_links(Block*, const diy::ReduceProxy& srp, int dim, int round, int rounds, bool wrap, const Bounds& domain) const { int gid = srp.gid(); int lid = srp.master()->lid(gid); @@ -346,7 +346,7 @@ update_links(Block* b, const diy::ReduceProxy& srp, int dim, int round, int roun template<class Block, class Point> void diy::detail::KDTreePartition<Block,Point>:: -split_to_neighbors(Block* b, const diy::ReduceProxy& srp, int dim) const +split_to_neighbors(Block*, const diy::ReduceProxy& srp, int) const { int lid = srp.master()->lid(srp.gid()); RCLink* link = static_cast<RCLink*>(srp.master()->link(lid)); @@ -366,20 +366,23 @@ void diy::detail::KDTreePartition<Block,Point>:: compute_local_histogram(Block* b, const diy::ReduceProxy& srp, int dim) const { + auto udim = static_cast<unsigned>(dim); int lid = srp.master()->lid(srp.gid()); RCLink* link = static_cast<RCLink*>(srp.master()->link(lid)); // compute and enqueue local histogram Histogram histogram(bins_); - float width = (link->core().max[dim] - link->core().min[dim])/bins_; + float width = (link->core().max[udim] - link->core().min[udim])/bins_; for (size_t i = 0; i < (b->*points_).size(); ++i) { - float x = (b->*points_)[i][dim]; - int loc = (x - link->core().min[dim]) / width; - if (loc < 0) - throw std::runtime_error(fmt::format("{} {} {}", loc, x, link->core().min[dim])); - if (loc >= (int) bins_) + float x = (b->*points_)[i][udim]; + float floc = (x - link->core().min[udim]) / width; + if (floc < 0) + throw std::runtime_error(fmt::format("{} {} {}", floc, x, link->core().min[udim])); + + auto loc = static_cast<size_t>(floc); + if (loc >= bins_) loc = bins_ - 1; ++(histogram[loc]); } @@ -390,7 +393,7 @@ compute_local_histogram(Block* b, const diy::ReduceProxy& srp, int dim) const template<class Block, class Point> void diy::detail::KDTreePartition<Block,Point>:: -add_histogram(Block* b, const diy::ReduceProxy& srp, Histogram& histogram) const +add_histogram(Block*, const diy::ReduceProxy& srp, Histogram& histogram) const { // dequeue and add up the histograms for (int i = 0; i < srp.in_link().size(); ++i) @@ -407,7 +410,7 @@ add_histogram(Block* b, const diy::ReduceProxy& srp, Histogram& histogram) const template<class Block, class Point> void diy::detail::KDTreePartition<Block,Point>:: -receive_histogram(Block* b, const diy::ReduceProxy& srp, Histogram& histogram) const +receive_histogram(Block*, const diy::ReduceProxy& srp, Histogram& histogram) const { srp.dequeue(srp.in_link().target(0).gid, histogram); } @@ -415,7 +418,7 @@ receive_histogram(Block* b, const diy::ReduceProxy& srp, Histogram& histogram) c template<class Block, class Point> void diy::detail::KDTreePartition<Block,Point>:: -forward_histogram(Block* b, const diy::ReduceProxy& srp, const Histogram& histogram) const +forward_histogram(Block*, const diy::ReduceProxy& srp, const Histogram& histogram) const { for (int i = 0; i < srp.out_link().size(); ++i) srp.enqueue(srp.out_link().target(i), histogram); @@ -445,22 +448,26 @@ enqueue_exchange(Block* b, const diy::ReduceProxy& srp, int dim, const Histogram size_t cur = 0; float width = (link->core().max[dim] - link->core().min[dim])/bins_; float split = 0; - size_t i = 0; - for (; i < histogram.size(); ++i) + + // scope-block for variable `i` { - if (cur + histogram[i] > total/2) - break; - cur += histogram[i]; + size_t i = 0; + for (; i < histogram.size(); ++i) + { + if (cur + histogram[i] > total/2) + break; + cur += histogram[i]; + } + if (i == 0) + ++i; + else if (i >= histogram.size() - 1) + i = histogram.size() - 2; + split = link->core().min[dim] + width*i; + log->trace("Found split: {} (dim={}) in {} - {}", split, dim, link->core().min[dim], link->core().max[dim]); } - if (i == 0) - ++i; - else if (i >= histogram.size() - 1) - i = histogram.size() - 2; - split = link->core().min[dim] + width*i; - log->trace("Found split: {} (dim={}) in {} - {}", split, dim, link->core().min[dim], link->core().max[dim]); // subset and enqueue - std::vector< std::vector<Point> > out_points(srp.out_link().size()); + std::vector< std::vector<Point> > out_points(static_cast<size_t>(srp.out_link().size())); for (size_t i = 0; i < (b->*points_).size(); ++i) { float x = (b->*points_)[i][dim]; diff --git a/include/vtkdiy2/detail/algorithms/load-balance-collective.hpp b/include/vtkdiy2/detail/algorithms/load-balance-collective.hpp new file mode 100644 index 0000000000000000000000000000000000000000..a22ee3d54bd2362ed1aae99cfada58f563754229 --- /dev/null +++ b/include/vtkdiy2/detail/algorithms/load-balance-collective.hpp @@ -0,0 +1,125 @@ +#pragma once + +#include <queue> +#include "load-balance.hpp" + +namespace diy +{ + +namespace detail +{ + +// exchange work information among all processes using synchronous collective method +inline void exchange_work_info(diy::Master& master, + const WorkInfo& my_work_info, // my process' work info + std::vector<WorkInfo>& all_work_info) // (output) global work info +{ + auto nprocs = master.communicator().size(); // global number of procs + all_work_info.resize(nprocs); + diy::mpi::detail::all_gather(master.communicator(), &my_work_info, sizeof(WorkInfo), MPI_BYTE, &all_work_info[0]); +} + +// determine move info from work info +inline void decide_move_info(std::vector<WorkInfo>& all_work_info, // global work info + std::vector<MoveInfo>& all_move_info) // (output) move info for all moves +{ + all_move_info.clear(); + + // move all blocks with an approximation to the longest processing time first (LPTF) scheduling algorithm + // https://en.wikipedia.org/wiki/Longest-processing-time-first_scheduling + // we iteratively move the heaviest block to lightest proc + // constrained by only recording the heaviest block for each proc, not all blocks + + // minimum proc_work priority queue, top is min proc_work + auto cmp = [&](WorkInfo& a, WorkInfo& b) { return a.proc_work > b.proc_work; }; + std::priority_queue<WorkInfo, std::vector<WorkInfo>, decltype(cmp)> min_proc_work_q(cmp); + for (auto i = 0; i < all_work_info.size(); i++) + min_proc_work_q.push(all_work_info[i]); + + // sort all_work_info by descending top_work + std::sort(all_work_info.begin(), all_work_info.end(), + [&](WorkInfo& a, WorkInfo& b) { return a.top_work > b.top_work; }); + + // walk the all_work_info vector in descending top_work order + // move the next heaviest block to the lightest proc + for (auto i = 0; i < all_work_info.size(); i++) + { + auto src_work_info = all_work_info[i]; // heaviest block + auto dst_work_info = min_proc_work_q.top(); // lightest proc + + // sanity check that the move makes sense + if (src_work_info.proc_work - dst_work_info.proc_work > src_work_info.top_work && // improve load balance + src_work_info.proc_rank != dst_work_info.proc_rank && // not self + src_work_info.nlids > 1) // don't leave a proc with no blocks + { + MoveInfo move_info; + move_info.src_proc = src_work_info.proc_rank; + move_info.dst_proc = dst_work_info.proc_rank; + move_info.move_gid = src_work_info.top_gid; + all_move_info.push_back(move_info); + + // update the min_proc_work priority queue + auto work_info = min_proc_work_q.top(); // lightest proc + work_info.proc_work += src_work_info.top_work; + if (work_info.top_work < src_work_info.top_work) + { + work_info.top_work = src_work_info.top_work; + work_info.top_gid = src_work_info.top_gid; + } + min_proc_work_q.pop(); + min_proc_work_q.push(work_info); + } + } +} + +// move one block from src to dst proc +inline void move_block(diy::Master& master, + const MoveInfo& move_info) +{ + // sanity check that source and destination are different + if (move_info.src_proc == move_info.dst_proc) + { + fmt::print(stderr, "Error: move_block(): source and destination are same. This should not happen.\n"); + abort(); + } + + if (master.communicator().rank() == move_info.src_proc) + { + diy::MemoryBuffer bb; + + // move the block from src to dst proc + void* send_b = master.block(master.lid(move_info.move_gid)); + master.saver()(send_b, bb); + master.communicator().send(move_info.dst_proc, 0, bb.buffer); + + // move the link for the moving block + diy::Link* send_link = master.link(master.lid(move_info.move_gid)); + diy::LinkFactory::save(bb, send_link); + master.communicator().send(move_info.dst_proc, 0, bb.buffer); + + // remove the block from the master + int move_lid = master.lid(move_info.move_gid); + master.destroyer()(master.release(move_lid)); + } + else if (master.communicator().rank() == move_info.dst_proc) + { + diy::MemoryBuffer bb; + + // move the block from src to dst proc + void* recv_b = master.creator()(); + master.communicator().recv(move_info.src_proc, 0, bb.buffer); + master.loader()(recv_b, bb); + + // move the link for the moving block + diy::Link* recv_link; + master.communicator().recv(move_info.src_proc, 0, bb.buffer); + recv_link = diy::LinkFactory::load(bb); + + // add the block to the master + master.add(move_info.move_gid, recv_b, recv_link); + } +} + +} // namespace detail + +} // namespace diy diff --git a/include/vtkdiy2/detail/algorithms/load-balance-sampling.hpp b/include/vtkdiy2/detail/algorithms/load-balance-sampling.hpp new file mode 100644 index 0000000000000000000000000000000000000000..e4c6f254a6cb4c6e51763a0bfe682e12228b4549 --- /dev/null +++ b/include/vtkdiy2/detail/algorithms/load-balance-sampling.hpp @@ -0,0 +1,217 @@ +#pragma once + +#include "load-balance.hpp" + +namespace diy +{ + +namespace detail +{ + +// send requests for work info +inline void send_req(AuxBlock*, // local block (unused) + const diy::Master::ProxyWithLink& cp, // communication proxy for neighbor blocks + std::set<int>& procs) // processes to query +{ + // send requests for work info to sample_procs + int v = 1; // any message will do + for (auto proc_iter = procs.begin(); proc_iter != procs.end(); proc_iter++) + { + int gid = *proc_iter; + int proc = *proc_iter; + diy::BlockID dest_block = {gid, proc}; + cp.enqueue(dest_block, v); + } +} + +// receive requests for work info +inline void recv_req(AuxBlock*, // local block (unused) + const diy::Master::ProxyWithLink& cp, // communication proxy for neighbor blocks + std::vector<int>& req_procs) // processes requesting work info +{ + std::vector<int> incoming_gids; + cp.incoming(incoming_gids); + + // for anything incoming, dequeue data received in the last exchange + for (int i = 0; i < incoming_gids.size(); i++) + { + int gid = incoming_gids[i]; + if (cp.incoming(gid).size()) + { + int v; + cp.dequeue(gid, v); + req_procs.push_back(gid); // aux_master has 1 gid per proc, so gid = proc + } + } +} + +// get work information from a random sample of processes +inline void exchange_sample_work_info(diy::Master& master, // the real master with multiple blocks per process + diy::Master& aux_master, // auxiliary master with 1 block per process for communicating between procs + float sample_frac, // fraction of procs to sample 0.0 < sample_size <= 1.0 + const WorkInfo& my_work_info, // my process' work info + std::vector<WorkInfo>& sample_work_info) // (output) vector of sorted sample work info, sorted by increasing total work per process +{ + auto nprocs = master.communicator().size(); // global number of procs + auto my_proc = master.communicator().rank(); // rank of my proc + + // pick a random sample of processes, w/o duplicates, and excluding myself + int nsamples = static_cast<int>(sample_frac * (nprocs - 1)); + std::set<int> sample_procs; + for (auto i = 0; i < nsamples; i++) + { + int rand_proc; + do + { + std::uniform_int_distribution<> distrib(0, nprocs - 1); // inclusive + rand_proc = distrib(master.mt_gen); + } while (sample_procs.find(rand_proc) != sample_procs.end() || rand_proc == my_proc); + sample_procs.insert(rand_proc); + } + + // rexchange requests for work info + std::vector<int> req_procs; // requests for work info received from these processes + aux_master.foreach([&](AuxBlock* b, const diy::Master::ProxyWithLink& cp) + { send_req(b, cp, sample_procs); }); + aux_master.exchange(true); // true = remote + aux_master.foreach([&](AuxBlock* b, const diy::Master::ProxyWithLink& cp) + { recv_req(b, cp, req_procs); }); + + // send work info + int work_info_tag = 0; + std::vector<diy::mpi::request> reqs(req_procs.size()); + for (auto i = 0; i < req_procs.size(); i++) + reqs[i] = mpi::detail::isend(MPI_Comm(master.communicator()), req_procs[i], work_info_tag, &my_work_info, sizeof(WorkInfo), MPI_BYTE); + + // receive work info + sample_work_info.resize(nsamples); + for (auto i = 0; i < nsamples; i++) + mpi::detail::recv(MPI_Comm(master.communicator()), diy::mpi::any_source, work_info_tag, &sample_work_info[i], sizeof(WorkInfo), MPI_BYTE); + + // ensure all the send requests cleared + for (auto i = 0; i < req_procs.size(); i++) + reqs[i].wait(); + + // sort sample_work_info by proc_work + std::sort(sample_work_info.begin(), sample_work_info.end(), + [&](WorkInfo& a, WorkInfo& b) { return a.proc_work < b.proc_work; }); +} + +// send block +inline void send_block(AuxBlock*, // local block (unused) + const diy::Master::ProxyWithLink& cp, // communication proxy for neighbor blocks + diy::Master& master, // real master with multiple blocks per process + const std::vector<WorkInfo>& sample_work_info, // sampled work info + const WorkInfo& my_work_info, // my work info + float quantile) // quantile cutoff above which to move blocks (0.0 - 1.0) +{ + MoveInfo move_info = {-1, -1, -1}; + + // my rank's position in the sampled work info, sorted by proc_work + int my_work_idx = sample_work_info.size(); // index where my work would be in the sample_work + for (auto i = 0; i < sample_work_info.size(); i++) + { + if (my_work_info.proc_work < sample_work_info[i].proc_work) + { + my_work_idx = i; + break; + } + } + + // send my heaviest block if it passes the quantile cutoff + if (my_work_idx >= quantile * sample_work_info.size()) + { + // pick the destination process to be the mirror image of my work location in the samples + // ie, the heavier my process, the lighter the destination process + int target = sample_work_info.size() - my_work_idx; + + auto src_work_info = my_work_info; + auto dst_work_info = sample_work_info[target]; + + // sanity check that the move makes sense + if (src_work_info.proc_work - dst_work_info.proc_work > src_work_info.top_work && // improve load balance + src_work_info.proc_rank != dst_work_info.proc_rank && // not self + src_work_info.nlids > 1) // don't leave a proc with no blocks + { + + move_info.move_gid = my_work_info.top_gid; + move_info.src_proc = my_work_info.proc_rank; + move_info.dst_proc = sample_work_info[target].proc_rank; + + // destination in aux_master, where gid = proc + diy::BlockID dest_block = {move_info.dst_proc, move_info.dst_proc}; + + // enqueue the gid of the moving block + cp.enqueue(dest_block, move_info.move_gid); + + // enqueue the block + void* send_b = master.block(master.lid(move_info.move_gid)); + diy::MemoryBuffer bb; + master.saver()(send_b, bb); + cp.enqueue(dest_block, bb.buffer); + + // enqueue the link for the block + diy::Link* send_link = master.link(master.lid(move_info.move_gid)); + diy::LinkFactory::save(bb, send_link); + cp.enqueue(dest_block, bb.buffer); + + // remove the block from the master + int move_lid = master.lid(move_info.move_gid); + master.destroyer()(master.release(move_lid)); + } + } +} + +// receive block +inline void recv_block(AuxBlock*, // local block (unused) + const diy::Master::ProxyWithLink& cp, // communication proxy for neighbor blocks + diy::Master& master) // real master with multiple blocks per process +{ + std::vector<int> incoming_gids; + cp.incoming(incoming_gids); + + // for anything incoming, dequeue data received in the last exchange + for (int i = 0; i < incoming_gids.size(); i++) + { + int gid = incoming_gids[i]; + if (cp.incoming(gid).size()) + { + // dequeue the gid of the moving block + int move_gid; + cp.dequeue(gid, move_gid); + + // dequeue the block + void* recv_b = master.creator()(); + diy::MemoryBuffer bb; + cp.dequeue(gid, bb.buffer); + master.loader()(recv_b, bb); + + // dequeue the link + diy::Link* recv_link; + cp.dequeue(gid, bb.buffer); + recv_link = diy::LinkFactory::load(bb); + + // add block to the master + master.add(move_gid, recv_b, recv_link); + } + } +} + +// move blocks based on sampled work info +inline void move_sample_blocks(diy::Master& master, // real master with multiple blocks per process + diy::Master& aux_master, // auxiliary master with 1 block per process for communcating between procs + const std::vector<WorkInfo>& sample_work_info, // sampled work info + const WorkInfo& my_work_info, // my work info + float quantile) // quantile cutoff above which to move blocks (0.0 - 1.0) +{ + // rexchange moving blocks + aux_master.foreach([&](AuxBlock* b, const diy::Master::ProxyWithLink& cp) + { send_block(b, cp, master, sample_work_info, my_work_info, quantile); }); + aux_master.exchange(true); // true = remote + aux_master.foreach([&](AuxBlock* b, const diy::Master::ProxyWithLink& cp) + { recv_block(b, cp, master); }); +} + +} // namespace detail + +} // namespace diy diff --git a/include/vtkdiy2/detail/algorithms/load-balance.hpp b/include/vtkdiy2/detail/algorithms/load-balance.hpp new file mode 100644 index 0000000000000000000000000000000000000000..f394c1c4c9fb21135d51648aa12089eb8a640eeb --- /dev/null +++ b/include/vtkdiy2/detail/algorithms/load-balance.hpp @@ -0,0 +1,38 @@ +#pragma once + +namespace diy +{ + +namespace detail +{ + +// information about work for one process +struct WorkInfo +{ + int proc_rank; // mpi rank of this process + int top_gid; // gid of most expensive block in this process TODO: can be top-k-gids, as long as k is fixed and known by all + Work top_work; // work of top_gid TODO: can be vector of top-k work, as long as k is fixed and known by all + Work proc_work; // total work of this process + int nlids; // local number of blocks in this process +}; + +// information about a block that is moving +struct MoveInfo +{ + MoveInfo(): move_gid(-1), src_proc(-1), dst_proc(-1) {} + MoveInfo(int move_gid_, int src_proc_, int dst_proc_) : move_gid(move_gid_), src_proc(src_proc_), dst_proc(dst_proc_) {} + int move_gid; + int src_proc; + int dst_proc; +}; + +// auxiliary empty block structure +struct AuxBlock +{ + static void* create() { return new AuxBlock; } + static void destroy(void* b) { delete static_cast<AuxBlock*>(b); } +}; + +} // namespace detail + +} // namespace diy diff --git a/include/vtkdiy2/detail/algorithms/sort.hpp b/include/vtkdiy2/detail/algorithms/sort.hpp index 3e9ffd82f363519cd520abdfd555ed17c49f2496..e1c83c76401ccd322561db5288297d3a219ee8ce 100644 --- a/include/vtkdiy2/detail/algorithms/sort.hpp +++ b/include/vtkdiy2/detail/algorithms/sort.hpp @@ -85,29 +85,29 @@ struct SampleSort<Block,T,Cmp>::Sampler Sampler(ValuesVector values_, ValuesVector dividers_, const Cmp& cmp_, size_t num_samples_): values(values_), dividers(dividers_), cmp(cmp_), num_samples(num_samples_) {} - void operator()(Block* b, const ReduceProxy& srp, const RegularSwapPartners& partners) const + void operator()(Block* b, const ReduceProxy& srp, const RegularSwapPartners&) const { int k_in = srp.in_link().size(); int k_out = srp.out_link().size(); - std::vector<T> samples; + std::vector<T> samps; if (k_in == 0) { // draw random samples for (size_t i = 0; i < num_samples; ++i) - samples.push_back((b->*values)[std::rand() % (b->*values).size()]); + samps.push_back((b->*values)[std::rand() % (b->*values).size()]); } else - dequeue_values(samples, srp, false); + dequeue_values(samps, srp, false); if (k_out == 0) { // pick subsamples that separate quantiles - std::sort(samples.begin(), samples.end(), cmp); + std::sort(samps.begin(), samps.end(), cmp); std::vector<T> subsamples(srp.nblocks() - 1); - int step = samples.size() / srp.nblocks(); // NB: subsamples.size() + 1 + size_t step = samps.size() / srp.nblocks(); // NB: subsamples.size() + 1 for (size_t i = 0; i < subsamples.size(); ++i) - subsamples[i] = samples[(i+1)*step]; + subsamples[i] = samps[(i+1)*step]; (b->*dividers).swap(subsamples); } else @@ -115,7 +115,7 @@ struct SampleSort<Block,T,Cmp>::Sampler for (int i = 0; i < k_out; ++i) { MemoryBuffer& out = srp.outgoing(srp.out_link().target(i)); - save(out, &samples[0], samples.size()); + save(out, &samps[0], samps.size()); } } } @@ -139,7 +139,7 @@ struct SampleSort<Block,T,Cmp>::Exchanger // enqueue values to the correct locations for (size_t i = 0; i < (b->*values).size(); ++i) { - int to = std::lower_bound((b->*samples).begin(), (b->*samples).end(), (b->*values)[i], cmp) - (b->*samples).begin(); + int to = static_cast<int>(std::lower_bound((b->*samples).begin(), (b->*samples).end(), (b->*values)[i], cmp) - (b->*samples).begin()); rp.enqueue(rp.out_link().target(to), (b->*values)[i]); } (b->*values).clear(); diff --git a/include/vtkdiy2/detail/block_traits.hpp b/include/vtkdiy2/detail/block_traits.hpp index eb4b7c547d397b98b8209d7644253ce6f7793c6e..984613d94bb3f185a944393c1252fb8b4985e849 100644 --- a/include/vtkdiy2/detail/block_traits.hpp +++ b/include/vtkdiy2/detail/block_traits.hpp @@ -10,7 +10,7 @@ namespace detail template<class F> struct block_traits { - typedef typename std::remove_pointer<typename function_traits<F>::template arg<0>::type>::type type; + typedef typename std::remove_pointer<typename std::remove_reference<typename function_traits<F>::template arg<0>::type>::type>::type type; }; // matches block member functions diff --git a/include/vtkdiy2/detail/master/collectives.hpp b/include/vtkdiy2/detail/master/collectives.hpp index 303ba74a6ea5c77b1456d6d5b9ea2f03d8b1ae95..c98aef2a113437b4ecdbd5a8111f4a50c385797e 100644 --- a/include/vtkdiy2/detail/master/collectives.hpp +++ b/include/vtkdiy2/detail/master/collectives.hpp @@ -20,7 +20,7 @@ namespace diy void init() { out_ = in_; } void update(const CollectiveOp& other) { out_ = op_(out_, static_cast<const AllReduceOp&>(other).in_); } - void global(const mpi::communicator& comm) { T res; mpi::all_reduce(comm, out_, res, op_); out_ = res; } + void global(const mpi::communicator& comm) { T res{}; mpi::all_reduce(comm, out_, res, op_); out_ = res; } void copy_from(const CollectiveOp& other) { out_ = static_cast<const AllReduceOp&>(other).out_; } void result_out(void* dest) const { *reinterpret_cast<T*>(dest) = out_; } diff --git a/include/vtkdiy2/detail/master/communication.hpp b/include/vtkdiy2/detail/master/communication.hpp index 51cc435b280a65d169c872034c6d02f5e7185f1f..1f6b0800fa9dce113fe736d2b2a09965a2a6b6c5 100644 --- a/include/vtkdiy2/detail/master/communication.hpp +++ b/include/vtkdiy2/detail/master/communication.hpp @@ -5,11 +5,13 @@ namespace diy int from, to; int nparts; int round; + int nblobs; }; struct Master::InFlightSend { std::shared_ptr<MemoryBuffer> message; + BinaryBlob blob; mpi::request request; MessageInfo info; // for debug purposes @@ -18,12 +20,18 @@ namespace diy struct Master::InFlightRecv { MemoryBuffer message; - MessageInfo info { -1, -1, -1, -1 }; + MessageInfo info { -1, -1, -1, -1, -1 }; bool done = false; + MemoryManagement mem; inline bool recv(mpi::communicator& comm, const mpi::status& status); inline void place(IncomingRound* in, bool unload, ExternalStorage* storage, IExchangeInfo* iexchange); - void reset() { *this = InFlightRecv(); } + void reset() + { + MemoryManagement mem_ = mem; + *this = InFlightRecv(); + mem = mem_; + } }; struct Master::InFlightRecvsMap: public std::map<int, InFlightRecv> @@ -63,7 +71,7 @@ namespace diy struct mpi_datatype< diy::detail::VectorWindow<T> > { using VecWin = diy::detail::VectorWindow<T>; - static MPI_Datatype datatype() { return get_mpi_datatype<T>(); } + static diy::mpi::datatype datatype() { return get_mpi_datatype<T>(); } static const void* address(const VecWin& x) { return x.begin; } static void* address(VecWin& x) { return x.begin; } static int count(const VecWin& x) { return static_cast<int>(x.count); } @@ -111,7 +119,7 @@ recv(mpi::communicator& comm, const mpi::status& status) result = true; } - else + else if (info.nparts > 0) { size_t start_idx = message.buffer.size(); size_t count = status.count<char>(); @@ -124,9 +132,24 @@ recv(mpi::communicator& comm, const mpi::status& status) comm.recv(status.source(), status.tag(), window); info.nparts--; + } else if (info.nblobs > 0) + { + size_t count = status.count<char>(); + detail::VectorWindow<char> window; + + char* buffer = mem.allocate(info.to, count); + + window.begin = buffer; + window.count = count; + + comm.recv(status.source(), status.tag(), window); + + message.save_binary_blob(buffer, count, mem.deallocate); + + info.nblobs--; } - if (info.nparts == 0) + if (info.nparts == 0 && info.nblobs == 0) done = true; return result; @@ -135,35 +158,21 @@ recv(mpi::communicator& comm, const mpi::status& status) // once the InFlightRecv is done, place it either out of core or in the appropriate incoming queue void diy::Master::InFlightRecv:: -place(IncomingRound* in, bool unload, ExternalStorage* storage, IExchangeInfo* iexchange) +place(IncomingRound* in, bool unload, ExternalStorage* storage, IExchangeInfo*) { - size_t size = message.size(); int from = info.from; int to = info.to; - int external = -1; + + message.reset(); + + auto access = in->map[to][from].access(); + access->emplace_back(std::move(message)); if (unload) { get_logger()->debug("Directly unloading queue {} <- {}", to, from); - external = storage->put(message); // unload directly - } - else if (!iexchange) - { - in->map[to].queues[from].swap(message); - in->map[to].queues[from].reset(); // buffer position = 0 - } - else // iexchange - { - auto log = get_logger(); - log->debug("[{}] Received queue {} <- {}", iexchange->comm.rank(), to, from); - - iexchange->not_done(to); - in->map[to].queues[from].append_binary(&message.buffer[0], message.size()); // append instead of overwrite - - iexchange->dec_work(); - log->debug("[{}] Decrementing work after receiving\n", to); + access->back().unload(storage); } - in->map[to].records[from] = QueueRecord(size, external); ++(in->received); } diff --git a/include/vtkdiy2/detail/master/execution.hpp b/include/vtkdiy2/detail/master/execution.hpp index 8f9c0dbb8b052682bf8bc0928a6757345c19b2a9..d74d25cc0f5ad0c9fd7d60bd57345be3d198191d 100644 --- a/include/vtkdiy2/detail/master/execution.hpp +++ b/include/vtkdiy2/detail/master/execution.hpp @@ -1,3 +1,5 @@ +#include <algorithm> + struct diy::Master::ProcessBlock { ProcessBlock(Master& master_, @@ -61,8 +63,7 @@ struct diy::Master::ProcessBlock cmd->execute(skip ? 0 : master.block(i), master.proxy(i)); // no longer need them, so get rid of them - current_incoming[gid].queues.clear(); - current_incoming[gid].records.clear(); + current_incoming[gid].clear(); } if (skip && master.block(i) == 0) diff --git a/include/vtkdiy2/detail/master/foreach_exchange.hpp b/include/vtkdiy2/detail/master/foreach_exchange.hpp new file mode 100644 index 0000000000000000000000000000000000000000..a4d89a8bec8a50137c633fd4b8910928343c9405 --- /dev/null +++ b/include/vtkdiy2/detail/master/foreach_exchange.hpp @@ -0,0 +1,105 @@ +struct diy::Master::CoroutineArg +{ + int lid; + ProxyWithLink& proxy; + coroutine::cothread_t main; + Master* master; + std::function<void(int, const ProxyWithLink&)> f; +}; + +void +diy::Master:: +launch_process_block_coroutine() +{ + using namespace coroutine; + + CoroutineArg* arg = static_cast<CoroutineArg*>(argument()); + int lid = arg->lid; + ProxyWithLink& cp = arg->proxy; + cothread_t main = arg->main; + // unused + //Master* master = arg->master; + auto f = arg->f; + + co_switch(main); // give the argument back + + f(lid, cp); + cp.set_done(true); + co_switch(main); +} + +template<class F> +void +diy::Master:: +foreach_exchange(const F& f, bool remote, unsigned int stack_size) +{ + using Block = typename detail::block_traits<F>::type; + foreach_exchange_<Block>(f, remote, stack_size); +} + +template<class Block> +void +diy::Master:: +foreach_exchange_(const CoroutineCallback<Block>& f, bool remote, unsigned int stack_size) +{ + auto scoped = prof.scoped("foreach_exchange"); + DIY_UNUSED(scoped); + + assert(commands_.empty()); // can't have queued, unexecuted commands left over from ordinary foreach() + + using namespace coroutine; + + // setup coroutines and proxies + std::vector<cothread_t> coroutines; + std::vector<std::unique_ptr<ProxyWithLink>> proxies; + std::vector<Block*> blocks(size(), nullptr); + for (int i = 0; i < size(); ++i) + { + cothread_t c = co_create(stack_size, &launch_process_block_coroutine); + coroutines.push_back(c); + proxies.emplace_back(make_unique<ProxyWithLink>(proxy(i))); + + auto trampoline = [&f,&blocks,this](int lid, const ProxyWithLink& cp) + { + Block* const& b = blocks[lid]; + f(b, cp); + }; + CoroutineArg arg { i, *proxies.back(), co_active(), this, trampoline }; + argument() = &arg; + + co_switch(c); + } + + int ndone = 0; + std::vector<bool> done(size(), false); + while(ndone < size()) + { + // TODO: parallelize the loop using multiple threads + for(int i = 0; i < size(); ++i) + { + if (done[i] == true) + continue; + + blocks[i] = get<Block>(i); // load block in case it's out of core + + cothread_t c = coroutines[i]; + auto& cp = *proxies[i]; + cp.init(); // reset incoming/outgoing/collectives + cp.set_main(co_active()); + co_switch(c); + + if (cp.done()) + { + done[i] = true; + ndone++; + } + } + + // TODO: should we disable the last exchange; the user could call that one manually + // exchange calls execute(), but commands_ are empty, so it should be Ok + exchange(remote); + } + + for (cothread_t cor : coroutines) + co_delete(cor); +} diff --git a/include/vtkdiy2/detail/master/iexchange-collective.hpp b/include/vtkdiy2/detail/master/iexchange-collective.hpp index 575519af724a9152b191025747a19aca50104d12..ad7a9fb2619e5550a70725de779d56c84cbea0e5 100644 --- a/include/vtkdiy2/detail/master/iexchange-collective.hpp +++ b/include/vtkdiy2/detail/master/iexchange-collective.hpp @@ -1,18 +1,26 @@ +#include <atomic> + namespace diy { struct Master::IExchangeInfoCollective: public IExchangeInfo { - using IExchangeInfo::IExchangeInfo; + IExchangeInfoCollective(mpi::communicator c, stats::Profiler& p): + IExchangeInfo(c, p) + { + local_work_ = 0; + dirty = 0; + state = 0; + } inline bool all_done() override; // get global all done status inline void add_work(int work) override; // add work to global work counter inline void control() override; - int local_work_ = 0; - int dirty = 0; + std::atomic<int> local_work_; + std::atomic<int> dirty; int local_dirty, all_dirty; - int state = 0; + std::atomic<int> state; mpi::request r; // debug diff --git a/include/vtkdiy2/detail/master/iexchange-dud.hpp b/include/vtkdiy2/detail/master/iexchange-dud.hpp deleted file mode 100644 index 050c2e3a18a568d2a6fc9da0295f25ba3114e218..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/detail/master/iexchange-dud.hpp +++ /dev/null @@ -1,338 +0,0 @@ -namespace diy -{ - struct Master::IExchangeInfoDUD: public IExchangeInfo - { - struct Message - { - std::array<int,2> msg; - mpi::request request; - }; - - using IExchangeInfo::IExchangeInfo; - - inline bool all_done() override; // get global all done status - inline void add_work(int work) override; // add work to global work counter - inline void control() override; - inline void update_subtree(int diff); - inline bool process_work_update(); - inline void check_for_abort(); - inline void abort(int trial); - inline void process_done(int source, int trial); - inline void reset_child_confirmations(); - int right_bit(int x) const { return ((x ^ (x-1)) + 1) >> 1; } - - void send(int rk, int type, int x) - { - inflight_.emplace_back(); - Message& m = inflight_.back(); - m.msg[0] = type; - m.msg[1] = x; - m.request = comm.issend(rk, tags::iexchange, m.msg); - log->trace("[{}] Sending to {}, type = {}, x = {}", comm.rank(), rk, type, x); - } - void recv(int rk, int& type, int& x) - { - std::array<int,2> msg; - comm.recv(rk, tags::iexchange, msg); - type = msg[0]; - x = msg[1]; - log->trace("[{}] Received from {}, type = {}, x = {}, msg = {}", comm.rank(), rk, type, x); - } - - inline bool nudge(); - int parent() const { return comm.rank() & (comm.rank() - 1); } // flip the last 1 to 0 - inline void signal_children(int tag, int x); - bool incomplete() const { return subtree_work_ > 0 || !inflight_.empty(); } - bool stale() const { return subtree_work_ != last_subtree_work_message_ || local_work_ != last_local_work_message_; } - - struct type { enum { - work_update = 0, - done, - abort - }; }; - std::unordered_map<int, bool> done; // gid -> done - - int local_work_ = 0, last_local_work_message_ = 0; - int subtree_work_ = 0, last_subtree_work_message_ = 0; - int down_up_down_ = 0; - - std::list<Message> inflight_; - int last_trial_ = -1; - int child_confirmations = -1; - - // debug - bool first_dud = true; - using IExchangeInfo::prof; - }; -} - - -// get global all done status -bool -diy::Master::IExchangeInfoDUD:: -all_done() -{ - if (down_up_down_ == 3) - while (!inflight_.empty()) nudge(); // make sure that all the messages are propagated before we finish - // if we've decided that we are done, the only outstanding messages - // can be the done signals to children; nothing else should be in-flight - - return down_up_down_ == 3; -} - -// add arbitrary units of work to global work counter -void -diy::Master::IExchangeInfoDUD:: -add_work(int work) -{ - int cur_local_work = local_work_; - local_work_ += work; - assert(local_work_ >= 0); - - log->trace("[{}] Adding work: work = {}, local_work = {}, cur_local_work = {}", comm.rank(), work, local_work_, cur_local_work); - - if ((cur_local_work == 0) ^ (local_work_ == 0)) // changed from or to zero - { - int diff = (local_work_ - last_local_work_message_); - update_subtree(diff); - last_local_work_message_ = local_work_; - } -} - -void -diy::Master::IExchangeInfoDUD:: -update_subtree(int diff) -{ - int cur_subtree_work = subtree_work_; - subtree_work_ += diff; - log->debug("[{}] Updating subtree: diff = {}, subtree_work_ = {}", comm.rank(), diff, subtree_work_); - assert(subtree_work_ >= 0); - - if ((cur_subtree_work == 0) ^ (subtree_work_ == 0)) // changed from or to zero - { - if (comm.rank() != 0) - { - int subtree_diff = (subtree_work_ - last_subtree_work_message_); - log->debug("[{}] Sending subtree update: diff = {}, subtree_diff = {}", comm.rank(), diff, subtree_diff); - send(parent(), type::work_update, subtree_diff); - last_subtree_work_message_ = subtree_work_; - if (down_up_down_ == 1) - abort(last_trial_); - else if (down_up_down_ == 2) - log->warn("[{}] Enqueueing work update after finishing, diff = {}", comm.rank(), subtree_diff); - // This is Ok in general: if this happens, somebody else must abort this trial. - else if (down_up_down_ == 3) - log->critical("[{}] Enqueueing work update after all done, diff = {}", comm.rank(), subtree_diff); - } else - { - assert(down_up_down_ < 2); - down_up_down_ = 0; // if we are updating work on the root, definitely abort the down-up-down protocol - } - } -} - -void -diy::Master::IExchangeInfoDUD:: -control() -{ - mpi::optional<mpi::status> ostatus = comm.iprobe(mpi::any_source, tags::iexchange); - while(ostatus) - { - int t, x; - recv(ostatus->source(), t, x); - if (t == type::work_update) - { - // x = diff - log->debug("[{}] subtree update request from {}, diff = {}", comm.rank(), ostatus->source(), x); - update_subtree(x); // for now propagates up the tree verbatim - } else if (t == type::abort) - { - // x = trial - assert(x >= -1); - abort(x); - } else if (t == type::done) - { - process_done(ostatus->source(), x); - } - ostatus = comm.iprobe(mpi::any_source, tags::iexchange); - } - - // initiate down-up-down protocol - if (subtree_work_ == 0 && comm.rank() == 0 && down_up_down_ == 0) - { - // debug - if (first_dud) - { - prof >> "iexchange-control"; // consensus-time cannot nest in iexchange-control - prof << "consensus-time"; - prof << "iexchange-control"; - first_dud = false; - } - - down_up_down_ = 1; - reset_child_confirmations(); - if (child_confirmations) - { - signal_children(type::done, ++last_trial_); - log->info("Initiated down-up-down, trial = {}", last_trial_); - } else // no children - down_up_down_ = 3; - } - - while(nudge()); -} - -void -diy::Master::IExchangeInfoDUD:: -abort(int trial) -{ - if (down_up_down_ == 0) // already aborted - return; - - if (trial != last_trial_) - return; - - log->warn("[{}] aborting trial {}", comm.rank(), trial); - assert(trial >= 0); - - down_up_down_ = 0; - - if (comm.rank() != 0) - { - send(parent(), type::abort, trial); // propagate abort - if (down_up_down_ >= 2) - log->critical("[{}] sending abort after done", comm.rank()); - last_trial_ = -1; // all future aborts for this trial will be stale - } -} - -void -diy::Master::IExchangeInfoDUD:: -process_done(int source, int trial) -{ - if (trial < -1) - { - log->critical("[{}] done with source = {}, trial = {}", comm.rank(), source, trial); - assert(trial >= -1); - } - - while(nudge()); // clear up finished requests: this is necessary since requests may have been received; - // we are now getting responses to them; but they are still listed in our inflight_ - - if (source == parent()) - { - if (trial == last_trial_) // confirmation that we are done - { - assert(down_up_down_ == 2); - log->info("[{}] received done confirmation from parent, trial = {}; incomplete = {}, subtree = {}, stale = {}", - comm.rank(), trial, incomplete(), subtree_work_, stale()); - down_up_down_ = 3; - assert(!incomplete() && !stale()); - } else - { - last_trial_ = trial; - down_up_down_ = 1; - - // check that there are no changes - if (incomplete() || stale()) - abort(trial); - } - - // pass the message to children - if (down_up_down_ > 0) - { - reset_child_confirmations(); - if (child_confirmations) - { - log->info("[{}] signalling done to children, trial = {}", comm.rank(), trial); - signal_children(type::done, trial); - } - else if (down_up_down_ < 2) // no children, signal back to parent right away, unless it was the final done - { - down_up_down_ = 2; - log->info("[{}] signalling done to parent (1), trial = {}, incomplete = {}", comm.rank(), trial, incomplete()); - send(parent(), type::done, trial); - } - } - } else // signal from a child - { - if (trial == last_trial_) - { - int child_mask = right_bit(source); - child_confirmations &= ~child_mask; - if (child_confirmations == 0) // done - { - if (comm.rank() != 0) - { - if (incomplete() || stale()) // heard from all the children, but there is something incomplete - abort(trial); - else - { - down_up_down_ = 2; - log->info("[{}] signalling done to parent (2), trial = {}, incomplete = {}", comm.rank(), trial, incomplete()); - send(parent(), type::done, trial); - } - } - else if (down_up_down_ == 1) - { - log->info("[{}] received done confirmation from children at root, trial = {}", comm.rank(), trial); - // initiate final down - down_up_down_ = 3; - signal_children(type::done, trial); - } - } - } // else stale trial confirmation, drop - } -} - -void -diy::Master::IExchangeInfoDUD:: -reset_child_confirmations() -{ - child_confirmations = 0; - int child_mask = 1; - int child = child_mask | comm.rank(); - while (child != comm.rank() && child < comm.size()) - { - child_confirmations |= child_mask; - - child_mask <<= 1; - child = child_mask | comm.rank(); - } -} - -void -diy::Master::IExchangeInfoDUD:: -signal_children(int tag, int x) -{ - int child_mask = 1; - int child = child_mask | comm.rank(); - while (child != comm.rank() && child < comm.size()) - { - send(child, tag, x); - - child_mask <<= 1; - child = child_mask | comm.rank(); - } -} - -bool -diy::Master::IExchangeInfoDUD:: -nudge() -{ - bool success = false; - for (auto it = inflight_.begin(); it != inflight_.end();) - { - mpi::optional<mpi::status> ostatus = it->request.test(); - if (ostatus) - { - success = true; - it = inflight_.erase(it); - } - else - ++it; - } - return success; -} - - diff --git a/include/vtkdiy2/detail/master/iexchange.hpp b/include/vtkdiy2/detail/master/iexchange.hpp index 38fe255c7263d600f35971e4c4ae78a158b0a340..1d10c1b728a11199d8a496d8f9ad0e04843fd80c 100644 --- a/include/vtkdiy2/detail/master/iexchange.hpp +++ b/include/vtkdiy2/detail/master/iexchange.hpp @@ -5,17 +5,11 @@ namespace diy using Clock = std::chrono::high_resolution_clock; using Time = Clock::time_point; - IExchangeInfo(mpi::communicator comm_, size_t min_queue_size, size_t max_hold_time, bool fine, stats::Profiler& prof_): - comm(comm_), - fine_(fine), - min_queue_size_(min_queue_size), - max_hold_time_(max_hold_time), - prof(prof_) { time_stamp_send(); } + IExchangeInfo(mpi::communicator c, stats::Profiler& p): + comm(c), + prof(p) {} virtual ~IExchangeInfo() {} - void not_done(int gid) { update_done(gid, false); } - inline void update_done(int gid, bool done_); - virtual bool all_done() =0; // get global all done status virtual void add_work(int work) =0; // add work to global work counter virtual void control() =0; @@ -23,43 +17,12 @@ namespace diy void inc_work() { add_work(1); } // increment work counter void dec_work() { add_work(-1); } // decremnent work counter - // shortcut - void time_stamp_send() { time_last_send = Clock::now(); } - bool hold(size_t queue_size) { return queue_size < min_queue_size_ && hold_time() < max_hold_time_; } - size_t hold_time() { return std::chrono::duration_cast<std::chrono::milliseconds>(Clock::now() - time_last_send).count(); } - bool fine() const { return fine_; } - mpi::communicator comm; - std::unordered_map<int, bool> done; // gid -> done - - bool fine_ = false; std::shared_ptr<spd::logger> log = get_logger(); - Time time_last_send; // time of last send from any queue in send_outgoing_queues() - - size_t min_queue_size_; // minimum short message size (bytes) - size_t max_hold_time_; // maximum short message hold time (milliseconds) - - int from_gid = -1; // gid of current block, for shortcut sending of only this block's queues - stats::Profiler& prof; }; } -void -diy::Master::IExchangeInfo:: -update_done(int gid, bool done_) -{ - if (done[gid] != done_) - { - done[gid] = done_; - if (done_) - dec_work(); - else - inc_work(); - } -} - -#include "iexchange-dud.hpp" #include "iexchange-collective.hpp" diff --git a/include/vtkdiy2/detail/reduce/all-to-all.hpp b/include/vtkdiy2/detail/reduce/all-to-all.hpp index 7e30825474fc0f727199e7eaf6740825fdfd06c7..498917c1db74e9f88353c11ecb46990318e07afd 100644 --- a/include/vtkdiy2/detail/reduce/all-to-all.hpp +++ b/include/vtkdiy2/detail/reduce/all-to-all.hpp @@ -23,31 +23,38 @@ namespace detail } } - void operator()(Block* b, const ReduceProxy& srp, const RegularSwapPartners& partners) const + void operator()(Block* b, const ReduceProxy& srp, const RegularSwapPartners&) const { int k_in = srp.in_link().size(); int k_out = srp.out_link().size(); if (k_in == 0 && k_out == 0) // special case of a single block { - ReduceProxy all_srp_out(srp, srp.block(), 0, srp.assigner(), empty_link, all_neighbors_link); - ReduceProxy all_srp_in (srp, srp.block(), 1, srp.assigner(), all_neighbors_link, empty_link); + ReduceProxy all_srp(std::move(const_cast<ReduceProxy&>(srp)), srp.block(), 0, srp.assigner(), empty_link, all_neighbors_link); - op(b, all_srp_out); - MemoryBuffer& in_queue = all_srp_in.incoming(all_srp_in.in_link().target(0).gid); - in_queue.swap(all_srp_out.outgoing(all_srp_out.out_link().target(0))); + op(b, all_srp); + + MemoryBuffer& in_queue = all_srp.incoming(all_srp.out_link().target(0).gid); + in_queue.swap(all_srp.outgoing(all_srp.out_link().target(0))); in_queue.reset(); + all_srp.outgoing()->clear(); + + // change to incoming proxy + all_srp.set_round(1); + auto& in_link = const_cast<Link&>(all_srp.in_link()); + auto& out_link = const_cast<Link&>(all_srp.out_link()); + in_link.swap(out_link); - op(b, all_srp_in); + op(b, all_srp); return; } if (k_in == 0) // initial round { - ReduceProxy all_srp(srp, srp.block(), 0, srp.assigner(), empty_link, all_neighbors_link); + ReduceProxy all_srp(std::move(const_cast<ReduceProxy&>(srp)), srp.block(), 0, srp.assigner(), empty_link, all_neighbors_link); op(b, all_srp); - Master::OutgoingQueues all_queues; + Master::Proxy::OutgoingQueues all_queues; all_queues.swap(*all_srp.outgoing()); // clears out the queues and stores them locally // enqueue outgoing @@ -67,10 +74,10 @@ namespace detail } else if (k_out == 0) // final round { // dequeue incoming + reorder into the correct order - ReduceProxy all_srp(srp, srp.block(), 1, srp.assigner(), all_neighbors_link, empty_link); + ReduceProxy all_srp(std::move(const_cast<ReduceProxy&>(srp)), srp.block(), 1, srp.assigner(), all_neighbors_link, empty_link); - Master::IncomingQueues all_incoming; - all_incoming.swap(*srp.incoming()); + Master::Proxy::IncomingQueues all_incoming; + all_incoming.swap(*all_srp.incoming()); std::pair<int, int> range; // all the ranges should be the same for (int i = 0; i < k_in; ++i) diff --git a/include/vtkdiy2/dynamic-point.hpp b/include/vtkdiy2/dynamic-point.hpp index 67d52b458a8b965f11383a120fa6482d3c24d241..35dd4b6852d432a1ad4d34286b5034374f44281b 100644 --- a/include/vtkdiy2/dynamic-point.hpp +++ b/include/vtkdiy2/dynamic-point.hpp @@ -7,7 +7,7 @@ #include <algorithm> #include "constants.h" -#include "itlib/small_vector.hpp" +#include "thirdparty/itlib/small_vector.hpp" namespace diy { @@ -23,10 +23,10 @@ class DynamicPoint: public itlib::small_vector<Coordinate_, static_size> struct rebind { typedef DynamicPoint<U> type; }; public: - DynamicPoint(int dim, Coordinate x = 0): + DynamicPoint(size_t dim, Coordinate x = 0): Parent(dim, x) {} template<class T> DynamicPoint(const DynamicPoint<T>& p) { for (size_t i = 0; i < dimension(); ++i) (*this)[i] = p[i]; } - template<class T> DynamicPoint(const T* a, int dim) { for (size_t i = 0; i < static_cast<size_t>(dim); ++i) (*this)[i] = a[i]; } + template<class T> DynamicPoint(const T* a, size_t dim) { for (size_t i = 0; i < dim; ++i) (*this)[i] = a[i]; } template<class T> DynamicPoint(const std::vector<T>& a): Parent(a.begin(), a.end()) {} DynamicPoint(std::initializer_list<Coordinate> lst): @@ -36,13 +36,13 @@ class DynamicPoint: public itlib::small_vector<Coordinate_, static_size> DynamicPoint(const DynamicPoint&) =default; DynamicPoint& operator=(const DynamicPoint&) =default; - unsigned dimension() const { return Parent::size(); } + unsigned dimension() const { return static_cast<unsigned>(Parent::size()); } - static DynamicPoint zero(int dim) { return DynamicPoint(dim, 0); } - static DynamicPoint one(int dim) { return DynamicPoint(dim, 1); } + static DynamicPoint zero(size_t dim) { return DynamicPoint(dim, 0); } + static DynamicPoint one(size_t dim) { return DynamicPoint(dim, 1); } - DynamicPoint drop(int dim) const { DynamicPoint p(dimension() - 1); size_t c = 0; for (size_t i = 0; i < dimension(); ++i) { if (i == dim) continue; p[c++] = (*this)[i]; } return p; } - DynamicPoint lift(int dim, Coordinate x) const { DynamicPoint p(dimension() + 1); for (size_t i = 0; i < dimension()+1; ++i) { if (i < dim) p[i] = (*this)[i]; else if (i == dim) p[i] = x; else if (i > dim) p[i] = (*this)[i-1]; } return p; } + DynamicPoint drop(size_t dim) const { DynamicPoint p(dimension() - 1); size_t c = 0; for (size_t i = 0; i < dimension(); ++i) { if (i == dim) continue; p[c++] = (*this)[i]; } return p; } + DynamicPoint lift(size_t dim, Coordinate x) const { DynamicPoint p(dimension() + 1); for (size_t i = 0; i < dimension()+1; ++i) { if (i < dim) p[i] = (*this)[i]; else if (i == dim) p[i] = x; else if (i > dim) p[i] = (*this)[i-1]; } return p; } using Parent::operator[]; diff --git a/include/vtkdiy2/factory.hpp b/include/vtkdiy2/factory.hpp index 90d4ff37fff65b95aee495d5c014e36956fa770e..a89a1eb51007e58a97aa6498dbeb9e047a7abc86 100644 --- a/include/vtkdiy2/factory.hpp +++ b/include/vtkdiy2/factory.hpp @@ -26,8 +26,6 @@ class Factory template <class T> struct Registrar: Base { - friend T; - static bool registerT() { const auto name = typeid(T).name(); @@ -37,17 +35,29 @@ class Factory }; return true; } - static bool registered; + static volatile bool registered; std::string id() const override { return typeid(T).name(); } +#if defined(__NVCC__) + protected: +#else private: + friend T; +#endif +#if defined(__INTEL_COMPILER) + __attribute__ ((used)) +#endif Registrar(): Base(Key{}) { (void)registered; } }; - friend Base; +#if defined(__NVCC__) + protected: +#else private: + friend Base; +#endif class Key { Key(){}; @@ -67,7 +77,7 @@ class Factory template <class Base, class... Args> template <class T> -bool Factory<Base, Args...>::Registrar<T>::registered = Factory<Base, Args...>::Registrar<T>::registerT(); +volatile bool Factory<Base, Args...>::Registrar<T>::registered = Factory<Base, Args...>::Registrar<T>::registerT(); } diff --git a/include/vtkdiy2/fmt/compile.h b/include/vtkdiy2/fmt/compile.h deleted file mode 100644 index 82625bbc6571ab481765482044f3142da72d72c0..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/fmt/compile.h +++ /dev/null @@ -1,466 +0,0 @@ -// Formatting library for C++ - experimental format string compilation -// -// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors -// All rights reserved. -// -// For the license information refer to format.h. - -#ifndef FMT_COMPILE_H_ -#define FMT_COMPILE_H_ - -#include <vector> -#include "format.h" - -FMT_BEGIN_NAMESPACE -namespace internal { - -template <typename Char> struct format_part { - public: - struct named_argument_id { - FMT_CONSTEXPR named_argument_id(internal::string_view_metadata id) - : id(id) {} - internal::string_view_metadata id; - }; - - struct argument_id { - FMT_CONSTEXPR argument_id() : argument_id(0u) {} - - FMT_CONSTEXPR argument_id(unsigned id) - : which(which_arg_id::index), val(id) {} - - FMT_CONSTEXPR argument_id(internal::string_view_metadata id) - : which(which_arg_id::named_index), val(id) {} - - enum class which_arg_id { index, named_index }; - - which_arg_id which; - - union value { - FMT_CONSTEXPR value() : index(0u) {} - FMT_CONSTEXPR value(unsigned id) : index(id) {} - FMT_CONSTEXPR value(internal::string_view_metadata id) - : named_index(id) {} - - unsigned index; - internal::string_view_metadata named_index; - } val; - }; - - struct specification { - FMT_CONSTEXPR specification() : arg_id(0u) {} - FMT_CONSTEXPR specification(unsigned id) : arg_id(id) {} - - FMT_CONSTEXPR specification(internal::string_view_metadata id) - : arg_id(id) {} - - argument_id arg_id; - internal::dynamic_format_specs<Char> parsed_specs; - }; - - FMT_CONSTEXPR format_part() - : which(kind::argument_id), end_of_argument_id(0u), val(0u) {} - - FMT_CONSTEXPR format_part(internal::string_view_metadata text) - : which(kind::text), end_of_argument_id(0u), val(text) {} - - FMT_CONSTEXPR format_part(unsigned id) - : which(kind::argument_id), end_of_argument_id(0u), val(id) {} - - FMT_CONSTEXPR format_part(named_argument_id arg_id) - : which(kind::named_argument_id), end_of_argument_id(0u), val(arg_id) {} - - FMT_CONSTEXPR format_part(specification spec) - : which(kind::specification), end_of_argument_id(0u), val(spec) {} - - enum class kind { argument_id, named_argument_id, text, specification }; - - kind which; - std::size_t end_of_argument_id; - union value { - FMT_CONSTEXPR value() : arg_id(0u) {} - FMT_CONSTEXPR value(unsigned id) : arg_id(id) {} - FMT_CONSTEXPR value(named_argument_id named_id) - : named_arg_id(named_id.id) {} - FMT_CONSTEXPR value(internal::string_view_metadata t) : text(t) {} - FMT_CONSTEXPR value(specification s) : spec(s) {} - unsigned arg_id; - internal::string_view_metadata named_arg_id; - internal::string_view_metadata text; - specification spec; - } val; -}; - -template <typename Char, typename PartsContainer> -class format_preparation_handler : public internal::error_handler { - private: - using part = format_part<Char>; - - public: - using iterator = typename basic_string_view<Char>::iterator; - - FMT_CONSTEXPR format_preparation_handler(basic_string_view<Char> format, - PartsContainer& parts) - : parts_(parts), format_(format), parse_context_(format) {} - - FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) { - if (begin == end) return; - const auto offset = begin - format_.data(); - const auto size = end - begin; - parts_.push_back(part(string_view_metadata(offset, size))); - } - - FMT_CONSTEXPR void on_arg_id() { - parts_.push_back(part(parse_context_.next_arg_id())); - } - - FMT_CONSTEXPR void on_arg_id(unsigned id) { - parse_context_.check_arg_id(id); - parts_.push_back(part(id)); - } - - FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) { - const auto view = string_view_metadata(format_, id); - const auto arg_id = typename part::named_argument_id(view); - parts_.push_back(part(arg_id)); - } - - FMT_CONSTEXPR void on_replacement_field(const Char* ptr) { - parts_.back().end_of_argument_id = ptr - format_.begin(); - } - - FMT_CONSTEXPR const Char* on_format_specs(const Char* begin, - const Char* end) { - const auto specs_offset = to_unsigned(begin - format_.begin()); - - using parse_context = basic_parse_context<Char>; - internal::dynamic_format_specs<Char> parsed_specs; - dynamic_specs_handler<parse_context> handler(parsed_specs, parse_context_); - begin = parse_format_specs(begin, end, handler); - - if (*begin != '}') on_error("missing '}' in format string"); - - auto& last_part = parts_.back(); - auto specs = last_part.which == part::kind::argument_id - ? typename part::specification(last_part.val.arg_id) - : typename part::specification(last_part.val.named_arg_id); - specs.parsed_specs = parsed_specs; - last_part = part(specs); - last_part.end_of_argument_id = specs_offset; - return begin; - } - - private: - PartsContainer& parts_; - basic_string_view<Char> format_; - basic_parse_context<Char> parse_context_; -}; - -template <typename Format, typename PreparedPartsProvider, typename... Args> -class prepared_format { - public: - using char_type = char_t<Format>; - using format_part_t = format_part<char_type>; - - constexpr prepared_format(Format f) - : format_(std::move(f)), parts_provider_(to_string_view(format_)) {} - - prepared_format() = delete; - - using context = buffer_context<char_type>; - - template <typename Range, typename Context> - auto vformat_to(Range out, basic_format_args<Context> args) const -> - typename Context::iterator { - const auto format_view = internal::to_string_view(format_); - basic_parse_context<char_type> parse_ctx(format_view); - Context ctx(out.begin(), args); - - const auto& parts = parts_provider_.parts(); - for (auto part_it = parts.begin(); part_it != parts.end(); ++part_it) { - const auto& part = *part_it; - const auto& value = part.val; - - switch (part.which) { - case format_part_t::kind::text: { - const auto text = value.text.to_view(format_view.data()); - auto output = ctx.out(); - auto&& it = internal::reserve(output, text.size()); - it = std::copy_n(text.begin(), text.size(), it); - ctx.advance_to(output); - } break; - - case format_part_t::kind::argument_id: { - advance_parse_context_to_specification(parse_ctx, part); - format_arg<Range>(parse_ctx, ctx, value.arg_id); - } break; - - case format_part_t::kind::named_argument_id: { - advance_parse_context_to_specification(parse_ctx, part); - const auto named_arg_id = - value.named_arg_id.to_view(format_view.data()); - format_arg<Range>(parse_ctx, ctx, named_arg_id); - } break; - case format_part_t::kind::specification: { - const auto& arg_id_value = value.spec.arg_id.val; - const auto arg = value.spec.arg_id.which == - format_part_t::argument_id::which_arg_id::index - ? ctx.arg(arg_id_value.index) - : ctx.arg(arg_id_value.named_index.to_view( - to_string_view(format_).data())); - - auto specs = value.spec.parsed_specs; - - handle_dynamic_spec<internal::width_checker>( - specs.width, specs.width_ref, ctx, format_view.begin()); - handle_dynamic_spec<internal::precision_checker>( - specs.precision, specs.precision_ref, ctx, format_view.begin()); - - check_prepared_specs(specs, arg.type()); - advance_parse_context_to_specification(parse_ctx, part); - ctx.advance_to( - visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg)); - } break; - } - } - - return ctx.out(); - } - - private: - void advance_parse_context_to_specification( - basic_parse_context<char_type>& parse_ctx, - const format_part_t& part) const { - const auto view = to_string_view(format_); - const auto specification_begin = view.data() + part.end_of_argument_id; - advance_to(parse_ctx, specification_begin); - } - - template <typename Range, typename Context, typename Id> - void format_arg(basic_parse_context<char_type>& parse_ctx, Context& ctx, - Id arg_id) const { - parse_ctx.check_arg_id(arg_id); - const auto stopped_at = - visit_format_arg(arg_formatter<Range>(ctx), ctx.arg(arg_id)); - ctx.advance_to(stopped_at); - } - - template <typename Char> - void check_prepared_specs(const basic_format_specs<Char>& specs, - internal::type arg_type) const { - internal::error_handler h; - numeric_specs_checker<internal::error_handler> checker(h, arg_type); - if (specs.align == align::numeric) checker.require_numeric_argument(); - if (specs.sign != sign::none) checker.check_sign(); - if (specs.alt) checker.require_numeric_argument(); - if (specs.precision >= 0) checker.check_precision(); - } - - private: - Format format_; - PreparedPartsProvider parts_provider_; -}; - -template <typename Char> struct part_counter { - unsigned num_parts = 0; - - FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) { - if (begin != end) ++num_parts; - } - - FMT_CONSTEXPR void on_arg_id() { ++num_parts; } - FMT_CONSTEXPR void on_arg_id(unsigned) { ++num_parts; } - FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; } - - FMT_CONSTEXPR void on_replacement_field(const Char*) {} - - FMT_CONSTEXPR const Char* on_format_specs(const Char* begin, - const Char* end) { - // Find the matching brace. - unsigned braces_counter = 0; - for (; begin != end; ++begin) { - if (*begin == '{') { - ++braces_counter; - } else if (*begin == '}') { - if (braces_counter == 0u) break; - --braces_counter; - } - } - return begin; - } - - FMT_CONSTEXPR void on_error(const char*) {} -}; - -template <typename Format> class compiletime_prepared_parts_type_provider { - private: - using char_type = char_t<Format>; - - static FMT_CONSTEXPR unsigned count_parts() { - FMT_CONSTEXPR_DECL const auto text = to_string_view(Format{}); - part_counter<char_type> counter; - internal::parse_format_string</*IS_CONSTEXPR=*/true>(text, counter); - return counter.num_parts; - } - -// Workaround for old compilers. Compiletime parts preparation will not be -// performed with them anyway. -#if FMT_USE_CONSTEXPR - static FMT_CONSTEXPR_DECL const unsigned number_of_format_parts = - compiletime_prepared_parts_type_provider::count_parts(); -#else - static const unsigned number_of_format_parts = 0u; -#endif - - public: - template <unsigned N> struct format_parts_array { - using value_type = format_part<char_type>; - - FMT_CONSTEXPR format_parts_array() : arr{} {} - - FMT_CONSTEXPR value_type& operator[](unsigned ind) { return arr[ind]; } - - FMT_CONSTEXPR const value_type* begin() const { return arr; } - FMT_CONSTEXPR const value_type* end() const { return begin() + N; } - - private: - value_type arr[N]; - }; - - struct empty { - // Parts preparator will search for it - using value_type = format_part<char_type>; - }; - - using type = conditional_t<number_of_format_parts != 0, - format_parts_array<number_of_format_parts>, empty>; -}; - -template <typename Parts> class compiletime_prepared_parts_collector { - private: - using format_part = typename Parts::value_type; - - public: - FMT_CONSTEXPR explicit compiletime_prepared_parts_collector(Parts& parts) - : parts_{parts}, counter_{0u} {} - - FMT_CONSTEXPR void push_back(format_part part) { parts_[counter_++] = part; } - - FMT_CONSTEXPR format_part& back() { return parts_[counter_ - 1]; } - - private: - Parts& parts_; - unsigned counter_; -}; - -template <typename PartsContainer, typename Char> -FMT_CONSTEXPR PartsContainer prepare_parts(basic_string_view<Char> format) { - PartsContainer parts; - internal::parse_format_string</*IS_CONSTEXPR=*/false>( - format, format_preparation_handler<Char, PartsContainer>(format, parts)); - return parts; -} - -template <typename PartsContainer, typename Char> -FMT_CONSTEXPR PartsContainer -prepare_compiletime_parts(basic_string_view<Char> format) { - using collector = compiletime_prepared_parts_collector<PartsContainer>; - - PartsContainer parts; - collector c(parts); - internal::parse_format_string</*IS_CONSTEXPR=*/true>( - format, format_preparation_handler<Char, collector>(format, c)); - return parts; -} - -template <typename PartsContainer> class runtime_parts_provider { - public: - runtime_parts_provider() = delete; - template <typename Char> - runtime_parts_provider(basic_string_view<Char> format) - : parts_(prepare_parts<PartsContainer>(format)) {} - - const PartsContainer& parts() const { return parts_; } - - private: - PartsContainer parts_; -}; - -template <typename Format, typename PartsContainer> -struct compiletime_parts_provider { - compiletime_parts_provider() = delete; - template <typename Char> - FMT_CONSTEXPR compiletime_parts_provider(basic_string_view<Char>) {} - - const PartsContainer& parts() const { - static FMT_CONSTEXPR_DECL const PartsContainer prepared_parts = - prepare_compiletime_parts<PartsContainer>( - internal::to_string_view(Format{})); - - return prepared_parts; - } -}; -} // namespace internal - -#if FMT_USE_CONSTEXPR -template <typename... Args, typename S, - FMT_ENABLE_IF(is_compile_string<S>::value)> -FMT_CONSTEXPR auto compile(S format_str) -> internal::prepared_format< - S, - internal::compiletime_parts_provider< - S, - typename internal::compiletime_prepared_parts_type_provider<S>::type>, - Args...> { - return format_str; -} -#endif - -template <typename... Args, typename Char, size_t N> -auto compile(const Char (&format_str)[N]) -> internal::prepared_format< - std::basic_string<Char>, - internal::runtime_parts_provider<std::vector<internal::format_part<Char>>>, - Args...> { - return std::basic_string<Char>(format_str, N - 1); -} - -template <typename CompiledFormat, typename... Args, - typename Char = typename CompiledFormat::char_type> -std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) { - basic_memory_buffer<Char> buffer; - using range = internal::buffer_range<Char>; - using context = buffer_context<Char>; - cf.template vformat_to<range, context>(range(buffer), - {make_format_args<context>(args...)}); - return to_string(buffer); -} - -template <typename OutputIt, typename CompiledFormat, typename... Args> -OutputIt format_to(OutputIt out, const CompiledFormat& cf, - const Args&... args) { - using char_type = typename CompiledFormat::char_type; - using range = internal::output_range<OutputIt, char_type>; - using context = format_context_t<OutputIt, char_type>; - return cf.template vformat_to<range, context>( - range(out), {make_format_args<context>(args...)}); -} - -template <typename OutputIt, typename CompiledFormat, typename... Args, - FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)> -format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n, - const CompiledFormat& cf, - const Args&... args) { - auto it = - format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...); - return {it.base(), it.count()}; -} - -template <typename CompiledFormat, typename... Args> -std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) { - return fmt::format_to( - internal::counting_iterator<typename CompiledFormat::char_type>(), - cf, args...) - .count(); -} - -FMT_END_NAMESPACE - -#endif // FMT_COMPILE_H_ diff --git a/include/vtkdiy2/fmt/core.h b/include/vtkdiy2/fmt/core.h deleted file mode 100644 index 2dc6ed552bbba388cefd2b1d54a4ca07f4865ebe..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/fmt/core.h +++ /dev/null @@ -1,1420 +0,0 @@ -// Formatting library for C++ - the core API -// -// Copyright (c) 2012 - present, Victor Zverovich -// All rights reserved. -// -// For the license information refer to format.h. - -#ifndef FMT_CORE_H_ -#define FMT_CORE_H_ - -#include <cassert> -#include <cstdio> // std::FILE -#include <cstring> -#include <iterator> -#include <string> -#include <type_traits> - -// The fmt library version in the form major * 10000 + minor * 100 + patch. -#define FMT_VERSION 60000 - -#ifdef __has_feature -# define FMT_HAS_FEATURE(x) __has_feature(x) -#else -# define FMT_HAS_FEATURE(x) 0 -#endif - -#if defined(__has_include) && !defined(__INTELLISENSE__) && \ - !(defined(__INTEL_COMPILER) && __INTEL_COMPILER < 1600) -# define FMT_HAS_INCLUDE(x) __has_include(x) -#else -# define FMT_HAS_INCLUDE(x) 0 -#endif - -#ifdef __has_cpp_attribute -# define FMT_HAS_CPP_ATTRIBUTE(x) __has_cpp_attribute(x) -#else -# define FMT_HAS_CPP_ATTRIBUTE(x) 0 -#endif - -#if defined(__GNUC__) && !defined(__clang__) -# define FMT_GCC_VERSION (__GNUC__ * 100 + __GNUC_MINOR__) -#else -# define FMT_GCC_VERSION 0 -#endif - -#if __cplusplus >= 201103L || defined(__GXX_EXPERIMENTAL_CXX0X__) -# define FMT_HAS_GXX_CXX11 FMT_GCC_VERSION -#else -# define FMT_HAS_GXX_CXX11 0 -#endif - -#ifdef _MSC_VER -# define FMT_MSC_VER _MSC_VER -#else -# define FMT_MSC_VER 0 -#endif - -// Check if relaxed C++14 constexpr is supported. -// GCC doesn't allow throw in constexpr until version 6 (bug 67371). -#ifndef FMT_USE_CONSTEXPR -# define FMT_USE_CONSTEXPR \ - (FMT_HAS_FEATURE(cxx_relaxed_constexpr) || FMT_MSC_VER >= 1910 || \ - (FMT_GCC_VERSION >= 600 && __cplusplus >= 201402L)) -#endif -#if FMT_USE_CONSTEXPR -# define FMT_CONSTEXPR constexpr -# define FMT_CONSTEXPR_DECL constexpr -#else -# define FMT_CONSTEXPR inline -# define FMT_CONSTEXPR_DECL -#endif - -#ifndef FMT_OVERRIDE -# if FMT_HAS_FEATURE(cxx_override) || \ - (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900 -# define FMT_OVERRIDE override -# else -# define FMT_OVERRIDE -# endif -#endif - -// Check if exceptions are disabled. -#ifndef FMT_EXCEPTIONS -# if (defined(__GNUC__) && !defined(__EXCEPTIONS)) || \ - FMT_MSC_VER && !_HAS_EXCEPTIONS -# define FMT_EXCEPTIONS 0 -# else -# define FMT_EXCEPTIONS 1 -# endif -#endif - -// Define FMT_USE_NOEXCEPT to make fmt use noexcept (C++11 feature). -#ifndef FMT_USE_NOEXCEPT -# define FMT_USE_NOEXCEPT 0 -#endif - -#if FMT_USE_NOEXCEPT || FMT_HAS_FEATURE(cxx_noexcept) || \ - (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900 -# define FMT_DETECTED_NOEXCEPT noexcept -# define FMT_HAS_CXX11_NOEXCEPT 1 -#else -# define FMT_DETECTED_NOEXCEPT throw() -# define FMT_HAS_CXX11_NOEXCEPT 0 -#endif - -#ifndef FMT_NOEXCEPT -# if FMT_EXCEPTIONS || FMT_HAS_CXX11_NOEXCEPT -# define FMT_NOEXCEPT FMT_DETECTED_NOEXCEPT -# else -# define FMT_NOEXCEPT -# endif -#endif - -// [[noreturn]] is disabled on MSVC because of bogus unreachable code warnings. -#if FMT_EXCEPTIONS && FMT_HAS_CPP_ATTRIBUTE(noreturn) && !FMT_MSC_VER -# define FMT_NORETURN [[noreturn]] -#else -# define FMT_NORETURN -#endif - -#ifndef FMT_DEPRECATED -# if (FMT_HAS_CPP_ATTRIBUTE(deprecated) && __cplusplus >= 201402L) || \ - FMT_MSC_VER >= 1900 -# define FMT_DEPRECATED [[deprecated]] -# else -# if defined(__GNUC__) || defined(__clang__) -# define FMT_DEPRECATED __attribute__((deprecated)) -# elif FMT_MSC_VER -# define FMT_DEPRECATED __declspec(deprecated) -# else -# define FMT_DEPRECATED /* deprecated */ -# endif -# endif -#endif -// Workaround broken [[deprecated]] in the Intel compiler. -#ifdef __INTEL_COMPILER -# define FMT_DEPRECATED_ALIAS -#else -# define FMT_DEPRECATED_ALIAS FMT_DEPRECATED -#endif - -#ifndef FMT_BEGIN_NAMESPACE -# if FMT_HAS_FEATURE(cxx_inline_namespaces) || FMT_GCC_VERSION >= 404 || \ - FMT_MSC_VER >= 1900 -# define FMT_INLINE_NAMESPACE inline namespace -# define FMT_END_NAMESPACE \ - } \ - } -# else -# define FMT_INLINE_NAMESPACE namespace -# define FMT_END_NAMESPACE \ - } \ - using namespace v6; \ - } -# endif -# define FMT_BEGIN_NAMESPACE \ - namespace fmt { \ - FMT_INLINE_NAMESPACE v6 { -#endif - -#if !defined(FMT_HEADER_ONLY) && defined(_WIN32) -# ifdef FMT_EXPORT -# define FMT_API __declspec(dllexport) -# elif defined(FMT_SHARED) -# define FMT_API __declspec(dllimport) -# define FMT_EXTERN_TEMPLATE_API FMT_API -# endif -#endif -#ifndef FMT_API -# define FMT_API -#endif -#ifndef FMT_EXTERN_TEMPLATE_API -# define FMT_EXTERN_TEMPLATE_API -#endif - -#ifndef FMT_HEADER_ONLY -# define FMT_EXTERN extern -#else -# define FMT_EXTERN -#endif - -#ifndef FMT_ASSERT -# define FMT_ASSERT(condition, message) assert((condition) && message) -#endif - -// libc++ supports string_view in pre-c++17. -#if (FMT_HAS_INCLUDE(<string_view>) && \ - (__cplusplus > 201402L || defined(_LIBCPP_VERSION))) || \ - (defined(_MSVC_LANG) && _MSVC_LANG > 201402L && _MSC_VER >= 1910) -# include <string_view> -# define FMT_USE_STRING_VIEW -#elif FMT_HAS_INCLUDE("experimental/string_view") && __cplusplus >= 201402L -# include <experimental/string_view> -# define FMT_USE_EXPERIMENTAL_STRING_VIEW -#endif - -FMT_BEGIN_NAMESPACE - -// Implementations of enable_if_t and other types for pre-C++14 systems. -template <bool B, class T = void> -using enable_if_t = typename std::enable_if<B, T>::type; -template <bool B, class T, class F> -using conditional_t = typename std::conditional<B, T, F>::type; -template <bool B> using bool_constant = std::integral_constant<bool, B>; -template <typename T> -using remove_reference_t = typename std::remove_reference<T>::type; -template <typename T> -using remove_const_t = typename std::remove_const<T>::type; - -struct monostate {}; - -// An enable_if helper to be used in template parameters which results in much -// shorter symbols: https://godbolt.org/z/sWw4vP. Extra parentheses are needed -// to workaround a bug in MSVC 2019 (see #1140 and #1186). -#define FMT_ENABLE_IF(...) enable_if_t<(__VA_ARGS__), int> = 0 - -namespace internal { - -// A workaround for gcc 4.8 to make void_t work in a SFINAE context. -template <typename... Ts> struct void_t_impl { using type = void; }; - -#if defined(FMT_USE_STRING_VIEW) -template <typename Char> using std_string_view = std::basic_string_view<Char>; -#elif defined(FMT_USE_EXPERIMENTAL_STRING_VIEW) -template <typename Char> -using std_string_view = std::experimental::basic_string_view<Char>; -#else -template <typename T> struct std_string_view {}; -#endif - -// Casts nonnegative integer to unsigned. -template <typename Int> -FMT_CONSTEXPR typename std::make_unsigned<Int>::type to_unsigned(Int value) { - FMT_ASSERT(value >= 0, "negative value"); - return static_cast<typename std::make_unsigned<Int>::type>(value); -} -} // namespace internal - -template <typename... Ts> -using void_t = typename internal::void_t_impl<Ts...>::type; - -/** - An implementation of ``std::basic_string_view`` for pre-C++17. It provides a - subset of the API. ``fmt::basic_string_view`` is used for format strings even - if ``std::string_view`` is available to prevent issues when a library is - compiled with a different ``-std`` option than the client code (which is not - recommended). - */ -template <typename Char> class basic_string_view { - private: - const Char* data_; - size_t size_; - - public: - using char_type = Char; - using iterator = const Char*; - - FMT_CONSTEXPR basic_string_view() FMT_NOEXCEPT : data_(nullptr), size_(0) {} - - /** Constructs a string reference object from a C string and a size. */ - FMT_CONSTEXPR basic_string_view(const Char* s, size_t count) FMT_NOEXCEPT - : data_(s), - size_(count) {} - - /** - \rst - Constructs a string reference object from a C string computing - the size with ``std::char_traits<Char>::length``. - \endrst - */ - basic_string_view(const Char* s) - : data_(s), size_(std::char_traits<Char>::length(s)) {} - - /** Constructs a string reference from a ``std::basic_string`` object. */ - template <typename Alloc> - FMT_CONSTEXPR basic_string_view(const std::basic_string<Char, Alloc>& s) - FMT_NOEXCEPT : data_(s.data()), - size_(s.size()) {} - - template < - typename S, - FMT_ENABLE_IF(std::is_same<S, internal::std_string_view<Char>>::value)> - FMT_CONSTEXPR basic_string_view(S s) FMT_NOEXCEPT : data_(s.data()), - size_(s.size()) {} - - /** Returns a pointer to the string data. */ - FMT_CONSTEXPR const Char* data() const { return data_; } - - /** Returns the string size. */ - FMT_CONSTEXPR size_t size() const { return size_; } - - FMT_CONSTEXPR iterator begin() const { return data_; } - FMT_CONSTEXPR iterator end() const { return data_ + size_; } - - FMT_CONSTEXPR void remove_prefix(size_t n) { - data_ += n; - size_ -= n; - } - - // Lexicographically compare this string reference to other. - int compare(basic_string_view other) const { - size_t str_size = size_ < other.size_ ? size_ : other.size_; - int result = std::char_traits<Char>::compare(data_, other.data_, str_size); - if (result == 0) - result = size_ == other.size_ ? 0 : (size_ < other.size_ ? -1 : 1); - return result; - } - - friend bool operator==(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) == 0; - } - friend bool operator!=(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) != 0; - } - friend bool operator<(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) < 0; - } - friend bool operator<=(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) <= 0; - } - friend bool operator>(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) > 0; - } - friend bool operator>=(basic_string_view lhs, basic_string_view rhs) { - return lhs.compare(rhs) >= 0; - } -}; - -using string_view = basic_string_view<char>; -using wstring_view = basic_string_view<wchar_t>; - -#ifndef __cpp_char8_t -// A UTF-8 code unit type. -enum char8_t : unsigned char {}; -#endif - -/** Specifies if ``T`` is a character type. Can be specialized by users. */ -template <typename T> struct is_char : std::false_type {}; -template <> struct is_char<char> : std::true_type {}; -template <> struct is_char<wchar_t> : std::true_type {}; -template <> struct is_char<char8_t> : std::true_type {}; -template <> struct is_char<char16_t> : std::true_type {}; -template <> struct is_char<char32_t> : std::true_type {}; - -/** - \rst - Returns a string view of `s`. In order to add custom string type support to - {fmt} provide an overload of `to_string_view` for it in the same namespace as - the type for the argument-dependent lookup to work. - - **Example**:: - - namespace my_ns { - inline string_view to_string_view(const my_string& s) { - return {s.data(), s.length()}; - } - } - std::string message = fmt::format(my_string("The answer is {}"), 42); - \endrst - */ -template <typename Char, FMT_ENABLE_IF(is_char<Char>::value)> -inline basic_string_view<Char> to_string_view(const Char* s) { - return s; -} - -template <typename Char, typename Traits, typename Allocator> -inline basic_string_view<Char> to_string_view( - const std::basic_string<Char, Traits, Allocator>& s) { - return {s.data(), s.size()}; -} - -template <typename Char> -inline basic_string_view<Char> to_string_view(basic_string_view<Char> s) { - return s; -} - -template <typename Char, - FMT_ENABLE_IF(!std::is_empty<internal::std_string_view<Char>>::value)> -inline basic_string_view<Char> to_string_view( - internal::std_string_view<Char> s) { - return s; -} - -// A base class for compile-time strings. It is defined in the fmt namespace to -// make formatting functions visible via ADL, e.g. format(fmt("{}"), 42). -struct compile_string {}; - -template <typename S> -struct is_compile_string : std::is_base_of<compile_string, S> {}; - -template <typename S, FMT_ENABLE_IF(is_compile_string<S>::value)> -constexpr basic_string_view<typename S::char_type> to_string_view(const S& s) { - return s; -} - -namespace internal { -void to_string_view(...); -using fmt::v6::to_string_view; - -// Specifies whether S is a string type convertible to fmt::basic_string_view. -// It should be a constexpr function but MSVC 2017 fails to compile it in -// enable_if and MSVC 2015 fails to compile it as an alias template. -template <typename S> -struct is_string : std::is_class<decltype(to_string_view(std::declval<S>()))> { -}; - -template <typename S, typename = void> struct char_t_impl {}; -template <typename S> struct char_t_impl<S, enable_if_t<is_string<S>::value>> { - using result = decltype(to_string_view(std::declval<S>())); - using type = typename result::char_type; -}; - -struct error_handler { - FMT_CONSTEXPR error_handler() {} - FMT_CONSTEXPR error_handler(const error_handler&) {} - - // This function is intentionally not constexpr to give a compile-time error. - FMT_NORETURN FMT_API void on_error(const char* message); -}; -} // namespace internal - -/** String's character type. */ -template <typename S> using char_t = typename internal::char_t_impl<S>::type; - -// Parsing context consisting of a format string range being parsed and an -// argument counter for automatic indexing. -template <typename Char, typename ErrorHandler = internal::error_handler> -class basic_parse_context : private ErrorHandler { - private: - basic_string_view<Char> format_str_; - int next_arg_id_; - - public: - using char_type = Char; - using iterator = typename basic_string_view<Char>::iterator; - - explicit FMT_CONSTEXPR basic_parse_context(basic_string_view<Char> format_str, - ErrorHandler eh = ErrorHandler()) - : ErrorHandler(eh), format_str_(format_str), next_arg_id_(0) {} - - // Returns an iterator to the beginning of the format string range being - // parsed. - FMT_CONSTEXPR iterator begin() const FMT_NOEXCEPT { - return format_str_.begin(); - } - - // Returns an iterator past the end of the format string range being parsed. - FMT_CONSTEXPR iterator end() const FMT_NOEXCEPT { return format_str_.end(); } - - // Advances the begin iterator to ``it``. - FMT_CONSTEXPR void advance_to(iterator it) { - format_str_.remove_prefix(internal::to_unsigned(it - begin())); - } - - // Returns the next argument index. - FMT_CONSTEXPR int next_arg_id() { - if (next_arg_id_ >= 0) return next_arg_id_++; - on_error("cannot switch from manual to automatic argument indexing"); - return 0; - } - - FMT_CONSTEXPR bool check_arg_id(int) { - if (next_arg_id_ > 0) { - on_error("cannot switch from automatic to manual argument indexing"); - return false; - } - next_arg_id_ = -1; - return true; - } - - FMT_CONSTEXPR void check_arg_id(basic_string_view<Char>) {} - - FMT_CONSTEXPR void on_error(const char* message) { - ErrorHandler::on_error(message); - } - - FMT_CONSTEXPR ErrorHandler error_handler() const { return *this; } -}; - -using format_parse_context = basic_parse_context<char>; -using wformat_parse_context = basic_parse_context<wchar_t>; - -using parse_context FMT_DEPRECATED_ALIAS = basic_parse_context<char>; -using wparse_context FMT_DEPRECATED_ALIAS = basic_parse_context<wchar_t>; - -template <typename Context> class basic_format_arg; -template <typename Context> class basic_format_args; - -// A formatter for objects of type T. -template <typename T, typename Char = char, typename Enable = void> -struct formatter { - // A deleted default constructor indicates a disabled formatter. - formatter() = delete; -}; - -template <typename T, typename Char, typename Enable = void> -struct FMT_DEPRECATED convert_to_int - : bool_constant<!std::is_arithmetic<T>::value && - std::is_convertible<T, int>::value> {}; - -namespace internal { - -// Specifies if T has an enabled formatter specialization. A type can be -// formattable even if it doesn't have a formatter e.g. via a conversion. -template <typename T, typename Context> -using has_formatter = - std::is_constructible<typename Context::template formatter_type<T>>; - -/** A contiguous memory buffer with an optional growing ability. */ -template <typename T> class buffer { - private: - buffer(const buffer&) = delete; - void operator=(const buffer&) = delete; - - T* ptr_; - std::size_t size_; - std::size_t capacity_; - - protected: - // Don't initialize ptr_ since it is not accessed to save a few cycles. - buffer(std::size_t sz) FMT_NOEXCEPT : size_(sz), capacity_(sz) {} - - buffer(T* p = nullptr, std::size_t sz = 0, std::size_t cap = 0) FMT_NOEXCEPT - : ptr_(p), - size_(sz), - capacity_(cap) {} - - /** Sets the buffer data and capacity. */ - void set(T* buf_data, std::size_t buf_capacity) FMT_NOEXCEPT { - ptr_ = buf_data; - capacity_ = buf_capacity; - } - - /** Increases the buffer capacity to hold at least *capacity* elements. */ - virtual void grow(std::size_t capacity) = 0; - - public: - using value_type = T; - using const_reference = const T&; - - virtual ~buffer() {} - - T* begin() FMT_NOEXCEPT { return ptr_; } - T* end() FMT_NOEXCEPT { return ptr_ + size_; } - - /** Returns the size of this buffer. */ - std::size_t size() const FMT_NOEXCEPT { return size_; } - - /** Returns the capacity of this buffer. */ - std::size_t capacity() const FMT_NOEXCEPT { return capacity_; } - - /** Returns a pointer to the buffer data. */ - T* data() FMT_NOEXCEPT { return ptr_; } - - /** Returns a pointer to the buffer data. */ - const T* data() const FMT_NOEXCEPT { return ptr_; } - - /** - Resizes the buffer. If T is a POD type new elements may not be initialized. - */ - void resize(std::size_t new_size) { - reserve(new_size); - size_ = new_size; - } - - /** Clears this buffer. */ - void clear() { size_ = 0; } - - /** Reserves space to store at least *capacity* elements. */ - void reserve(std::size_t new_capacity) { - if (new_capacity > capacity_) grow(new_capacity); - } - - void push_back(const T& value) { - reserve(size_ + 1); - ptr_[size_++] = value; - } - - /** Appends data to the end of the buffer. */ - template <typename U> void append(const U* begin, const U* end); - - T& operator[](std::size_t index) { return ptr_[index]; } - const T& operator[](std::size_t index) const { return ptr_[index]; } -}; - -// A container-backed buffer. -template <typename Container> -class container_buffer : public buffer<typename Container::value_type> { - private: - Container& container_; - - protected: - void grow(std::size_t capacity) FMT_OVERRIDE { - container_.resize(capacity); - this->set(&container_[0], capacity); - } - - public: - explicit container_buffer(Container& c) - : buffer<typename Container::value_type>(c.size()), container_(c) {} -}; - -// Extracts a reference to the container from back_insert_iterator. -template <typename Container> -inline Container& get_container(std::back_insert_iterator<Container> it) { - using bi_iterator = std::back_insert_iterator<Container>; - struct accessor : bi_iterator { - accessor(bi_iterator iter) : bi_iterator(iter) {} - using bi_iterator::container; - }; - return *accessor(it).container; -} - -template <typename T, typename Char = char, typename Enable = void> -struct fallback_formatter { - fallback_formatter() = delete; -}; - -// Specifies if T has an enabled fallback_formatter specialization. -template <typename T, typename Context> -using has_fallback_formatter = - std::is_constructible<fallback_formatter<T, typename Context::char_type>>; - -template <typename Char> struct named_arg_base; -template <typename T, typename Char> struct named_arg; - -enum type { - none_type, - named_arg_type, - // Integer types should go first, - int_type, - uint_type, - long_long_type, - ulong_long_type, - bool_type, - char_type, - last_integer_type = char_type, - // followed by floating-point types. - double_type, - long_double_type, - last_numeric_type = long_double_type, - cstring_type, - string_type, - pointer_type, - custom_type -}; - -// Maps core type T to the corresponding type enum constant. -template <typename T, typename Char> -struct type_constant : std::integral_constant<type, custom_type> {}; - -#define FMT_TYPE_CONSTANT(Type, constant) \ - template <typename Char> \ - struct type_constant<Type, Char> : std::integral_constant<type, constant> {} - -FMT_TYPE_CONSTANT(const named_arg_base<Char>&, named_arg_type); -FMT_TYPE_CONSTANT(int, int_type); -FMT_TYPE_CONSTANT(unsigned, uint_type); -FMT_TYPE_CONSTANT(long long, long_long_type); -FMT_TYPE_CONSTANT(unsigned long long, ulong_long_type); -FMT_TYPE_CONSTANT(bool, bool_type); -FMT_TYPE_CONSTANT(Char, char_type); -FMT_TYPE_CONSTANT(double, double_type); -FMT_TYPE_CONSTANT(long double, long_double_type); -FMT_TYPE_CONSTANT(const Char*, cstring_type); -FMT_TYPE_CONSTANT(basic_string_view<Char>, string_type); -FMT_TYPE_CONSTANT(const void*, pointer_type); - -FMT_CONSTEXPR bool is_integral(type t) { - FMT_ASSERT(t != named_arg_type, "invalid argument type"); - return t > none_type && t <= last_integer_type; -} - -FMT_CONSTEXPR bool is_arithmetic(type t) { - FMT_ASSERT(t != named_arg_type, "invalid argument type"); - return t > none_type && t <= last_numeric_type; -} - -template <typename Char> struct string_value { - const Char* data; - std::size_t size; -}; - -template <typename Context> struct custom_value { - using parse_context = basic_parse_context<typename Context::char_type>; - const void* value; - void (*format)(const void* arg, parse_context& parse_ctx, Context& ctx); -}; - -// A formatting argument value. -template <typename Context> class value { - public: - using char_type = typename Context::char_type; - - union { - int int_value; - unsigned uint_value; - long long long_long_value; - unsigned long long ulong_long_value; - bool bool_value; - char_type char_value; - double double_value; - long double long_double_value; - const void* pointer; - string_value<char_type> string; - custom_value<Context> custom; - const named_arg_base<char_type>* named_arg; - }; - - FMT_CONSTEXPR value(int val = 0) : int_value(val) {} - FMT_CONSTEXPR value(unsigned val) : uint_value(val) {} - value(long long val) : long_long_value(val) {} - value(unsigned long long val) : ulong_long_value(val) {} - value(double val) : double_value(val) {} - value(long double val) : long_double_value(val) {} - value(bool val) : bool_value(val) {} - value(char_type val) : char_value(val) {} - value(const char_type* val) { string.data = val; } - value(basic_string_view<char_type> val) { - string.data = val.data(); - string.size = val.size(); - } - value(const void* val) : pointer(val) {} - - template <typename T> value(const T& val) { - custom.value = &val; - // Get the formatter type through the context to allow different contexts - // have different extension points, e.g. `formatter<T>` for `format` and - // `printf_formatter<T>` for `printf`. - custom.format = format_custom_arg< - T, conditional_t<has_formatter<T, Context>::value, - typename Context::template formatter_type<T>, - fallback_formatter<T, char_type>>>; - } - - value(const named_arg_base<char_type>& val) { named_arg = &val; } - - private: - // Formats an argument of a custom type, such as a user-defined class. - template <typename T, typename Formatter> - static void format_custom_arg(const void* arg, - basic_parse_context<char_type>& parse_ctx, - Context& ctx) { - Formatter f; - parse_ctx.advance_to(f.parse(parse_ctx)); - ctx.advance_to(f.format(*static_cast<const T*>(arg), ctx)); - } -}; - -template <typename Context, typename T> -FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value); - -// To minimize the number of types we need to deal with, long is translated -// either to int or to long long depending on its size. -enum { long_short = sizeof(long) == sizeof(int) }; -using long_type = conditional_t<long_short, int, long long>; -using ulong_type = conditional_t<long_short, unsigned, unsigned long long>; - -// Maps formatting arguments to core types. -template <typename Context> struct arg_mapper { - using char_type = typename Context::char_type; - - FMT_CONSTEXPR int map(signed char val) { return val; } - FMT_CONSTEXPR unsigned map(unsigned char val) { return val; } - FMT_CONSTEXPR int map(short val) { return val; } - FMT_CONSTEXPR unsigned map(unsigned short val) { return val; } - FMT_CONSTEXPR int map(int val) { return val; } - FMT_CONSTEXPR unsigned map(unsigned val) { return val; } - FMT_CONSTEXPR long_type map(long val) { return val; } - FMT_CONSTEXPR ulong_type map(unsigned long val) { return val; } - FMT_CONSTEXPR long long map(long long val) { return val; } - FMT_CONSTEXPR unsigned long long map(unsigned long long val) { return val; } - FMT_CONSTEXPR bool map(bool val) { return val; } - - template <typename T, FMT_ENABLE_IF(is_char<T>::value)> - FMT_CONSTEXPR char_type map(T val) { - static_assert( - std::is_same<T, char>::value || std::is_same<T, char_type>::value, - "mixing character types is disallowed"); - return val; - } - - FMT_CONSTEXPR double map(float val) { return static_cast<double>(val); } - FMT_CONSTEXPR double map(double val) { return val; } - FMT_CONSTEXPR long double map(long double val) { return val; } - - FMT_CONSTEXPR const char_type* map(char_type* val) { return val; } - FMT_CONSTEXPR const char_type* map(const char_type* val) { return val; } - template <typename T, FMT_ENABLE_IF(is_string<T>::value)> - FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) { - static_assert(std::is_same<char_type, char_t<T>>::value, - "mixing character types is disallowed"); - return to_string_view(val); - } - template <typename T, - FMT_ENABLE_IF( - std::is_constructible<basic_string_view<char_type>, T>::value && - !is_string<T>::value)> - FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) { - return basic_string_view<char_type>(val); - } - FMT_CONSTEXPR const char* map(const signed char* val) { - static_assert(std::is_same<char_type, char>::value, "invalid string type"); - return reinterpret_cast<const char*>(val); - } - FMT_CONSTEXPR const char* map(const unsigned char* val) { - static_assert(std::is_same<char_type, char>::value, "invalid string type"); - return reinterpret_cast<const char*>(val); - } - - FMT_CONSTEXPR const void* map(void* val) { return val; } - FMT_CONSTEXPR const void* map(const void* val) { return val; } - FMT_CONSTEXPR const void* map(std::nullptr_t val) { return val; } - template <typename T> FMT_CONSTEXPR int map(const T*) { - // Formatting of arbitrary pointers is disallowed. If you want to output - // a pointer cast it to "void *" or "const void *". In particular, this - // forbids formatting of "[const] volatile char *" which is printed as bool - // by iostreams. - static_assert(!sizeof(T), "formatting of non-void pointers is disallowed"); - return 0; - } - - template <typename T, - FMT_ENABLE_IF(std::is_enum<T>::value && - !has_formatter<T, Context>::value && - !has_fallback_formatter<T, Context>::value)> - FMT_CONSTEXPR int map(const T& val) { - return static_cast<int>(val); - } - template <typename T, - FMT_ENABLE_IF(!is_string<T>::value && !is_char<T>::value && - (has_formatter<T, Context>::value || - has_fallback_formatter<T, Context>::value))> - FMT_CONSTEXPR const T& map(const T& val) { - return val; - } - - template <typename T> - FMT_CONSTEXPR const named_arg_base<char_type>& map( - const named_arg<T, char_type>& val) { - auto arg = make_arg<Context>(val.value); - std::memcpy(val.data, &arg, sizeof(arg)); - return val; - } -}; - -// A type constant after applying arg_mapper<Context>. -template <typename T, typename Context> -using mapped_type_constant = - type_constant<decltype(arg_mapper<Context>().map(std::declval<T>())), - typename Context::char_type>; - -// Maximum number of arguments with packed types. -enum { max_packed_args = 15 }; -enum : unsigned long long { is_unpacked_bit = 1ull << 63 }; - -template <typename Context> class arg_map; -} // namespace internal - -// A formatting argument. It is a trivially copyable/constructible type to -// allow storage in basic_memory_buffer. -template <typename Context> class basic_format_arg { - private: - internal::value<Context> value_; - internal::type type_; - - template <typename ContextType, typename T> - friend FMT_CONSTEXPR basic_format_arg<ContextType> internal::make_arg( - const T& value); - - template <typename Visitor, typename Ctx> - friend FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis, - const basic_format_arg<Ctx>& arg) - -> decltype(vis(0)); - - friend class basic_format_args<Context>; - friend class internal::arg_map<Context>; - - using char_type = typename Context::char_type; - - public: - class handle { - public: - explicit handle(internal::custom_value<Context> custom) : custom_(custom) {} - - void format(basic_parse_context<char_type>& parse_ctx, Context& ctx) const { - custom_.format(custom_.value, parse_ctx, ctx); - } - - private: - internal::custom_value<Context> custom_; - }; - - FMT_CONSTEXPR basic_format_arg() : type_(internal::none_type) {} - - FMT_CONSTEXPR explicit operator bool() const FMT_NOEXCEPT { - return type_ != internal::none_type; - } - - internal::type type() const { return type_; } - - bool is_integral() const { return internal::is_integral(type_); } - bool is_arithmetic() const { return internal::is_arithmetic(type_); } -}; - -/** - \rst - Visits an argument dispatching to the appropriate visit method based on - the argument type. For example, if the argument type is ``double`` then - ``vis(value)`` will be called with the value of type ``double``. - \endrst - */ -template <typename Visitor, typename Context> -FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis, - const basic_format_arg<Context>& arg) - -> decltype(vis(0)) { - using char_type = typename Context::char_type; - switch (arg.type_) { - case internal::none_type: - break; - case internal::named_arg_type: - FMT_ASSERT(false, "invalid argument type"); - break; - case internal::int_type: - return vis(arg.value_.int_value); - case internal::uint_type: - return vis(arg.value_.uint_value); - case internal::long_long_type: - return vis(arg.value_.long_long_value); - case internal::ulong_long_type: - return vis(arg.value_.ulong_long_value); - case internal::bool_type: - return vis(arg.value_.bool_value); - case internal::char_type: - return vis(arg.value_.char_value); - case internal::double_type: - return vis(arg.value_.double_value); - case internal::long_double_type: - return vis(arg.value_.long_double_value); - case internal::cstring_type: - return vis(arg.value_.string.data); - case internal::string_type: - return vis(basic_string_view<char_type>(arg.value_.string.data, - arg.value_.string.size)); - case internal::pointer_type: - return vis(arg.value_.pointer); - case internal::custom_type: - return vis(typename basic_format_arg<Context>::handle(arg.value_.custom)); - } - return vis(monostate()); -} - -namespace internal { -// A map from argument names to their values for named arguments. -template <typename Context> class arg_map { - private: - arg_map(const arg_map&) = delete; - void operator=(const arg_map&) = delete; - - using char_type = typename Context::char_type; - - struct entry { - basic_string_view<char_type> name; - basic_format_arg<Context> arg; - }; - - entry* map_; - unsigned size_; - - void push_back(value<Context> val) { - const auto& named = *val.named_arg; - map_[size_] = {named.name, named.template deserialize<Context>()}; - ++size_; - } - - public: - arg_map() : map_(nullptr), size_(0) {} - void init(const basic_format_args<Context>& args); - ~arg_map() { delete[] map_; } - - basic_format_arg<Context> find(basic_string_view<char_type> name) const { - // The list is unsorted, so just return the first matching name. - for (entry *it = map_, *end = map_ + size_; it != end; ++it) { - if (it->name == name) return it->arg; - } - return {}; - } -}; - -// A type-erased reference to an std::locale to avoid heavy <locale> include. -class locale_ref { - private: - const void* locale_; // A type-erased pointer to std::locale. - - public: - locale_ref() : locale_(nullptr) {} - template <typename Locale> explicit locale_ref(const Locale& loc); - - template <typename Locale> Locale get() const; -}; - -template <typename> constexpr unsigned long long encode_types() { return 0; } - -template <typename Context, typename Arg, typename... Args> -constexpr unsigned long long encode_types() { - return mapped_type_constant<Arg, Context>::value | - (encode_types<Context, Args...>() << 4); -} - -template <typename Context, typename T> -FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value) { - basic_format_arg<Context> arg; - arg.type_ = mapped_type_constant<T, Context>::value; - arg.value_ = arg_mapper<Context>().map(value); - return arg; -} - -template <bool IS_PACKED, typename Context, typename T, - FMT_ENABLE_IF(IS_PACKED)> -inline value<Context> make_arg(const T& val) { - return arg_mapper<Context>().map(val); -} - -template <bool IS_PACKED, typename Context, typename T, - FMT_ENABLE_IF(!IS_PACKED)> -inline basic_format_arg<Context> make_arg(const T& value) { - return make_arg<Context>(value); -} -} // namespace internal - -// Formatting context. -template <typename OutputIt, typename Char> class basic_format_context { - public: - /** The character type for the output. */ - using char_type = Char; - - private: - OutputIt out_; - basic_format_args<basic_format_context> args_; - internal::arg_map<basic_format_context> map_; - internal::locale_ref loc_; - - basic_format_context(const basic_format_context&) = delete; - void operator=(const basic_format_context&) = delete; - - public: - using iterator = OutputIt; - using format_arg = basic_format_arg<basic_format_context>; - template <typename T> using formatter_type = formatter<T, char_type>; - - /** - Constructs a ``basic_format_context`` object. References to the arguments are - stored in the object so make sure they have appropriate lifetimes. - */ - basic_format_context(OutputIt out, - basic_format_args<basic_format_context> ctx_args, - internal::locale_ref loc = internal::locale_ref()) - : out_(out), args_(ctx_args), loc_(loc) {} - - format_arg arg(int id) const { return args_.get(id); } - - // Checks if manual indexing is used and returns the argument with the - // specified name. - format_arg arg(basic_string_view<char_type> name); - - internal::error_handler error_handler() { return {}; } - void on_error(const char* message) { error_handler().on_error(message); } - - // Returns an iterator to the beginning of the output range. - iterator out() { return out_; } - - // Advances the begin iterator to ``it``. - void advance_to(iterator it) { out_ = it; } - - internal::locale_ref locale() { return loc_; } -}; - -template <typename Char> -using buffer_context = - basic_format_context<std::back_insert_iterator<internal::buffer<Char>>, - Char>; -using format_context = buffer_context<char>; -using wformat_context = buffer_context<wchar_t>; - -/** - \rst - An array of references to arguments. It can be implicitly converted into - `~fmt::basic_format_args` for passing into type-erased formatting functions - such as `~fmt::vformat`. - \endrst - */ -template <typename Context, typename... Args> class format_arg_store { - private: - static const size_t num_args = sizeof...(Args); - static const bool is_packed = num_args < internal::max_packed_args; - - using value_type = conditional_t<is_packed, internal::value<Context>, - basic_format_arg<Context>>; - - // If the arguments are not packed, add one more element to mark the end. - value_type data_[num_args + (num_args == 0 ? 1 : 0)]; - - friend class basic_format_args<Context>; - - public: - static constexpr unsigned long long types = - is_packed ? internal::encode_types<Context, Args...>() - : internal::is_unpacked_bit | num_args; - FMT_DEPRECATED static constexpr unsigned long long TYPES = types; - - format_arg_store(const Args&... args) - : data_{internal::make_arg<is_packed, Context>(args)...} {} -}; - -/** - \rst - Constructs an `~fmt::format_arg_store` object that contains references to - arguments and can be implicitly converted to `~fmt::format_args`. `Context` - can be omitted in which case it defaults to `~fmt::context`. - See `~fmt::arg` for lifetime considerations. - \endrst - */ -template <typename Context = format_context, typename... Args> -inline format_arg_store<Context, Args...> make_format_args( - const Args&... args) { - return {args...}; -} - -/** Formatting arguments. */ -template <typename Context> class basic_format_args { - public: - using size_type = int; - using format_arg = basic_format_arg<Context>; - - private: - // To reduce compiled code size per formatting function call, types of first - // max_packed_args arguments are passed in the types_ field. - unsigned long long types_; - union { - // If the number of arguments is less than max_packed_args, the argument - // values are stored in values_, otherwise they are stored in args_. - // This is done to reduce compiled code size as storing larger objects - // may require more code (at least on x86-64) even if the same amount of - // data is actually copied to stack. It saves ~10% on the bloat test. - const internal::value<Context>* values_; - const format_arg* args_; - }; - - bool is_packed() const { return (types_ & internal::is_unpacked_bit) == 0; } - - internal::type type(int index) const { - int shift = index * 4; - return static_cast<internal::type>((types_ & (0xfull << shift)) >> shift); - } - - friend class internal::arg_map<Context>; - - void set_data(const internal::value<Context>* values) { values_ = values; } - void set_data(const format_arg* args) { args_ = args; } - - format_arg do_get(int index) const { - format_arg arg; - if (!is_packed()) { - auto num_args = max_size(); - if (index < num_args) arg = args_[index]; - return arg; - } - if (index > internal::max_packed_args) return arg; - arg.type_ = type(index); - if (arg.type_ == internal::none_type) return arg; - internal::value<Context>& val = arg.value_; - val = values_[index]; - return arg; - } - - public: - basic_format_args() : types_(0) {} - - /** - \rst - Constructs a `basic_format_args` object from `~fmt::format_arg_store`. - \endrst - */ - template <typename... Args> - basic_format_args(const format_arg_store<Context, Args...>& store) - : types_(static_cast<unsigned long long>(store.types)) { - set_data(store.data_); - } - - /** - \rst - Constructs a `basic_format_args` object from a dynamic set of arguments. - \endrst - */ - basic_format_args(const format_arg* args, int count) - : types_(internal::is_unpacked_bit | internal::to_unsigned(count)) { - set_data(args); - } - - /** Returns the argument at specified index. */ - format_arg get(int index) const { - format_arg arg = do_get(index); - if (arg.type_ == internal::named_arg_type) - arg = arg.value_.named_arg->template deserialize<Context>(); - return arg; - } - - int max_size() const { - unsigned long long max_packed = internal::max_packed_args; - return static_cast<int>(is_packed() ? max_packed - : types_ & ~internal::is_unpacked_bit); - } -}; - -/** An alias to ``basic_format_args<context>``. */ -// It is a separate type rather than an alias to make symbols readable. -struct format_args : basic_format_args<format_context> { - template <typename... Args> - format_args(Args&&... args) - : basic_format_args<format_context>(std::forward<Args>(args)...) {} -}; -struct wformat_args : basic_format_args<wformat_context> { - template <typename... Args> - wformat_args(Args&&... args) - : basic_format_args<wformat_context>(std::forward<Args>(args)...) {} -}; - -template <typename Container> struct is_contiguous : std::false_type {}; - -template <typename Char> -struct is_contiguous<std::basic_string<Char>> : std::true_type {}; - -template <typename Char> -struct is_contiguous<internal::buffer<Char>> : std::true_type {}; - -namespace internal { - -template <typename OutputIt> -struct is_contiguous_back_insert_iterator : std::false_type {}; -template <typename Container> -struct is_contiguous_back_insert_iterator<std::back_insert_iterator<Container>> - : is_contiguous<Container> {}; - -template <typename Char> struct named_arg_base { - basic_string_view<Char> name; - - // Serialized value<context>. - mutable char data[sizeof(basic_format_arg<buffer_context<Char>>)]; - - named_arg_base(basic_string_view<Char> nm) : name(nm) {} - - template <typename Context> basic_format_arg<Context> deserialize() const { - basic_format_arg<Context> arg; - std::memcpy(&arg, data, sizeof(basic_format_arg<Context>)); - return arg; - } -}; - -template <typename T, typename Char> struct named_arg : named_arg_base<Char> { - const T& value; - - named_arg(basic_string_view<Char> name, const T& val) - : named_arg_base<Char>(name), value(val) {} -}; - -template <typename..., typename S, FMT_ENABLE_IF(!is_compile_string<S>::value)> -inline void check_format_string(const S&) { -#if defined(FMT_ENFORCE_COMPILE_STRING) - static_assert(is_compile_string<S>::value, - "FMT_ENFORCE_COMPILE_STRING requires all format strings to " - "utilize FMT_STRING() or fmt()."); -#endif -} -template <typename..., typename S, FMT_ENABLE_IF(is_compile_string<S>::value)> -void check_format_string(S); - -struct view {}; -template <bool...> struct bool_pack; -template <bool... Args> -using all_true = - std::is_same<bool_pack<Args..., true>, bool_pack<true, Args...>>; - -template <typename... Args, typename S, typename Char = char_t<S>> -inline format_arg_store<buffer_context<Char>, remove_reference_t<Args>...> -make_args_checked(const S& format_str, - const remove_reference_t<Args>&... args) { - static_assert(all_true<(!std::is_base_of<view, remove_reference_t<Args>>() || - !std::is_reference<Args>())...>::value, - "passing views as lvalues is disallowed"); - check_format_string<remove_const_t<remove_reference_t<Args>>...>(format_str); - return {args...}; -} - -template <typename Char> -std::basic_string<Char> vformat(basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args); - -template <typename Char> -typename buffer_context<Char>::iterator vformat_to( - buffer<Char>& buf, basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args); -} // namespace internal - -/** - \rst - Returns a named argument to be used in a formatting function. - - The named argument holds a reference and does not extend the lifetime - of its arguments. - Consequently, a dangling reference can accidentally be created. - The user should take care to only pass this function temporaries when - the named argument is itself a temporary, as per the following example. - - **Example**:: - - fmt::print("Elapsed time: {s:.2f} seconds", fmt::arg("s", 1.23)); - \endrst - */ -template <typename S, typename T, typename Char = char_t<S>> -inline internal::named_arg<T, Char> arg(const S& name, const T& arg) { - static_assert(internal::is_string<S>::value, ""); - return {name, arg}; -} - -// Disable nested named arguments, e.g. ``arg("a", arg("b", 42))``. -template <typename S, typename T, typename Char> -void arg(S, internal::named_arg<T, Char>) = delete; - -/** Formats a string and writes the output to ``out``. */ -// GCC 8 and earlier cannot handle std::back_insert_iterator<Container> with -// vformat_to<ArgFormatter>(...) overload, so SFINAE on iterator type instead. -template <typename OutputIt, typename S, typename Char = char_t<S>, - FMT_ENABLE_IF( - internal::is_contiguous_back_insert_iterator<OutputIt>::value)> -OutputIt vformat_to(OutputIt out, const S& format_str, - basic_format_args<buffer_context<Char>> args) { - using container = remove_reference_t<decltype(internal::get_container(out))>; - internal::container_buffer<container> buf((internal::get_container(out))); - internal::vformat_to(buf, to_string_view(format_str), args); - return out; -} - -template <typename Container, typename S, typename... Args, - FMT_ENABLE_IF( - is_contiguous<Container>::value&& internal::is_string<S>::value)> -inline std::back_insert_iterator<Container> format_to( - std::back_insert_iterator<Container> out, const S& format_str, - Args&&... args) { - return vformat_to( - out, to_string_view(format_str), - {internal::make_args_checked<Args...>(format_str, args...)}); -} - -template <typename S, typename Char = char_t<S>> -inline std::basic_string<Char> vformat( - const S& format_str, basic_format_args<buffer_context<Char>> args) { - return internal::vformat(to_string_view(format_str), args); -} - -/** - \rst - Formats arguments and returns the result as a string. - - **Example**:: - - #include <fmt/core.h> - std::string message = fmt::format("The answer is {}", 42); - \endrst -*/ -// Pass char_t as a default template parameter instead of using -// std::basic_string<char_t<S>> to reduce the symbol size. -template <typename S, typename... Args, typename Char = char_t<S>> -inline std::basic_string<Char> format(const S& format_str, Args&&... args) { - return internal::vformat( - to_string_view(format_str), - {internal::make_args_checked<Args...>(format_str, args...)}); -} - -FMT_API void vprint(std::FILE* f, string_view format_str, format_args args); -FMT_API void vprint(std::FILE* f, wstring_view format_str, wformat_args args); - -/** - \rst - Prints formatted data to the file *f*. For wide format strings, - *f* should be in wide-oriented mode set via ``fwide(f, 1)`` or - ``_setmode(_fileno(f), _O_U8TEXT)`` on Windows. - - **Example**:: - - fmt::print(stderr, "Don't {}!", "panic"); - \endrst - */ -template <typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value)> -inline void print(std::FILE* f, const S& format_str, Args&&... args) { - vprint(f, to_string_view(format_str), - internal::make_args_checked<Args...>(format_str, args...)); -} - -FMT_API void vprint(string_view format_str, format_args args); -FMT_API void vprint(wstring_view format_str, wformat_args args); - -/** - \rst - Prints formatted data to ``stdout``. - - **Example**:: - - fmt::print("Elapsed time: {0:.2f} seconds", 1.23); - \endrst - */ -template <typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value)> -inline void print(const S& format_str, Args&&... args) { - vprint(to_string_view(format_str), - internal::make_args_checked<Args...>(format_str, args...)); -} -FMT_END_NAMESPACE - -#endif // FMT_CORE_H_ diff --git a/include/vtkdiy2/fmt/format-inl.h b/include/vtkdiy2/fmt/format-inl.h deleted file mode 100644 index 147062fe5d385b733e4268f8790f9dafb8c18e0e..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/fmt/format-inl.h +++ /dev/null @@ -1,1000 +0,0 @@ -// Formatting library for C++ -// -// Copyright (c) 2012 - 2016, Victor Zverovich -// All rights reserved. -// -// For the license information refer to format.h. - -#ifndef FMT_FORMAT_INL_H_ -#define FMT_FORMAT_INL_H_ - -#include "format.h" - -#include <string.h> - -#include <cctype> -#include <cerrno> -#include <climits> -#include <cmath> -#include <cstdarg> -#include <cstddef> // for std::ptrdiff_t -#include <cstring> // for std::memmove -#include <cwchar> -#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR) -# include <locale> -#endif - -#if FMT_USE_WINDOWS_H -# if !defined(FMT_HEADER_ONLY) && !defined(WIN32_LEAN_AND_MEAN) -# define WIN32_LEAN_AND_MEAN -# endif -# if defined(NOMINMAX) || defined(FMT_WIN_MINMAX) -# include <windows.h> -# else -# define NOMINMAX -# include <windows.h> -# undef NOMINMAX -# endif -#endif - -#if FMT_EXCEPTIONS -# define FMT_TRY try -# define FMT_CATCH(x) catch (x) -#else -# define FMT_TRY if (true) -# define FMT_CATCH(x) if (false) -#endif - -#ifdef _MSC_VER -# pragma warning(push) -# pragma warning(disable : 4127) // conditional expression is constant -# pragma warning(disable : 4702) // unreachable code -// Disable deprecation warning for strerror. The latter is not called but -// MSVC fails to detect it. -# pragma warning(disable : 4996) -#endif - -// Dummy implementations of strerror_r and strerror_s called if corresponding -// system functions are not available. -inline fmt::internal::null<> strerror_r(int, char*, ...) { - return fmt::internal::null<>(); -} -inline fmt::internal::null<> strerror_s(char*, std::size_t, ...) { - return fmt::internal::null<>(); -} - -FMT_BEGIN_NAMESPACE -namespace internal { - -#ifndef _MSC_VER -# define FMT_SNPRINTF snprintf -#else // _MSC_VER -inline int fmt_snprintf(char* buffer, size_t size, const char* format, ...) { - va_list args; - va_start(args, format); - int result = vsnprintf_s(buffer, size, _TRUNCATE, format, args); - va_end(args); - return result; -} -# define FMT_SNPRINTF fmt_snprintf -#endif // _MSC_VER - -using format_func = void (*)(internal::buffer<char>&, int, string_view); - -// Portable thread-safe version of strerror. -// Sets buffer to point to a string describing the error code. -// This can be either a pointer to a string stored in buffer, -// or a pointer to some static immutable string. -// Returns one of the following values: -// 0 - success -// ERANGE - buffer is not large enough to store the error message -// other - failure -// Buffer should be at least of size 1. -FMT_FUNC int safe_strerror(int error_code, char*& buffer, - std::size_t buffer_size) FMT_NOEXCEPT { - FMT_ASSERT(buffer != nullptr && buffer_size != 0, "invalid buffer"); - - class dispatcher { - private: - int error_code_; - char*& buffer_; - std::size_t buffer_size_; - - // A noop assignment operator to avoid bogus warnings. - void operator=(const dispatcher&) {} - - // Handle the result of XSI-compliant version of strerror_r. - int handle(int result) { - // glibc versions before 2.13 return result in errno. - return result == -1 ? errno : result; - } - - // Handle the result of GNU-specific version of strerror_r. - int handle(char* message) { - // If the buffer is full then the message is probably truncated. - if (message == buffer_ && strlen(buffer_) == buffer_size_ - 1) - return ERANGE; - buffer_ = message; - return 0; - } - - // Handle the case when strerror_r is not available. - int handle(internal::null<>) { - return fallback(strerror_s(buffer_, buffer_size_, error_code_)); - } - - // Fallback to strerror_s when strerror_r is not available. - int fallback(int result) { - // If the buffer is full then the message is probably truncated. - return result == 0 && strlen(buffer_) == buffer_size_ - 1 ? ERANGE - : result; - } - -#if !FMT_MSC_VER - // Fallback to strerror if strerror_r and strerror_s are not available. - int fallback(internal::null<>) { - errno = 0; - buffer_ = strerror(error_code_); - return errno; - } -#endif - - public: - dispatcher(int err_code, char*& buf, std::size_t buf_size) - : error_code_(err_code), buffer_(buf), buffer_size_(buf_size) {} - - int run() { return handle(strerror_r(error_code_, buffer_, buffer_size_)); } - }; - return dispatcher(error_code, buffer, buffer_size).run(); -} - -FMT_FUNC void format_error_code(internal::buffer<char>& out, int error_code, - string_view message) FMT_NOEXCEPT { - // Report error code making sure that the output fits into - // inline_buffer_size to avoid dynamic memory allocation and potential - // bad_alloc. - out.resize(0); - static const char SEP[] = ": "; - static const char ERROR_STR[] = "error "; - // Subtract 2 to account for terminating null characters in SEP and ERROR_STR. - std::size_t error_code_size = sizeof(SEP) + sizeof(ERROR_STR) - 2; - auto abs_value = static_cast<uint32_or_64_t<int>>(error_code); - if (internal::is_negative(error_code)) { - abs_value = 0 - abs_value; - ++error_code_size; - } - error_code_size += internal::to_unsigned(internal::count_digits(abs_value)); - internal::writer w(out); - if (message.size() <= inline_buffer_size - error_code_size) { - w.write(message); - w.write(SEP); - } - w.write(ERROR_STR); - w.write(error_code); - assert(out.size() <= inline_buffer_size); -} - -// A wrapper around fwrite that throws on error. -FMT_FUNC void fwrite_fully(const void* ptr, size_t size, size_t count, - FILE* stream) { - size_t written = std::fwrite(ptr, size, count, stream); - if (written < count) { - FMT_THROW(system_error(errno, "cannot write to file")); - } -} - -FMT_FUNC void report_error(format_func func, int error_code, - string_view message) FMT_NOEXCEPT { - memory_buffer full_message; - func(full_message, error_code, message); - // Don't use fwrite_fully because the latter may throw. - (void)std::fwrite(full_message.data(), full_message.size(), 1, stderr); - std::fputc('\n', stderr); -} -} // namespace internal - -#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR) -namespace internal { - -template <typename Locale> -locale_ref::locale_ref(const Locale& loc) : locale_(&loc) { - static_assert(std::is_same<Locale, std::locale>::value, ""); -} - -template <typename Locale> Locale locale_ref::get() const { - static_assert(std::is_same<Locale, std::locale>::value, ""); - return locale_ ? *static_cast<const std::locale*>(locale_) : std::locale(); -} - -template <typename Char> FMT_FUNC Char thousands_sep_impl(locale_ref loc) { - return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()) - .thousands_sep(); -} -template <typename Char> FMT_FUNC Char decimal_point_impl(locale_ref loc) { - return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()) - .decimal_point(); -} -} // namespace internal -#else -template <typename Char> -FMT_FUNC Char internal::thousands_sep_impl(locale_ref) { - return FMT_STATIC_THOUSANDS_SEPARATOR; -} -template <typename Char> -FMT_FUNC Char internal::decimal_point_impl(locale_ref) { - return '.'; -} -#endif - -FMT_API FMT_FUNC format_error::~format_error() FMT_NOEXCEPT {} -FMT_API FMT_FUNC system_error::~system_error() FMT_NOEXCEPT {} - -FMT_FUNC void system_error::init(int err_code, string_view format_str, - format_args args) { - error_code_ = err_code; - memory_buffer buffer; - format_system_error(buffer, err_code, vformat(format_str, args)); - std::runtime_error& base = *this; - base = std::runtime_error(to_string(buffer)); -} - -namespace internal { - -template <> FMT_FUNC int count_digits<4>(internal::fallback_uintptr n) { - // Assume little endian; pointer formatting is implementation-defined anyway. - int i = static_cast<int>(sizeof(void*)) - 1; - while (i > 0 && n.value[i] == 0) --i; - auto char_digits = std::numeric_limits<unsigned char>::digits / 4; - return i >= 0 ? i * char_digits + count_digits<4, unsigned>(n.value[i]) : 1; -} - -template <typename T> -int format_float(char* buf, std::size_t size, const char* format, int precision, - T value) { -#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION - if (precision > 100000) - throw std::runtime_error( - "fuzz mode - avoid large allocation inside snprintf"); -#endif - // Suppress the warning about nonliteral format string. - auto snprintf_ptr = FMT_SNPRINTF; - return precision < 0 ? snprintf_ptr(buf, size, format, value) - : snprintf_ptr(buf, size, format, precision, value); -} - -template <typename T> -const char basic_data<T>::digits[] = - "0001020304050607080910111213141516171819" - "2021222324252627282930313233343536373839" - "4041424344454647484950515253545556575859" - "6061626364656667686970717273747576777879" - "8081828384858687888990919293949596979899"; - -template <typename T> -const char basic_data<T>::hex_digits[] = "0123456789abcdef"; - -#define FMT_POWERS_OF_10(factor) \ - factor * 10, factor * 100, factor * 1000, factor * 10000, factor * 100000, \ - factor * 1000000, factor * 10000000, factor * 100000000, \ - factor * 1000000000 - -template <typename T> -const uint64_t basic_data<T>::powers_of_10_64[] = { - 1, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ull), - 10000000000000000000ull}; - -template <typename T> -const uint32_t basic_data<T>::zero_or_powers_of_10_32[] = {0, - FMT_POWERS_OF_10(1)}; - -template <typename T> -const uint64_t basic_data<T>::zero_or_powers_of_10_64[] = { - 0, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ull), - 10000000000000000000ull}; - -// Normalized 64-bit significands of pow(10, k), for k = -348, -340, ..., 340. -// These are generated by support/compute-powers.py. -template <typename T> -const uint64_t basic_data<T>::pow10_significands[] = { - 0xfa8fd5a0081c0288, 0xbaaee17fa23ebf76, 0x8b16fb203055ac76, - 0xcf42894a5dce35ea, 0x9a6bb0aa55653b2d, 0xe61acf033d1a45df, - 0xab70fe17c79ac6ca, 0xff77b1fcbebcdc4f, 0xbe5691ef416bd60c, - 0x8dd01fad907ffc3c, 0xd3515c2831559a83, 0x9d71ac8fada6c9b5, - 0xea9c227723ee8bcb, 0xaecc49914078536d, 0x823c12795db6ce57, - 0xc21094364dfb5637, 0x9096ea6f3848984f, 0xd77485cb25823ac7, - 0xa086cfcd97bf97f4, 0xef340a98172aace5, 0xb23867fb2a35b28e, - 0x84c8d4dfd2c63f3b, 0xc5dd44271ad3cdba, 0x936b9fcebb25c996, - 0xdbac6c247d62a584, 0xa3ab66580d5fdaf6, 0xf3e2f893dec3f126, - 0xb5b5ada8aaff80b8, 0x87625f056c7c4a8b, 0xc9bcff6034c13053, - 0x964e858c91ba2655, 0xdff9772470297ebd, 0xa6dfbd9fb8e5b88f, - 0xf8a95fcf88747d94, 0xb94470938fa89bcf, 0x8a08f0f8bf0f156b, - 0xcdb02555653131b6, 0x993fe2c6d07b7fac, 0xe45c10c42a2b3b06, - 0xaa242499697392d3, 0xfd87b5f28300ca0e, 0xbce5086492111aeb, - 0x8cbccc096f5088cc, 0xd1b71758e219652c, 0x9c40000000000000, - 0xe8d4a51000000000, 0xad78ebc5ac620000, 0x813f3978f8940984, - 0xc097ce7bc90715b3, 0x8f7e32ce7bea5c70, 0xd5d238a4abe98068, - 0x9f4f2726179a2245, 0xed63a231d4c4fb27, 0xb0de65388cc8ada8, - 0x83c7088e1aab65db, 0xc45d1df942711d9a, 0x924d692ca61be758, - 0xda01ee641a708dea, 0xa26da3999aef774a, 0xf209787bb47d6b85, - 0xb454e4a179dd1877, 0x865b86925b9bc5c2, 0xc83553c5c8965d3d, - 0x952ab45cfa97a0b3, 0xde469fbd99a05fe3, 0xa59bc234db398c25, - 0xf6c69a72a3989f5c, 0xb7dcbf5354e9bece, 0x88fcf317f22241e2, - 0xcc20ce9bd35c78a5, 0x98165af37b2153df, 0xe2a0b5dc971f303a, - 0xa8d9d1535ce3b396, 0xfb9b7cd9a4a7443c, 0xbb764c4ca7a44410, - 0x8bab8eefb6409c1a, 0xd01fef10a657842c, 0x9b10a4e5e9913129, - 0xe7109bfba19c0c9d, 0xac2820d9623bf429, 0x80444b5e7aa7cf85, - 0xbf21e44003acdd2d, 0x8e679c2f5e44ff8f, 0xd433179d9c8cb841, - 0x9e19db92b4e31ba9, 0xeb96bf6ebadf77d9, 0xaf87023b9bf0ee6b, -}; - -// Binary exponents of pow(10, k), for k = -348, -340, ..., 340, corresponding -// to significands above. -template <typename T> -const int16_t basic_data<T>::pow10_exponents[] = { - -1220, -1193, -1166, -1140, -1113, -1087, -1060, -1034, -1007, -980, -954, - -927, -901, -874, -847, -821, -794, -768, -741, -715, -688, -661, - -635, -608, -582, -555, -529, -502, -475, -449, -422, -396, -369, - -343, -316, -289, -263, -236, -210, -183, -157, -130, -103, -77, - -50, -24, 3, 30, 56, 83, 109, 136, 162, 189, 216, - 242, 269, 295, 322, 348, 375, 402, 428, 455, 481, 508, - 534, 561, 588, 614, 641, 667, 694, 720, 747, 774, 800, - 827, 853, 880, 907, 933, 960, 986, 1013, 1039, 1066}; - -template <typename T> -const char basic_data<T>::foreground_color[] = "\x1b[38;2;"; -template <typename T> -const char basic_data<T>::background_color[] = "\x1b[48;2;"; -template <typename T> const char basic_data<T>::reset_color[] = "\x1b[0m"; -template <typename T> const wchar_t basic_data<T>::wreset_color[] = L"\x1b[0m"; - -template <typename T> struct bits { - static FMT_CONSTEXPR_DECL const int value = - static_cast<int>(sizeof(T) * std::numeric_limits<unsigned char>::digits); -}; - -// A handmade floating-point number f * pow(2, e). -class fp { - private: - using significand_type = uint64_t; - - // All sizes are in bits. - // Subtract 1 to account for an implicit most significant bit in the - // normalized form. - static FMT_CONSTEXPR_DECL const int double_significand_size = - std::numeric_limits<double>::digits - 1; - static FMT_CONSTEXPR_DECL const uint64_t implicit_bit = - 1ull << double_significand_size; - - public: - significand_type f; - int e; - - static FMT_CONSTEXPR_DECL const int significand_size = - bits<significand_type>::value; - - fp() : f(0), e(0) {} - fp(uint64_t f_val, int e_val) : f(f_val), e(e_val) {} - - // Constructs fp from an IEEE754 double. It is a template to prevent compile - // errors on platforms where double is not IEEE754. - template <typename Double> explicit fp(Double d) { - // Assume double is in the format [sign][exponent][significand]. - using limits = std::numeric_limits<Double>; - const int exponent_size = - bits<Double>::value - double_significand_size - 1; // -1 for sign - const uint64_t significand_mask = implicit_bit - 1; - const uint64_t exponent_mask = (~0ull >> 1) & ~significand_mask; - const int exponent_bias = (1 << exponent_size) - limits::max_exponent - 1; - auto u = bit_cast<uint64_t>(d); - auto biased_e = (u & exponent_mask) >> double_significand_size; - f = u & significand_mask; - if (biased_e != 0) - f += implicit_bit; - else - biased_e = 1; // Subnormals use biased exponent 1 (min exponent). - e = static_cast<int>(biased_e - exponent_bias - double_significand_size); - } - - // Normalizes the value converted from double and multiplied by (1 << SHIFT). - template <int SHIFT = 0> void normalize() { - // Handle subnormals. - auto shifted_implicit_bit = implicit_bit << SHIFT; - while ((f & shifted_implicit_bit) == 0) { - f <<= 1; - --e; - } - // Subtract 1 to account for hidden bit. - auto offset = significand_size - double_significand_size - SHIFT - 1; - f <<= offset; - e -= offset; - } - - // Compute lower and upper boundaries (m^- and m^+ in the Grisu paper), where - // a boundary is a value half way between the number and its predecessor - // (lower) or successor (upper). The upper boundary is normalized and lower - // has the same exponent but may be not normalized. - void compute_boundaries(fp& lower, fp& upper) const { - lower = - f == implicit_bit ? fp((f << 2) - 1, e - 2) : fp((f << 1) - 1, e - 1); - upper = fp((f << 1) + 1, e - 1); - upper.normalize<1>(); // 1 is to account for the exponent shift above. - lower.f <<= lower.e - upper.e; - lower.e = upper.e; - } -}; - -// Returns an fp number representing x - y. Result may not be normalized. -inline fp operator-(fp x, fp y) { - FMT_ASSERT(x.f >= y.f && x.e == y.e, "invalid operands"); - return fp(x.f - y.f, x.e); -} - -// Computes an fp number r with r.f = x.f * y.f / pow(2, 64) rounded to nearest -// with half-up tie breaking, r.e = x.e + y.e + 64. Result may not be -// normalized. -FMT_FUNC fp operator*(fp x, fp y) { - int exp = x.e + y.e + 64; -#if FMT_USE_INT128 - auto product = static_cast<__uint128_t>(x.f) * y.f; - auto f = static_cast<uint64_t>(product >> 64); - if ((static_cast<uint64_t>(product) & (1ULL << 63)) != 0) ++f; - return fp(f, exp); -#else - // Multiply 32-bit parts of significands. - uint64_t mask = (1ULL << 32) - 1; - uint64_t a = x.f >> 32, b = x.f & mask; - uint64_t c = y.f >> 32, d = y.f & mask; - uint64_t ac = a * c, bc = b * c, ad = a * d, bd = b * d; - // Compute mid 64-bit of result and round. - uint64_t mid = (bd >> 32) + (ad & mask) + (bc & mask) + (1U << 31); - return fp(ac + (ad >> 32) + (bc >> 32) + (mid >> 32), exp); -#endif -} - -// Returns cached power (of 10) c_k = c_k.f * pow(2, c_k.e) such that its -// (binary) exponent satisfies min_exponent <= c_k.e <= min_exponent + 28. -FMT_FUNC fp get_cached_power(int min_exponent, int& pow10_exponent) { - const double one_over_log2_10 = 0.30102999566398114; // 1 / log2(10) - int index = static_cast<int>( - std::ceil((min_exponent + fp::significand_size - 1) * one_over_log2_10)); - // Decimal exponent of the first (smallest) cached power of 10. - const int first_dec_exp = -348; - // Difference between 2 consecutive decimal exponents in cached powers of 10. - const int dec_exp_step = 8; - index = (index - first_dec_exp - 1) / dec_exp_step + 1; - pow10_exponent = first_dec_exp + index * dec_exp_step; - return fp(data::pow10_significands[index], data::pow10_exponents[index]); -} - -enum round_direction { unknown, up, down }; - -// Given the divisor (normally a power of 10), the remainder = v % divisor for -// some number v and the error, returns whether v should be rounded up, down, or -// whether the rounding direction can't be determined due to error. -// error should be less than divisor / 2. -inline round_direction get_round_direction(uint64_t divisor, uint64_t remainder, - uint64_t error) { - FMT_ASSERT(remainder < divisor, ""); // divisor - remainder won't overflow. - FMT_ASSERT(error < divisor, ""); // divisor - error won't overflow. - FMT_ASSERT(error < divisor - error, ""); // error * 2 won't overflow. - // Round down if (remainder + error) * 2 <= divisor. - if (remainder <= divisor - remainder && error * 2 <= divisor - remainder * 2) - return down; - // Round up if (remainder - error) * 2 >= divisor. - if (remainder >= error && - remainder - error >= divisor - (remainder - error)) { - return up; - } - return unknown; -} - -namespace digits { -enum result { - more, // Generate more digits. - done, // Done generating digits. - error // Digit generation cancelled due to an error. -}; -} - -// Generates output using the Grisu digit-gen algorithm. -// error: the size of the region (lower, upper) outside of which numbers -// definitely do not round to value (Delta in Grisu3). -template <typename Handler> -digits::result grisu_gen_digits(fp value, uint64_t error, int& exp, - Handler& handler) { - fp one(1ull << -value.e, value.e); - // The integral part of scaled value (p1 in Grisu) = value / one. It cannot be - // zero because it contains a product of two 64-bit numbers with MSB set (due - // to normalization) - 1, shifted right by at most 60 bits. - uint32_t integral = static_cast<uint32_t>(value.f >> -one.e); - FMT_ASSERT(integral != 0, ""); - FMT_ASSERT(integral == value.f >> -one.e, ""); - // The fractional part of scaled value (p2 in Grisu) c = value % one. - uint64_t fractional = value.f & (one.f - 1); - exp = count_digits(integral); // kappa in Grisu. - // Divide by 10 to prevent overflow. - auto result = handler.on_start(data::powers_of_10_64[exp - 1] << -one.e, - value.f / 10, error * 10, exp); - if (result != digits::more) return result; - // Generate digits for the integral part. This can produce up to 10 digits. - do { - uint32_t digit = 0; - // This optimization by miloyip reduces the number of integer divisions by - // one per iteration. - switch (exp) { - case 10: - digit = integral / 1000000000; - integral %= 1000000000; - break; - case 9: - digit = integral / 100000000; - integral %= 100000000; - break; - case 8: - digit = integral / 10000000; - integral %= 10000000; - break; - case 7: - digit = integral / 1000000; - integral %= 1000000; - break; - case 6: - digit = integral / 100000; - integral %= 100000; - break; - case 5: - digit = integral / 10000; - integral %= 10000; - break; - case 4: - digit = integral / 1000; - integral %= 1000; - break; - case 3: - digit = integral / 100; - integral %= 100; - break; - case 2: - digit = integral / 10; - integral %= 10; - break; - case 1: - digit = integral; - integral = 0; - break; - default: - FMT_ASSERT(false, "invalid number of digits"); - } - --exp; - uint64_t remainder = - (static_cast<uint64_t>(integral) << -one.e) + fractional; - result = handler.on_digit(static_cast<char>('0' + digit), - data::powers_of_10_64[exp] << -one.e, remainder, - error, exp, true); - if (result != digits::more) return result; - } while (exp > 0); - // Generate digits for the fractional part. - for (;;) { - fractional *= 10; - error *= 10; - char digit = - static_cast<char>('0' + static_cast<char>(fractional >> -one.e)); - fractional &= one.f - 1; - --exp; - result = handler.on_digit(digit, one.f, fractional, error, exp, false); - if (result != digits::more) return result; - } -} - -// The fixed precision digit handler. -struct fixed_handler { - char* buf; - int size; - int precision; - int exp10; - bool fixed; - - digits::result on_start(uint64_t divisor, uint64_t remainder, uint64_t error, - int& exp) { - // Non-fixed formats require at least one digit and no precision adjustment. - if (!fixed) return digits::more; - // Adjust fixed precision by exponent because it is relative to decimal - // point. - precision += exp + exp10; - // Check if precision is satisfied just by leading zeros, e.g. - // format("{:.2f}", 0.001) gives "0.00" without generating any digits. - if (precision > 0) return digits::more; - if (precision < 0) return digits::done; - auto dir = get_round_direction(divisor, remainder, error); - if (dir == unknown) return digits::error; - buf[size++] = dir == up ? '1' : '0'; - return digits::done; - } - - digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder, - uint64_t error, int, bool integral) { - FMT_ASSERT(remainder < divisor, ""); - buf[size++] = digit; - if (size < precision) return digits::more; - if (!integral) { - // Check if error * 2 < divisor with overflow prevention. - // The check is not needed for the integral part because error = 1 - // and divisor > (1 << 32) there. - if (error >= divisor || error >= divisor - error) return digits::error; - } else { - FMT_ASSERT(error == 1 && divisor > 2, ""); - } - auto dir = get_round_direction(divisor, remainder, error); - if (dir != up) return dir == down ? digits::done : digits::error; - ++buf[size - 1]; - for (int i = size - 1; i > 0 && buf[i] > '9'; --i) { - buf[i] = '0'; - ++buf[i - 1]; - } - if (buf[0] > '9') { - buf[0] = '1'; - buf[size++] = '0'; - } - return digits::done; - } -}; - -// The shortest representation digit handler. -template <int GRISU_VERSION> struct grisu_shortest_handler { - char* buf; - int size; - // Distance between scaled value and upper bound (wp_W in Grisu3). - uint64_t diff; - - digits::result on_start(uint64_t, uint64_t, uint64_t, int&) { - return digits::more; - } - - // Decrement the generated number approaching value from above. - void round(uint64_t d, uint64_t divisor, uint64_t& remainder, - uint64_t error) { - while ( - remainder < d && error - remainder >= divisor && - (remainder + divisor < d || d - remainder >= remainder + divisor - d)) { - --buf[size - 1]; - remainder += divisor; - } - } - - // Implements Grisu's round_weed. - digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder, - uint64_t error, int exp, bool integral) { - buf[size++] = digit; - if (remainder >= error) return digits::more; - if (GRISU_VERSION != 3) { - uint64_t d = integral ? diff : diff * data::powers_of_10_64[-exp]; - round(d, divisor, remainder, error); - return digits::done; - } - uint64_t unit = integral ? 1 : data::powers_of_10_64[-exp]; - uint64_t up = (diff - 1) * unit; // wp_Wup - round(up, divisor, remainder, error); - uint64_t down = (diff + 1) * unit; // wp_Wdown - if (remainder < down && error - remainder >= divisor && - (remainder + divisor < down || - down - remainder > remainder + divisor - down)) { - return digits::error; - } - return 2 * unit <= remainder && remainder <= error - 4 * unit - ? digits::done - : digits::error; - } -}; - -template <typename Double, - enable_if_t<(sizeof(Double) == sizeof(uint64_t)), int>> -FMT_API bool grisu_format(Double value, buffer<char>& buf, int precision, - unsigned options, int& exp) { - FMT_ASSERT(value >= 0, "value is negative"); - bool fixed = (options & grisu_options::fixed) != 0; - if (value <= 0) { // <= instead of == to silence a warning. - if (precision <= 0 || !fixed) { - exp = 0; - buf.push_back('0'); - } else { - exp = -precision; - buf.resize(precision); - std::uninitialized_fill_n(buf.data(), precision, '0'); - } - return true; - } - - fp fp_value(value); - const int min_exp = -60; // alpha in Grisu. - int cached_exp10 = 0; // K in Grisu. - if (precision != -1) { - if (precision > 17) return false; - fp_value.normalize(); - auto cached_pow = get_cached_power( - min_exp - (fp_value.e + fp::significand_size), cached_exp10); - fp_value = fp_value * cached_pow; - fixed_handler handler{buf.data(), 0, precision, -cached_exp10, fixed}; - if (grisu_gen_digits(fp_value, 1, exp, handler) == digits::error) - return false; - buf.resize(to_unsigned(handler.size)); - } else { - fp lower, upper; // w^- and w^+ in the Grisu paper. - fp_value.compute_boundaries(lower, upper); - // Find a cached power of 10 such that multiplying upper by it will bring - // the exponent in the range [min_exp, -32]. - auto cached_pow = get_cached_power( // \tilde{c}_{-k} in Grisu. - min_exp - (upper.e + fp::significand_size), cached_exp10); - fp_value.normalize(); - fp_value = fp_value * cached_pow; - lower = lower * cached_pow; // \tilde{M}^- in Grisu. - upper = upper * cached_pow; // \tilde{M}^+ in Grisu. - assert(min_exp <= upper.e && upper.e <= -32); - auto result = digits::result(); - int size = 0; - if ((options & grisu_options::grisu3) != 0) { - --lower.f; // \tilde{M}^- - 1 ulp -> M^-_{\downarrow}. - ++upper.f; // \tilde{M}^+ + 1 ulp -> M^+_{\uparrow}. - // Numbers outside of (lower, upper) definitely do not round to value. - grisu_shortest_handler<3> handler{buf.data(), 0, (upper - fp_value).f}; - result = grisu_gen_digits(upper, upper.f - lower.f, exp, handler); - size = handler.size; - } else { - ++lower.f; // \tilde{M}^- + 1 ulp -> M^-_{\uparrow}. - --upper.f; // \tilde{M}^+ - 1 ulp -> M^+_{\downarrow}. - grisu_shortest_handler<2> handler{buf.data(), 0, (upper - fp_value).f}; - result = grisu_gen_digits(upper, upper.f - lower.f, exp, handler); - size = handler.size; - } - if (result == digits::error) return false; - buf.resize(to_unsigned(size)); - } - exp -= cached_exp10; - return true; -} - -template <typename Double> -char* sprintf_format(Double value, internal::buffer<char>& buf, - sprintf_specs specs) { - // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail. - FMT_ASSERT(buf.capacity() != 0, "empty buffer"); - - // Build format string. - enum { max_format_size = 10 }; // longest format: %#-*.*Lg - char format[max_format_size]; - char* format_ptr = format; - *format_ptr++ = '%'; - if (specs.alt || !specs.type) *format_ptr++ = '#'; - if (specs.precision >= 0) { - *format_ptr++ = '.'; - *format_ptr++ = '*'; - } - if (std::is_same<Double, long double>::value) *format_ptr++ = 'L'; - - char type = specs.type; - - if (type == '%') - type = 'f'; - else if (type == 0 || type == 'n') - type = 'g'; -#if FMT_MSC_VER - if (type == 'F') { - // MSVC's printf doesn't support 'F'. - type = 'f'; - } -#endif - *format_ptr++ = type; - *format_ptr = '\0'; - - // Format using snprintf. - char* start = nullptr; - char* decimal_point_pos = nullptr; - for (;;) { - std::size_t buffer_size = buf.capacity(); - start = &buf[0]; - int result = - format_float(start, buffer_size, format, specs.precision, value); - if (result >= 0) { - unsigned n = internal::to_unsigned(result); - if (n < buf.capacity()) { - // Find the decimal point. - auto p = buf.data(), end = p + n; - if (*p == '+' || *p == '-') ++p; - if (specs.type != 'a' && specs.type != 'A') { - while (p < end && *p >= '0' && *p <= '9') ++p; - if (p < end && *p != 'e' && *p != 'E') { - decimal_point_pos = p; - if (!specs.type) { - // Keep only one trailing zero after the decimal point. - ++p; - if (*p == '0') ++p; - while (p != end && *p >= '1' && *p <= '9') ++p; - char* where = p; - while (p != end && *p == '0') ++p; - if (p == end || *p < '0' || *p > '9') { - if (p != end) std::memmove(where, p, to_unsigned(end - p)); - n -= static_cast<unsigned>(p - where); - } - } - } - } - buf.resize(n); - break; // The buffer is large enough - continue with formatting. - } - buf.reserve(n + 1); - } else { - // If result is negative we ask to increase the capacity by at least 1, - // but as std::vector, the buffer grows exponentially. - buf.reserve(buf.capacity() + 1); - } - } - return decimal_point_pos; -} -} // namespace internal - -#if FMT_USE_WINDOWS_H - -FMT_FUNC internal::utf8_to_utf16::utf8_to_utf16(string_view s) { - static const char ERROR_MSG[] = "cannot convert string from UTF-8 to UTF-16"; - if (s.size() > INT_MAX) - FMT_THROW(windows_error(ERROR_INVALID_PARAMETER, ERROR_MSG)); - int s_size = static_cast<int>(s.size()); - if (s_size == 0) { - // MultiByteToWideChar does not support zero length, handle separately. - buffer_.resize(1); - buffer_[0] = 0; - return; - } - - int length = MultiByteToWideChar(CP_UTF8, MB_ERR_INVALID_CHARS, s.data(), - s_size, nullptr, 0); - if (length == 0) FMT_THROW(windows_error(GetLastError(), ERROR_MSG)); - buffer_.resize(length + 1); - length = MultiByteToWideChar(CP_UTF8, MB_ERR_INVALID_CHARS, s.data(), s_size, - &buffer_[0], length); - if (length == 0) FMT_THROW(windows_error(GetLastError(), ERROR_MSG)); - buffer_[length] = 0; -} - -FMT_FUNC internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) { - if (int error_code = convert(s)) { - FMT_THROW(windows_error(error_code, - "cannot convert string from UTF-16 to UTF-8")); - } -} - -FMT_FUNC int internal::utf16_to_utf8::convert(wstring_view s) { - if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER; - int s_size = static_cast<int>(s.size()); - if (s_size == 0) { - // WideCharToMultiByte does not support zero length, handle separately. - buffer_.resize(1); - buffer_[0] = 0; - return 0; - } - - int length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, nullptr, 0, - nullptr, nullptr); - if (length == 0) return GetLastError(); - buffer_.resize(length + 1); - length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, &buffer_[0], - length, nullptr, nullptr); - if (length == 0) return GetLastError(); - buffer_[length] = 0; - return 0; -} - -FMT_FUNC void windows_error::init(int err_code, string_view format_str, - format_args args) { - error_code_ = err_code; - memory_buffer buffer; - internal::format_windows_error(buffer, err_code, vformat(format_str, args)); - std::runtime_error& base = *this; - base = std::runtime_error(to_string(buffer)); -} - -FMT_FUNC void internal::format_windows_error(internal::buffer<char>& out, - int error_code, - string_view message) FMT_NOEXCEPT { - FMT_TRY { - wmemory_buffer buf; - buf.resize(inline_buffer_size); - for (;;) { - wchar_t* system_message = &buf[0]; - int result = FormatMessageW( - FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr, - error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message, - static_cast<uint32_t>(buf.size()), nullptr); - if (result != 0) { - utf16_to_utf8 utf8_message; - if (utf8_message.convert(system_message) == ERROR_SUCCESS) { - internal::writer w(out); - w.write(message); - w.write(": "); - w.write(utf8_message); - return; - } - break; - } - if (GetLastError() != ERROR_INSUFFICIENT_BUFFER) - break; // Can't get error message, report error code instead. - buf.resize(buf.size() * 2); - } - } - FMT_CATCH(...) {} - format_error_code(out, error_code, message); -} - -#endif // FMT_USE_WINDOWS_H - -FMT_FUNC void format_system_error(internal::buffer<char>& out, int error_code, - string_view message) FMT_NOEXCEPT { - FMT_TRY { - memory_buffer buf; - buf.resize(inline_buffer_size); - for (;;) { - char* system_message = &buf[0]; - int result = - internal::safe_strerror(error_code, system_message, buf.size()); - if (result == 0) { - internal::writer w(out); - w.write(message); - w.write(": "); - w.write(system_message); - return; - } - if (result != ERANGE) - break; // Can't get error message, report error code instead. - buf.resize(buf.size() * 2); - } - } - FMT_CATCH(...) {} - format_error_code(out, error_code, message); -} - -FMT_FUNC void internal::error_handler::on_error(const char* message) { - FMT_THROW(format_error(message)); -} - -FMT_FUNC void report_system_error(int error_code, - fmt::string_view message) FMT_NOEXCEPT { - report_error(format_system_error, error_code, message); -} - -#if FMT_USE_WINDOWS_H -FMT_FUNC void report_windows_error(int error_code, - fmt::string_view message) FMT_NOEXCEPT { - report_error(internal::format_windows_error, error_code, message); -} -#endif - -FMT_FUNC void vprint(std::FILE* f, string_view format_str, format_args args) { - memory_buffer buffer; - internal::vformat_to(buffer, format_str, - basic_format_args<buffer_context<char>>(args)); - internal::fwrite_fully(buffer.data(), 1, buffer.size(), f); -} - -FMT_FUNC void vprint(std::FILE* f, wstring_view format_str, wformat_args args) { - wmemory_buffer buffer; - internal::vformat_to(buffer, format_str, args); - buffer.push_back(L'\0'); - if (std::fputws(buffer.data(), f) == -1) { - FMT_THROW(system_error(errno, "cannot write to file")); - } -} - -FMT_FUNC void vprint(string_view format_str, format_args args) { - vprint(stdout, format_str, args); -} - -FMT_FUNC void vprint(wstring_view format_str, wformat_args args) { - vprint(stdout, format_str, args); -} - -FMT_END_NAMESPACE - -#ifdef _MSC_VER -# pragma warning(pop) -#endif - -#endif // FMT_FORMAT_INL_H_ diff --git a/include/vtkdiy2/fmt/format.h b/include/vtkdiy2/fmt/format.h deleted file mode 100644 index dcf4a3998140f748fc7c7a82ef39bebfd32fd1d3..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/fmt/format.h +++ /dev/null @@ -1,3602 +0,0 @@ -/* - Formatting library for C++ - - Copyright (c) 2012 - present, Victor Zverovich - - Permission is hereby granted, free of charge, to any person obtaining - a copy of this software and associated documentation files (the - "Software"), to deal in the Software without restriction, including - without limitation the rights to use, copy, modify, merge, publish, - distribute, sublicense, and/or sell copies of the Software, and to - permit persons to whom the Software is furnished to do so, subject to - the following conditions: - - The above copyright notice and this permission notice shall be - included in all copies or substantial portions of the Software. - - THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, - EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF - MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND - NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE - LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION - OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION - WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - - --- Optional exception to the license --- - - As an exception, if, as a result of your compiling your source code, portions - of this Software are embedded into a machine-executable object form of such - source code, you may redistribute such embedded portions in such object form - without including the above copyright and permission notices. - */ - -#ifndef FMT_FORMAT_H_ -#define FMT_FORMAT_H_ - -#define FMT_HEADER_ONLY // Added by diy for header-only usage - -#include <algorithm> -#include <cassert> -#include <cmath> -#include <cstdint> -#include <cstring> -#include <iterator> -#include <limits> -#include <memory> -#include <stdexcept> - -#include "core.h" - -#ifdef __clang__ -# define FMT_CLANG_VERSION (__clang_major__ * 100 + __clang_minor__) -#else -# define FMT_CLANG_VERSION 0 -#endif - -#ifdef __INTEL_COMPILER -# define FMT_ICC_VERSION __INTEL_COMPILER -#elif defined(__ICL) -# define FMT_ICC_VERSION __ICL -#else -# define FMT_ICC_VERSION 0 -#endif - -#ifdef __NVCC__ -# define FMT_CUDA_VERSION (__CUDACC_VER_MAJOR__ * 100 + __CUDACC_VER_MINOR__) -#else -# define FMT_CUDA_VERSION 0 -#endif - -#ifdef __has_builtin -# define FMT_HAS_BUILTIN(x) __has_builtin(x) -#else -# define FMT_HAS_BUILTIN(x) 0 -#endif - -#ifndef FMT_THROW -# if FMT_EXCEPTIONS -# if FMT_MSC_VER -FMT_BEGIN_NAMESPACE -namespace internal { -template <typename Exception> inline void do_throw(const Exception& x) { - // Silence unreachable code warnings in MSVC because these are nearly - // impossible to fix in a generic code. - volatile bool b = true; - if (b) throw x; -} -} // namespace internal -FMT_END_NAMESPACE -# define FMT_THROW(x) fmt::internal::do_throw(x) -# else -# define FMT_THROW(x) throw x -# endif -# else -# define FMT_THROW(x) \ - do { \ - static_cast<void>(sizeof(x)); \ - assert(false); \ - } while (false) -# endif -#endif - -#ifndef FMT_USE_USER_DEFINED_LITERALS -// For Intel and NVIDIA compilers both they and the system gcc/msc support UDLs. -# if (FMT_HAS_FEATURE(cxx_user_literals) || FMT_GCC_VERSION >= 407 || \ - FMT_MSC_VER >= 1900) && \ - (!(FMT_ICC_VERSION || FMT_CUDA_VERSION) || FMT_ICC_VERSION >= 1500 || \ - FMT_CUDA_VERSION >= 700) -# define FMT_USE_USER_DEFINED_LITERALS 1 -# else -# define FMT_USE_USER_DEFINED_LITERALS 0 -# endif -#endif - -#ifndef FMT_USE_UDL_TEMPLATE -// EDG front end based compilers (icc, nvcc) do not support UDL templates yet -// and GCC 9 warns about them. -# if FMT_USE_USER_DEFINED_LITERALS && FMT_ICC_VERSION == 0 && \ - FMT_CUDA_VERSION == 0 && \ - ((FMT_GCC_VERSION >= 600 && FMT_GCC_VERSION <= 900 && \ - __cplusplus >= 201402L) || \ - FMT_CLANG_VERSION >= 304) -# define FMT_USE_UDL_TEMPLATE 1 -# else -# define FMT_USE_UDL_TEMPLATE 0 -# endif -#endif - -#ifdef FMT_USE_INT128 -// Do nothing. -#elif defined(__SIZEOF_INT128__) -# define FMT_USE_INT128 1 -#else -# define FMT_USE_INT128 0 -#endif - -// __builtin_clz is broken in clang with Microsoft CodeGen: -// https://github.com/fmtlib/fmt/issues/519 -#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clz)) && !FMT_MSC_VER -# define FMT_BUILTIN_CLZ(n) __builtin_clz(n) -#endif -#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clzll)) && !FMT_MSC_VER -# define FMT_BUILTIN_CLZLL(n) __builtin_clzll(n) -#endif - -// Some compilers masquerade as both MSVC and GCC-likes or otherwise support -// __builtin_clz and __builtin_clzll, so only define FMT_BUILTIN_CLZ using the -// MSVC intrinsics if the clz and clzll builtins are not available. -#if FMT_MSC_VER && !defined(FMT_BUILTIN_CLZLL) && !defined(_MANAGED) -# include <intrin.h> // _BitScanReverse, _BitScanReverse64 - -FMT_BEGIN_NAMESPACE -namespace internal { -// Avoid Clang with Microsoft CodeGen's -Wunknown-pragmas warning. -# ifndef __clang__ -# pragma intrinsic(_BitScanReverse) -# endif -inline uint32_t clz(uint32_t x) { - unsigned long r = 0; - _BitScanReverse(&r, x); - - assert(x != 0); - // Static analysis complains about using uninitialized data - // "r", but the only way that can happen is if "x" is 0, - // which the callers guarantee to not happen. -# pragma warning(suppress : 6102) - return 31 - r; -} -# define FMT_BUILTIN_CLZ(n) fmt::internal::clz(n) - -# if defined(_WIN64) && !defined(__clang__) -# pragma intrinsic(_BitScanReverse64) -# endif - -inline uint32_t clzll(uint64_t x) { - unsigned long r = 0; -# ifdef _WIN64 - _BitScanReverse64(&r, x); -# else - // Scan the high 32 bits. - if (_BitScanReverse(&r, static_cast<uint32_t>(x >> 32))) return 63 - (r + 32); - - // Scan the low 32 bits. - _BitScanReverse(&r, static_cast<uint32_t>(x)); -# endif - - assert(x != 0); - // Static analysis complains about using uninitialized data - // "r", but the only way that can happen is if "x" is 0, - // which the callers guarantee to not happen. -# pragma warning(suppress : 6102) - return 63 - r; -} -# define FMT_BUILTIN_CLZLL(n) fmt::internal::clzll(n) -} // namespace internal -FMT_END_NAMESPACE -#endif - -FMT_BEGIN_NAMESPACE -namespace internal { - -// A fallback implementation of uintptr_t for systems that lack it. -struct fallback_uintptr { - unsigned char value[sizeof(void*)]; -}; -#ifdef UINTPTR_MAX -using uintptr_t = ::uintptr_t; -#else -using uintptr_t = fallback_uintptr; -#endif - -// An equivalent of `*reinterpret_cast<Dest*>(&source)` that doesn't produce -// undefined behavior (e.g. due to type aliasing). -// Example: uint64_t d = bit_cast<uint64_t>(2.718); -template <typename Dest, typename Source> -inline Dest bit_cast(const Source& source) { - static_assert(sizeof(Dest) == sizeof(Source), "size mismatch"); - Dest dest; - std::memcpy(&dest, &source, sizeof(dest)); - return dest; -} - -// An approximation of iterator_t for pre-C++20 systems. -template <typename T> -using iterator_t = decltype(std::begin(std::declval<T&>())); - -// Detect the iterator category of *any* given type in a SFINAE-friendly way. -// Unfortunately, older implementations of std::iterator_traits are not safe -// for use in a SFINAE-context. -template <typename It, typename Enable = void> -struct iterator_category : std::false_type {}; - -template <typename T> struct iterator_category<T*> { - using type = std::random_access_iterator_tag; -}; - -template <typename It> -struct iterator_category<It, void_t<typename It::iterator_category>> { - using type = typename It::iterator_category; -}; - -// Detect if *any* given type models the OutputIterator concept. -template <typename It> class is_output_iterator { - // Check for mutability because all iterator categories derived from - // std::input_iterator_tag *may* also meet the requirements of an - // OutputIterator, thereby falling into the category of 'mutable iterators' - // [iterator.requirements.general] clause 4. The compiler reveals this - // property only at the point of *actually dereferencing* the iterator! - template <typename U> - static decltype(*(std::declval<U>())) test(std::input_iterator_tag); - template <typename U> static char& test(std::output_iterator_tag); - template <typename U> static const char& test(...); - - using type = decltype(test<It>(typename iterator_category<It>::type{})); - - public: - static const bool value = !std::is_const<remove_reference_t<type>>::value; -}; - -// A workaround for std::string not having mutable data() until C++17. -template <typename Char> inline Char* get_data(std::basic_string<Char>& s) { - return &s[0]; -} -template <typename Container> -inline typename Container::value_type* get_data(Container& c) { - return c.data(); -} - -#ifdef _SECURE_SCL -// Make a checked iterator to avoid MSVC warnings. -template <typename T> using checked_ptr = stdext::checked_array_iterator<T*>; -template <typename T> checked_ptr<T> make_checked(T* p, std::size_t size) { - return {p, size}; -} -#else -template <typename T> using checked_ptr = T*; -template <typename T> inline T* make_checked(T* p, std::size_t) { return p; } -#endif - -template <typename Container, FMT_ENABLE_IF(is_contiguous<Container>::value)> -inline checked_ptr<typename Container::value_type> reserve( - std::back_insert_iterator<Container>& it, std::size_t n) { - Container& c = get_container(it); - std::size_t size = c.size(); - c.resize(size + n); - return make_checked(get_data(c) + size, n); -} - -template <typename Iterator> -inline Iterator& reserve(Iterator& it, std::size_t) { - return it; -} - -// An output iterator that counts the number of objects written to it and -// discards them. -template <typename T> class counting_iterator { - private: - std::size_t count_; - mutable T blackhole_; - - public: - using iterator_category = std::output_iterator_tag; - using value_type = T; - using difference_type = std::ptrdiff_t; - using pointer = T*; - using reference = T&; - using _Unchecked_type = counting_iterator; // Mark iterator as checked. - - counting_iterator() : count_(0) {} - - std::size_t count() const { return count_; } - - counting_iterator& operator++() { - ++count_; - return *this; - } - - counting_iterator operator++(int) { - auto it = *this; - ++*this; - return it; - } - - T& operator*() const { return blackhole_; } -}; - -template <typename OutputIt> class truncating_iterator_base { - protected: - OutputIt out_; - std::size_t limit_; - std::size_t count_; - - truncating_iterator_base(OutputIt out, std::size_t limit) - : out_(out), limit_(limit), count_(0) {} - - public: - using iterator_category = std::output_iterator_tag; - using difference_type = void; - using pointer = void; - using reference = void; - using _Unchecked_type = - truncating_iterator_base; // Mark iterator as checked. - - OutputIt base() const { return out_; } - std::size_t count() const { return count_; } -}; - -// An output iterator that truncates the output and counts the number of objects -// written to it. -template <typename OutputIt, - typename Enable = typename std::is_void< - typename std::iterator_traits<OutputIt>::value_type>::type> -class truncating_iterator; - -template <typename OutputIt> -class truncating_iterator<OutputIt, std::false_type> - : public truncating_iterator_base<OutputIt> { - using traits = std::iterator_traits<OutputIt>; - - mutable typename traits::value_type blackhole_; - - public: - using value_type = typename traits::value_type; - - truncating_iterator(OutputIt out, std::size_t limit) - : truncating_iterator_base<OutputIt>(out, limit) {} - - truncating_iterator& operator++() { - if (this->count_++ < this->limit_) ++this->out_; - return *this; - } - - truncating_iterator operator++(int) { - auto it = *this; - ++*this; - return it; - } - - value_type& operator*() const { - return this->count_ < this->limit_ ? *this->out_ : blackhole_; - } -}; - -template <typename OutputIt> -class truncating_iterator<OutputIt, std::true_type> - : public truncating_iterator_base<OutputIt> { - public: - using value_type = typename OutputIt::container_type::value_type; - - truncating_iterator(OutputIt out, std::size_t limit) - : truncating_iterator_base<OutputIt>(out, limit) {} - - truncating_iterator& operator=(value_type val) { - if (this->count_++ < this->limit_) this->out_ = val; - return *this; - } - - truncating_iterator& operator++() { return *this; } - truncating_iterator& operator++(int) { return *this; } - truncating_iterator& operator*() { return *this; } -}; - -// A range with the specified output iterator and value type. -template <typename OutputIt, typename T = typename OutputIt::value_type> -class output_range { - private: - OutputIt it_; - - public: - using value_type = T; - using iterator = OutputIt; - struct sentinel {}; - - explicit output_range(OutputIt it) : it_(it) {} - OutputIt begin() const { return it_; } - sentinel end() const { return {}; } // Sentinel is not used yet. -}; - -// A range with an iterator appending to a buffer. -template <typename T> -class buffer_range - : public output_range<std::back_insert_iterator<buffer<T>>, T> { - public: - using iterator = std::back_insert_iterator<buffer<T>>; - using output_range<iterator, T>::output_range; - buffer_range(buffer<T>& buf) - : output_range<iterator, T>(std::back_inserter(buf)) {} -}; - -template <typename Char> -inline size_t count_code_points(basic_string_view<Char> s) { - return s.size(); -} - -// Counts the number of code points in a UTF-8 string. -inline size_t count_code_points(basic_string_view<char8_t> s) { - const char8_t* data = s.data(); - size_t num_code_points = 0; - for (size_t i = 0, size = s.size(); i != size; ++i) { - if ((data[i] & 0xc0) != 0x80) ++num_code_points; - } - return num_code_points; -} - -inline char8_t to_char8_t(char c) { return static_cast<char8_t>(c); } - -template <typename InputIt, typename OutChar> -using needs_conversion = bool_constant< - std::is_same<typename std::iterator_traits<InputIt>::value_type, - char>::value && - std::is_same<OutChar, char8_t>::value>; - -template <typename OutChar, typename InputIt, typename OutputIt, - FMT_ENABLE_IF(!needs_conversion<InputIt, OutChar>::value)> -OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) { - return std::copy(begin, end, it); -} - -template <typename OutChar, typename InputIt, typename OutputIt, - FMT_ENABLE_IF(needs_conversion<InputIt, OutChar>::value)> -OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) { - return std::transform(begin, end, it, to_char8_t); -} - -#ifndef FMT_USE_GRISU -# define FMT_USE_GRISU 0 -#endif - -template <typename T> constexpr bool use_grisu() { - return FMT_USE_GRISU && std::numeric_limits<double>::is_iec559 && - sizeof(T) <= sizeof(double); -} - -template <typename T> -template <typename U> -void buffer<T>::append(const U* begin, const U* end) { - std::size_t new_size = size_ + to_unsigned(end - begin); - reserve(new_size); - std::uninitialized_copy(begin, end, make_checked(ptr_, capacity_) + size_); - size_ = new_size; -} -} // namespace internal - -// A UTF-8 string view. -class u8string_view : public basic_string_view<char8_t> { - public: - u8string_view(const char* s) - : basic_string_view<char8_t>(reinterpret_cast<const char8_t*>(s)) {} - u8string_view(const char* s, size_t count) FMT_NOEXCEPT - : basic_string_view<char8_t>(reinterpret_cast<const char8_t*>(s), count) { - } -}; - -#if FMT_USE_USER_DEFINED_LITERALS -inline namespace literals { -inline u8string_view operator"" _u(const char* s, std::size_t n) { - return {s, n}; -} -} // namespace literals -#endif - -// The number of characters to store in the basic_memory_buffer object itself -// to avoid dynamic memory allocation. -enum { inline_buffer_size = 500 }; - -/** - \rst - A dynamically growing memory buffer for trivially copyable/constructible types - with the first ``SIZE`` elements stored in the object itself. - - You can use one of the following type aliases for common character types: - - +----------------+------------------------------+ - | Type | Definition | - +================+==============================+ - | memory_buffer | basic_memory_buffer<char> | - +----------------+------------------------------+ - | wmemory_buffer | basic_memory_buffer<wchar_t> | - +----------------+------------------------------+ - - **Example**:: - - fmt::memory_buffer out; - format_to(out, "The answer is {}.", 42); - - This will append the following output to the ``out`` object: - - .. code-block:: none - - The answer is 42. - - The output can be converted to an ``std::string`` with ``to_string(out)``. - \endrst - */ -template <typename T, std::size_t SIZE = inline_buffer_size, - typename Allocator = std::allocator<T>> -class basic_memory_buffer : private Allocator, public internal::buffer<T> { - private: - T store_[SIZE]; - - // Deallocate memory allocated by the buffer. - void deallocate() { - T* data = this->data(); - if (data != store_) Allocator::deallocate(data, this->capacity()); - } - - protected: - void grow(std::size_t size) FMT_OVERRIDE; - - public: - using value_type = T; - using const_reference = const T&; - - explicit basic_memory_buffer(const Allocator& alloc = Allocator()) - : Allocator(alloc) { - this->set(store_, SIZE); - } - ~basic_memory_buffer() { deallocate(); } - - private: - // Move data from other to this buffer. - void move(basic_memory_buffer& other) { - Allocator &this_alloc = *this, &other_alloc = other; - this_alloc = std::move(other_alloc); - T* data = other.data(); - std::size_t size = other.size(), capacity = other.capacity(); - if (data == other.store_) { - this->set(store_, capacity); - std::uninitialized_copy(other.store_, other.store_ + size, - internal::make_checked(store_, capacity)); - } else { - this->set(data, capacity); - // Set pointer to the inline array so that delete is not called - // when deallocating. - other.set(other.store_, 0); - } - this->resize(size); - } - - public: - /** - \rst - Constructs a :class:`fmt::basic_memory_buffer` object moving the content - of the other object to it. - \endrst - */ - basic_memory_buffer(basic_memory_buffer&& other) { move(other); } - - /** - \rst - Moves the content of the other ``basic_memory_buffer`` object to this one. - \endrst - */ - basic_memory_buffer& operator=(basic_memory_buffer&& other) { - assert(this != &other); - deallocate(); - move(other); - return *this; - } - - // Returns a copy of the allocator associated with this buffer. - Allocator get_allocator() const { return *this; } -}; - -template <typename T, std::size_t SIZE, typename Allocator> -void basic_memory_buffer<T, SIZE, Allocator>::grow(std::size_t size) { -#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION - if (size > 1000) throw std::runtime_error("fuzz mode - won't grow that much"); -#endif - std::size_t old_capacity = this->capacity(); - std::size_t new_capacity = old_capacity + old_capacity / 2; - if (size > new_capacity) new_capacity = size; - T* old_data = this->data(); - T* new_data = std::allocator_traits<Allocator>::allocate(*this, new_capacity); - // The following code doesn't throw, so the raw pointer above doesn't leak. - std::uninitialized_copy(old_data, old_data + this->size(), - internal::make_checked(new_data, new_capacity)); - this->set(new_data, new_capacity); - // deallocate must not throw according to the standard, but even if it does, - // the buffer already uses the new storage and will deallocate it in - // destructor. - if (old_data != store_) Allocator::deallocate(old_data, old_capacity); -} - -using memory_buffer = basic_memory_buffer<char>; -using wmemory_buffer = basic_memory_buffer<wchar_t>; - -/** A formatting error such as invalid format string. */ -class FMT_API format_error : public std::runtime_error { - public: - explicit format_error(const char* message) : std::runtime_error(message) {} - explicit format_error(const std::string& message) - : std::runtime_error(message) {} - ~format_error() FMT_NOEXCEPT; -}; - -namespace internal { - -// Returns true if value is negative, false otherwise. -// Same as `value < 0` but doesn't produce warnings if T is an unsigned type. -template <typename T, FMT_ENABLE_IF(std::numeric_limits<T>::is_signed)> -FMT_CONSTEXPR bool is_negative(T value) { - return value < 0; -} -template <typename T, FMT_ENABLE_IF(!std::numeric_limits<T>::is_signed)> -FMT_CONSTEXPR bool is_negative(T) { - return false; -} - -// Smallest of uint32_t and uint64_t that is large enough to represent all -// values of T. -template <typename T> -using uint32_or_64_t = - conditional_t<std::numeric_limits<T>::digits <= 32, uint32_t, uint64_t>; - -// Static data is placed in this class template for the header-only config. -template <typename T = void> struct FMT_EXTERN_TEMPLATE_API basic_data { - static const uint64_t powers_of_10_64[]; - static const uint32_t zero_or_powers_of_10_32[]; - static const uint64_t zero_or_powers_of_10_64[]; - static const uint64_t pow10_significands[]; - static const int16_t pow10_exponents[]; - static const char digits[]; - static const char hex_digits[]; - static const char foreground_color[]; - static const char background_color[]; - static const char reset_color[5]; - static const wchar_t wreset_color[5]; -}; - -FMT_EXTERN template struct basic_data<void>; - -// This is a struct rather than an alias to avoid shadowing warnings in gcc. -struct data : basic_data<> {}; - -#ifdef FMT_BUILTIN_CLZLL -// Returns the number of decimal digits in n. Leading zeros are not counted -// except for n == 0 in which case count_digits returns 1. -inline int count_digits(uint64_t n) { - // Based on http://graphics.stanford.edu/~seander/bithacks.html#IntegerLog10 - // and the benchmark https://github.com/localvoid/cxx-benchmark-count-digits. - int t = (64 - FMT_BUILTIN_CLZLL(n | 1)) * 1233 >> 12; - return t - (n < data::zero_or_powers_of_10_64[t]) + 1; -} -#else -// Fallback version of count_digits used when __builtin_clz is not available. -inline int count_digits(uint64_t n) { - int count = 1; - for (;;) { - // Integer division is slow so do it for a group of four digits instead - // of for every digit. The idea comes from the talk by Alexandrescu - // "Three Optimization Tips for C++". See speed-test for a comparison. - if (n < 10) return count; - if (n < 100) return count + 1; - if (n < 1000) return count + 2; - if (n < 10000) return count + 3; - n /= 10000u; - count += 4; - } -} -#endif - -// Counts the number of digits in n. BITS = log2(radix). -template <unsigned BITS, typename UInt> inline int count_digits(UInt n) { - int num_digits = 0; - do { - ++num_digits; - } while ((n >>= BITS) != 0); - return num_digits; -} - -template <> int count_digits<4>(internal::fallback_uintptr n); - -#if FMT_HAS_CPP_ATTRIBUTE(always_inline) -# define FMT_ALWAYS_INLINE __attribute__((always_inline)) -#else -# define FMT_ALWAYS_INLINE -#endif - -template <typename Handler> -inline char* lg(uint32_t n, Handler h) FMT_ALWAYS_INLINE; - -// Computes g = floor(log10(n)) and calls h.on<g>(n); -template <typename Handler> inline char* lg(uint32_t n, Handler h) { - return n < 100 ? n < 10 ? h.template on<0>(n) : h.template on<1>(n) - : n < 1000000 - ? n < 10000 ? n < 1000 ? h.template on<2>(n) - : h.template on<3>(n) - : n < 100000 ? h.template on<4>(n) - : h.template on<5>(n) - : n < 100000000 ? n < 10000000 ? h.template on<6>(n) - : h.template on<7>(n) - : n < 1000000000 ? h.template on<8>(n) - : h.template on<9>(n); -} - -// An lg handler that formats a decimal number. -// Usage: lg(n, decimal_formatter(buffer)); -class decimal_formatter { - private: - char* buffer_; - - void write_pair(unsigned N, uint32_t index) { - std::memcpy(buffer_ + N, data::digits + index * 2, 2); - } - - public: - explicit decimal_formatter(char* buf) : buffer_(buf) {} - - template <unsigned N> char* on(uint32_t u) { - if (N == 0) { - *buffer_ = static_cast<char>(u) + '0'; - } else if (N == 1) { - write_pair(0, u); - } else { - // The idea of using 4.32 fixed-point numbers is based on - // https://github.com/jeaiii/itoa - unsigned n = N - 1; - unsigned a = n / 5 * n * 53 / 16; - uint64_t t = - ((1ULL << (32 + a)) / data::zero_or_powers_of_10_32[n] + 1 - n / 9); - t = ((t * u) >> a) + n / 5 * 4; - write_pair(0, t >> 32); - for (unsigned i = 2; i < N; i += 2) { - t = 100ULL * static_cast<uint32_t>(t); - write_pair(i, t >> 32); - } - if (N % 2 == 0) { - buffer_[N] = - static_cast<char>((10ULL * static_cast<uint32_t>(t)) >> 32) + '0'; - } - } - return buffer_ += N + 1; - } -}; - -#ifdef FMT_BUILTIN_CLZ -// Optional version of count_digits for better performance on 32-bit platforms. -inline int count_digits(uint32_t n) { - int t = (32 - FMT_BUILTIN_CLZ(n | 1)) * 1233 >> 12; - return t - (n < data::zero_or_powers_of_10_32[t]) + 1; -} -#endif - -template <typename Char> FMT_API Char thousands_sep_impl(locale_ref loc); -template <typename Char> inline Char thousands_sep(locale_ref loc) { - return Char(thousands_sep_impl<char>(loc)); -} -template <> inline wchar_t thousands_sep(locale_ref loc) { - return thousands_sep_impl<wchar_t>(loc); -} - -template <typename Char> FMT_API Char decimal_point_impl(locale_ref loc); -template <typename Char> inline Char decimal_point(locale_ref loc) { - return Char(decimal_point_impl<char>(loc)); -} -template <> inline wchar_t decimal_point(locale_ref loc) { - return decimal_point_impl<wchar_t>(loc); -} - -// Formats a decimal unsigned integer value writing into buffer. -// add_thousands_sep is called after writing each char to add a thousands -// separator if necessary. -template <typename UInt, typename Char, typename F> -inline Char* format_decimal(Char* buffer, UInt value, int num_digits, - F add_thousands_sep) { - FMT_ASSERT(num_digits >= 0, "invalid digit count"); - buffer += num_digits; - Char* end = buffer; - while (value >= 100) { - // Integer division is slow so do it for a group of two digits instead - // of for every digit. The idea comes from the talk by Alexandrescu - // "Three Optimization Tips for C++". See speed-test for a comparison. - unsigned index = static_cast<unsigned>((value % 100) * 2); - value /= 100; - *--buffer = static_cast<Char>(data::digits[index + 1]); - add_thousands_sep(buffer); - *--buffer = static_cast<Char>(data::digits[index]); - add_thousands_sep(buffer); - } - if (value < 10) { - *--buffer = static_cast<Char>('0' + value); - return end; - } - unsigned index = static_cast<unsigned>(value * 2); - *--buffer = static_cast<Char>(data::digits[index + 1]); - add_thousands_sep(buffer); - *--buffer = static_cast<Char>(data::digits[index]); - return end; -} - -template <typename Char, typename UInt, typename Iterator, typename F> -inline Iterator format_decimal(Iterator out, UInt value, int num_digits, - F add_thousands_sep) { - FMT_ASSERT(num_digits >= 0, "invalid digit count"); - // Buffer should be large enough to hold all digits (<= digits10 + 1). - enum { max_size = std::numeric_limits<UInt>::digits10 + 1 }; - Char buffer[max_size + max_size / 3]; - auto end = format_decimal(buffer, value, num_digits, add_thousands_sep); - return internal::copy_str<Char>(buffer, end, out); -} - -template <typename Char, typename It, typename UInt> -inline It format_decimal(It out, UInt value, int num_digits) { - return format_decimal<Char>(out, value, num_digits, [](Char*) {}); -} - -template <unsigned BASE_BITS, typename Char, typename UInt> -inline Char* format_uint(Char* buffer, UInt value, int num_digits, - bool upper = false) { - buffer += num_digits; - Char* end = buffer; - do { - const char* digits = upper ? "0123456789ABCDEF" : data::hex_digits; - unsigned digit = (value & ((1 << BASE_BITS) - 1)); - *--buffer = static_cast<Char>(BASE_BITS < 4 ? static_cast<char>('0' + digit) - : digits[digit]); - } while ((value >>= BASE_BITS) != 0); - return end; -} - -template <unsigned BASE_BITS, typename Char> -Char* format_uint(Char* buffer, internal::fallback_uintptr n, int num_digits, - bool = false) { - auto char_digits = std::numeric_limits<unsigned char>::digits / 4; - int start = (num_digits + char_digits - 1) / char_digits - 1; - if (int start_digits = num_digits % char_digits) { - unsigned value = n.value[start--]; - buffer = format_uint<BASE_BITS>(buffer, value, start_digits); - } - for (; start >= 0; --start) { - unsigned value = n.value[start]; - buffer += char_digits; - auto p = buffer; - for (int i = 0; i < char_digits; ++i) { - unsigned digit = (value & ((1 << BASE_BITS) - 1)); - *--p = static_cast<Char>(data::hex_digits[digit]); - value >>= BASE_BITS; - } - } - return buffer; -} - -template <unsigned BASE_BITS, typename Char, typename It, typename UInt> -inline It format_uint(It out, UInt value, int num_digits, bool upper = false) { - // Buffer should be large enough to hold all digits (digits / BASE_BITS + 1). - char buffer[std::numeric_limits<UInt>::digits / BASE_BITS + 1]; - format_uint<BASE_BITS>(buffer, value, num_digits, upper); - return internal::copy_str<Char>(buffer, buffer + num_digits, out); -} - -#ifndef _WIN32 -# define FMT_USE_WINDOWS_H 0 -#elif !defined(FMT_USE_WINDOWS_H) -# define FMT_USE_WINDOWS_H 1 -#endif - -// Define FMT_USE_WINDOWS_H to 0 to disable use of windows.h. -// All the functionality that relies on it will be disabled too. -#if FMT_USE_WINDOWS_H -// A converter from UTF-8 to UTF-16. -// It is only provided for Windows since other systems support UTF-8 natively. -class utf8_to_utf16 { - private: - wmemory_buffer buffer_; - - public: - FMT_API explicit utf8_to_utf16(string_view s); - operator wstring_view() const { return wstring_view(&buffer_[0], size()); } - size_t size() const { return buffer_.size() - 1; } - const wchar_t* c_str() const { return &buffer_[0]; } - std::wstring str() const { return std::wstring(&buffer_[0], size()); } -}; - -// A converter from UTF-16 to UTF-8. -// It is only provided for Windows since other systems support UTF-8 natively. -class utf16_to_utf8 { - private: - memory_buffer buffer_; - - public: - utf16_to_utf8() {} - FMT_API explicit utf16_to_utf8(wstring_view s); - operator string_view() const { return string_view(&buffer_[0], size()); } - size_t size() const { return buffer_.size() - 1; } - const char* c_str() const { return &buffer_[0]; } - std::string str() const { return std::string(&buffer_[0], size()); } - - // Performs conversion returning a system error code instead of - // throwing exception on conversion error. This method may still throw - // in case of memory allocation error. - FMT_API int convert(wstring_view s); -}; - -FMT_API void format_windows_error(fmt::internal::buffer<char>& out, - int error_code, - fmt::string_view message) FMT_NOEXCEPT; -#endif - -template <typename T = void> struct null {}; - -// Workaround an array initialization issue in gcc 4.8. -template <typename Char> struct fill_t { - private: - Char data_[6]; - - public: - FMT_CONSTEXPR Char& operator[](size_t index) { return data_[index]; } - FMT_CONSTEXPR const Char& operator[](size_t index) const { - return data_[index]; - } - - static FMT_CONSTEXPR fill_t<Char> make() { - auto fill = fill_t<Char>(); - fill[0] = Char(' '); - return fill; - } -}; -} // namespace internal - -// We cannot use enum classes as bit fields because of a gcc bug -// https://gcc.gnu.org/bugzilla/show_bug.cgi?id=61414. -namespace align { -enum type { none, left, right, center, numeric }; -} -using align_t = align::type; - -namespace sign { -enum type { none, minus, plus, space }; -} -using sign_t = sign::type; - -// Format specifiers for built-in and string types. -template <typename Char> struct basic_format_specs { - int width; - int precision; - char type; - align_t align : 4; - sign_t sign : 3; - bool alt : 1; // Alternate form ('#'). - internal::fill_t<Char> fill; - - constexpr basic_format_specs() - : width(0), - precision(-1), - type(0), - align(align::none), - sign(sign::none), - alt(false), - fill(internal::fill_t<Char>::make()) {} -}; - -using format_specs = basic_format_specs<char>; - -namespace internal { - -// Writes the exponent exp in the form "[+-]d{2,3}" to buffer. -template <typename Char, typename It> It write_exponent(int exp, It it) { - FMT_ASSERT(-1000 < exp && exp < 1000, "exponent out of range"); - if (exp < 0) { - *it++ = static_cast<Char>('-'); - exp = -exp; - } else { - *it++ = static_cast<Char>('+'); - } - if (exp >= 100) { - *it++ = static_cast<Char>(static_cast<char>('0' + exp / 100)); - exp %= 100; - } - const char* d = data::digits + exp * 2; - *it++ = static_cast<Char>(d[0]); - *it++ = static_cast<Char>(d[1]); - return it; -} - -struct gen_digits_params { - int num_digits; - bool fixed; - bool upper; - bool trailing_zeros; -}; - -// The number is given as v = digits * pow(10, exp). -template <typename Char, typename It> -It grisu_prettify(const char* digits, int size, int exp, It it, - gen_digits_params params, Char decimal_point) { - // pow(10, full_exp - 1) <= v <= pow(10, full_exp). - int full_exp = size + exp; - if (!params.fixed) { - // Insert a decimal point after the first digit and add an exponent. - *it++ = static_cast<Char>(*digits); - if (size > 1) *it++ = decimal_point; - exp += size - 1; - it = copy_str<Char>(digits + 1, digits + size, it); - if (size < params.num_digits) - it = std::fill_n(it, params.num_digits - size, static_cast<Char>('0')); - *it++ = static_cast<Char>(params.upper ? 'E' : 'e'); - return write_exponent<Char>(exp, it); - } - if (size <= full_exp) { - // 1234e7 -> 12340000000[.0+] - it = copy_str<Char>(digits, digits + size, it); - it = std::fill_n(it, full_exp - size, static_cast<Char>('0')); - int num_zeros = (std::max)(params.num_digits - full_exp, 1); - if (params.trailing_zeros) { - *it++ = decimal_point; -#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION - if (num_zeros > 1000) - throw std::runtime_error("fuzz mode - avoiding excessive cpu use"); -#endif - it = std::fill_n(it, num_zeros, static_cast<Char>('0')); - } - } else if (full_exp > 0) { - // 1234e-2 -> 12.34[0+] - it = copy_str<Char>(digits, digits + full_exp, it); - if (!params.trailing_zeros) { - // Remove trailing zeros. - while (size > full_exp && digits[size - 1] == '0') --size; - if (size != full_exp) *it++ = decimal_point; - return copy_str<Char>(digits + full_exp, digits + size, it); - } - *it++ = decimal_point; - it = copy_str<Char>(digits + full_exp, digits + size, it); - if (params.num_digits > size) { - // Add trailing zeros. - int num_zeros = params.num_digits - size; - it = std::fill_n(it, num_zeros, static_cast<Char>('0')); - } - } else { - // 1234e-6 -> 0.001234 - *it++ = static_cast<Char>('0'); - int num_zeros = -full_exp; - if (params.num_digits >= 0 && params.num_digits < num_zeros) - num_zeros = params.num_digits; - if (!params.trailing_zeros) - while (size > 0 && digits[size - 1] == '0') --size; - if (num_zeros != 0 || size != 0) { - *it++ = decimal_point; - it = std::fill_n(it, num_zeros, static_cast<Char>('0')); - it = copy_str<Char>(digits, digits + size, it); - } - } - return it; -} - -namespace grisu_options { -enum { fixed = 1, grisu3 = 2 }; -} - -// Formats value using the Grisu algorithm: -// https://www.cs.tufts.edu/~nr/cs257/archive/florian-loitsch/printf.pdf -template <typename Double, FMT_ENABLE_IF(sizeof(Double) == sizeof(uint64_t))> -FMT_API bool grisu_format(Double, buffer<char>&, int, unsigned, int&); -template <typename Double, FMT_ENABLE_IF(sizeof(Double) != sizeof(uint64_t))> -inline bool grisu_format(Double, buffer<char>&, int, unsigned, int&) { - return false; -} - -struct sprintf_specs { - int precision; - char type; - bool alt : 1; - - template <typename Char> - constexpr sprintf_specs(basic_format_specs<Char> specs) - : precision(specs.precision), type(specs.type), alt(specs.alt) {} - - constexpr bool has_precision() const { return precision >= 0; } -}; - -template <typename Double> -char* sprintf_format(Double, internal::buffer<char>&, sprintf_specs); - -template <typename Handler> -FMT_CONSTEXPR void handle_int_type_spec(char spec, Handler&& handler) { - switch (spec) { - case 0: - case 'd': - handler.on_dec(); - break; - case 'x': - case 'X': - handler.on_hex(); - break; - case 'b': - case 'B': - handler.on_bin(); - break; - case 'o': - handler.on_oct(); - break; - case 'n': - handler.on_num(); - break; - default: - handler.on_error(); - } -} - -template <typename Handler> -FMT_CONSTEXPR void handle_float_type_spec(char spec, Handler&& handler) { - switch (spec) { - case 0: - case 'g': - case 'G': - handler.on_general(); - break; - case 'e': - case 'E': - handler.on_exp(); - break; - case 'f': - case 'F': - handler.on_fixed(); - break; - case '%': - handler.on_percent(); - break; - case 'a': - case 'A': - handler.on_hex(); - break; - case 'n': - handler.on_num(); - break; - default: - handler.on_error(); - break; - } -} - -template <typename Char, typename Handler> -FMT_CONSTEXPR void handle_char_specs(const basic_format_specs<Char>* specs, - Handler&& handler) { - if (!specs) return handler.on_char(); - if (specs->type && specs->type != 'c') return handler.on_int(); - if (specs->align == align::numeric || specs->sign != sign::none || specs->alt) - handler.on_error("invalid format specifier for char"); - handler.on_char(); -} - -template <typename Char, typename Handler> -FMT_CONSTEXPR void handle_cstring_type_spec(Char spec, Handler&& handler) { - if (spec == 0 || spec == 's') - handler.on_string(); - else if (spec == 'p') - handler.on_pointer(); - else - handler.on_error("invalid type specifier"); -} - -template <typename Char, typename ErrorHandler> -FMT_CONSTEXPR void check_string_type_spec(Char spec, ErrorHandler&& eh) { - if (spec != 0 && spec != 's') eh.on_error("invalid type specifier"); -} - -template <typename Char, typename ErrorHandler> -FMT_CONSTEXPR void check_pointer_type_spec(Char spec, ErrorHandler&& eh) { - if (spec != 0 && spec != 'p') eh.on_error("invalid type specifier"); -} - -template <typename ErrorHandler> class int_type_checker : private ErrorHandler { - public: - FMT_CONSTEXPR explicit int_type_checker(ErrorHandler eh) : ErrorHandler(eh) {} - - FMT_CONSTEXPR void on_dec() {} - FMT_CONSTEXPR void on_hex() {} - FMT_CONSTEXPR void on_bin() {} - FMT_CONSTEXPR void on_oct() {} - FMT_CONSTEXPR void on_num() {} - - FMT_CONSTEXPR void on_error() { - ErrorHandler::on_error("invalid type specifier"); - } -}; - -template <typename ErrorHandler> -class float_type_checker : private ErrorHandler { - public: - FMT_CONSTEXPR explicit float_type_checker(ErrorHandler eh) - : ErrorHandler(eh) {} - - FMT_CONSTEXPR void on_general() {} - FMT_CONSTEXPR void on_exp() {} - FMT_CONSTEXPR void on_fixed() {} - FMT_CONSTEXPR void on_percent() {} - FMT_CONSTEXPR void on_hex() {} - FMT_CONSTEXPR void on_num() {} - - FMT_CONSTEXPR void on_error() { - ErrorHandler::on_error("invalid type specifier"); - } -}; - -template <typename ErrorHandler> -class char_specs_checker : public ErrorHandler { - private: - char type_; - - public: - FMT_CONSTEXPR char_specs_checker(char type, ErrorHandler eh) - : ErrorHandler(eh), type_(type) {} - - FMT_CONSTEXPR void on_int() { - handle_int_type_spec(type_, int_type_checker<ErrorHandler>(*this)); - } - FMT_CONSTEXPR void on_char() {} -}; - -template <typename ErrorHandler> -class cstring_type_checker : public ErrorHandler { - public: - FMT_CONSTEXPR explicit cstring_type_checker(ErrorHandler eh) - : ErrorHandler(eh) {} - - FMT_CONSTEXPR void on_string() {} - FMT_CONSTEXPR void on_pointer() {} -}; - -template <typename Context> -void arg_map<Context>::init(const basic_format_args<Context>& args) { - if (map_) return; - map_ = new entry[internal::to_unsigned(args.max_size())]; - if (args.is_packed()) { - for (int i = 0;; ++i) { - internal::type arg_type = args.type(i); - if (arg_type == internal::none_type) return; - if (arg_type == internal::named_arg_type) push_back(args.values_[i]); - } - } - for (int i = 0, n = args.max_size(); i < n; ++i) { - auto type = args.args_[i].type_; - if (type == internal::named_arg_type) push_back(args.args_[i].value_); - } -} - -// This template provides operations for formatting and writing data into a -// character range. -template <typename Range> class basic_writer { - public: - using char_type = typename Range::value_type; - using iterator = typename Range::iterator; - using format_specs = basic_format_specs<char_type>; - - private: - iterator out_; // Output iterator. - internal::locale_ref locale_; - - // Attempts to reserve space for n extra characters in the output range. - // Returns a pointer to the reserved range or a reference to out_. - auto reserve(std::size_t n) -> decltype(internal::reserve(out_, n)) { - return internal::reserve(out_, n); - } - - template <typename F> struct padded_int_writer { - size_t size_; - string_view prefix; - char_type fill; - std::size_t padding; - F f; - - size_t size() const { return size_; } - size_t width() const { return size_; } - - template <typename It> void operator()(It&& it) const { - if (prefix.size() != 0) - it = internal::copy_str<char_type>(prefix.begin(), prefix.end(), it); - it = std::fill_n(it, padding, fill); - f(it); - } - }; - - // Writes an integer in the format - // <left-padding><prefix><numeric-padding><digits><right-padding> - // where <digits> are written by f(it). - template <typename F> - void write_int(int num_digits, string_view prefix, format_specs specs, F f) { - std::size_t size = prefix.size() + internal::to_unsigned(num_digits); - char_type fill = specs.fill[0]; - std::size_t padding = 0; - if (specs.align == align::numeric) { - auto unsiged_width = internal::to_unsigned(specs.width); - if (unsiged_width > size) { - padding = unsiged_width - size; - size = unsiged_width; - } - } else if (specs.precision > num_digits) { - size = prefix.size() + internal::to_unsigned(specs.precision); - padding = internal::to_unsigned(specs.precision - num_digits); - fill = static_cast<char_type>('0'); - } - if (specs.align == align::none) specs.align = align::right; - write_padded(specs, padded_int_writer<F>{size, prefix, fill, padding, f}); - } - - // Writes a decimal integer. - template <typename Int> void write_decimal(Int value) { - auto abs_value = static_cast<uint32_or_64_t<Int>>(value); - bool is_negative = internal::is_negative(value); - if (is_negative) abs_value = 0 - abs_value; - int num_digits = internal::count_digits(abs_value); - auto&& it = - reserve((is_negative ? 1 : 0) + static_cast<size_t>(num_digits)); - if (is_negative) *it++ = static_cast<char_type>('-'); - it = internal::format_decimal<char_type>(it, abs_value, num_digits); - } - - // The handle_int_type_spec handler that writes an integer. - template <typename Int, typename Specs> struct int_writer { - using unsigned_type = uint32_or_64_t<Int>; - - basic_writer<Range>& writer; - const Specs& specs; - unsigned_type abs_value; - char prefix[4]; - unsigned prefix_size; - - string_view get_prefix() const { return string_view(prefix, prefix_size); } - - int_writer(basic_writer<Range>& w, Int value, const Specs& s) - : writer(w), - specs(s), - abs_value(static_cast<unsigned_type>(value)), - prefix_size(0) { - if (internal::is_negative(value)) { - prefix[0] = '-'; - ++prefix_size; - abs_value = 0 - abs_value; - } else if (specs.sign != sign::none && specs.sign != sign::minus) { - prefix[0] = specs.sign == sign::plus ? '+' : ' '; - ++prefix_size; - } - } - - struct dec_writer { - unsigned_type abs_value; - int num_digits; - - template <typename It> void operator()(It&& it) const { - it = internal::format_decimal<char_type>(it, abs_value, num_digits); - } - }; - - void on_dec() { - int num_digits = internal::count_digits(abs_value); - writer.write_int(num_digits, get_prefix(), specs, - dec_writer{abs_value, num_digits}); - } - - struct hex_writer { - int_writer& self; - int num_digits; - - template <typename It> void operator()(It&& it) const { - it = internal::format_uint<4, char_type>(it, self.abs_value, num_digits, - self.specs.type != 'x'); - } - }; - - void on_hex() { - if (specs.alt) { - prefix[prefix_size++] = '0'; - prefix[prefix_size++] = specs.type; - } - int num_digits = internal::count_digits<4>(abs_value); - writer.write_int(num_digits, get_prefix(), specs, - hex_writer{*this, num_digits}); - } - - template <int BITS> struct bin_writer { - unsigned_type abs_value; - int num_digits; - - template <typename It> void operator()(It&& it) const { - it = internal::format_uint<BITS, char_type>(it, abs_value, num_digits); - } - }; - - void on_bin() { - if (specs.alt) { - prefix[prefix_size++] = '0'; - prefix[prefix_size++] = static_cast<char>(specs.type); - } - int num_digits = internal::count_digits<1>(abs_value); - writer.write_int(num_digits, get_prefix(), specs, - bin_writer<1>{abs_value, num_digits}); - } - - void on_oct() { - int num_digits = internal::count_digits<3>(abs_value); - if (specs.alt && specs.precision <= num_digits) { - // Octal prefix '0' is counted as a digit, so only add it if precision - // is not greater than the number of digits. - prefix[prefix_size++] = '0'; - } - writer.write_int(num_digits, get_prefix(), specs, - bin_writer<3>{abs_value, num_digits}); - } - - enum { sep_size = 1 }; - - struct num_writer { - unsigned_type abs_value; - int size; - char_type sep; - - template <typename It> void operator()(It&& it) const { - basic_string_view<char_type> s(&sep, sep_size); - // Index of a decimal digit with the least significant digit having - // index 0. - unsigned digit_index = 0; - it = internal::format_decimal<char_type>( - it, abs_value, size, [s, &digit_index](char_type*& buffer) { - if (++digit_index % 3 != 0) return; - buffer -= s.size(); - std::uninitialized_copy(s.data(), s.data() + s.size(), - internal::make_checked(buffer, s.size())); - }); - } - }; - - void on_num() { - char_type sep = internal::thousands_sep<char_type>(writer.locale_); - if (!sep) return on_dec(); - int num_digits = internal::count_digits(abs_value); - int size = num_digits + sep_size * ((num_digits - 1) / 3); - writer.write_int(size, get_prefix(), specs, - num_writer{abs_value, size, sep}); - } - - FMT_NORETURN void on_error() { - FMT_THROW(format_error("invalid type specifier")); - } - }; - - enum { inf_size = 3 }; // This is an enum to workaround a bug in MSVC. - - struct inf_or_nan_writer { - char sign; - bool as_percentage; - const char* str; - - size_t size() const { - return static_cast<std::size_t>(inf_size + (sign ? 1 : 0) + - (as_percentage ? 1 : 0)); - } - size_t width() const { return size(); } - - template <typename It> void operator()(It&& it) const { - if (sign) *it++ = static_cast<char_type>(sign); - it = internal::copy_str<char_type>( - str, str + static_cast<std::size_t>(inf_size), it); - if (as_percentage) *it++ = static_cast<char_type>('%'); - } - }; - - struct double_writer { - char sign; - internal::buffer<char>& buffer; - char* decimal_point_pos; - char_type decimal_point; - - size_t size() const { return buffer.size() + (sign ? 1 : 0); } - size_t width() const { return size(); } - - template <typename It> void operator()(It&& it) { - if (sign) *it++ = static_cast<char_type>(sign); - auto begin = buffer.begin(); - if (decimal_point_pos) { - it = internal::copy_str<char_type>(begin, decimal_point_pos, it); - *it++ = decimal_point; - begin = decimal_point_pos + 1; - } - it = internal::copy_str<char_type>(begin, buffer.end(), it); - } - }; - - class grisu_writer { - private: - internal::buffer<char>& digits_; - size_t size_; - char sign_; - int exp_; - internal::gen_digits_params params_; - char_type decimal_point_; - - public: - grisu_writer(char sign, internal::buffer<char>& digits, int exp, - const internal::gen_digits_params& params, - char_type decimal_point) - : digits_(digits), - sign_(sign), - exp_(exp), - params_(params), - decimal_point_(decimal_point) { - int num_digits = static_cast<int>(digits.size()); - int full_exp = num_digits + exp - 1; - int precision = params.num_digits > 0 ? params.num_digits : 11; - params_.fixed |= full_exp >= -4 && full_exp < precision; - auto it = internal::grisu_prettify<char>( - digits.data(), num_digits, exp, internal::counting_iterator<char>(), - params_, '.'); - size_ = it.count(); - } - - size_t size() const { return size_ + (sign_ ? 1 : 0); } - size_t width() const { return size(); } - - template <typename It> void operator()(It&& it) { - if (sign_) *it++ = static_cast<char_type>(sign_); - int num_digits = static_cast<int>(digits_.size()); - it = internal::grisu_prettify<char_type>(digits_.data(), num_digits, exp_, - it, params_, decimal_point_); - } - }; - - template <typename Char> struct str_writer { - const Char* s; - size_t size_; - - size_t size() const { return size_; } - size_t width() const { - return internal::count_code_points(basic_string_view<Char>(s, size_)); - } - - template <typename It> void operator()(It&& it) const { - it = internal::copy_str<char_type>(s, s + size_, it); - } - }; - - template <typename UIntPtr> struct pointer_writer { - UIntPtr value; - int num_digits; - - size_t size() const { return to_unsigned(num_digits) + 2; } - size_t width() const { return size(); } - - template <typename It> void operator()(It&& it) const { - *it++ = static_cast<char_type>('0'); - *it++ = static_cast<char_type>('x'); - it = internal::format_uint<4, char_type>(it, value, num_digits); - } - }; - - public: - /** Constructs a ``basic_writer`` object. */ - explicit basic_writer(Range out, - internal::locale_ref loc = internal::locale_ref()) - : out_(out.begin()), locale_(loc) {} - - iterator out() const { return out_; } - - // Writes a value in the format - // <left-padding><value><right-padding> - // where <value> is written by f(it). - template <typename F> void write_padded(const format_specs& specs, F&& f) { - // User-perceived width (in code points). - unsigned width = to_unsigned(specs.width); - size_t size = f.size(); // The number of code units. - size_t num_code_points = width != 0 ? f.width() : size; - if (width <= num_code_points) return f(reserve(size)); - auto&& it = reserve(width + (size - num_code_points)); - char_type fill = specs.fill[0]; - std::size_t padding = width - num_code_points; - if (specs.align == align::right) { - it = std::fill_n(it, padding, fill); - f(it); - } else if (specs.align == align::center) { - std::size_t left_padding = padding / 2; - it = std::fill_n(it, left_padding, fill); - f(it); - it = std::fill_n(it, padding - left_padding, fill); - } else { - f(it); - it = std::fill_n(it, padding, fill); - } - } - - void write(int value) { write_decimal(value); } - void write(long value) { write_decimal(value); } - void write(long long value) { write_decimal(value); } - - void write(unsigned value) { write_decimal(value); } - void write(unsigned long value) { write_decimal(value); } - void write(unsigned long long value) { write_decimal(value); } - - // Writes a formatted integer. - template <typename T, typename Spec> - void write_int(T value, const Spec& spec) { - internal::handle_int_type_spec(spec.type, - int_writer<T, Spec>(*this, value, spec)); - } - - void write(double value, const format_specs& specs = format_specs()) { - write_double(value, specs); - } - - /** - \rst - Formats *value* using the general format for floating-point numbers - (``'g'``) and writes it to the buffer. - \endrst - */ - void write(long double value, const format_specs& specs = format_specs()) { - write_double(value, specs); - } - - // Formats a floating-point number (double or long double). - template <typename T, bool USE_GRISU = fmt::internal::use_grisu<T>()> - void write_double(T value, const format_specs& specs); - - /** Writes a character to the buffer. */ - void write(char value) { - auto&& it = reserve(1); - *it++ = value; - } - - template <typename Char, FMT_ENABLE_IF(std::is_same<Char, char_type>::value)> - void write(Char value) { - auto&& it = reserve(1); - *it++ = value; - } - - /** - \rst - Writes *value* to the buffer. - \endrst - */ - void write(string_view value) { - auto&& it = reserve(value.size()); - it = internal::copy_str<char_type>(value.begin(), value.end(), it); - } - void write(wstring_view value) { - static_assert(std::is_same<char_type, wchar_t>::value, ""); - auto&& it = reserve(value.size()); - it = std::copy(value.begin(), value.end(), it); - } - - // Writes a formatted string. - template <typename Char> - void write(const Char* s, std::size_t size, const format_specs& specs) { - write_padded(specs, str_writer<Char>{s, size}); - } - - template <typename Char> - void write(basic_string_view<Char> s, - const format_specs& specs = format_specs()) { - const Char* data = s.data(); - std::size_t size = s.size(); - if (specs.precision >= 0 && internal::to_unsigned(specs.precision) < size) - size = internal::to_unsigned(specs.precision); - write(data, size, specs); - } - - template <typename UIntPtr> - void write_pointer(UIntPtr value, const format_specs* specs) { - int num_digits = internal::count_digits<4>(value); - auto pw = pointer_writer<UIntPtr>{value, num_digits}; - if (!specs) return pw(reserve(to_unsigned(num_digits) + 2)); - format_specs specs_copy = *specs; - if (specs_copy.align == align::none) specs_copy.align = align::right; - write_padded(specs_copy, pw); - } -}; - -using writer = basic_writer<buffer_range<char>>; - -template <typename Range, typename ErrorHandler = internal::error_handler> -class arg_formatter_base { - public: - using char_type = typename Range::value_type; - using iterator = typename Range::iterator; - using format_specs = basic_format_specs<char_type>; - - private: - using writer_type = basic_writer<Range>; - writer_type writer_; - format_specs* specs_; - - struct char_writer { - char_type value; - - size_t size() const { return 1; } - size_t width() const { return 1; } - - template <typename It> void operator()(It&& it) const { *it++ = value; } - }; - - void write_char(char_type value) { - if (specs_) - writer_.write_padded(*specs_, char_writer{value}); - else - writer_.write(value); - } - - void write_pointer(const void* p) { - writer_.write_pointer(internal::bit_cast<internal::uintptr_t>(p), specs_); - } - - protected: - writer_type& writer() { return writer_; } - FMT_DEPRECATED format_specs* spec() { return specs_; } - format_specs* specs() { return specs_; } - iterator out() { return writer_.out(); } - - void write(bool value) { - string_view sv(value ? "true" : "false"); - specs_ ? writer_.write(sv, *specs_) : writer_.write(sv); - } - - void write(const char_type* value) { - if (!value) { - FMT_THROW(format_error("string pointer is null")); - } else { - auto length = std::char_traits<char_type>::length(value); - basic_string_view<char_type> sv(value, length); - specs_ ? writer_.write(sv, *specs_) : writer_.write(sv); - } - } - - public: - arg_formatter_base(Range r, format_specs* s, locale_ref loc) - : writer_(r, loc), specs_(s) {} - - iterator operator()(monostate) { - FMT_ASSERT(false, "invalid argument type"); - return out(); - } - - template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> - iterator operator()(T value) { - if (specs_) - writer_.write_int(value, *specs_); - else - writer_.write(value); - return out(); - } - - iterator operator()(char_type value) { - internal::handle_char_specs( - specs_, char_spec_handler(*this, static_cast<char_type>(value))); - return out(); - } - - iterator operator()(bool value) { - if (specs_ && specs_->type) return (*this)(value ? 1 : 0); - write(value != 0); - return out(); - } - - template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)> - iterator operator()(T value) { - writer_.write_double(value, specs_ ? *specs_ : format_specs()); - return out(); - } - - struct char_spec_handler : ErrorHandler { - arg_formatter_base& formatter; - char_type value; - - char_spec_handler(arg_formatter_base& f, char_type val) - : formatter(f), value(val) {} - - void on_int() { - if (formatter.specs_) - formatter.writer_.write_int(value, *formatter.specs_); - else - formatter.writer_.write(value); - } - void on_char() { formatter.write_char(value); } - }; - - struct cstring_spec_handler : internal::error_handler { - arg_formatter_base& formatter; - const char_type* value; - - cstring_spec_handler(arg_formatter_base& f, const char_type* val) - : formatter(f), value(val) {} - - void on_string() { formatter.write(value); } - void on_pointer() { formatter.write_pointer(value); } - }; - - iterator operator()(const char_type* value) { - if (!specs_) return write(value), out(); - internal::handle_cstring_type_spec(specs_->type, - cstring_spec_handler(*this, value)); - return out(); - } - - iterator operator()(basic_string_view<char_type> value) { - if (specs_) { - internal::check_string_type_spec(specs_->type, internal::error_handler()); - writer_.write(value, *specs_); - } else { - writer_.write(value); - } - return out(); - } - - iterator operator()(const void* value) { - if (specs_) - check_pointer_type_spec(specs_->type, internal::error_handler()); - write_pointer(value); - return out(); - } -}; - -template <typename Char> FMT_CONSTEXPR bool is_name_start(Char c) { - return ('a' <= c && c <= 'z') || ('A' <= c && c <= 'Z') || '_' == c; -} - -// Parses the range [begin, end) as an unsigned integer. This function assumes -// that the range is non-empty and the first character is a digit. -template <typename Char, typename ErrorHandler> -FMT_CONSTEXPR int parse_nonnegative_int(const Char*& begin, const Char* end, - ErrorHandler&& eh) { - assert(begin != end && '0' <= *begin && *begin <= '9'); - if (*begin == '0') { - ++begin; - return 0; - } - unsigned value = 0; - // Convert to unsigned to prevent a warning. - constexpr unsigned max_int = (std::numeric_limits<int>::max)(); - unsigned big = max_int / 10; - do { - // Check for overflow. - if (value > big) { - value = max_int + 1; - break; - } - value = value * 10 + unsigned(*begin - '0'); - ++begin; - } while (begin != end && '0' <= *begin && *begin <= '9'); - if (value > max_int) eh.on_error("number is too big"); - return static_cast<int>(value); -} - -template <typename Context> class custom_formatter { - private: - using char_type = typename Context::char_type; - - basic_parse_context<char_type>& parse_ctx_; - Context& ctx_; - - public: - explicit custom_formatter(basic_parse_context<char_type>& parse_ctx, - Context& ctx) - : parse_ctx_(parse_ctx), ctx_(ctx) {} - - bool operator()(typename basic_format_arg<Context>::handle h) const { - h.format(parse_ctx_, ctx_); - return true; - } - - template <typename T> bool operator()(T) const { return false; } -}; - -template <typename T> -using is_integer = - bool_constant<std::is_integral<T>::value && !std::is_same<T, bool>::value && - !std::is_same<T, char>::value && - !std::is_same<T, wchar_t>::value>; - -template <typename ErrorHandler> class width_checker { - public: - explicit FMT_CONSTEXPR width_checker(ErrorHandler& eh) : handler_(eh) {} - - template <typename T, FMT_ENABLE_IF(is_integer<T>::value)> - FMT_CONSTEXPR unsigned long long operator()(T value) { - if (is_negative(value)) handler_.on_error("negative width"); - return static_cast<unsigned long long>(value); - } - - template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)> - FMT_CONSTEXPR unsigned long long operator()(T) { - handler_.on_error("width is not integer"); - return 0; - } - - private: - ErrorHandler& handler_; -}; - -template <typename ErrorHandler> class precision_checker { - public: - explicit FMT_CONSTEXPR precision_checker(ErrorHandler& eh) : handler_(eh) {} - - template <typename T, FMT_ENABLE_IF(is_integer<T>::value)> - FMT_CONSTEXPR unsigned long long operator()(T value) { - if (is_negative(value)) handler_.on_error("negative precision"); - return static_cast<unsigned long long>(value); - } - - template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)> - FMT_CONSTEXPR unsigned long long operator()(T) { - handler_.on_error("precision is not integer"); - return 0; - } - - private: - ErrorHandler& handler_; -}; - -// A format specifier handler that sets fields in basic_format_specs. -template <typename Char> class specs_setter { - public: - explicit FMT_CONSTEXPR specs_setter(basic_format_specs<Char>& specs) - : specs_(specs) {} - - FMT_CONSTEXPR specs_setter(const specs_setter& other) - : specs_(other.specs_) {} - - FMT_CONSTEXPR void on_align(align_t align) { specs_.align = align; } - FMT_CONSTEXPR void on_fill(Char fill) { specs_.fill[0] = fill; } - FMT_CONSTEXPR void on_plus() { specs_.sign = sign::plus; } - FMT_CONSTEXPR void on_minus() { specs_.sign = sign::minus; } - FMT_CONSTEXPR void on_space() { specs_.sign = sign::space; } - FMT_CONSTEXPR void on_hash() { specs_.alt = true; } - - FMT_CONSTEXPR void on_zero() { - specs_.align = align::numeric; - specs_.fill[0] = Char('0'); - } - - FMT_CONSTEXPR void on_width(int width) { specs_.width = width; } - FMT_CONSTEXPR void on_precision(int precision) { - specs_.precision = precision; - } - FMT_CONSTEXPR void end_precision() {} - - FMT_CONSTEXPR void on_type(Char type) { - specs_.type = static_cast<char>(type); - } - - protected: - basic_format_specs<Char>& specs_; -}; - -template <typename ErrorHandler> class numeric_specs_checker { - public: - FMT_CONSTEXPR numeric_specs_checker(ErrorHandler& eh, internal::type arg_type) - : error_handler_(eh), arg_type_(arg_type) {} - - FMT_CONSTEXPR void require_numeric_argument() { - if (!is_arithmetic(arg_type_)) - error_handler_.on_error("format specifier requires numeric argument"); - } - - FMT_CONSTEXPR void check_sign() { - require_numeric_argument(); - if (is_integral(arg_type_) && arg_type_ != int_type && - arg_type_ != long_long_type && arg_type_ != internal::char_type) { - error_handler_.on_error("format specifier requires signed argument"); - } - } - - FMT_CONSTEXPR void check_precision() { - if (is_integral(arg_type_) || arg_type_ == internal::pointer_type) - error_handler_.on_error("precision not allowed for this argument type"); - } - - private: - ErrorHandler& error_handler_; - internal::type arg_type_; -}; - -// A format specifier handler that checks if specifiers are consistent with the -// argument type. -template <typename Handler> class specs_checker : public Handler { - public: - FMT_CONSTEXPR specs_checker(const Handler& handler, internal::type arg_type) - : Handler(handler), checker_(*this, arg_type) {} - - FMT_CONSTEXPR specs_checker(const specs_checker& other) - : Handler(other), checker_(*this, other.arg_type_) {} - - FMT_CONSTEXPR void on_align(align_t align) { - if (align == align::numeric) checker_.require_numeric_argument(); - Handler::on_align(align); - } - - FMT_CONSTEXPR void on_plus() { - checker_.check_sign(); - Handler::on_plus(); - } - - FMT_CONSTEXPR void on_minus() { - checker_.check_sign(); - Handler::on_minus(); - } - - FMT_CONSTEXPR void on_space() { - checker_.check_sign(); - Handler::on_space(); - } - - FMT_CONSTEXPR void on_hash() { - checker_.require_numeric_argument(); - Handler::on_hash(); - } - - FMT_CONSTEXPR void on_zero() { - checker_.require_numeric_argument(); - Handler::on_zero(); - } - - FMT_CONSTEXPR void end_precision() { checker_.check_precision(); } - - private: - numeric_specs_checker<Handler> checker_; -}; - -template <template <typename> class Handler, typename T, typename FormatArg, - typename ErrorHandler> -FMT_CONSTEXPR void set_dynamic_spec(T& value, FormatArg arg, ErrorHandler eh) { - unsigned long long big_value = - visit_format_arg(Handler<ErrorHandler>(eh), arg); - if (big_value > to_unsigned((std::numeric_limits<int>::max)())) - eh.on_error("number is too big"); - value = static_cast<T>(big_value); -} - -struct auto_id {}; - -template <typename Context> -FMT_CONSTEXPR typename Context::format_arg get_arg(Context& ctx, int id) { - auto arg = ctx.arg(id); - if (!arg) ctx.on_error("argument index out of range"); - return arg; -} - -// The standard format specifier handler with checking. -template <typename ParseContext, typename Context> -class specs_handler : public specs_setter<typename Context::char_type> { - public: - using char_type = typename Context::char_type; - - FMT_CONSTEXPR specs_handler(basic_format_specs<char_type>& specs, - ParseContext& parse_ctx, Context& ctx) - : specs_setter<char_type>(specs), - parse_context_(parse_ctx), - context_(ctx) {} - - template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) { - set_dynamic_spec<width_checker>(this->specs_.width, get_arg(arg_id), - context_.error_handler()); - } - - template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) { - set_dynamic_spec<precision_checker>(this->specs_.precision, get_arg(arg_id), - context_.error_handler()); - } - - void on_error(const char* message) { context_.on_error(message); } - - private: - // This is only needed for compatibility with gcc 4.4. - using format_arg = typename Context::format_arg; - - FMT_CONSTEXPR format_arg get_arg(auto_id) { - return internal::get_arg(context_, parse_context_.next_arg_id()); - } - - FMT_CONSTEXPR format_arg get_arg(int arg_id) { - parse_context_.check_arg_id(arg_id); - return internal::get_arg(context_, arg_id); - } - - FMT_CONSTEXPR format_arg get_arg(basic_string_view<char_type> arg_id) { - parse_context_.check_arg_id(arg_id); - return context_.arg(arg_id); - } - - ParseContext& parse_context_; - Context& context_; -}; - -struct string_view_metadata { - FMT_CONSTEXPR string_view_metadata() : offset_(0u), size_(0u) {} - template <typename Char> - FMT_CONSTEXPR string_view_metadata(basic_string_view<Char> primary_string, - basic_string_view<Char> view) - : offset_(to_unsigned(view.data() - primary_string.data())), - size_(view.size()) {} - FMT_CONSTEXPR string_view_metadata(std::size_t offset, std::size_t size) - : offset_(offset), size_(size) {} - template <typename Char> - FMT_CONSTEXPR basic_string_view<Char> to_view(const Char* str) const { - return {str + offset_, size_}; - } - - std::size_t offset_; - std::size_t size_; -}; - -enum class arg_id_kind { none, index, name }; - -// An argument reference. -template <typename Char> struct arg_ref { - FMT_CONSTEXPR arg_ref() : kind(arg_id_kind::none), val() {} - FMT_CONSTEXPR explicit arg_ref(int index) - : kind(arg_id_kind::index), val(index) {} - FMT_CONSTEXPR explicit arg_ref(string_view_metadata name) - : kind(arg_id_kind::name), val(name) {} - - FMT_CONSTEXPR arg_ref& operator=(int idx) { - kind = arg_id_kind::index; - val.index = idx; - return *this; - } - - arg_id_kind kind; - union value { - FMT_CONSTEXPR value() : index(0u) {} - FMT_CONSTEXPR value(int id) : index(id) {} - FMT_CONSTEXPR value(string_view_metadata n) : name(n) {} - - int index; - string_view_metadata name; - } val; -}; - -// Format specifiers with width and precision resolved at formatting rather -// than parsing time to allow re-using the same parsed specifiers with -// different sets of arguments (precompilation of format strings). -template <typename Char> -struct dynamic_format_specs : basic_format_specs<Char> { - arg_ref<Char> width_ref; - arg_ref<Char> precision_ref; -}; - -// Format spec handler that saves references to arguments representing dynamic -// width and precision to be resolved at formatting time. -template <typename ParseContext> -class dynamic_specs_handler - : public specs_setter<typename ParseContext::char_type> { - public: - using char_type = typename ParseContext::char_type; - - FMT_CONSTEXPR dynamic_specs_handler(dynamic_format_specs<char_type>& specs, - ParseContext& ctx) - : specs_setter<char_type>(specs), specs_(specs), context_(ctx) {} - - FMT_CONSTEXPR dynamic_specs_handler(const dynamic_specs_handler& other) - : specs_setter<char_type>(other), - specs_(other.specs_), - context_(other.context_) {} - - template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) { - specs_.width_ref = make_arg_ref(arg_id); - } - - template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) { - specs_.precision_ref = make_arg_ref(arg_id); - } - - FMT_CONSTEXPR void on_error(const char* message) { - context_.on_error(message); - } - - private: - using arg_ref_type = arg_ref<char_type>; - - FMT_CONSTEXPR arg_ref_type make_arg_ref(int arg_id) { - context_.check_arg_id(arg_id); - return arg_ref_type(arg_id); - } - - FMT_CONSTEXPR arg_ref_type make_arg_ref(auto_id) { - return arg_ref_type(context_.next_arg_id()); - } - - FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<char_type> arg_id) { - context_.check_arg_id(arg_id); - basic_string_view<char_type> format_str( - context_.begin(), to_unsigned(context_.end() - context_.begin())); - const auto id_metadata = string_view_metadata(format_str, arg_id); - return arg_ref_type(id_metadata); - } - - dynamic_format_specs<char_type>& specs_; - ParseContext& context_; -}; - -template <typename Char, typename IDHandler> -FMT_CONSTEXPR const Char* parse_arg_id(const Char* begin, const Char* end, - IDHandler&& handler) { - assert(begin != end); - Char c = *begin; - if (c == '}' || c == ':') return handler(), begin; - if (c >= '0' && c <= '9') { - int index = parse_nonnegative_int(begin, end, handler); - if (begin == end || (*begin != '}' && *begin != ':')) - return handler.on_error("invalid format string"), begin; - handler(index); - return begin; - } - if (!is_name_start(c)) - return handler.on_error("invalid format string"), begin; - auto it = begin; - do { - ++it; - } while (it != end && (is_name_start(c = *it) || ('0' <= c && c <= '9'))); - handler(basic_string_view<Char>(begin, to_unsigned(it - begin))); - return it; -} - -// Adapts SpecHandler to IDHandler API for dynamic width. -template <typename SpecHandler, typename Char> struct width_adapter { - explicit FMT_CONSTEXPR width_adapter(SpecHandler& h) : handler(h) {} - - FMT_CONSTEXPR void operator()() { handler.on_dynamic_width(auto_id()); } - FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_width(id); } - FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { - handler.on_dynamic_width(id); - } - - FMT_CONSTEXPR void on_error(const char* message) { - handler.on_error(message); - } - - SpecHandler& handler; -}; - -// Adapts SpecHandler to IDHandler API for dynamic precision. -template <typename SpecHandler, typename Char> struct precision_adapter { - explicit FMT_CONSTEXPR precision_adapter(SpecHandler& h) : handler(h) {} - - FMT_CONSTEXPR void operator()() { handler.on_dynamic_precision(auto_id()); } - FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_precision(id); } - FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { - handler.on_dynamic_precision(id); - } - - FMT_CONSTEXPR void on_error(const char* message) { - handler.on_error(message); - } - - SpecHandler& handler; -}; - -// Parses fill and alignment. -template <typename Char, typename Handler> -FMT_CONSTEXPR const Char* parse_align(const Char* begin, const Char* end, - Handler&& handler) { - FMT_ASSERT(begin != end, ""); - auto align = align::none; - int i = 0; - if (begin + 1 != end) ++i; - do { - switch (static_cast<char>(begin[i])) { - case '<': - align = align::left; - break; - case '>': - align = align::right; - break; - case '=': - align = align::numeric; - break; - case '^': - align = align::center; - break; - } - if (align != align::none) { - if (i > 0) { - auto c = *begin; - if (c == '{') - return handler.on_error("invalid fill character '{'"), begin; - begin += 2; - handler.on_fill(c); - } else - ++begin; - handler.on_align(align); - break; - } - } while (i-- > 0); - return begin; -} - -template <typename Char, typename Handler> -FMT_CONSTEXPR const Char* parse_width(const Char* begin, const Char* end, - Handler&& handler) { - FMT_ASSERT(begin != end, ""); - if ('0' <= *begin && *begin <= '9') { - handler.on_width(parse_nonnegative_int(begin, end, handler)); - } else if (*begin == '{') { - ++begin; - if (begin != end) - begin = parse_arg_id(begin, end, width_adapter<Handler, Char>(handler)); - if (begin == end || *begin != '}') - return handler.on_error("invalid format string"), begin; - ++begin; - } - return begin; -} - -template <typename Char, typename Handler> -FMT_CONSTEXPR const Char* parse_precision(const Char* begin, const Char* end, - Handler&& handler) { - ++begin; - auto c = begin != end ? *begin : Char(); - if ('0' <= c && c <= '9') { - handler.on_precision(parse_nonnegative_int(begin, end, handler)); - } else if (c == '{') { - ++begin; - if (begin != end) { - begin = - parse_arg_id(begin, end, precision_adapter<Handler, Char>(handler)); - } - if (begin == end || *begin++ != '}') - return handler.on_error("invalid format string"), begin; - } else { - return handler.on_error("missing precision specifier"), begin; - } - handler.end_precision(); - return begin; -} - -// Parses standard format specifiers and sends notifications about parsed -// components to handler. -template <typename Char, typename SpecHandler> -FMT_CONSTEXPR const Char* parse_format_specs(const Char* begin, const Char* end, - SpecHandler&& handler) { - if (begin == end || *begin == '}') return begin; - - begin = parse_align(begin, end, handler); - if (begin == end) return begin; - - // Parse sign. - switch (static_cast<char>(*begin)) { - case '+': - handler.on_plus(); - ++begin; - break; - case '-': - handler.on_minus(); - ++begin; - break; - case ' ': - handler.on_space(); - ++begin; - break; - } - if (begin == end) return begin; - - if (*begin == '#') { - handler.on_hash(); - if (++begin == end) return begin; - } - - // Parse zero flag. - if (*begin == '0') { - handler.on_zero(); - if (++begin == end) return begin; - } - - begin = parse_width(begin, end, handler); - if (begin == end) return begin; - - // Parse precision. - if (*begin == '.') { - begin = parse_precision(begin, end, handler); - } - - // Parse type. - if (begin != end && *begin != '}') handler.on_type(*begin++); - return begin; -} - -// Return the result via the out param to workaround gcc bug 77539. -template <bool IS_CONSTEXPR, typename T, typename Ptr = const T*> -FMT_CONSTEXPR bool find(Ptr first, Ptr last, T value, Ptr& out) { - for (out = first; out != last; ++out) { - if (*out == value) return true; - } - return false; -} - -template <> -inline bool find<false, char>(const char* first, const char* last, char value, - const char*& out) { - out = static_cast<const char*>( - std::memchr(first, value, internal::to_unsigned(last - first))); - return out != nullptr; -} - -template <typename Handler, typename Char> struct id_adapter { - FMT_CONSTEXPR void operator()() { handler.on_arg_id(); } - FMT_CONSTEXPR void operator()(int id) { handler.on_arg_id(id); } - FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { - handler.on_arg_id(id); - } - FMT_CONSTEXPR void on_error(const char* message) { - handler.on_error(message); - } - Handler& handler; -}; - -template <bool IS_CONSTEXPR, typename Char, typename Handler> -FMT_CONSTEXPR void parse_format_string(basic_string_view<Char> format_str, - Handler&& handler) { - struct pfs_writer { - FMT_CONSTEXPR void operator()(const Char* begin, const Char* end) { - if (begin == end) return; - for (;;) { - const Char* p = nullptr; - if (!find<IS_CONSTEXPR>(begin, end, '}', p)) - return handler_.on_text(begin, end); - ++p; - if (p == end || *p != '}') - return handler_.on_error("unmatched '}' in format string"); - handler_.on_text(begin, p); - begin = p + 1; - } - } - Handler& handler_; - } write{handler}; - auto begin = format_str.data(); - auto end = begin + format_str.size(); - while (begin != end) { - // Doing two passes with memchr (one for '{' and another for '}') is up to - // 2.5x faster than the naive one-pass implementation on big format strings. - const Char* p = begin; - if (*begin != '{' && !find<IS_CONSTEXPR>(begin, end, '{', p)) - return write(begin, end); - write(begin, p); - ++p; - if (p == end) return handler.on_error("invalid format string"); - if (static_cast<char>(*p) == '}') { - handler.on_arg_id(); - handler.on_replacement_field(p); - } else if (*p == '{') { - handler.on_text(p, p + 1); - } else { - p = parse_arg_id(p, end, id_adapter<Handler, Char>{handler}); - Char c = p != end ? *p : Char(); - if (c == '}') { - handler.on_replacement_field(p); - } else if (c == ':') { - p = handler.on_format_specs(p + 1, end); - if (p == end || *p != '}') - return handler.on_error("unknown format specifier"); - } else { - return handler.on_error("missing '}' in format string"); - } - } - begin = p + 1; - } -} - -template <typename T, typename ParseContext> -FMT_CONSTEXPR const typename ParseContext::char_type* parse_format_specs( - ParseContext& ctx) { - using char_type = typename ParseContext::char_type; - using context = buffer_context<char_type>; - using mapped_type = - conditional_t<internal::mapped_type_constant<T, context>::value != - internal::custom_type, - decltype(arg_mapper<context>().map(std::declval<T>())), T>; - conditional_t<has_formatter<mapped_type, context>::value, - formatter<mapped_type, char_type>, - internal::fallback_formatter<T, char_type>> - f; - return f.parse(ctx); -} - -template <typename Char, typename ErrorHandler, typename... Args> -class format_string_checker { - public: - explicit FMT_CONSTEXPR format_string_checker( - basic_string_view<Char> format_str, ErrorHandler eh) - : arg_id_((std::numeric_limits<unsigned>::max)()), - context_(format_str, eh), - parse_funcs_{&parse_format_specs<Args, parse_context_type>...} {} - - FMT_CONSTEXPR void on_text(const Char*, const Char*) {} - - FMT_CONSTEXPR void on_arg_id() { - arg_id_ = context_.next_arg_id(); - check_arg_id(); - } - FMT_CONSTEXPR void on_arg_id(int id) { - arg_id_ = id; - context_.check_arg_id(id); - check_arg_id(); - } - FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { - on_error("compile-time checks don't support named arguments"); - } - - FMT_CONSTEXPR void on_replacement_field(const Char*) {} - - FMT_CONSTEXPR const Char* on_format_specs(const Char* begin, const Char*) { - advance_to(context_, begin); - return arg_id_ < num_args ? parse_funcs_[arg_id_](context_) : begin; - } - - FMT_CONSTEXPR void on_error(const char* message) { - context_.on_error(message); - } - - private: - using parse_context_type = basic_parse_context<Char, ErrorHandler>; - enum { num_args = sizeof...(Args) }; - - FMT_CONSTEXPR void check_arg_id() { - if (arg_id_ >= num_args) context_.on_error("argument index out of range"); - } - - // Format specifier parsing function. - using parse_func = const Char* (*)(parse_context_type&); - - unsigned arg_id_; - parse_context_type context_; - parse_func parse_funcs_[num_args > 0 ? num_args : 1]; -}; - -template <typename Char, typename ErrorHandler, typename... Args> -FMT_CONSTEXPR bool do_check_format_string(basic_string_view<Char> s, - ErrorHandler eh = ErrorHandler()) { - format_string_checker<Char, ErrorHandler, Args...> checker(s, eh); - parse_format_string<true>(s, checker); - return true; -} - -template <typename... Args, typename S, - enable_if_t<(is_compile_string<S>::value), int>> -void check_format_string(S format_str) { - FMT_CONSTEXPR_DECL bool invalid_format = - internal::do_check_format_string<typename S::char_type, - internal::error_handler, Args...>( - to_string_view(format_str)); - (void)invalid_format; -} - -template <template <typename> class Handler, typename Spec, typename Context> -void handle_dynamic_spec(Spec& value, arg_ref<typename Context::char_type> ref, - Context& ctx, - const typename Context::char_type* format_str) { - switch (ref.kind) { - case arg_id_kind::none: - break; - case arg_id_kind::index: - internal::set_dynamic_spec<Handler>(value, ctx.arg(ref.val.index), - ctx.error_handler()); - break; - case arg_id_kind::name: { - const auto arg_id = ref.val.name.to_view(format_str); - internal::set_dynamic_spec<Handler>(value, ctx.arg(arg_id), - ctx.error_handler()); - break; - } - } -} -} // namespace internal - -template <typename Range> -using basic_writer FMT_DEPRECATED_ALIAS = internal::basic_writer<Range>; -using writer FMT_DEPRECATED_ALIAS = internal::writer; -using wwriter FMT_DEPRECATED_ALIAS = - internal::basic_writer<internal::buffer_range<wchar_t>>; - -/** The default argument formatter. */ -template <typename Range> -class arg_formatter : public internal::arg_formatter_base<Range> { - private: - using char_type = typename Range::value_type; - using base = internal::arg_formatter_base<Range>; - using context_type = basic_format_context<typename base::iterator, char_type>; - - context_type& ctx_; - basic_parse_context<char_type>* parse_ctx_; - - public: - using range = Range; - using iterator = typename base::iterator; - using format_specs = typename base::format_specs; - - /** - \rst - Constructs an argument formatter object. - *ctx* is a reference to the formatting context, - *specs* contains format specifier information for standard argument types. - \endrst - */ - explicit arg_formatter(context_type& ctx, - basic_parse_context<char_type>* parse_ctx = nullptr, - format_specs* specs = nullptr) - : base(Range(ctx.out()), specs, ctx.locale()), - ctx_(ctx), - parse_ctx_(parse_ctx) {} - - using base::operator(); - - /** Formats an argument of a user-defined type. */ - iterator operator()(typename basic_format_arg<context_type>::handle handle) { - handle.format(*parse_ctx_, ctx_); - return this->out(); - } -}; - -/** - An error returned by an operating system or a language runtime, - for example a file opening error. -*/ -class FMT_API system_error : public std::runtime_error { - private: - void init(int err_code, string_view format_str, format_args args); - - protected: - int error_code_; - - system_error() : std::runtime_error(""), error_code_(0) {} - - public: - /** - \rst - Constructs a :class:`fmt::system_error` object with a description - formatted with `fmt::format_system_error`. *message* and additional - arguments passed into the constructor are formatted similarly to - `fmt::format`. - - **Example**:: - - // This throws a system_error with the description - // cannot open file 'madeup': No such file or directory - // or similar (system message may vary). - const char *filename = "madeup"; - std::FILE *file = std::fopen(filename, "r"); - if (!file) - throw fmt::system_error(errno, "cannot open file '{}'", filename); - \endrst - */ - template <typename... Args> - system_error(int error_code, string_view message, const Args&... args) - : std::runtime_error("") { - init(error_code, message, make_format_args(args...)); - } - ~system_error() FMT_NOEXCEPT; - - int error_code() const { return error_code_; } -}; - -/** - \rst - Formats an error returned by an operating system or a language runtime, - for example a file opening error, and writes it to *out* in the following - form: - - .. parsed-literal:: - *<message>*: *<system-message>* - - where *<message>* is the passed message and *<system-message>* is - the system message corresponding to the error code. - *error_code* is a system error code as given by ``errno``. - If *error_code* is not a valid error code such as -1, the system message - may look like "Unknown error -1" and is platform-dependent. - \endrst - */ -FMT_API void format_system_error(internal::buffer<char>& out, int error_code, - fmt::string_view message) FMT_NOEXCEPT; - -struct float_spec_handler { - char type; - bool upper; - bool fixed; - bool as_percentage; - bool use_locale; - - explicit float_spec_handler(char t) - : type(t), - upper(false), - fixed(false), - as_percentage(false), - use_locale(false) {} - - void on_general() { - if (type == 'G') upper = true; - } - - void on_exp() { - if (type == 'E') upper = true; - } - - void on_fixed() { - fixed = true; - if (type == 'F') upper = true; - } - - void on_percent() { - fixed = true; - as_percentage = true; - } - - void on_hex() { - if (type == 'A') upper = true; - } - - void on_num() { use_locale = true; } - - FMT_NORETURN void on_error() { - FMT_THROW(format_error("invalid type specifier")); - } -}; - -template <typename Range> -template <typename T, bool USE_GRISU> -void internal::basic_writer<Range>::write_double(T value, - const format_specs& specs) { - // Check type. - float_spec_handler handler(static_cast<char>(specs.type)); - internal::handle_float_type_spec(handler.type, handler); - - char sign = 0; - // Use signbit instead of value < 0 since the latter is always false for NaN. - if (std::signbit(value)) { - sign = '-'; - value = -value; - } else if (specs.sign != sign::none) { - if (specs.sign == sign::plus) - sign = '+'; - else if (specs.sign == sign::space) - sign = ' '; - } - - if (!std::isfinite(value)) { - // Format infinity and NaN ourselves because sprintf's output is not - // consistent across platforms. - const char* str = std::isinf(value) ? (handler.upper ? "INF" : "inf") - : (handler.upper ? "NAN" : "nan"); - return write_padded(specs, - inf_or_nan_writer{sign, handler.as_percentage, str}); - } - - if (handler.as_percentage) value *= 100; - - memory_buffer buffer; - int exp = 0; - int precision = specs.precision >= 0 || !specs.type ? specs.precision : 6; - unsigned options = handler.fixed ? internal::grisu_options::fixed : 0; - bool use_grisu = USE_GRISU && - (specs.type != 'a' && specs.type != 'A' && - specs.type != 'e' && specs.type != 'E') && - internal::grisu_format(static_cast<double>(value), buffer, - precision, options, exp); - char* decimal_point_pos = nullptr; - if (!use_grisu) - decimal_point_pos = internal::sprintf_format(value, buffer, specs); - - if (handler.as_percentage) { - buffer.push_back('%'); - --exp; // Adjust decimal place position. - } - format_specs as = specs; - if (specs.align == align::numeric) { - if (sign) { - auto&& it = reserve(1); - *it++ = static_cast<char_type>(sign); - sign = 0; - if (as.width) --as.width; - } - as.align = align::right; - } else if (specs.align == align::none) { - as.align = align::right; - } - char_type decimal_point = handler.use_locale - ? internal::decimal_point<char_type>(locale_) - : static_cast<char_type>('.'); - if (use_grisu) { - auto params = internal::gen_digits_params(); - params.fixed = handler.fixed; - params.num_digits = precision; - params.trailing_zeros = - (precision != 0 && (handler.fixed || !specs.type)) || specs.alt; - write_padded(as, grisu_writer(sign, buffer, exp, params, decimal_point)); - } else { - write_padded(as, - double_writer{sign, buffer, decimal_point_pos, decimal_point}); - } -} - -// Reports a system error without throwing an exception. -// Can be used to report errors from destructors. -FMT_API void report_system_error(int error_code, - string_view message) FMT_NOEXCEPT; - -#if FMT_USE_WINDOWS_H - -/** A Windows error. */ -class windows_error : public system_error { - private: - FMT_API void init(int error_code, string_view format_str, format_args args); - - public: - /** - \rst - Constructs a :class:`fmt::windows_error` object with the description - of the form - - .. parsed-literal:: - *<message>*: *<system-message>* - - where *<message>* is the formatted message and *<system-message>* is the - system message corresponding to the error code. - *error_code* is a Windows error code as given by ``GetLastError``. - If *error_code* is not a valid error code such as -1, the system message - will look like "error -1". - - **Example**:: - - // This throws a windows_error with the description - // cannot open file 'madeup': The system cannot find the file specified. - // or similar (system message may vary). - const char *filename = "madeup"; - LPOFSTRUCT of = LPOFSTRUCT(); - HFILE file = OpenFile(filename, &of, OF_READ); - if (file == HFILE_ERROR) { - throw fmt::windows_error(GetLastError(), - "cannot open file '{}'", filename); - } - \endrst - */ - template <typename... Args> - windows_error(int error_code, string_view message, const Args&... args) { - init(error_code, message, make_format_args(args...)); - } -}; - -// Reports a Windows error without throwing an exception. -// Can be used to report errors from destructors. -FMT_API void report_windows_error(int error_code, - string_view message) FMT_NOEXCEPT; - -#endif - -/** Fast integer formatter. */ -class format_int { - private: - // Buffer should be large enough to hold all digits (digits10 + 1), - // a sign and a null character. - enum { buffer_size = std::numeric_limits<unsigned long long>::digits10 + 3 }; - mutable char buffer_[buffer_size]; - char* str_; - - // Formats value in reverse and returns a pointer to the beginning. - char* format_decimal(unsigned long long value) { - char* ptr = buffer_ + (buffer_size - 1); // Parens to workaround MSVC bug. - while (value >= 100) { - // Integer division is slow so do it for a group of two digits instead - // of for every digit. The idea comes from the talk by Alexandrescu - // "Three Optimization Tips for C++". See speed-test for a comparison. - unsigned index = static_cast<unsigned>((value % 100) * 2); - value /= 100; - *--ptr = internal::data::digits[index + 1]; - *--ptr = internal::data::digits[index]; - } - if (value < 10) { - *--ptr = static_cast<char>('0' + value); - return ptr; - } - unsigned index = static_cast<unsigned>(value * 2); - *--ptr = internal::data::digits[index + 1]; - *--ptr = internal::data::digits[index]; - return ptr; - } - - void format_signed(long long value) { - unsigned long long abs_value = static_cast<unsigned long long>(value); - bool negative = value < 0; - if (negative) abs_value = 0 - abs_value; - str_ = format_decimal(abs_value); - if (negative) *--str_ = '-'; - } - - public: - explicit format_int(int value) { format_signed(value); } - explicit format_int(long value) { format_signed(value); } - explicit format_int(long long value) { format_signed(value); } - explicit format_int(unsigned value) : str_(format_decimal(value)) {} - explicit format_int(unsigned long value) : str_(format_decimal(value)) {} - explicit format_int(unsigned long long value) : str_(format_decimal(value)) {} - - /** Returns the number of characters written to the output buffer. */ - std::size_t size() const { - return internal::to_unsigned(buffer_ - str_ + buffer_size - 1); - } - - /** - Returns a pointer to the output buffer content. No terminating null - character is appended. - */ - const char* data() const { return str_; } - - /** - Returns a pointer to the output buffer content with terminating null - character appended. - */ - const char* c_str() const { - buffer_[buffer_size - 1] = '\0'; - return str_; - } - - /** - \rst - Returns the content of the output buffer as an ``std::string``. - \endrst - */ - std::string str() const { return std::string(str_, size()); } -}; - -// A formatter specialization for the core types corresponding to internal::type -// constants. -template <typename T, typename Char> -struct formatter<T, Char, - enable_if_t<internal::type_constant<T, Char>::value != - internal::custom_type>> { - FMT_CONSTEXPR formatter() : format_str_(nullptr) {} - - // Parses format specifiers stopping either at the end of the range or at the - // terminating '}'. - template <typename ParseContext> - FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { - format_str_ = ctx.begin(); - using handler_type = internal::dynamic_specs_handler<ParseContext>; - auto type = internal::type_constant<T, Char>::value; - internal::specs_checker<handler_type> handler(handler_type(specs_, ctx), - type); - auto it = parse_format_specs(ctx.begin(), ctx.end(), handler); - auto eh = ctx.error_handler(); - switch (type) { - case internal::none_type: - case internal::named_arg_type: - FMT_ASSERT(false, "invalid argument type"); - break; - case internal::int_type: - case internal::uint_type: - case internal::long_long_type: - case internal::ulong_long_type: - case internal::bool_type: - handle_int_type_spec(specs_.type, - internal::int_type_checker<decltype(eh)>(eh)); - break; - case internal::char_type: - handle_char_specs( - &specs_, internal::char_specs_checker<decltype(eh)>(specs_.type, eh)); - break; - case internal::double_type: - case internal::long_double_type: - handle_float_type_spec(specs_.type, - internal::float_type_checker<decltype(eh)>(eh)); - break; - case internal::cstring_type: - internal::handle_cstring_type_spec( - specs_.type, internal::cstring_type_checker<decltype(eh)>(eh)); - break; - case internal::string_type: - internal::check_string_type_spec(specs_.type, eh); - break; - case internal::pointer_type: - internal::check_pointer_type_spec(specs_.type, eh); - break; - case internal::custom_type: - // Custom format specifiers should be checked in parse functions of - // formatter specializations. - break; - } - return it; - } - - template <typename FormatContext> - auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) { - internal::handle_dynamic_spec<internal::width_checker>( - specs_.width, specs_.width_ref, ctx, format_str_); - internal::handle_dynamic_spec<internal::precision_checker>( - specs_.precision, specs_.precision_ref, ctx, format_str_); - using range_type = - internal::output_range<typename FormatContext::iterator, - typename FormatContext::char_type>; - return visit_format_arg(arg_formatter<range_type>(ctx, nullptr, &specs_), - internal::make_arg<FormatContext>(val)); - } - - private: - internal::dynamic_format_specs<Char> specs_; - const Char* format_str_; -}; - -#define FMT_FORMAT_AS(Type, Base) \ - template <typename Char> \ - struct formatter<Type, Char> : formatter<Base, Char> { \ - template <typename FormatContext> \ - auto format(const Type& val, FormatContext& ctx) -> decltype(ctx.out()) { \ - return formatter<Base, Char>::format(val, ctx); \ - } \ - } - -FMT_FORMAT_AS(signed char, int); -FMT_FORMAT_AS(unsigned char, unsigned); -FMT_FORMAT_AS(short, int); -FMT_FORMAT_AS(unsigned short, unsigned); -FMT_FORMAT_AS(long, long long); -FMT_FORMAT_AS(unsigned long, unsigned long long); -FMT_FORMAT_AS(float, double); -FMT_FORMAT_AS(Char*, const Char*); -FMT_FORMAT_AS(std::basic_string<Char>, basic_string_view<Char>); -FMT_FORMAT_AS(std::nullptr_t, const void*); -FMT_FORMAT_AS(internal::std_string_view<Char>, basic_string_view<Char>); - -template <typename Char> -struct formatter<void*, Char> : formatter<const void*, Char> { - template <typename FormatContext> - auto format(void* val, FormatContext& ctx) -> decltype(ctx.out()) { - return formatter<const void*, Char>::format(val, ctx); - } -}; - -template <typename Char, size_t N> -struct formatter<Char[N], Char> : formatter<basic_string_view<Char>, Char> { - template <typename FormatContext> - auto format(const Char* val, FormatContext& ctx) -> decltype(ctx.out()) { - return formatter<basic_string_view<Char>, Char>::format(val, ctx); - } -}; - -// A formatter for types known only at run time such as variant alternatives. -// -// Usage: -// using variant = std::variant<int, std::string>; -// template <> -// struct formatter<variant>: dynamic_formatter<> { -// void format(buffer &buf, const variant &v, context &ctx) { -// visit([&](const auto &val) { format(buf, val, ctx); }, v); -// } -// }; -template <typename Char = char> class dynamic_formatter { - private: - struct null_handler : internal::error_handler { - void on_align(align_t) {} - void on_plus() {} - void on_minus() {} - void on_space() {} - void on_hash() {} - }; - - public: - template <typename ParseContext> - auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { - format_str_ = ctx.begin(); - // Checks are deferred to formatting time when the argument type is known. - internal::dynamic_specs_handler<ParseContext> handler(specs_, ctx); - return parse_format_specs(ctx.begin(), ctx.end(), handler); - } - - template <typename T, typename FormatContext> - auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) { - handle_specs(ctx); - internal::specs_checker<null_handler> checker( - null_handler(), - internal::mapped_type_constant<T, FormatContext>::value); - checker.on_align(specs_.align); - switch (specs_.sign) { - case sign::none: - break; - case sign::plus: - checker.on_plus(); - break; - case sign::minus: - checker.on_minus(); - break; - case sign::space: - checker.on_space(); - break; - } - if (specs_.alt) checker.on_hash(); - if (specs_.precision >= 0) checker.end_precision(); - using range = internal::output_range<typename FormatContext::iterator, - typename FormatContext::char_type>; - visit_format_arg(arg_formatter<range>(ctx, nullptr, &specs_), - internal::make_arg<FormatContext>(val)); - return ctx.out(); - } - - private: - template <typename Context> void handle_specs(Context& ctx) { - internal::handle_dynamic_spec<internal::width_checker>( - specs_.width, specs_.width_ref, ctx, format_str_); - internal::handle_dynamic_spec<internal::precision_checker>( - specs_.precision, specs_.precision_ref, ctx, format_str_); - } - - internal::dynamic_format_specs<Char> specs_; - const Char* format_str_; -}; - -template <typename Range, typename Char> -typename basic_format_context<Range, Char>::format_arg -basic_format_context<Range, Char>::arg(basic_string_view<char_type> name) { - map_.init(args_); - format_arg arg = map_.find(name); - if (arg.type() == internal::none_type) this->on_error("argument not found"); - return arg; -} - -template <typename Char, typename ErrorHandler> -FMT_CONSTEXPR void advance_to(basic_parse_context<Char, ErrorHandler>& ctx, - const Char* p) { - ctx.advance_to(ctx.begin() + (p - &*ctx.begin())); -} - -template <typename ArgFormatter, typename Char, typename Context> -struct format_handler : internal::error_handler { - using range = typename ArgFormatter::range; - - format_handler(range r, basic_string_view<Char> str, - basic_format_args<Context> format_args, - internal::locale_ref loc) - : parse_context(str), context(r.begin(), format_args, loc) {} - - void on_text(const Char* begin, const Char* end) { - auto size = internal::to_unsigned(end - begin); - auto out = context.out(); - auto&& it = internal::reserve(out, size); - it = std::copy_n(begin, size, it); - context.advance_to(out); - } - - void get_arg(int id) { arg = internal::get_arg(context, id); } - - void on_arg_id() { get_arg(parse_context.next_arg_id()); } - void on_arg_id(int id) { - parse_context.check_arg_id(id); - get_arg(id); - } - void on_arg_id(basic_string_view<Char> id) { arg = context.arg(id); } - - void on_replacement_field(const Char* p) { - advance_to(parse_context, p); - internal::custom_formatter<Context> f(parse_context, context); - if (!visit_format_arg(f, arg)) - context.advance_to( - visit_format_arg(ArgFormatter(context, &parse_context), arg)); - } - - const Char* on_format_specs(const Char* begin, const Char* end) { - advance_to(parse_context, begin); - internal::custom_formatter<Context> f(parse_context, context); - if (visit_format_arg(f, arg)) return parse_context.begin(); - basic_format_specs<Char> specs; - using internal::specs_handler; - using parse_context_t = basic_parse_context<Char>; - internal::specs_checker<specs_handler<parse_context_t, Context>> handler( - specs_handler<parse_context_t, Context>(specs, parse_context, context), - arg.type()); - begin = parse_format_specs(begin, end, handler); - if (begin == end || *begin != '}') on_error("missing '}' in format string"); - advance_to(parse_context, begin); - context.advance_to( - visit_format_arg(ArgFormatter(context, &parse_context, &specs), arg)); - return begin; - } - - basic_parse_context<Char> parse_context; - Context context; - basic_format_arg<Context> arg; -}; - -/** Formats arguments and writes the output to the range. */ -template <typename ArgFormatter, typename Char, typename Context> -typename Context::iterator vformat_to( - typename ArgFormatter::range out, basic_string_view<Char> format_str, - basic_format_args<Context> args, - internal::locale_ref loc = internal::locale_ref()) { - format_handler<ArgFormatter, Char, Context> h(out, format_str, args, loc); - internal::parse_format_string<false>(format_str, h); - return h.context.out(); -} - -// Casts ``p`` to ``const void*`` for pointer formatting. -// Example: -// auto s = format("{}", ptr(p)); -template <typename T> inline const void* ptr(const T* p) { return p; } -template <typename T> inline const void* ptr(const std::unique_ptr<T>& p) { - return p.get(); -} -template <typename T> inline const void* ptr(const std::shared_ptr<T>& p) { - return p.get(); -} - -template <typename It, typename Char> struct arg_join : internal::view { - It begin; - It end; - basic_string_view<Char> sep; - - arg_join(It b, It e, basic_string_view<Char> s) : begin(b), end(e), sep(s) {} -}; - -template <typename It, typename Char> -struct formatter<arg_join<It, Char>, Char> - : formatter<typename std::iterator_traits<It>::value_type, Char> { - template <typename FormatContext> - auto format(const arg_join<It, Char>& value, FormatContext& ctx) - -> decltype(ctx.out()) { - using base = formatter<typename std::iterator_traits<It>::value_type, Char>; - auto it = value.begin; - auto out = ctx.out(); - if (it != value.end) { - out = base::format(*it++, ctx); - while (it != value.end) { - out = std::copy(value.sep.begin(), value.sep.end(), out); - ctx.advance_to(out); - out = base::format(*it++, ctx); - } - } - return out; - } -}; - -/** - Returns an object that formats the iterator range `[begin, end)` with elements - separated by `sep`. - */ -template <typename It> -arg_join<It, char> join(It begin, It end, string_view sep) { - return {begin, end, sep}; -} - -template <typename It> -arg_join<It, wchar_t> join(It begin, It end, wstring_view sep) { - return {begin, end, sep}; -} - -/** - \rst - Returns an object that formats `range` with elements separated by `sep`. - - **Example**:: - - std::vector<int> v = {1, 2, 3}; - fmt::print("{}", fmt::join(v, ", ")); - // Output: "1, 2, 3" - \endrst - */ -template <typename Range> -arg_join<internal::iterator_t<const Range>, char> join(const Range& range, - string_view sep) { - return join(std::begin(range), std::end(range), sep); -} - -template <typename Range> -arg_join<internal::iterator_t<const Range>, wchar_t> join(const Range& range, - wstring_view sep) { - return join(std::begin(range), std::end(range), sep); -} - -/** - \rst - Converts *value* to ``std::string`` using the default format for type *T*. - It doesn't support user-defined types with custom formatters. - - **Example**:: - - #include <fmt/format.h> - - std::string answer = fmt::to_string(42); - \endrst - */ -template <typename T> inline std::string to_string(const T& value) { - return format("{}", value); -} - -/** - Converts *value* to ``std::wstring`` using the default format for type *T*. - */ -template <typename T> inline std::wstring to_wstring(const T& value) { - return format(L"{}", value); -} - -template <typename Char, std::size_t SIZE> -std::basic_string<Char> to_string(const basic_memory_buffer<Char, SIZE>& buf) { - return std::basic_string<Char>(buf.data(), buf.size()); -} - -template <typename Char> -typename buffer_context<Char>::iterator internal::vformat_to( - internal::buffer<Char>& buf, basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args) { - using range = buffer_range<Char>; - return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), - args); -} - -template <typename S, typename Char = char_t<S>, - FMT_ENABLE_IF(internal::is_string<S>::value)> -inline typename buffer_context<Char>::iterator vformat_to( - internal::buffer<Char>& buf, const S& format_str, - basic_format_args<buffer_context<Char>> args) { - return internal::vformat_to(buf, to_string_view(format_str), args); -} - -template <typename S, typename... Args, std::size_t SIZE = inline_buffer_size, - typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>> -inline typename buffer_context<Char>::iterator format_to( - basic_memory_buffer<Char, SIZE>& buf, const S& format_str, Args&&... args) { - internal::check_format_string<Args...>(format_str); - using context = buffer_context<Char>; - return internal::vformat_to(buf, to_string_view(format_str), - {make_format_args<context>(args...)}); -} - -template <typename OutputIt, typename Char = char> -using format_context_t = basic_format_context<OutputIt, Char>; - -template <typename OutputIt, typename Char = char> -using format_args_t = basic_format_args<format_context_t<OutputIt, Char>>; - -template <typename S, typename OutputIt, typename... Args, - FMT_ENABLE_IF( - internal::is_output_iterator<OutputIt>::value && - !internal::is_contiguous_back_insert_iterator<OutputIt>::value)> -inline OutputIt vformat_to(OutputIt out, const S& format_str, - format_args_t<OutputIt, char_t<S>> args) { - using range = internal::output_range<OutputIt, char_t<S>>; - return vformat_to<arg_formatter<range>>(range(out), - to_string_view(format_str), args); -} - -/** - \rst - Formats arguments, writes the result to the output iterator ``out`` and returns - the iterator past the end of the output range. - - **Example**:: - - std::vector<char> out; - fmt::format_to(std::back_inserter(out), "{}", 42); - \endrst - */ -template <typename OutputIt, typename S, typename... Args, - FMT_ENABLE_IF( - internal::is_output_iterator<OutputIt>::value && - !internal::is_contiguous_back_insert_iterator<OutputIt>::value && - internal::is_string<S>::value)> -inline OutputIt format_to(OutputIt out, const S& format_str, Args&&... args) { - internal::check_format_string<Args...>(format_str); - using context = format_context_t<OutputIt, char_t<S>>; - return vformat_to(out, to_string_view(format_str), - {make_format_args<context>(args...)}); -} - -template <typename OutputIt> struct format_to_n_result { - /** Iterator past the end of the output range. */ - OutputIt out; - /** Total (not truncated) output size. */ - std::size_t size; -}; - -template <typename OutputIt, typename Char = typename OutputIt::value_type> -using format_to_n_context = - format_context_t<fmt::internal::truncating_iterator<OutputIt>, Char>; - -template <typename OutputIt, typename Char = typename OutputIt::value_type> -using format_to_n_args = basic_format_args<format_to_n_context<OutputIt, Char>>; - -template <typename OutputIt, typename Char, typename... Args> -inline format_arg_store<format_to_n_context<OutputIt, Char>, Args...> -make_format_to_n_args(const Args&... args) { - return format_arg_store<format_to_n_context<OutputIt, Char>, Args...>( - args...); -} - -template <typename OutputIt, typename Char, typename... Args, - FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)> -inline format_to_n_result<OutputIt> vformat_to_n( - OutputIt out, std::size_t n, basic_string_view<Char> format_str, - format_to_n_args<OutputIt, Char> args) { - auto it = vformat_to(internal::truncating_iterator<OutputIt>(out, n), - format_str, args); - return {it.base(), it.count()}; -} - -/** - \rst - Formats arguments, writes up to ``n`` characters of the result to the output - iterator ``out`` and returns the total output size and the iterator past the - end of the output range. - \endrst - */ -template <typename OutputIt, typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value&& - internal::is_output_iterator<OutputIt>::value)> -inline format_to_n_result<OutputIt> format_to_n(OutputIt out, std::size_t n, - const S& format_str, - const Args&... args) { - internal::check_format_string<Args...>(format_str); - using context = format_to_n_context<OutputIt, char_t<S>>; - return vformat_to_n(out, n, to_string_view(format_str), - {make_format_args<context>(args...)}); -} - -template <typename Char> -inline std::basic_string<Char> internal::vformat( - basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args) { - basic_memory_buffer<Char> buffer; - internal::vformat_to(buffer, format_str, args); - return fmt::to_string(buffer); -} - -/** - Returns the number of characters in the output of - ``format(format_str, args...)``. - */ -template <typename... Args> -inline std::size_t formatted_size(string_view format_str, const Args&... args) { - auto it = format_to(internal::counting_iterator<char>(), format_str, args...); - return it.count(); -} - -#if FMT_USE_USER_DEFINED_LITERALS -namespace internal { - -# if FMT_USE_UDL_TEMPLATE -template <typename Char, Char... CHARS> class udl_formatter { - public: - template <typename... Args> - std::basic_string<Char> operator()(Args&&... args) const { - FMT_CONSTEXPR_DECL Char s[] = {CHARS..., '\0'}; - FMT_CONSTEXPR_DECL bool invalid_format = - do_check_format_string<Char, error_handler, Args...>( - basic_string_view<Char>(s, sizeof...(CHARS))); - (void)invalid_format; - return format(s, std::forward<Args>(args)...); - } -}; -# else -template <typename Char> struct udl_formatter { - basic_string_view<Char> str; - - template <typename... Args> - std::basic_string<Char> operator()(Args&&... args) const { - return format(str, std::forward<Args>(args)...); - } -}; -# endif // FMT_USE_UDL_TEMPLATE - -template <typename Char> struct udl_arg { - basic_string_view<Char> str; - - template <typename T> named_arg<T, Char> operator=(T&& value) const { - return {str, std::forward<T>(value)}; - } -}; - -} // namespace internal - -inline namespace literals { -# if FMT_USE_UDL_TEMPLATE -# pragma GCC diagnostic push -# if FMT_CLANG_VERSION -# pragma GCC diagnostic ignored "-Wgnu-string-literal-operator-template" -# endif -template <typename Char, Char... CHARS> -FMT_CONSTEXPR internal::udl_formatter<Char, CHARS...> operator""_format() { - return {}; -} -# pragma GCC diagnostic pop -# else -/** - \rst - User-defined literal equivalent of :func:`fmt::format`. - - **Example**:: - - using namespace fmt::literals; - std::string message = "The answer is {}"_format(42); - \endrst - */ -FMT_CONSTEXPR internal::udl_formatter<char> operator"" _format(const char* s, - std::size_t n) { - return {{s, n}}; -} -FMT_CONSTEXPR internal::udl_formatter<wchar_t> operator"" _format( - const wchar_t* s, std::size_t n) { - return {{s, n}}; -} -# endif // FMT_USE_UDL_TEMPLATE - -/** - \rst - User-defined literal equivalent of :func:`fmt::arg`. - - **Example**:: - - using namespace fmt::literals; - fmt::print("Elapsed time: {s:.2f} seconds", "s"_a=1.23); - \endrst - */ -FMT_CONSTEXPR internal::udl_arg<char> operator"" _a(const char* s, - std::size_t n) { - return {{s, n}}; -} -FMT_CONSTEXPR internal::udl_arg<wchar_t> operator"" _a(const wchar_t* s, - std::size_t n) { - return {{s, n}}; -} -} // namespace literals -#endif // FMT_USE_USER_DEFINED_LITERALS -FMT_END_NAMESPACE - -/** - \rst - Constructs a compile-time format string. - - **Example**:: - - // A compile-time error because 'd' is an invalid specifier for strings. - std::string s = format(FMT_STRING("{:d}"), "foo"); - \endrst - */ -#define FMT_STRING(s) \ - [] { \ - struct str : fmt::compile_string { \ - using char_type = typename std::remove_cv<std::remove_pointer< \ - typename std::decay<decltype(s)>::type>::type>::type; \ - FMT_CONSTEXPR operator fmt::basic_string_view<char_type>() const { \ - return {s, sizeof(s) / sizeof(char_type) - 1}; \ - } \ - } result; \ - /* Suppress Qt Creator warning about unused operator. */ \ - (void)static_cast<fmt::basic_string_view<typename str::char_type>>( \ - result); \ - return result; \ - }() - -#if defined(FMT_STRING_ALIAS) && FMT_STRING_ALIAS -/** - \rst - Constructs a compile-time format string. This macro is disabled by default to - prevent potential name collisions. To enable it define ``FMT_STRING_ALIAS`` to - 1 before including ``fmt/format.h``. - - **Example**:: - - #define FMT_STRING_ALIAS 1 - #include <fmt/format.h> - // A compile-time error because 'd' is an invalid specifier for strings. - std::string s = format(fmt("{:d}"), "foo"); - \endrst - */ -# define fmt(s) FMT_STRING(s) -#endif - -#ifdef FMT_HEADER_ONLY -# define FMT_FUNC inline -# include "format-inl.h" -#else -# define FMT_FUNC -#endif - -#endif // FMT_FORMAT_H_ diff --git a/include/vtkdiy2/fmt/locale.h b/include/vtkdiy2/fmt/locale.h deleted file mode 100644 index 7c13656e4fa8b78a7e7aacc18cd2eeaa84cdc449..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/fmt/locale.h +++ /dev/null @@ -1,77 +0,0 @@ -// Formatting library for C++ - std::locale support -// -// Copyright (c) 2012 - present, Victor Zverovich -// All rights reserved. -// -// For the license information refer to format.h. - -#ifndef FMT_LOCALE_H_ -#define FMT_LOCALE_H_ - -#include <locale> -#include "format.h" - -FMT_BEGIN_NAMESPACE - -namespace internal { -template <typename Char> -typename buffer_context<Char>::iterator vformat_to( - const std::locale& loc, buffer<Char>& buf, - basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args) { - using range = buffer_range<Char>; - return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args, - internal::locale_ref(loc)); -} - -template <typename Char> -std::basic_string<Char> vformat(const std::locale& loc, - basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args) { - basic_memory_buffer<Char> buffer; - internal::vformat_to(loc, buffer, format_str, args); - return fmt::to_string(buffer); -} -} // namespace internal - -template <typename S, typename Char = char_t<S>> -inline std::basic_string<Char> vformat( - const std::locale& loc, const S& format_str, - basic_format_args<buffer_context<Char>> args) { - return internal::vformat(loc, to_string_view(format_str), args); -} - -template <typename S, typename... Args, typename Char = char_t<S>> -inline std::basic_string<Char> format(const std::locale& loc, - const S& format_str, Args&&... args) { - return internal::vformat( - loc, to_string_view(format_str), - {internal::make_args_checked<Args...>(format_str, args...)}); -} - -template <typename S, typename OutputIt, typename... Args, - typename Char = enable_if_t< - internal::is_output_iterator<OutputIt>::value, char_t<S>>> -inline OutputIt vformat_to(OutputIt out, const std::locale& loc, - const S& format_str, - format_args_t<OutputIt, Char> args) { - using range = internal::output_range<OutputIt, Char>; - return vformat_to<arg_formatter<range>>( - range(out), to_string_view(format_str), args, internal::locale_ref(loc)); -} - -template <typename OutputIt, typename S, typename... Args, - FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&& - internal::is_string<S>::value)> -inline OutputIt format_to(OutputIt out, const std::locale& loc, - const S& format_str, Args&&... args) { - internal::check_format_string<Args...>(format_str); - using context = format_context_t<OutputIt, char_t<S>>; - format_arg_store<context, Args...> as{args...}; - return vformat_to(out, loc, to_string_view(format_str), - basic_format_args<context>(as)); -} - -FMT_END_NAMESPACE - -#endif // FMT_LOCALE_H_ diff --git a/include/vtkdiy2/grid.hpp b/include/vtkdiy2/grid.hpp index 2913891015db4ea1d2f9cca96601cc9da993d0d8..139157626391b5aec7ea1f4cb2ac3626547cf539 100644 --- a/include/vtkdiy2/grid.hpp +++ b/include/vtkdiy2/grid.hpp @@ -55,7 +55,7 @@ struct GridRef inline Vertex vertex(Index idx) const; - Index index(const Vertex& v) const { Index idx = 0; for (unsigned i = 0; i < D; ++i) { idx += ((Index) v[i]) * ((Index) stride_[i]); } return idx; } + Index index(const Vertex& v) const { Index idx = 0; for (unsigned i = 0; i < D; ++i) { idx += ((Index) v[i]) * stride_[i]; } return idx; } Index size() const { return size(shape()); } void swap(GridRef& other) { std::swap(data_, other.data_); std::swap(shape_, other.shape_); std::swap(stride_, other.stride_); std::swap(c_order_, other.c_order_); } @@ -65,6 +65,8 @@ struct GridRef static constexpr unsigned dimension() { return D; } + bool contains(const Vertex& v) { for (unsigned i = 0; i < D; ++i) { if (v[i] < 0 || v[i] >= shape_[i]) return false;} return true; } + protected: static Index size(const Vertex& v) { Index res = 1; for (unsigned i = 0; i < D; ++i) res *= v[i]; return res; } @@ -73,10 +75,9 @@ struct GridRef { Index cur = 1; if (c_order_) - for (unsigned i = D; i > 0; --i) { stride_[i-1] = cur; cur *= shape_[i-1]; } + for (unsigned i = D; i > 0; --i) { stride_[i-1] = cur; cur *= static_cast<Index>(shape_[i-1]); } else - for (unsigned i = 0; i < D; ++i) { stride_[i] = cur; cur *= shape_[i]; } - + for (unsigned i = 0; i < D; ++i) { stride_[i] = cur; cur *= static_cast<Index>(shape_[i]); } } void set_shape(const Vertex& v) { shape_ = v; set_stride(); } void set_data(C* data) { data_ = data; } @@ -85,7 +86,7 @@ struct GridRef private: C* data_; Vertex shape_; - Vertex stride_; + diy::Point<Index, D> stride_; bool c_order_; }; @@ -107,8 +108,8 @@ struct Grid: public GridRef<C,D> Grid(): Parent(new C[0], Vertex::zero()) {} template<class Int> - Grid(const Point<Int, D>& shape, bool c_order = true): - Parent(new C[size(shape)], shape, c_order) + Grid(const Point<Int, D>& s, bool c_order = true): + Parent(new C[size(s)], s, c_order) {} Grid(Grid&& g): Grid() { Parent::swap(g); } @@ -147,11 +148,11 @@ struct Grid: public GridRef<C,D> private: template<class OC> - void copy_data(const OC* data) + void copy_data(const OC* data_) { Index s = size(shape()); for (Index i = 0; i < s; ++i) - Parent::data()[i] = data[i]; + Parent::data()[i] = data_[i]; } }; @@ -181,13 +182,13 @@ vertex(typename GridRef<C, D>::Index idx) const if (c_order()) for (unsigned i = 0; i < D; ++i) { - v[i] = idx / stride_[i]; + v[i] = static_cast<int>(idx / stride_[i]); idx %= stride_[i]; } else for (int i = D-1; i >= 0; --i) { - v[i] = idx / stride_[i]; + v[i] = static_cast<int>(idx / stride_[i]); idx %= stride_[i]; } return v; diff --git a/include/vtkdiy2/io/block.hpp b/include/vtkdiy2/io/block.hpp index 26635bac299f598f25adabc32865976b88b3b59f..0cf2b97b503fc73e23d2c921cc9ed9fdbd1e1e12 100644 --- a/include/vtkdiy2/io/block.hpp +++ b/include/vtkdiy2/io/block.hpp @@ -205,12 +205,11 @@ namespace io extra.reset(); // Get local gids from assigner - size_t size = all_offset_counts.size(); - assigner.set_nblocks(size); + assigner.set_nblocks(static_cast<int>(all_offset_counts.size())); std::vector<int> gids; assigner.local_gids(comm.rank(), gids); - for (unsigned i = 0; i < gids.size(); ++i) + for (size_t i = 0; i < gids.size(); ++i) { if (gids[i] != all_offset_counts[gids[i]].gid) get_logger()->warn("gids don't match in diy::io::read_blocks(), {} vs {}", @@ -342,7 +341,7 @@ namespace split } // Get local gids from assigner - assigner.set_nblocks(size); + assigner.set_nblocks(static_cast<int>(size)); std::vector<int> gids; assigner.local_gids(comm.rank(), gids); diff --git a/include/vtkdiy2/io/bov.hpp b/include/vtkdiy2/io/bov.hpp index 7a7737e8a8c6a2fb58cda575a47c90c68e439b1d..4f7a3e0ee2d2b2e35c8a54aaea62f3a83b2e505c 100644 --- a/include/vtkdiy2/io/bov.hpp +++ b/include/vtkdiy2/io/bov.hpp @@ -2,11 +2,8 @@ #define DIY_IO_BOV_HPP #include <vector> -#include <algorithm> -#include <numeric> -#include "../types.hpp" -#include "../mpi.hpp" +#include "../mpi/io.hpp" namespace diy { @@ -39,8 +36,9 @@ namespace io shape_.push_back(shape[i]); stride_.push_back(1); } - for (int i = shape_.size() - 2; i >= 0; --i) + for (auto i = shape_.size() - 2; i == 0; --i) stride_[i] = stride_[i+1] * shape_[i+1]; + stride_[0] = stride_[1] * shape_[1]; } const Shape& shape() const { return shape_; } @@ -71,50 +69,7 @@ void diy::io::BOV:: read(const DiscreteBounds& bounds, T* buffer, bool collective, int chunk) const { -#ifndef DIY_NO_MPI - int dim = shape_.size(); - int total = 1; - std::vector<int> subsizes; - for (int i = 0; i < dim; ++i) - { - subsizes.push_back(bounds.max[i] - bounds.min[i] + 1); - total *= subsizes.back(); - } - - MPI_Datatype T_type; - if (chunk == 1) - T_type = mpi::detail::get_mpi_datatype<T>(); - else - { - // create an MPI struct of size chunk to read the data in those chunks - // (this allows to work around MPI-IO weirdness where crucial quantities - // are ints, which are too narrow of a type) - int array_of_blocklengths[] = { chunk }; - MPI_Aint array_of_displacements[] = { 0 }; - MPI_Datatype array_of_types[] = { mpi::detail::get_mpi_datatype<T>() }; - MPI_Type_create_struct(1, array_of_blocklengths, array_of_displacements, array_of_types, &T_type); - MPI_Type_commit(&T_type); - } - - MPI_Datatype fileblk; - MPI_Type_create_subarray(dim, (int*) &shape_[0], &subsizes[0], (int*) &bounds.min[0], MPI_ORDER_C, T_type, &fileblk); - MPI_Type_commit(&fileblk); - - MPI_File_set_view(f_.handle(), offset_, T_type, fileblk, (char*)"native", MPI_INFO_NULL); - - mpi::status s; - if (!collective) - MPI_File_read(f_.handle(), buffer, total, T_type, &s.s); - else - MPI_File_read_all(f_.handle(), buffer, total, T_type, &s.s); - - if (chunk != 1) - MPI_Type_free(&T_type); - MPI_Type_free(&fileblk); -#else - (void) bounds; (void) buffer; (void) collective; (void)chunk; - DIY_UNSUPPORTED_MPI_CALL(diy::io::BOV::read); -#endif + f_.read_bov(bounds, static_cast<int>(shape_.size()), shape_.data(), reinterpret_cast<char*>(buffer), offset_, mpi::detail::get_mpi_datatype<T>(), collective, chunk); } template<class T> @@ -130,52 +85,7 @@ void diy::io::BOV:: write(const DiscreteBounds& bounds, const T* buffer, const DiscreteBounds& core, bool collective, int chunk) { -#ifndef DIY_NO_MPI - int dim = shape_.size(); - std::vector<int> subsizes; - std::vector<int> buffer_shape, buffer_start; - for (int i = 0; i < dim; ++i) - { - buffer_shape.push_back(bounds.max[i] - bounds.min[i] + 1); - buffer_start.push_back(core.min[i] - bounds.min[i]); - subsizes.push_back(core.max[i] - core.min[i] + 1); - } - - MPI_Datatype T_type; - if (chunk == 1) - T_type = mpi::detail::get_mpi_datatype<T>(); - else - { - // assume T is a binary block and create an MPI struct of appropriate size - int array_of_blocklengths[] = { chunk }; - MPI_Aint array_of_displacements[] = { 0 }; - MPI_Datatype array_of_types[] = { mpi::detail::get_mpi_datatype<T>() }; - MPI_Type_create_struct(1, array_of_blocklengths, array_of_displacements, array_of_types, &T_type); - MPI_Type_commit(&T_type); - } - - MPI_Datatype fileblk, subbuffer; - MPI_Type_create_subarray(dim, (int*) &shape_[0], &subsizes[0], (int*) &core.min[0], MPI_ORDER_C, T_type, &fileblk); - MPI_Type_create_subarray(dim, (int*) &buffer_shape[0], &subsizes[0], (int*) &buffer_start[0], MPI_ORDER_C, T_type, &subbuffer); - MPI_Type_commit(&fileblk); - MPI_Type_commit(&subbuffer); - - MPI_File_set_view(f_.handle(), offset_, T_type, fileblk, (char*)"native", MPI_INFO_NULL); - - mpi::status s; - if (!collective) - MPI_File_write(f_.handle(), (void*)buffer, 1, subbuffer, &s.s); - else - MPI_File_write_all(f_.handle(), (void*)buffer, 1, subbuffer, &s.s); - - if (chunk != 1) - MPI_Type_free(&T_type); - MPI_Type_free(&fileblk); - MPI_Type_free(&subbuffer); -#else - (void) bounds; (void) buffer;(void) core; (void) collective; (void) chunk; - DIY_UNSUPPORTED_MPI_CALL(diy::io::bov::write); -#endif + f_.write_bov(bounds, core, static_cast<int>(shape_.size()), shape_.data(), reinterpret_cast<const char*>(buffer), offset_, mpi::detail::get_mpi_datatype<T>(), collective, chunk); } #endif diff --git a/include/vtkdiy2/io/numpy.hpp b/include/vtkdiy2/io/numpy.hpp index 0199a0c38f4f1ea23c79661578036074dfab1fa2..242313ed216776a7b68a4ee07f1556ea6fec2635 100644 --- a/include/vtkdiy2/io/numpy.hpp +++ b/include/vtkdiy2/io/numpy.hpp @@ -79,21 +79,21 @@ parse_npy_header(BOV::Shape& shape, bool& fortran_order) header = header.substr(11, nl - 11 + 1); size_t header_size = nl + 1; - int loc1, loc2; + size_t loc1, loc2; //fortran order loc1 = header.find("fortran_order")+16; fortran_order = (header.substr(loc1,4) == "True" ? true : false); //shape - unsigned ndims; + size_t ndims; loc1 = header.find("("); loc2 = header.find(")"); std::string str_shape = header.substr(loc1+1,loc2-loc1-1); if(str_shape[str_shape.size()-1] == ',') ndims = 1; else ndims = std::count(str_shape.begin(),str_shape.end(),',')+1; shape.resize(ndims); - for(unsigned int i = 0;i < ndims;i++) { + for(size_t i = 0;i < ndims;i++) { loc1 = str_shape.find(","); shape[i] = atoi(str_shape.substr(0,loc1).c_str()); str_shape = str_shape.substr(loc1+1); diff --git a/include/vtkdiy2/io/shared.hpp b/include/vtkdiy2/io/shared.hpp index 26d94d6c16da021a2ed5077dedc063cfe89da2f3..00328612cac459fd261d80365872cc1c539929c3 100644 --- a/include/vtkdiy2/io/shared.hpp +++ b/include/vtkdiy2/io/shared.hpp @@ -22,19 +22,35 @@ class SharedOutFile: public std::ostringstream void close() { - auto str = this->str(); - std::vector<char> contents(str.begin(), str.end()); - if (world_.rank() == root_) + if (root_ >= 0) { - std::vector<std::vector<char>> all_contents; - diy::mpi::gather(world_, contents, all_contents, root_); + auto str = this->str(); + std::vector<char> contents(str.begin(), str.end()); + if (world_.rank() == root_) + { + std::vector<std::vector<char>> all_contents; + diy::mpi::gather(world_, contents, all_contents, root_); - // write the file serially - std::ofstream out(filename_); - for (auto& contents : all_contents) - out.write(contents.data(), contents.size()); + // write the file serially + std::ofstream fout(filename_); + for (auto& cntnts : all_contents) + fout.write(cntnts.data(), cntnts.size()); + } else + diy::mpi::gather(world_, contents, root_); } else - diy::mpi::gather(world_, contents, root_); + { + int x = 0; + if (world_.rank() > 0) + world_.recv(world_.rank() - 1, 0, x); + + std::ofstream fout(filename_, std::ios_base::app); + fout << this->str(); + + if (world_.rank() < world_.size() - 1) + world_.send(world_.rank() + 1, 0, x); + + world_.barrier(); + } } private: diff --git a/include/vtkdiy2/io/utils.hpp b/include/vtkdiy2/io/utils.hpp index 3e44a470c475650902e55d84d21b9171d7a47a00..c857560effc12023d4107c35633c249014ea89ef 100644 --- a/include/vtkdiy2/io/utils.hpp +++ b/include/vtkdiy2/io/utils.hpp @@ -5,6 +5,8 @@ #include <direct.h> #include <io.h> #include <share.h> +#define NOMINMAX +#include <windows.h> #else #include <unistd.h> // mkstemp() on Mac #include <dirent.h> diff --git a/include/vtkdiy2/link.hpp b/include/vtkdiy2/link.hpp index 423e24807fa4423e9696e2dc406a8d160f225abc..c87e274de18abd4c5385efb65fa68aba7bfc1739 100644 --- a/include/vtkdiy2/link.hpp +++ b/include/vtkdiy2/link.hpp @@ -84,7 +84,7 @@ namespace diy // direction int direction(Direction dir) const; // convert direction to a neighbor (-1 if no neighbor) Direction direction(int i) const { return dir_vec_[i]; } - void add_direction(Direction dir) { int c = dir_map_.size(); dir_map_[dir] = c; dir_vec_.push_back(dir); } + void add_direction(Direction dir) { auto c = static_cast<int>(dir_map_.size()); dir_map_[dir] = c; dir_vec_.push_back(dir); } // wrap void add_wrap(Direction dir) { wrap_.push_back(dir); } diff --git a/include/vtkdiy2/log.hpp b/include/vtkdiy2/log.hpp index f47962d3b61cb42f622662c8cf7e98713c485c70..32f77cc0b1a27c129ff4cac1d287c10f163a8447 100644 --- a/include/vtkdiy2/log.hpp +++ b/include/vtkdiy2/log.hpp @@ -4,8 +4,8 @@ #ifndef DIY_USE_SPDLOG #include <memory> -#include "fmt/format.h" -#include "fmt/ostream.h" +#include "thirdparty/fmt/format.h" +#include "thirdparty/fmt/ostream.h" namespace diy { @@ -55,8 +55,8 @@ set_logger(Args...) #include <spdlog/sinks/null_sink.h> #include <spdlog/sinks/stdout_sinks.h> -#include <spdlog/fmt/bundled/format.h> -#include <spdlog/fmt/bundled/ostream.h> +#include <spdlog/fmt/fmt.h> +#include <spdlog/fmt/ostr.h> namespace diy { diff --git a/include/vtkdiy2/master.hpp b/include/vtkdiy2/master.hpp index 9761ce0f3cf9950d4613b025dd169513a8fc5751..51a03ce0c1e3e249716da364d6cf345915fb90f2 100644 --- a/include/vtkdiy2/master.hpp +++ b/include/vtkdiy2/master.hpp @@ -10,6 +10,8 @@ #include <numeric> #include <memory> #include <chrono> +#include <climits> +#include <random> #include "link.hpp" #include "collection.hpp" @@ -21,6 +23,9 @@ #include "thread.hpp" +#include "coroutine.hpp" +#include "utils.hpp" + #include "detail/block_traits.hpp" #include "log.hpp" @@ -28,6 +33,23 @@ namespace diy { + + struct MemoryManagement + { + using Allocate = std::function<char* (int, size_t)>; + using Deallocate = BinaryBlob::Deleter; + using MemCopy = std::function<void(char*, const char*, size_t)>; + + MemoryManagement() = default; + MemoryManagement(Allocate allocate_, Deallocate deallocate_, MemCopy copy_): + allocate(allocate_), deallocate(deallocate_), copy(copy_) {} + + Allocate allocate = [](int /* gid */, size_t n) { return new char[n]; }; + Deallocate deallocate = [](const char* p) { delete[] p; }; + MemCopy copy = [](char* dest, const char* src, size_t count) { std::memcpy(dest, src, count); }; + }; + + // Stores and manages blocks; initiates serialization and communication when necessary. // // Provides a foreach function, which is meant as the main entry point. @@ -68,6 +90,10 @@ namespace diy template<class Block> using Callback = std::function<void(Block*, const ProxyWithLink&)>; + // foreach_exchange callback + template<class Block> + using CoroutineCallback = std::function<void(Block* const&, const ProxyWithLink&)>; + // iexchange callback template<class Block> using ICallback = std::function<bool(Block*, const ProxyWithLink&)>; @@ -84,7 +110,7 @@ namespace diy { QueueSizePolicy(size_t sz): size(sz) {} bool unload_incoming(const Master&, int, int, size_t sz) const { return sz > size; } - bool unload_outgoing(const Master& master, int from, size_t sz) const { return sz > size*master.outgoing_count(from); } + bool unload_outgoing(const Master&, int, size_t sz) const { return sz > size; } size_t size; }; @@ -107,32 +133,40 @@ namespace diy struct CollectivesList; // std::list<Collective> struct CollectivesMap; // std::map<int, CollectivesList> // gid -> [collectives] - struct QueueRecord { - QueueRecord(size_t s = 0, int e = -1): size(s), external(e) {} - size_t size; - int external; - }; + QueueRecord(MemoryBuffer&& b): + buffer_(std::move(b)) { size_ = buffer_.size(); external_ = -1; } + QueueRecord(size_t s = 0, int e = -1): size_(s), external_(e) {} + QueueRecord(const QueueRecord&) =delete; + QueueRecord(QueueRecord&&) =default; + QueueRecord& operator=(const QueueRecord&) =delete; + QueueRecord& operator=(QueueRecord&&) =default; - typedef std::map<int, QueueRecord> InQueueRecords; // gid -> (size, external) - typedef std::map<int, MemoryBuffer> IncomingQueues; // gid -> queue - typedef std::map<BlockID, MemoryBuffer> OutgoingQueues; // (gid, proc) -> queue - typedef std::map<BlockID, QueueRecord> OutQueueRecords; // (gid, proc) -> (size, external) - struct IncomingQueuesRecords - { - InQueueRecords records; - IncomingQueues queues; - }; - struct OutgoingQueuesRecord - { - OutgoingQueuesRecord(int e = -1): external(e) {} - int external; - OutQueueRecords external_local; - OutgoingQueues queues; + bool external() const { return external_ != -1; } + MemoryBuffer&& move() { return std::move(buffer_); } + size_t size() const { if (external()) return size_; return buffer_.size(); } + + void reset() { buffer_.reset(); } + + void unload(ExternalStorage* storage) { size_ = buffer_.size(); external_ = storage->put(buffer_); } + void load(ExternalStorage* storage) { storage->get(external_, buffer_); external_ = -1; } + + MemoryBuffer& buffer() { return buffer_; } + + private: + size_t size_; + int external_; + MemoryBuffer buffer_; }; - typedef std::map<int, IncomingQueuesRecords> IncomingQueuesMap; // gid -> { gid -> queue } - typedef std::map<int, OutgoingQueuesRecord> OutgoingQueuesMap; // gid -> { (gid,proc) -> queue } + + using RecordQueue = critical_resource<std::deque<QueueRecord>>; + + using IncomingQueues = concurrent_map<int, RecordQueue>; // gid -> [(size, external, buffer), ...] + using OutgoingQueues = concurrent_map<BlockID, RecordQueue>; // bid -> [(size, external, buffer), ...] + + using IncomingQueuesMap = std::map<int, IncomingQueues>; // gid -> { gid -> [(size, external, buffer), ...]} + using OutgoingQueuesMap = std::map<int, OutgoingQueues>; // gid -> { bid -> [(size, external, buffer), ...]} struct IncomingRound { @@ -141,7 +175,6 @@ namespace diy }; typedef std::map<int, IncomingRound> IncomingRoundMap; - public: /** * \ingroup Initialization @@ -167,12 +200,17 @@ namespace diy inline void destroy(int i) { if (blocks_.own()) blocks_.destroy(i); } inline int add(int gid, void* b, Link* l); //!< add a block + inline int add(int gid, void* b, const Link& l){ return add(gid, b, l.clone()); } inline void* release(int i); //!< release ownership of the block //!< return the `i`-th block inline void* block(int i) const { return blocks_.find(i); } template<class Block> Block* block(int i) const { return static_cast<Block*>(block(i)); } + + const Collection& + blocks() const { return blocks_; } + //! return the `i`-th block, loading it if necessary void* get(int i) { return blocks_.get(i); } template<class Block> @@ -207,32 +245,23 @@ namespace diy bool local(int gid__) const { return lids_.find(gid__) != lids_.end(); } //! exchange the queues between all the blocks (collective operation) - inline void exchange(bool remote = false); + inline void exchange(bool remote = false, MemoryManagement mem = MemoryManagement()); //! nonblocking exchange of the queues between all the blocks template<class Block> - void iexchange_(const ICallback<Block>& f, - size_t min_queue_size, - size_t max_hold_time, - bool fine); + void iexchange_(const ICallback<Block>& f, MemoryManagement mem); template<class F> - void iexchange(const F& f, - size_t min_queue_size = 0, // in bytes, queues smaller than min_queue_size will be held for up to max_hold_time - size_t max_hold_time = 0, // in milliseconds - bool fine = false) + void iexchange(const F& f, MemoryManagement mem = MemoryManagement()) { using Block = typename detail::block_traits<F>::type; - iexchange_<Block>(f, min_queue_size, max_hold_time, fine); + iexchange_<Block>(f, mem); } inline void process_collectives(); inline - ProxyWithLink proxy(int i) const; - - inline - ProxyWithLink proxy(int i, IExchangeInfo* iexchange) const; + ProxyWithLink proxy(int i, IExchangeInfo* iex = 0) const; //! return the number of local blocks unsigned int size() const { return static_cast<unsigned int>(blocks_.size()); } @@ -243,7 +272,13 @@ namespace diy int threads() const { return threads_; } int in_memory() const { return *blocks_.in_memory().const_access(); } - void set_threads(int threads__) { threads_ = threads__; } + void set_threads(int threads__) + { + threads_ = threads__; +#if defined(DIY_NO_THREADS) + threads_ = 1; +#endif + } CreateBlock creator() const { return blocks_.creator(); } DestroyBlock destroyer() const { return blocks_.destroyer(); } @@ -266,11 +301,22 @@ namespace diy bool immediate() const { return immediate_; } void set_immediate(bool i) { if (i && !immediate_) execute(); immediate_ = i; } + /** foreach_exchange **/ + struct CoroutineArg; + + inline static + void launch_process_block_coroutine(); + + template<class Block> + void foreach_exchange_(const CoroutineCallback<Block>& f, bool remote, unsigned int stack_size); + + template<class F> + void foreach_exchange(const F& f, bool remote = false, unsigned int stack_size = 16*1024*1024); + public: // Communicator functionality - IncomingQueues& incoming(int gid__) { return incoming_[exchange_round_].map[gid__].queues; } - OutgoingQueues& outgoing(int gid__) { return outgoing_[gid__].queues; } - size_t outgoing_count(int gid__) const { OutgoingQueuesMap::const_iterator it = outgoing_.find(gid__); if (it == outgoing_.end()) return 0; return it->second.queues.size(); } + IncomingQueues& incoming(int gid__) { return incoming_[exchange_round_].map[gid__]; } + OutgoingQueues& outgoing(int gid__) { return outgoing_[gid__]; } inline CollectivesList& collectives(int gid__); inline CollectivesMap& collectives(); @@ -281,33 +327,30 @@ namespace diy public: // Communicator functionality - inline void flush(bool remote = false); // makes sure all the serialized queues migrate to their target processors + inline void flush(bool remote, MemoryManagement mem = MemoryManagement()); // makes sure all the serialized queues migrate to their target processors private: // Communicator functionality - inline void comm_exchange(GidSendOrder& gid_order, IExchangeInfo* iexchange = 0); - inline void rcomm_exchange(); // possibly called in between block computations - inline bool nudge(IExchangeInfo* iexchange = 0); - inline void send_queue(int from_gid, int to_gid, int to_proc, MemoryBuffer& out_queue, bool remote, IExchangeInfo* iexchange); + inline void comm_exchange(GidSendOrder& gid_order, MemoryManagement mem, IExchangeInfo* iex = 0); + inline void rcomm_exchange(MemoryManagement mem); // possibly called in between block computations + inline bool nudge(IExchangeInfo* iex = 0); + inline void send_queue(int from_gid, int to_gid, int to_proc, QueueRecord& qr, bool remote, MemoryManagement mem, IExchangeInfo* iex); inline void send_outgoing_queues(GidSendOrder& gid_order, bool remote, - IExchangeInfo* iexchange = 0); - inline void check_incoming_queues(IExchangeInfo* iexchange = 0); + MemoryManagement mem, + IExchangeInfo* iex = 0); + inline void check_incoming_queues(MemoryManagement mem, IExchangeInfo* iex = 0); inline GidSendOrder order_gids(); inline void touch_queues(); - inline void move_external_local(int from); - inline void send_same_rank(int from, int to, MemoryBuffer& bb, IExchangeInfo* iexchange); - inline void send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, IExchangeInfo* iexchange); + inline void send_same_rank(int from, int to, QueueRecord& qr, MemoryManagement mem, IExchangeInfo* iex); + inline void send_different_rank(int from, int to, int proc, QueueRecord& qr, bool remote, IExchangeInfo* iex); inline InFlightRecv& inflight_recv(int proc); inline InFlightSendsList& inflight_sends(); // iexchange commmunication - inline void icommunicate(IExchangeInfo* iexchange); // async communication - - // debug - inline void show_incoming_records() const; + inline void icommunicate(IExchangeInfo* iex, MemoryManagement mem); // async communication struct tags { enum { queue, @@ -348,6 +391,7 @@ namespace diy std::shared_ptr<spd::logger> log = get_logger(); stats::Profiler prof; stats::Annotation exchange_round_annotation { "diy.exchange-round" }; + std::mt19937 mt_gen; // mersenne_twister random number generator }; struct Master::SkipNoIncoming @@ -360,6 +404,7 @@ namespace diy #include "detail/master/commands.hpp" #include "proxy.hpp" #include "detail/master/execution.hpp" +#include "detail/master/foreach_exchange.hpp" diy::Master:: Master(mpi::communicator comm, @@ -374,14 +419,28 @@ Master(mpi::communicator comm, blocks_(create_, destroy_, storage, save, load_), queue_policy_(q_policy), limit_(limit__), +#if !defined(DIY_NO_THREADS) threads_(threads__ == -1 ? static_cast<int>(thread::hardware_concurrency()) : threads__), +#else + threads_(1), +#endif storage_(storage), // Communicator functionality inflight_sends_(new InFlightSendsList), inflight_recvs_(new InFlightRecvsMap), collectives_(new CollectivesMap) { +#ifdef DIY_NO_THREADS + (void) threads__; +#endif comm_.duplicate(comm); + + // seed random number generator, broadcast seed, offset by rank + std::random_device rd; // seed source for the random number engine + unsigned int s = rd(); + diy::mpi::broadcast(communicator(), s, 0); + std::mt19937 gen(s + communicator().rank()); // mersenne_twister random number generator + mt_gen = gen; } diy::Master:: @@ -431,18 +490,20 @@ unload_incoming(int gid__) { IncomingQueuesMap::iterator qmap_itr = round_itr->second.map.find(gid__); if (qmap_itr == round_itr->second.map.end()) - { continue; - } - IncomingQueuesRecords& in_qrs = qmap_itr->second; - for (InQueueRecords::iterator it = in_qrs.records.begin(); it != in_qrs.records.end(); ++it) + + IncomingQueues& in_qs = qmap_itr->second; + for (auto& x : in_qs) { - QueueRecord& qr = it->second; - if (queue_policy_->unload_incoming(*this, it->first, gid__, qr.size)) - { - log->debug("Unloading queue: {} <- {}", gid__, it->first); - qr.external = storage_->put(in_qrs.queues[it->first]); - } + int from = x.first; + for (QueueRecord& qr : *x.second.access()) + { + if (queue_policy_->unload_incoming(*this, from, gid__, qr.size())) + { + log->debug("Unloading queue: {} <- {}", gid__, from); + qr.unload(storage_); + } + } } } } @@ -451,54 +512,18 @@ void diy::Master:: unload_outgoing(int gid__) { - OutgoingQueuesRecord& out_qr = outgoing_[gid__]; - - size_t out_queues_size = sizeof(size_t); // map size - size_t count = 0; - // count the size of the queues we need to pack - for (auto& rec : out_qr.queues) + OutgoingQueues& out_qs = outgoing_[gid__]; + for (auto& x : out_qs) { - if (rec.first.proc == comm_.rank()) continue; - - out_queues_size += sizeof(BlockID); // target - out_queues_size += Serialization<MemoryBuffer>::size(rec.second); // buffer contents - ++count; - } - if (queue_policy_->unload_outgoing(*this, gid__, out_queues_size - sizeof(size_t))) - { - log->debug("Unloading outgoing queues: {} -> ...; size = {}\n", gid__, out_queues_size); - MemoryBuffer bb; bb.reserve(out_queues_size); - diy::save(bb, count); - - // pack queues going to a remote proc into bb; queues going to a - // different block on our rank, stay separated, recorded in external_local - for (auto it = out_qr.queues.begin(); it != out_qr.queues.end();) + int to = x.first.gid; + for (QueueRecord& qr : *x.second.access()) { - auto bid = it->first; - auto& buffer = it->second; - if (bid.proc == comm_.rank()) - { - // treat as incoming - if (queue_policy_->unload_incoming(*this, gid__, bid.gid, buffer.size())) - { - QueueRecord& qr = out_qr.external_local[bid]; - qr.size = buffer.size(); - qr.external = storage_->put(buffer); - - out_qr.queues.erase(it++); - } ++it; // else keep in memory - } else + if (queue_policy_->unload_outgoing(*this, gid__, qr.size())) { - diy::save(bb, bid); - diy::save(bb, buffer); - - out_qr.queues.erase(it++); + log->debug("Unloading outgoing queue: {} -> {}", gid__, to); + qr.unload(storage_); } } - - // TODO: this mechanism could be adjusted for direct saving to disk - // (without intermediate binary buffer serialization) - out_qr.external = storage_->put(bb); } } @@ -524,16 +549,22 @@ void diy::Master:: load_incoming(int gid__) { - IncomingQueuesRecords& in_qrs = incoming_[exchange_round_].map[gid__]; - for (InQueueRecords::iterator it = in_qrs.records.begin(); it != in_qrs.records.end(); ++it) + IncomingQueues& in_qs = incoming_[exchange_round_].map[gid__]; + for (auto& x : in_qs) { - QueueRecord& qr = it->second; - if (qr.external != -1) - { - log->debug("Loading queue: {} <- {}", gid__, it->first); - storage_->get(qr.external, in_qrs.queues[it->first]); - qr.external = -1; - } + int from = x.first; + auto access = x.second.access(); + if (!access->empty()) + { + // NB: we only load the front queue, if we want to use out-of-core + // machinery with iexchange, this will require changes + auto& qr = access->front(); + if (qr.external()) + { + log->debug("Loading queue: {} <- {}", gid__, from); + qr.load(storage_); + } + } } } @@ -543,33 +574,30 @@ load_outgoing(int gid__) { // TODO: we could adjust this mechanism to read directly from storage, // bypassing an intermediate MemoryBuffer - OutgoingQueuesRecord& out_qr = outgoing_[gid__]; - if (out_qr.external != -1) + OutgoingQueues& out_qs = outgoing_[gid__]; + for (auto& x : out_qs) { - MemoryBuffer bb; - storage_->get(out_qr.external, bb); - out_qr.external = -1; - - size_t count; - diy::load(bb, count); - for (size_t i = 0; i < count; ++i) - { - BlockID to; - diy::load(bb, to); - diy::load(bb, out_qr.queues[to]); - } + int to = x.first.gid; + int to_rank = x.first.proc; + auto access = x.second.access(); + if (!access->empty()) + { + // NB: we only load the front queue, if we want to use out-of-core + // machinery with iexchange, this will require changes + auto& qr = access->front(); + if (qr.external() && comm_.rank() != to_rank) // skip queues to the same rank + { + log->debug("Loading queue: {} -> {}", gid__, to); + qr.load(storage_); + } + } } } diy::Master::ProxyWithLink diy::Master:: -proxy(int i) const -{ return ProxyWithLink(Proxy(const_cast<Master*>(this), gid(i)), block(i), link(i)); } - -diy::Master::ProxyWithLink -diy::Master:: -proxy(int i, IExchangeInfo* iexchange) const -{ return ProxyWithLink(Proxy(const_cast<Master*>(this), gid(i), iexchange), block(i), link(i)); } +proxy(int i, IExchangeInfo* iex) const +{ return ProxyWithLink(Proxy(const_cast<Master*>(this), gid(i), iex), block(i), link(i)); } int diy::Master:: @@ -596,8 +624,18 @@ diy::Master:: release(int i) { void* b = blocks_.release(i); + + expected_ -= links_[i]->size_unique(); delete link(i); links_[i] = 0; + std::swap(links_[i], links_.back()); + links_.pop_back(); + lids_.erase(gid(i)); + + std::swap(gids_[i], gids_.back()); + gids_.pop_back(); + lids_[gid(i)] = i; + return b; } @@ -605,12 +643,12 @@ bool diy::Master:: has_incoming(int i) const { - const IncomingQueuesRecords& in_qrs = const_cast<Master&>(*this).incoming_[exchange_round_].map[gid(i)]; - for (InQueueRecords::const_iterator it = in_qrs.records.begin(); it != in_qrs.records.end(); ++it) + const IncomingQueues& in_qs = const_cast<Master&>(*this).incoming_[exchange_round_].map[gid(i)]; + for (auto& x : in_qs) { - const QueueRecord& qr = it->second; - if (qr.size != 0) - return true; + auto access = x.second.const_access(); + if (!access->empty() && access->front().size() != 0) + return true; } return false; } @@ -633,7 +671,7 @@ foreach_(const Callback<Block>& f, const Skip& skip) void diy::Master:: -exchange(bool remote) +exchange(bool remote, MemoryManagement mem) { auto scoped = prof.scoped("exchange"); DIY_UNUSED(scoped); @@ -642,17 +680,16 @@ exchange(bool remote) log->debug("Starting exchange"); -#ifdef DIY_NO_MPI - // remote doesn't need to do anything special if there is no mpi, but we also - // can't just use it because of the ibarrier - remote = false; -#endif + if (comm_.size() == 1) + { + remote = false; + } // make sure there is a queue for each neighbor if (!remote) touch_queues(); - flush(remote); + flush(remote, mem); log->debug("Finished exchange"); } @@ -662,14 +699,13 @@ touch_queues() { for (int i = 0; i < (int)size(); ++i) { - OutgoingQueues& outgoing_queues = outgoing_[gid(i)].queues; - OutQueueRecords& external_local = outgoing_[gid(i)].external_local; - if (outgoing_queues.size() < (size_t)link(i)->size()) - for (unsigned j = 0; j < (unsigned)link(i)->size(); ++j) - { - if (external_local.find(link(i)->target(j)) == external_local.end()) - outgoing_queues[link(i)->target(j)]; // touch the outgoing queue, creating it if necessary - } + OutgoingQueues& outgoing_queues = outgoing_[gid(i)]; + for (BlockID target : link(i)->neighbors()) + { + auto access = outgoing_queues[target].access(); + if (access->empty()) + access->emplace_back(); + } } } @@ -686,57 +722,101 @@ touch_queues() template<class Block> void diy::Master:: -iexchange_(const ICallback<Block>& f, - size_t min_queue_size, - size_t max_hold_time, - bool fine) +iexchange_(const ICallback<Block>& f, MemoryManagement mem) { auto scoped = prof.scoped("iexchange"); DIY_UNUSED(scoped); +#if !defined(DIY_NO_THREADS) && (!defined(DIY_USE_CALIPER) && defined(DIY_PROFILE)) + static_assert(false, "Cannot use DIY's internal profiler; it's not thread safe. Use caliper."); +#endif + // prepare for next round incoming_.erase(exchange_round_); ++exchange_round_; exchange_round_annotation.set(exchange_round_); + // touch the outgoing and incoming queues to make sure they exist + for (unsigned i = 0; i < size(); ++i) + { + outgoing(gid(i)); + incoming(gid(i)); + } + //IExchangeInfoDUD iexchange(comm_, min_queue_size, max_hold_time, fine, prof); - IExchangeInfoCollective iexchange(comm_, min_queue_size, max_hold_time, fine, prof); - iexchange.add_work(size()); // start with one work unit for each block + IExchangeInfoCollective iex(comm_, prof); + iex.add_work(size()); // start with one work unit for each block + + thread comm_thread; + if (threads() > 1) + comm_thread = thread([this,&iex,mem]() + { + while(!iex.all_done()) + { + icommunicate(&iex, mem); + iex.control(); + //std::this_thread::sleep_for(std::chrono::microseconds(1)); + } + }); + + auto empty_incoming = [this](int gid) + { + for (auto& x : incoming(gid)) + if (!x.second.access()->empty()) + return false; + return true; + }; std::map<int, bool> done_result; do { - for (size_t i = 0; i < size(); i++) // for all blocks + size_t work_done = 0; + DIY_UNUSED(work_done); + for (int i = 0; i < static_cast<int>(size()); i++) // for all blocks { - iexchange.from_gid = gid(i); // for shortcut sending only from current block during icommunicate - stats::Annotation::Guard g( stats::Annotation("diy.block").set(iexchange.from_gid) ); + int gid = this->gid(i); + stats::Annotation::Guard g( stats::Annotation("diy.block").set(gid) ); - icommunicate(&iexchange); // TODO: separate comm thread std::thread t(icommunicate); - ProxyWithLink cp = proxy(i, &iexchange); - - bool done = done_result[cp.gid()]; - if (!done || !cp.empty_incoming_queues()) + if (threads() == 1) + icommunicate(&iex, mem); + bool done = done_result[gid]; + if (!done || !empty_incoming(gid)) { prof << "callback"; - done = f(block<Block>(i), cp); + iex.inc_work(); // even if we remove the queues, when constructing the proxy, we still have work to do + { + ProxyWithLink cp = proxy(i, &iex); + done = f(block<Block>(i), cp); + if (done_result[gid] ^ done) // status changed + { + if (done) + iex.dec_work(); + else + iex.inc_work(); + } + } // NB: we need cp to go out of scope and copy out its queues before we can decrement the work + iex.dec_work(); prof >> "callback"; + ++work_done; } - done_result[cp.gid()] = done; - - done &= cp.empty_queues(); - + done_result[gid] = done; log->debug("Done: {}", done); + } - prof << "work-counting"; - iexchange.update_done(cp.gid(), done); - prof >> "work-counting"; + if (threads() == 1) + { + prof << "iexchange-control"; + iex.control(); + prof >> "iexchange-control"; } + //else + //if (work_done == 0) + // std::this_thread::sleep_for(std::chrono::microseconds(1)); + } while (!iex.all_done()); + log->info("[{}] ==== Leaving iexchange ====\n", iex.comm.rank()); - prof << "iexchange-control"; - iexchange.control(); - prof >> "iexchange-control"; - } while (!iexchange.all_done()); - log->info("[{}] ==== Leaving iexchange ====\n", iexchange.comm.rank()); + if (threads() > 1) + comm_thread.join(); //comm_.barrier(); // TODO: this is only necessary for DUD prof >> "consensus-time"; @@ -747,17 +827,17 @@ iexchange_(const ICallback<Block>& f, /* Communicator */ void diy::Master:: -comm_exchange(GidSendOrder& gid_order, IExchangeInfo* iexchange) +comm_exchange(GidSendOrder& gid_order, MemoryManagement mem, IExchangeInfo* iex) { auto scoped = prof.scoped("comm-exchange"); DIY_UNUSED(scoped); - send_outgoing_queues(gid_order, false, iexchange); + send_outgoing_queues(gid_order, false, mem, iex); - while(nudge(iexchange)) // kick requests + while(nudge(iex)) // kick requests ; - check_incoming_queues(iexchange); + check_incoming_queues(mem, iex); } /* Remote communicator */ @@ -788,7 +868,7 @@ comm_exchange(GidSendOrder& gid_order, IExchangeInfo* iexchange) // void diy::Master:: -rcomm_exchange() +rcomm_exchange(MemoryManagement mem) { bool done = false; bool ibarr_act = false; @@ -799,12 +879,12 @@ rcomm_exchange() while (!done) { - send_outgoing_queues(gid_order, true, 0); + send_outgoing_queues(gid_order, true, mem, 0); // kick requests nudge(); - check_incoming_queues(); + check_incoming_queues(mem); if (ibarr_act) { if (ibarr_req.test()) @@ -831,13 +911,19 @@ order_gids() GidSendOrder order; - for (OutgoingQueuesMap::iterator it = outgoing_.begin(); it != outgoing_.end(); ++it) + for (auto& x : outgoing_) { - OutgoingQueuesRecord& out = it->second; - if (out.external == -1) - order.list.push_front(it->first); - else - order.list.push_back(it->first); + OutgoingQueues& out = x.second; + if (!out.empty()) + { + auto access = out.begin()->second.access(); + if (!access->empty() && !access->front().external()) + { + order.list.push_front(x.first); + continue; + } + } + order.list.push_back(x.first); } log->debug("order.size(): {}", order.size()); @@ -856,27 +942,17 @@ order_gids() // iexchange communicator void diy::Master:: -icommunicate(IExchangeInfo* iexchange) +icommunicate(IExchangeInfo* iex, MemoryManagement mem) { auto scoped = prof.scoped("icommunicate"); DIY_UNUSED(scoped); log->debug("Entering icommunicate()"); - // lock out other threads - // TODO: not threaded yet - // if (!CAS(comm_flag, 0, 1)) - // return; - - // debug -// log->info("out_queues_limit: {}", out_queues_limit); - - // order gids - auto gid_order = order_gids(); // exchange - comm_exchange(gid_order, iexchange); + comm_exchange(gid_order, mem, iex); // cleanup @@ -893,48 +969,58 @@ diy::Master:: send_queue(int from_gid, int to_gid, int to_proc, - MemoryBuffer& out_queue, + QueueRecord& qr, bool remote, - IExchangeInfo* iexchange) + MemoryManagement mem, + IExchangeInfo* iex) { stats::Annotation::Guard gb( stats::Annotation("diy.block").set(from_gid) ); stats::Annotation::Guard gt( stats::Annotation("diy.to").set(to_gid) ); - stats::Annotation::Guard gq( stats::Annotation("diy.q-size").set(stats::Variant(static_cast<uint64_t>(out_queue.size()))) ); + stats::Annotation::Guard gq( stats::Annotation("diy.q-size").set(stats::Variant(static_cast<uint64_t>(qr.size()))) ); // skip empty queues and hold queues shorter than some limit for some time - if ( iexchange && (out_queue.size() == 0 || iexchange->hold(out_queue.size())) ) - return; - log->debug("[{}] Sending queue: {} <- {} of size {}, iexchange = {}", comm_.rank(), to_gid, from_gid, out_queue.size(), iexchange ? 1 : 0); - - if (iexchange) - iexchange->time_stamp_send(); // hold time begins counting from now + assert(!iex || qr.size() != 0); + log->debug("[{}] Sending queue: {} <- {} of size {}, iexchange = {}", comm_.rank(), to_gid, from_gid, qr.size(), iex ? 1 : 0); if (to_proc == comm_.rank()) // sending to same rank, simply swap buffers - send_same_rank(from_gid, to_gid, out_queue, iexchange); + send_same_rank(from_gid, to_gid, qr, mem, iex); else // sending to an actual message to a different rank - send_different_rank(from_gid, to_gid, to_proc, out_queue, remote, iexchange); + send_different_rank(from_gid, to_gid, to_proc, qr, remote, iex); } void diy::Master:: send_outgoing_queues(GidSendOrder& gid_order, bool remote, // TODO: are remote and iexchange mutually exclusive? If so, use single enum? - IExchangeInfo* iexchange) + MemoryManagement mem, + IExchangeInfo* iex) { auto scoped = prof.scoped("send-outgoing-queues"); DIY_UNUSED(scoped); - if (iexchange) // for iexchange, send queues from a single block + if (iex) // for iex, send queues from a single block { - OutgoingQueues& outgoing = outgoing_[iexchange->from_gid].queues; - for (OutgoingQueues::iterator it = outgoing.begin(); it != outgoing.end(); ++it) + for (int from : gid_order.list) { - BlockID to_block = it->first; - int to_gid = to_block.gid; - int to_proc = to_block.proc; + OutgoingQueues& outgoing = this->outgoing(from); + for (auto& x : outgoing) + { + BlockID to_block = x.first; + int to_gid = to_block.gid; + int to_proc = to_block.proc; - log->debug("Processing queue: {} <- {} of size {}", to_gid, iexchange->from_gid, outgoing_[iexchange->from_gid].queues[to_block].size()); - send_queue(iexchange->from_gid, to_gid, to_proc, it->second, remote, iexchange); + auto access = x.second.access(); + while (!access->empty()) + { + auto qr = std::move(access->front()); + access->pop_front(); + access.unlock(); // others can push on this queue, while we are working + assert(!qr.external()); + log->debug("Processing queue: {} <- {} of size {}", to_gid, from, qr.size()); + send_queue(from, to_gid, to_proc, qr, remote, mem, iex); + access.lock(); + } + } } } else // normal mode: send all outgoing queues @@ -943,21 +1029,24 @@ send_outgoing_queues(GidSendOrder& gid_order, { int from_gid = gid_order.pop(); - // move external queues going to our rank - move_external_local(from_gid); - - if (outgoing_[from_gid].external != -1) - load_outgoing(from_gid); + load_outgoing(from_gid); - OutgoingQueues& outgoing = outgoing_[from_gid].queues; - for (OutgoingQueues::iterator it = outgoing.begin(); it != outgoing.end(); ++it) + OutgoingQueues& outgoing = outgoing_[from_gid]; + for (auto& x : outgoing) { - BlockID to_block = it->first; + BlockID to_block = x.first; int to_gid = to_block.gid; int to_proc = to_block.proc; - log->debug("Processing queue: {} <- {} of size {}", to_gid, from_gid, outgoing_[from_gid].queues[to_block].size()); - send_queue(from_gid, to_gid, to_proc, it->second, remote, iexchange); + auto access = x.second.access(); + if (access->empty()) + continue; + + // NB: send only front + auto& qr = access->front(); + log->debug("Processing queue: {} <- {} of size {}", to_gid, from_gid, qr.size()); + send_queue(from_gid, to_gid, to_proc, qr, remote, mem, iex); + access->pop_front(); } } } @@ -965,89 +1054,45 @@ send_outgoing_queues(GidSendOrder& gid_order, void diy::Master:: -move_external_local(int from) +send_same_rank(int from, int to, QueueRecord& qr, MemoryManagement mem, IExchangeInfo*) { - IncomingRound& current_incoming = incoming_[exchange_round_]; + auto scoped = prof.scoped("send-same-rank"); - // deal with external_local queues - for (auto& x : outgoing_[from].external_local) - { - int to = x.first.gid; + log->debug("Moving queue in-place: {} <- {}", to, from); - log->debug("Processing local queue: {} <- {} of size {}", to, from, x.second.size); + IncomingRound& current_incoming = incoming_[exchange_round_]; - QueueRecord& in_qr = current_incoming.map[to].records[from]; - bool to_external = block(lid(to)) == 0; + auto access_incoming = current_incoming.map[to][from].access(); - if (to_external) - in_qr = x.second; - else - { - // load the queue - in_qr.size = x.second.size; - in_qr.external = -1; + // save blobs to copy them explicitly + std::vector<BinaryBlob> blobs; + qr.buffer().blobs.swap(blobs); + qr.buffer().blob_position = 0; - MemoryBuffer bb; - storage_->get(x.second.external, bb); + access_incoming->emplace_back(std::move(qr)); + QueueRecord& in_qr = access_incoming->back(); - current_incoming.map[to].queues[from].swap(bb); - } - current_incoming.received++; + // copy blobs explicitly; we cannot just move them in place, since we don't + // own their memory and must guarantee that it's safe to free, once + // exchange() is done + for (BinaryBlob& blob : blobs) + { + char* p = mem.allocate(to, blob.size); + mem.copy(p, blob.pointer.get(), blob.size); + in_qr.buffer().save_binary_blob(p, blob.size, mem.deallocate); } - outgoing_[from].external_local.clear(); -} - -void -diy::Master:: -send_same_rank(int from, int to, MemoryBuffer& bb, IExchangeInfo* iexchange) -{ - auto scoped = prof.scoped("send-same-rank"); - - log->debug("Moving queue in-place: {} <- {}", to, from); - - IncomingRound& current_incoming = incoming_[exchange_round_]; - QueueRecord& in_qr = current_incoming.map[to].records[from]; - bool to_external = block(lid(to)) == 0; - if (to_external) - { - log->debug("Unloading outgoing directly as incoming: {} <- {}", to, from); - in_qr.size = bb.size(); - if (queue_policy_->unload_incoming(*this, from, to, in_qr.size)) - in_qr.external = storage_->put(bb); - else - { - MemoryBuffer& in_bb = current_incoming.map[to].queues[from]; - if (!iexchange) - { - in_bb.swap(bb); - in_bb.reset(); - } - else - { - iexchange->not_done(to); - in_bb.append_binary(&bb.buffer[0], bb.size()); - bb.clear(); - } - in_qr.external = -1; - } - } else // !to_external + if (!in_qr.external()) { - log->debug("Swapping in memory: {} <- {}", to, from); - MemoryBuffer& in_bb = current_incoming.map[to].queues[from]; - if (!iexchange) - { - in_bb.swap(bb); - in_bb.reset(); - } - else + in_qr.reset(); + + bool to_external = block(lid(to)) == 0; + if (to_external) { - iexchange->not_done(to); - in_bb.append_binary(&bb.buffer[0], bb.size()); - bb.wipe(); + log->debug("Unloading outgoing directly as incoming: {} <- {}", to, from); + if (queue_policy_->unload_incoming(*this, from, to, in_qr.size())) + in_qr.unload(storage_); } - in_qr.size = in_bb.size(); - in_qr.external = -1; } ++current_incoming.received; @@ -1055,17 +1100,18 @@ send_same_rank(int from, int to, MemoryBuffer& bb, IExchangeInfo* iexchange) void diy::Master:: -send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, IExchangeInfo* iexchange) +send_different_rank(int from, int to, int proc, QueueRecord& qr, bool remote, IExchangeInfo* iex) { auto scoped = prof.scoped("send-different-rank"); + assert(!qr.external()); + static const size_t MAX_MPI_MESSAGE_COUNT = INT_MAX; // sending to a different rank - std::shared_ptr<MemoryBuffer> buffer = std::make_shared<MemoryBuffer>(); - buffer->swap(bb); + std::shared_ptr<MemoryBuffer> buffer = std::make_shared<MemoryBuffer>(qr.move()); - MessageInfo info{from, to, 1, exchange_round_}; + MessageInfo info{from, to, 1, exchange_round_, static_cast<int>(buffer->nblobs())}; // size fits in one message if (Serialization<MemoryBuffer>::size(*buffer) + Serialization<MessageInfo>::size(info) <= MAX_MPI_MESSAGE_COUNT) { @@ -1075,15 +1121,8 @@ send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, I auto& inflight_send = inflight_sends().back(); inflight_send.info = info; - if (remote || iexchange) - { - if (iexchange) - { - iexchange->inc_work(); - log->debug("[{}] Incrementing work when sending queue\n", comm_.rank()); - } + if (remote || iex) inflight_send.request = comm_.issend(proc, tags::queue, buffer->buffer); - } else inflight_send.request = comm_.isend(proc, tags::queue, buffer->buffer); inflight_send.message = buffer; @@ -1098,23 +1137,27 @@ send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, I diy::save(*hb, buffer->size()); diy::save(*hb, info); - inflight_sends().emplace_back(); - auto& inflight_send = inflight_sends().back(); - - inflight_send.info = info; - if (remote || iexchange) { - // add one unit of work for the entire large message (upon sending the head, not the individual pieces below) - if (iexchange) - { - iexchange->inc_work(); - log->debug("[{}] Incrementing work when sending the leading piece\n", comm_.rank()); - } - inflight_send.request = comm_.issend(proc, tags::queue, hb->buffer); + inflight_sends().emplace_back(); + auto& inflight_send = inflight_sends().back(); + + inflight_send.info = info; + if (remote || iex) + { + // add one unit of work for the entire large message (upon sending the head, not the individual pieces below) + if (iex) + { + iex->inc_work(); + log->debug("[{}] Incrementing work when sending the leading piece\n", comm_.rank()); + } + inflight_send.request = comm_.issend(proc, tags::queue, hb->buffer); + } + else + { + inflight_send.request = comm_.isend(proc, tags::queue, hb->buffer); + } + inflight_send.message = hb; } - else - inflight_send.request = comm_.isend(proc, tags::queue, hb->buffer); - inflight_send.message = hb; // send the message pieces size_t msg_buff_idx = 0; @@ -1128,11 +1171,11 @@ send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, I auto& inflight_send = inflight_sends().back(); inflight_send.info = info; - if (remote || iexchange) + if (remote || iex) { - if (iexchange) + if (iex) { - iexchange->inc_work(); + iex->inc_work(); log->debug("[{}] Incrementing work when sending non-leading piece\n", comm_.rank()); } inflight_send.request = comm_.issend(proc, tags::queue, window); @@ -1142,11 +1185,33 @@ send_different_rank(int from, int to, int proc, MemoryBuffer& bb, bool remote, I inflight_send.message = buffer; } } // large message broken into pieces + + // send binary blobs + for (size_t i = 0; i < buffer->nblobs(); ++i) + { + auto blob = buffer->load_binary_blob(); + assert(blob.size < MAX_MPI_MESSAGE_COUNT); // for now assume blobs are small enough that we don't need to break them into multiple parts + + inflight_sends().emplace_back(); + auto& inflight_send = inflight_sends().back(); + + inflight_send.info = info; + + detail::VectorWindow<char> window; + window.begin = const_cast<char*>(blob.pointer.get()); + window.count = blob.size; + + if (remote || iex) + inflight_send.request = comm_.issend(proc, tags::queue, window); + else + inflight_send.request = comm_.isend(proc, tags::queue, window); + inflight_send.blob = std::move(blob); + } } void diy::Master:: -check_incoming_queues(IExchangeInfo* iexchange) +check_incoming_queues(MemoryManagement mem, IExchangeInfo* iex) { auto scoped = prof.scoped("check-incoming-queues"); DIY_UNUSED(scoped); @@ -1155,12 +1220,13 @@ check_incoming_queues(IExchangeInfo* iexchange) while (ostatus) { InFlightRecv& ir = inflight_recv(ostatus->source()); + ir.mem = mem; - if (iexchange) - iexchange->inc_work(); // increment work before sender's issend request can complete (so we are now responsible for the queue) + if (iex) + iex->inc_work(); // increment work before sender's issend request can complete (so we are now responsible for the queue) bool first_message = ir.recv(comm_, *ostatus); // possibly partial recv, in case of a multi-piece message - if (!first_message && iexchange) - iexchange->dec_work(); + if (!first_message && iex) + iex->dec_work(); if (ir.done) // all pieces assembled { @@ -1170,7 +1236,7 @@ check_incoming_queues(IExchangeInfo* iexchange) bool unload = ((ir.info.round == exchange_round_) ? (block(lid(ir.info.to)) == 0) : (limit_ != -1)) && queue_policy_->unload_incoming(*this, ir.info.from, ir.info.to, ir.message.size()); - ir.place(in, unload, storage_, iexchange); + ir.place(in, unload, storage_, iex); ir.reset(); } @@ -1180,7 +1246,7 @@ check_incoming_queues(IExchangeInfo* iexchange) void diy::Master:: -flush(bool remote) +flush(bool remote, MemoryManagement mem) { #ifdef DEBUG time_type start = get_time(); @@ -1194,13 +1260,13 @@ flush(bool remote) if (remote) - rcomm_exchange(); + rcomm_exchange(mem); else { auto gid_order = order_gids(); do { - comm_exchange(gid_order); + comm_exchange(gid_order, mem); #ifdef DEBUG time_type cur = get_time(); @@ -1217,14 +1283,13 @@ flush(bool remote) outgoing_.clear(); log->debug("Done in flush"); - //show_incoming_records(); process_collectives(); } bool diy::Master:: -nudge(IExchangeInfo* iexchange) +nudge(IExchangeInfo* iex) { bool success = false; for (InFlightSendsList::iterator it = inflight_sends().begin(); it != inflight_sends().end();) @@ -1234,10 +1299,10 @@ nudge(IExchangeInfo* iexchange) { success = true; it = inflight_sends().erase(it); - if (iexchange) + if (iex) { - log->debug("[{}] message left, decrementing work", iexchange->comm.rank()); - iexchange->dec_work(); // this message is receiver's responsibility now + log->debug("[{}] message left, decrementing work", iex->comm.rank()); + iex->dec_work(); // this message is receiver's responsibility now } } else @@ -1248,33 +1313,4 @@ nudge(IExchangeInfo* iexchange) return success; } -void -diy::Master:: -show_incoming_records() const -{ - for (IncomingRoundMap::const_iterator rounds_itr = incoming_.begin(); rounds_itr != incoming_.end(); ++rounds_itr) - { - for (IncomingQueuesMap::const_iterator it = rounds_itr->second.map.begin(); it != rounds_itr->second.map.end(); ++it) - { - const IncomingQueuesRecords& in_qrs = it->second; - for (InQueueRecords::const_iterator cur = in_qrs.records.begin(); cur != in_qrs.records.end(); ++cur) - { - const QueueRecord& qr = cur->second; - log->info("round: {}, {} <- {}: (size,external) = ({},{})", - rounds_itr->first, - it->first, cur->first, - qr.size, - qr.external); - } - for (IncomingQueues::const_iterator cur = in_qrs.queues.begin(); cur != in_qrs.queues.end(); ++cur) - { - log->info("round: {}, {} <- {}: queue.size() = {}", - rounds_itr->first, - it->first, cur->first, - const_cast<IncomingQueuesRecords&>(in_qrs).queues[cur->first].size()); - } - } - } -} - #endif diff --git a/include/vtkdiy2/mpi.hpp b/include/vtkdiy2/mpi.hpp index a1f19908f9884ffbffe2c599bf60a43f4a73e9fe..cac3d47d527c5942c660741726126ca5648a3115 100644 --- a/include/vtkdiy2/mpi.hpp +++ b/include/vtkdiy2/mpi.hpp @@ -1,14 +1,9 @@ #ifndef DIY_MPI_HPP #define DIY_MPI_HPP -#ifndef DIY_NO_MPI -#include <vtk_mpi.h> -#else -#include "mpi/no-mpi.hpp" -#endif - -#include "mpi/constants.hpp" +#include "mpi/config.hpp" #include "mpi/datatypes.hpp" +#include "mpi/environment.hpp" #include "mpi/optional.hpp" #include "mpi/status.hpp" #include "mpi/request.hpp" @@ -18,54 +13,4 @@ #include "mpi/io.hpp" #include "mpi/window.hpp" -namespace diy -{ -namespace mpi -{ - -//! \ingroup MPI -struct environment -{ - inline environment(int threading = MPI_THREAD_FUNNELED); - inline environment(int argc, char* argv[], int threading = MPI_THREAD_FUNNELED); - inline ~environment(); - - int threading() const { return provided_threading; } - - int provided_threading; -}; - -} -} - -diy::mpi::environment:: -environment(int threading) -{ -#ifndef DIY_NO_MPI - int argc = 0; char** argv; - MPI_Init_thread(&argc, &argv, threading, &provided_threading); -#else - provided_threading = threading; -#endif -} - -diy::mpi::environment:: -environment(int argc, char* argv[], int threading) -{ -#ifndef DIY_NO_MPI - MPI_Init_thread(&argc, &argv, threading, &provided_threading); -#else - (void) argc; (void) argv; - provided_threading = threading; -#endif -} - -diy::mpi::environment:: -~environment() -{ -#ifndef DIY_NO_MPI - MPI_Finalize(); -#endif -} - -#endif +#endif // DIY_MPI_HPP diff --git a/include/vtkdiy2/mpi/collectives.cpp b/include/vtkdiy2/mpi/collectives.cpp new file mode 100644 index 0000000000000000000000000000000000000000..1de4be4d197891674ef3e3c6d2d5db6115eaa27b --- /dev/null +++ b/include/vtkdiy2/mpi/collectives.cpp @@ -0,0 +1,161 @@ +#ifdef DIY_MPI_AS_LIB +#include "collectives.hpp" +#endif + +namespace diy +{ +namespace mpi +{ +namespace detail +{ + +inline void copy_buffer(const void* src, void* dst, size_t size, int count) +{ + if (src != dst) + { + std::copy_n(static_cast<const int8_t*>(src), + size * static_cast<size_t>(count), + static_cast<int8_t*>(dst)); + } +} + +void broadcast(const communicator& comm, void* data, int count, const datatype& type, int root) +{ +#if DIY_HAS_MPI + MPI_Bcast(data, count, mpi_cast(type.handle), root, mpi_cast(comm.handle())); +#else + (void) comm; (void) data; (void) count; (void) type; (void) root; +#endif +} + +request ibroadcast(const communicator& comm, void* data, int count, const datatype& type, int root) +{ + request r; +#if DIY_HAS_MPI + MPI_Ibcast(data, count, mpi_cast(type.handle), root, mpi_cast(comm.handle()), &mpi_cast(r.handle)); +#else + (void) comm; (void) data; (void) count; (void) type; (void) root; +#endif + return r; +} + +void gather(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut, + int root) +{ +#if DIY_HAS_MPI + MPI_Gather(dataIn, count, mpi_cast(type.handle), + dataOut, count, mpi_cast(type.handle), + root, mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; (void)root; +#endif +} + +void gather_v(const communicator& comm, + const void* dataIn, int countIn, const datatype& type, + void* dataOut, const int counts[], const int offsets[], + int root) +{ +#if DIY_HAS_MPI + MPI_Gatherv(dataIn, countIn, mpi_cast(type.handle), + dataOut, counts, offsets, mpi_cast(type.handle), + root, mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), countIn); + (void)comm; (void)counts, (void)offsets, (void)root; +#endif +} + +void all_gather(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut) +{ +#if DIY_HAS_MPI + MPI_Allgather(dataIn, count, mpi_cast(type.handle), + dataOut, count, mpi_cast(type.handle), + mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; +#endif +} + +void all_gather_v(const communicator& comm, + const void* dataIn, int countIn, const datatype& type, + void* dataOut, const int counts[], const int offsets[]) +{ +#if DIY_HAS_MPI + MPI_Allgatherv(dataIn, countIn, mpi_cast(type.handle), + dataOut, counts, offsets, mpi_cast(type.handle), + mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), countIn); + (void)comm; (void)counts; (void)offsets; +#endif +} + +void reduce(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut, + const operation& op, int root) +{ +#if DIY_HAS_MPI + MPI_Reduce(dataIn, dataOut, count, mpi_cast(type.handle), mpi_cast(op.handle), root, mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; (void)op; (void)root; +#endif +} + +void all_reduce(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op) +{ +#if DIY_HAS_MPI + MPI_Allreduce(dataIn, dataOut, count, mpi_cast(type.handle), mpi_cast(op.handle), mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; (void)op; +#endif +} + +request iall_reduce(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op) +{ + request r; +#if DIY_HAS_MPI + MPI_Iallreduce(dataIn, dataOut, count, mpi_cast(type.handle), mpi_cast(op.handle), mpi_cast(comm.handle()), &mpi_cast(r.handle)); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; (void)op; +#endif + return r; +} + +void scan(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op) +{ +#if DIY_HAS_MPI + MPI_Scan(dataIn, dataOut, count, mpi_cast(type.handle), mpi_cast(op.handle), mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; (void)op; +#endif +} + +void all_to_all(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut) +{ +#if DIY_HAS_MPI + MPI_Alltoall(dataIn, count, mpi_cast(type.handle), dataOut, count, mpi_cast(type.handle), mpi_cast(comm.handle())); +#else + copy_buffer(dataIn, dataOut, mpi_cast(type.handle), count); + (void)comm; +#endif +} + +} +} +} // diy::mpi::detail diff --git a/include/vtkdiy2/mpi/collectives.hpp b/include/vtkdiy2/mpi/collectives.hpp index 226a65f894c812fd13407a41d04c647f904643af..5f1490c80c0d51282105e24f76e0b4ae84b9d3f4 100644 --- a/include/vtkdiy2/mpi/collectives.hpp +++ b/include/vtkdiy2/mpi/collectives.hpp @@ -1,12 +1,80 @@ -#include <vector> +#ifndef DIY_MPI_COLLECTIVES_HPP +#define DIY_MPI_COLLECTIVES_HPP -#include "../constants.h" // for DIY_UNUSED. +#include "config.hpp" +#include "communicator.hpp" +#include "datatypes.hpp" #include "operations.hpp" +#include "request.hpp" + +#include <algorithm> +#include <vector> +#include <numeric> namespace diy { namespace mpi { + +namespace detail +{ + +DIY_MPI_EXPORT_FUNCTION +void broadcast(const communicator& comm, + void* data, int count, const datatype& type, + int root); + +DIY_MPI_EXPORT_FUNCTION +request ibroadcast(const communicator& comm, + void* data, int count, const datatype& type, + int root); + +DIY_MPI_EXPORT_FUNCTION +void gather(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut, + int root); + +DIY_MPI_EXPORT_FUNCTION +void gather_v(const communicator& comm, + const void* dataIn, int countIn, const datatype& type, + void* dataOut, const int counts[], const int offsets[], + int root); + +DIY_MPI_EXPORT_FUNCTION +void all_gather(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut); + +DIY_MPI_EXPORT_FUNCTION +void all_gather_v(const communicator& comm, + const void* dataIn, int countIn, const datatype& type, + void* dataOut, const int counts[], const int offsets[]); + +DIY_MPI_EXPORT_FUNCTION +void reduce(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut, + const operation& op, int root); + +DIY_MPI_EXPORT_FUNCTION +void all_reduce(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op); + +DIY_MPI_EXPORT_FUNCTION +request iall_reduce(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op); + +DIY_MPI_EXPORT_FUNCTION +void scan(const communicator& comm, + const void* dataIn, void* dataOut, int count, const datatype& type, + const operation& op); + +DIY_MPI_EXPORT_FUNCTION +void all_to_all(const communicator& comm, + const void* dataIn, int count, const datatype& type, void* dataOut); + +} // detail + //!\addtogroup MPI //!@{ @@ -15,288 +83,169 @@ namespace mpi { static void broadcast(const communicator& comm, T& x, int root) { -#ifndef DIY_NO_MPI - MPI_Bcast(address(x), count(x), datatype(x), root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(x); - DIY_UNUSED(root); -#endif + detail::broadcast(comm, address(x), count(x), datatype_of(x), root); } static void broadcast(const communicator& comm, std::vector<T>& x, int root) { -#ifndef DIY_NO_MPI size_t sz = x.size(); - Collectives<size_t, void*>::broadcast(comm, sz, root); + detail::broadcast(comm, &sz, 1, datatype_of(sz), root); if (comm.rank() != root) x.resize(sz); - MPI_Bcast(address(x), count(x), datatype(x), root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(x); - DIY_UNUSED(root); -#endif + detail::broadcast(comm, address(x), count(x), datatype_of(x), root); } static request ibroadcast(const communicator& comm, T& x, int root) { -#ifndef DIY_NO_MPI - request r; - MPI_Ibcast(address(x), count(x), datatype(x), root, comm, &r.r); - return r; -#else - DIY_UNUSED(comm); - DIY_UNUSED(x); - DIY_UNUSED(root); - DIY_UNSUPPORTED_MPI_CALL(MPI_Ibcast); -#endif + return detail::ibroadcast(comm, address(x), count(x), datatype_of(x), root); } static void gather(const communicator& comm, const T& in, std::vector<T>& out, int root) { out.resize(comm.size()); -#ifndef DIY_NO_MPI - MPI_Gather(address(in), count(in), datatype(in), address(out), count(in), datatype(out), root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(root); - out[0] = in; -#endif + detail::gather(comm, address(in), count(in), datatype_of(in), address(out), root); } static void gather(const communicator& comm, const std::vector<T>& in, std::vector< std::vector<T> >& out, int root) { -#ifndef DIY_NO_MPI - std::vector<int> counts(comm.size()); + std::vector<int> counts; + if (comm.rank() == root) + { + counts.resize(static_cast<size_t>(comm.size())); + } + Collectives<int,void*>::gather(comm, count(in), counts, root); - std::vector<int> offsets(comm.size(), 0); - for (unsigned i = 1; i < offsets.size(); ++i) - offsets[i] = offsets[i-1] + counts[i-1]; + std::vector<int> offsets; + if (comm.rank() == root) + { + offsets.resize(counts.size()); + offsets[0] = 0; + std::partial_sum(counts.begin(), counts.end() - 1, offsets.begin() + 1); + } int elem_size = count(in[0]); // size of 1 vector element in units of mpi datatype - std::vector<T> buffer((offsets.back() + counts.back()) / elem_size); - MPI_Gatherv(address(in), count(in), datatype(in), - address(buffer), - &counts[0], - &offsets[0], - datatype(buffer), - root, comm); + std::vector<T> buffer; + if (comm.rank() == root) + { + buffer.resize((offsets.back() + counts.back()) / elem_size); + } - out.resize(comm.size()); - size_t cur = 0; - for (unsigned i = 0; i < (unsigned)comm.size(); ++i) + detail::gather_v(comm, address(in), count(in), datatype_of(in), + address(buffer), counts.data(), offsets.data(), + root); + + if (comm.rank() == root) { - out[i].reserve(counts[i] / elem_size); - for (unsigned j = 0; j < (unsigned)(counts[i] / elem_size); ++j) - out[i].push_back(buffer[cur++]); + out.resize(static_cast<size_t>(comm.size())); + size_t offset = 0; + for (size_t i = 0; i < out.size(); ++i) + { + auto count = static_cast<size_t>(counts[i] / elem_size); + out[i].insert(out[i].end(), buffer.data() + offset, buffer.data() + offset + count); + offset += count; + } } -#else - DIY_UNUSED(comm); - DIY_UNUSED(root); - out.resize(1); - out[0] = in; -#endif } static void gather(const communicator& comm, const T& in, int root) { -#ifndef DIY_NO_MPI - MPI_Gather(address(in), count(in), datatype(in), address(in), count(in), datatype(in), root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(in); - DIY_UNUSED(root); - DIY_UNSUPPORTED_MPI_CALL("MPI_Gather"); -#endif + detail::gather(comm, address(in), count(in), datatype_of(in), address(in), root); } static void gather(const communicator& comm, const std::vector<T>& in, int root) { -#ifndef DIY_NO_MPI Collectives<int,void*>::gather(comm, count(in), root); - - MPI_Gatherv(address(in), count(in), datatype(in), - 0, 0, 0, - datatype(in), - root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(in); - DIY_UNUSED(root); - DIY_UNSUPPORTED_MPI_CALL("MPI_Gatherv"); -#endif + detail::gather_v(comm, address(in), count(in), datatype_of(in), 0, 0, 0, root); } static void all_gather(const communicator& comm, const T& in, std::vector<T>& out) { out.resize(comm.size()); -#ifndef DIY_NO_MPI - MPI_Allgather(address(in), count(in), datatype(in), - address(out), count(in), datatype(in), - comm); -#else - DIY_UNUSED(comm); - out[0] = in; -#endif + detail::all_gather(comm, address(in), count(in), datatype_of(in), address(out)); } static void all_gather(const communicator& comm, const std::vector<T>& in, std::vector< std::vector<T> >& out) { -#ifndef DIY_NO_MPI - std::vector<int> counts(comm.size()); + std::vector<int> counts(static_cast<size_t>(comm.size())); Collectives<int,void*>::all_gather(comm, count(in), counts); - std::vector<int> offsets(comm.size(), 0); - for (unsigned i = 1; i < offsets.size(); ++i) - offsets[i] = offsets[i-1] + counts[i-1]; + std::vector<int> offsets(counts.size()); + offsets[0] = 0; + std::partial_sum(counts.begin(), counts.end() - 1, offsets.begin() + 1); int elem_size = count(in[0]); // size of 1 vector element in units of mpi datatype std::vector<T> buffer((offsets.back() + counts.back()) / elem_size); - MPI_Allgatherv(address(in), count(in), datatype(in), - address(buffer), - &counts[0], - &offsets[0], - datatype(buffer), - comm); - - out.resize(comm.size()); - size_t cur = 0; - for (int i = 0; i < comm.size(); ++i) + detail::all_gather_v(comm, + address(in), count(in), datatype_of(in), + address(buffer), + &counts[0], + &offsets[0]); + + out.resize(static_cast<size_t>(comm.size())); + size_t offset = 0; + for (size_t i = 0; i < out.size(); ++i) { - out[i].reserve(counts[i] / elem_size); - for (int j = 0; j < (int)(counts[i] / elem_size); ++j) - out[i].push_back(buffer[cur++]); + auto count = static_cast<size_t>(counts[i] / elem_size); + out[i].insert(out[i].end(), buffer.data() + offset, buffer.data() + offset + count); + offset += count; } -#else - DIY_UNUSED(comm); - out.resize(1); - out[0] = in; -#endif } static void reduce(const communicator& comm, const T& in, T& out, int root, const Op&) { -#ifndef DIY_NO_MPI - MPI_Reduce(address(in), address(out), count(in), datatype(in), - detail::mpi_op<Op>::get(), - root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(root); - out = in; -#endif + auto op = detail::mpi_op<Op>::get(); + detail::reduce(comm, address(in), count(in), datatype_of(in), address(out), op, root); } static void reduce(const communicator& comm, const T& in, int root, const Op&) { -#ifndef DIY_NO_MPI - MPI_Reduce(address(in), address(in), count(in), datatype(in), - detail::mpi_op<Op>::get(), - root, comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(in); - DIY_UNUSED(root); - DIY_UNSUPPORTED_MPI_CALL("MPI_Reduce"); -#endif + auto op = detail::mpi_op<Op>::get(); + detail::reduce(comm, address(in), count(in), datatype_of(in), address(in), op, root); } static void all_reduce(const communicator& comm, const T& in, T& out, const Op&) { -#ifndef DIY_NO_MPI - MPI_Allreduce(address(in), address(out), count(in), datatype(in), - detail::mpi_op<Op>::get(), - comm); -#else - DIY_UNUSED(comm); - out = in; -#endif + auto op = detail::mpi_op<Op>::get(); + detail::all_reduce(comm, address(in), address(out), count(in), datatype_of(in), op); } static void all_reduce(const communicator& comm, const std::vector<T>& in, std::vector<T>& out, const Op&) { -#ifndef DIY_NO_MPI + auto op = detail::mpi_op<Op>::get(); out.resize(in.size()); - MPI_Allreduce(address(in), address(out), count(in), - datatype(in), - detail::mpi_op<Op>::get(), - comm); -#else - DIY_UNUSED(comm); - out = in; -#endif + detail::all_reduce(comm, address(in), address(out), count(in), datatype_of(in), op); } static request iall_reduce(const communicator& comm, const T& in, T& out, const Op&) { -#ifndef DIY_NO_MPI - request r; - MPI_Iallreduce(address(in), address(out), count(in), datatype(in), - detail::mpi_op<Op>::get(), - comm, &r.r); - return r; -#else - DIY_UNUSED(comm); - DIY_UNUSED(in); - DIY_UNUSED(out); - DIY_UNSUPPORTED_MPI_CALL(MPI_Iallreduce); -#endif + auto op = detail::mpi_op<Op>::get(); + return detail::iall_reduce(comm, address(in), address(out), count(in), datatype_of(in), op); } static request iall_reduce(const communicator& comm, const std::vector<T>& in, std::vector<T>& out, const Op&) { -#ifndef DIY_NO_MPI - request r; + auto op = detail::mpi_op<Op>::get(); out.resize(in.size()); - MPI_Iallreduce(address(in), address(out), count(in), - datatype(in), - detail::mpi_op<Op>::get(), - comm, &r.r); - return r; -#else - DIY_UNUSED(comm); - DIY_UNUSED(in); - DIY_UNUSED(out); - DIY_UNSUPPORTED_MPI_CALL(MPI_Iallreduce); -#endif + return detail::iall_reduce(comm, address(in), address(out), count(in), datatype_of(in), op); } static void scan(const communicator& comm, const T& in, T& out, const Op&) { -#ifndef DIY_NO_MPI - MPI_Scan(address(in), address(out), count(in), datatype(in), - detail::mpi_op<Op>::get(), - comm); -#else - DIY_UNUSED(comm); - out = in; -#endif + auto op = detail::mpi_op<Op>::get(); + detail::scan(comm, address(in), address(out), count(in), datatype_of(in), op); } static void all_to_all(const communicator& comm, const std::vector<T>& in, std::vector<T>& out, int n = 1) { -#ifndef DIY_NO_MPI // n specifies how many elements go to/from every process from every process; // the sizes of in and out are expected to be n * comm.size() int elem_size = count(in[0]); // size of 1 vector element in units of mpi datatype // NB: this will fail if T is a vector - MPI_Alltoall(address(in), - elem_size * n, - datatype(in), - address(out), - elem_size * n, - datatype(out), - comm); -#else - DIY_UNUSED(comm); - DIY_UNUSED(n); - out = in; -#endif + detail::all_to_all(comm, address(in), elem_size * n, datatype_of(in), address(out)); } }; @@ -449,3 +398,9 @@ namespace mpi //!@} } } + +#ifndef DIY_MPI_AS_LIB +#include "collectives.cpp" +#endif + +#endif // DIY_MPI_COLLECTIVES_HPP diff --git a/include/vtkdiy2/mpi/communicator.cpp b/include/vtkdiy2/mpi/communicator.cpp new file mode 100644 index 0000000000000000000000000000000000000000..a3df545fdda36fb6d83897cf0b950381b818d5e2 --- /dev/null +++ b/include/vtkdiy2/mpi/communicator.cpp @@ -0,0 +1,130 @@ +#ifdef DIY_MPI_AS_LIB +#include "communicator.hpp" +#endif + +diy::mpi::communicator::communicator() + : comm_(make_DIY_MPI_Comm(MPI_COMM_WORLD)), rank_(0), size_(1), owner_(false) +{ +#if DIY_HAS_MPI + MPI_Comm_rank(mpi_cast(comm_), &rank_); + MPI_Comm_size(mpi_cast(comm_), &size_); +#endif +} + +diy::mpi::communicator:: +communicator(DIY_MPI_Comm comm, bool owner): + comm_(comm), rank_(0), size_(1), owner_(owner) +{ +#if DIY_HAS_MPI + if (mpi_cast(comm_) != MPI_COMM_NULL) + { + MPI_Comm_rank(mpi_cast(comm_), &rank_); + MPI_Comm_size(mpi_cast(comm_), &size_); + } +#endif +} + +#ifndef DIY_MPI_AS_LIB // only available in header-only mode +diy::mpi::communicator:: +communicator(MPI_Comm comm, bool owner): + comm_(comm), rank_(0), size_(1), owner_(owner) +{ +#if DIY_HAS_MPI + if (comm_ != MPI_COMM_NULL) + { + MPI_Comm_rank(comm_, &rank_); + MPI_Comm_size(comm_, &size_); + } +#endif +} +#endif + +void +diy::mpi::communicator:: +destroy() +{ +#if DIY_HAS_MPI + if (owner_) + MPI_Comm_free(&mpi_cast(comm_)); +#endif +} + +diy::mpi::status +diy::mpi::communicator:: +probe(int source, int tag) const +{ +#if DIY_HAS_MPI + status s; + MPI_Probe(source, tag, mpi_cast(comm_), &mpi_cast(s.handle)); + return s; +#else + (void) source; (void) tag; + DIY_UNSUPPORTED_MPI_CALL(MPI_Probe); +#endif +} + +diy::mpi::optional<diy::mpi::status> +diy::mpi::communicator:: +iprobe(int source, int tag) const +{ + (void) source; (void) tag; +#if DIY_HAS_MPI + status s; + int flag; + MPI_Iprobe(source, tag, mpi_cast(comm_), &flag, &mpi_cast(s.handle)); + if (flag) + return s; +#endif + return optional<status>(); +} + +void +diy::mpi::communicator:: +barrier() const +{ +#if DIY_HAS_MPI + MPI_Barrier(mpi_cast(comm_)); +#endif +} + +diy::mpi::communicator +diy::mpi::communicator:: +split(int color, int key) const +{ +#if DIY_HAS_MPI + DIY_MPI_Comm newcomm; + MPI_Comm_split(mpi_cast(comm_), color, key, &mpi_cast(newcomm)); + return communicator(newcomm, true); +#else + (void) color; (void) key; + return communicator(); +#endif +} + +diy::mpi::request +diy::mpi::communicator:: +ibarrier() const +{ +#if DIY_HAS_MPI + request r; + MPI_Ibarrier(mpi_cast(comm_), &mpi_cast(r.handle)); + return r; +#else + // this is not the ideal fix; in principle we should just return a status + // that tests true, but this requires redesigning some parts of our no-mpi + // handling + DIY_UNSUPPORTED_MPI_CALL(MPI_Ibarrier); +#endif +} + +void +diy::mpi::communicator:: +duplicate(const communicator& other) +{ +#if DIY_HAS_MPI + DIY_MPI_Comm newcomm; + MPI_Comm_dup(mpi_cast(other.comm_), &mpi_cast(newcomm)); + (*this) = communicator(newcomm,true); +#endif + (void) other; +} diff --git a/include/vtkdiy2/mpi/communicator.hpp b/include/vtkdiy2/mpi/communicator.hpp index 4b29c4aca19d5cb6b03d654f7a8c366d6531b2e9..a4facaa149fc24b9bc906cb1e7508af1e7f85643 100644 --- a/include/vtkdiy2/mpi/communicator.hpp +++ b/include/vtkdiy2/mpi/communicator.hpp @@ -1,3 +1,12 @@ +#ifndef DIY_MPI_COMMUNICATOR_HPP +#define DIY_MPI_COMMUNICATOR_HPP + +#include "config.hpp" +#include "optional.hpp" +#include "point-to-point.hpp" +#include "request.hpp" +#include "status.hpp" + namespace diy { namespace mpi @@ -8,8 +17,14 @@ namespace mpi class communicator { public: - inline - communicator(MPI_Comm comm = MPI_COMM_WORLD, bool owner = false); + DIY_MPI_EXPORT_FUNCTION + communicator(); + + communicator(DIY_MPI_Comm comm): + communicator(comm, false) {} + + DIY_MPI_EXPORT_FUNCTION + communicator(DIY_MPI_Comm comm, bool owner); ~communicator() { destroy(); } @@ -25,9 +40,19 @@ namespace mpi size_(other.size_), owner_(other.owner_) { other.owner_ = false; } - communicator& +#ifndef DIY_MPI_AS_LIB // only available in header-only mode + communicator(MPI_Comm comm): + communicator(comm, false) {} + + DIY_MPI_EXPORT_FUNCTION + communicator(MPI_Comm comm, bool owner); + + operator MPI_Comm() { return comm_; } +#endif + + communicator& operator=(const communicator& other) { destroy(); comm_ = other.comm_; rank_ = other.rank_; size_ = other.size_; owner_ = false; return *this; } - communicator& + communicator& operator=(communicator&& other) { destroy(); comm_ = other.comm_; rank_ = other.rank_; size_ = other.size_; owner_ = other.owner_; other.owner_ = false; return *this; } int rank() const { return rank_; } @@ -35,169 +60,74 @@ namespace mpi //! Send `x` to processor `dest` using `tag` (blocking). template<class T> - void send(int dest, int tag, const T& x) const { detail::send<T>()(comm_, dest, tag, x); } + void send(int dest, int tag, const T& x) const { detail::send(comm_, dest, tag, x); } + + template<class T> + void ssend(int dest, int tag, const T& x) const { detail::ssend(comm_, dest, tag, x); } //! Receive `x` from `dest` using `tag` (blocking). //! If `T` is an `std::vector<...>`, `recv` will resize it to fit exactly the sent number of values. template<class T> - status recv(int source, int tag, T& x) const { return detail::recv<T>()(comm_, source, tag, x); } + status recv(int source, int tag, T& x) const { return detail::recv(comm_, source, tag, x); } //! Non-blocking version of `send()`. template<class T> - request isend(int dest, int tag, const T& x) const { return detail::isend<T>()(comm_, dest, tag, x); } + request isend(int dest, int tag, const T& x) const { return detail::isend(comm_, dest, tag, x); } //! Non-blocking version of `ssend()`. template<class T> - request issend(int dest, int tag, const T& x) const { return detail::issend<T>()(comm_, dest, tag, x); } + request issend(int dest, int tag, const T& x) const { return detail::issend(comm_, dest, tag, x); } //! Non-blocking version of `recv()`. //! If `T` is an `std::vector<...>`, its size must be big enough to accommodate the sent values. template<class T> - request irecv(int source, int tag, T& x) const { return detail::irecv<T>()(comm_, source, tag, x); } + request irecv(int source, int tag, T& x) const { return detail::irecv(comm_, source, tag, x); } //! probe - inline + DIY_MPI_EXPORT_FUNCTION status probe(int source, int tag) const; //! iprobe - inline + DIY_MPI_EXPORT_FUNCTION optional<status> iprobe(int source, int tag) const; //! barrier - inline + DIY_MPI_EXPORT_FUNCTION void barrier() const; //! Nonblocking version of barrier - inline + DIY_MPI_EXPORT_FUNCTION request ibarrier() const; - operator MPI_Comm() const { return comm_; } - //! split //! When keys are the same, the ties are broken by the rank in the original comm. - inline + DIY_MPI_EXPORT_FUNCTION communicator split(int color, int key = 0) const; //! duplicate - inline + DIY_MPI_EXPORT_FUNCTION void duplicate(const communicator& other); + DIY_MPI_Comm handle() const { return comm_; } + private: - inline + DIY_MPI_EXPORT_FUNCTION void destroy(); private: - MPI_Comm comm_; - int rank_; - int size_; - bool owner_; + DIY_MPI_Comm comm_; + int rank_; + int size_; + bool owner_; }; -} -} -diy::mpi::communicator:: -communicator(MPI_Comm comm, bool owner): - comm_(comm), rank_(0), size_(1), owner_(owner) -{ -#ifndef DIY_NO_MPI - if (comm != MPI_COMM_NULL) - { - MPI_Comm_rank(comm_, &rank_); - MPI_Comm_size(comm_, &size_); - } -#endif } +} // diy::mpi -void -diy::mpi::communicator:: -destroy() -{ -#ifndef DIY_NO_MPI - if (owner_) - MPI_Comm_free(&comm_); +#ifndef DIY_MPI_AS_LIB +#include "communicator.cpp" #endif -} -diy::mpi::status -diy::mpi::communicator:: -probe(int source, int tag) const -{ - (void) source; - (void) tag; - -#ifndef DIY_NO_MPI - status s; - MPI_Probe(source, tag, comm_, &s.s); - return s; -#else - DIY_UNSUPPORTED_MPI_CALL(MPI_Probe); -#endif -} - -diy::mpi::optional<diy::mpi::status> -diy::mpi::communicator:: -iprobe(int source, int tag) const -{ - (void) source; - (void) tag; -#ifndef DIY_NO_MPI - status s; - int flag; - MPI_Iprobe(source, tag, comm_, &flag, &s.s); - if (flag) - return s; -#endif - return optional<status>(); -} - -void -diy::mpi::communicator:: -barrier() const -{ -#ifndef DIY_NO_MPI - MPI_Barrier(comm_); -#endif -} - -diy::mpi::communicator -diy::mpi::communicator:: -split(int color, int key) const -{ -#ifndef DIY_NO_MPI - MPI_Comm newcomm; - MPI_Comm_split(comm_, color, key, &newcomm); - return communicator(newcomm, true); -#else - return communicator(); -#endif -} - -diy::mpi::request -diy::mpi::communicator:: -ibarrier() const -{ -#ifndef DIY_NO_MPI - request r_; - MPI_Ibarrier(comm_, &r_.r); - return r_; -#else - // this is not the ideal fix; in principle we should just return a status - // that tests true, but this requires redesigning some parts of our no-mpi - // handling - DIY_UNSUPPORTED_MPI_CALL(MPI_Ibarrier); -#endif -} - - -void -diy::mpi::communicator:: -duplicate(const communicator& other) -{ -#ifndef DIY_NO_MPI - MPI_Comm newcomm; - MPI_Comm_dup(other.comm_, &newcomm); - (*this) = communicator(newcomm,true); -#endif -} +#endif // DIY_MPI_COMMUNICATOR_HPP diff --git a/include/vtkdiy2/mpi/config.hpp b/include/vtkdiy2/mpi/config.hpp new file mode 100644 index 0000000000000000000000000000000000000000..d9edb1ce326b34fc0bd23a3f2d64dff7da01896f --- /dev/null +++ b/include/vtkdiy2/mpi/config.hpp @@ -0,0 +1,85 @@ +#ifndef DIY_MPI_CONFIG_HPP +#define DIY_MPI_CONFIG_HPP + +#include <utility> + +/// We want to allow the use of `diy::mpi` in either header-only or library mode. +/// DIY_MPI_AS_LIB is defined when using library mode. +/// This file contains some configuration macros. To maintain backwards compatibility +/// suitable default values should be defined when using header-only mode. + +/// DIY_HAS_MPI should always be defined when DIY_MPI_AS_LIB is defined, but only for +/// the compilation units that are part of the library. +/// DIY_HAS_MPI=1 means MPI library is availalbe. +/// For header-only, the default is to assume MPI is available +#if !defined(DIY_MPI_AS_LIB) && !defined(DIY_HAS_MPI) +# define DIY_HAS_MPI 1 +#endif + +/// Include appropriate mpi header. Since DIY_HAS_MPI is only defined for +/// the compilation units of the library, when in library mode, the header is +/// only included for the library's compilation units. +#ifdef DIY_HAS_MPI +# if DIY_HAS_MPI +# include <vtk_mpi.h> +# else +# include "no-mpi.hpp" +# endif +#endif + +/// Classes and objects that need to be visible to clients of the library should be +/// marked as DIY_MPI_EXPORT. Similarly API functions should be marked as +/// DIY_MPI_EXPORT_FUNCTION. +#include "diy-mpi-export.h" // defines DIY_MPI_EXPORT and DIY_MPI_EXPORT_FUNCTION + +/// Define alisases for MPI types +#ifdef DIY_MPI_AS_LIB +# include "mpitypes.hpp" // only configured in library mode +#else // ifdef DIY_MPI_AS_LIB + +namespace diy +{ +namespace mpi +{ + +#define DEFINE_DIY_MPI_TYPE(mpitype) \ +struct DIY_##mpitype { \ + DIY_##mpitype() = default; \ + DIY_##mpitype(const mpitype& obj) : data(obj) {} \ + DIY_##mpitype& operator=(const mpitype& obj) { data = obj; return *this; } \ + operator mpitype() { return data; } \ + mpitype data; \ +}; + +#define DEFINE_DIY_MPI_TYPE_MOVE(mpitype) \ +struct DIY_##mpitype { \ + DIY_##mpitype() = default; \ + DIY_##mpitype(const mpitype&) = delete; \ + DIY_##mpitype(mpitype&& obj) : data(std::move(obj)) {} \ + DIY_##mpitype& operator=(const mpitype&) = delete; \ + DIY_##mpitype& operator=(mpitype&& obj) { data = std::move(obj); return *this; } \ + operator const mpitype&() const { return data; } \ + void reset() { data = mpitype(); } \ +private: \ + mpitype data; \ +}; + +DEFINE_DIY_MPI_TYPE(MPI_Comm) +DEFINE_DIY_MPI_TYPE(MPI_Datatype) +DEFINE_DIY_MPI_TYPE(MPI_Status) +DEFINE_DIY_MPI_TYPE(MPI_Request) +DEFINE_DIY_MPI_TYPE(MPI_Op) +DEFINE_DIY_MPI_TYPE(MPI_File) +DEFINE_DIY_MPI_TYPE_MOVE(MPI_Win) + +#undef DEFINE_DIY_MPI_TYPE + +} +} // diy::mpi +#endif // ifdef DIY_MPI_AS_LIB + +#ifdef DIY_HAS_MPI +# include "mpi_cast.hpp" +#endif + +#endif // DIY_MPI_CONFIG_HPP diff --git a/include/vtkdiy2/mpi/constants.hpp b/include/vtkdiy2/mpi/constants.hpp deleted file mode 100644 index 7668e418f19b779db966a66f4341b8625c242826..0000000000000000000000000000000000000000 --- a/include/vtkdiy2/mpi/constants.hpp +++ /dev/null @@ -1,13 +0,0 @@ -#ifndef DIY_MPI_CONSTANTS_HPP -#define DIY_MPI_CONSTANTS_HPP - -namespace diy -{ -namespace mpi -{ - const int any_source = MPI_ANY_SOURCE; - const int any_tag = MPI_ANY_TAG; -} -} - -#endif diff --git a/include/vtkdiy2/mpi/datatypes.cpp b/include/vtkdiy2/mpi/datatypes.cpp new file mode 100644 index 0000000000000000000000000000000000000000..434e13b66b837613af48ca7f815b048895bdd796 --- /dev/null +++ b/include/vtkdiy2/mpi/datatypes.cpp @@ -0,0 +1,34 @@ +#ifdef DIY_MPI_AS_LIB +#include "datatypes.hpp" +#endif + +namespace diy +{ +namespace mpi +{ + +namespace detail +{ + +#define DIY_MPI_DATATYPE_MAP(cpp_type, mpi_type) \ + template<> datatype get_mpi_datatype<cpp_type>() { \ + return datatype(make_DIY_MPI_Datatype(mpi_type)); \ + } + + DIY_MPI_DATATYPE_MAP(char, MPI_BYTE) + DIY_MPI_DATATYPE_MAP(unsigned char, MPI_BYTE) + DIY_MPI_DATATYPE_MAP(bool, MPI_BYTE) + DIY_MPI_DATATYPE_MAP(int, MPI_INT) + DIY_MPI_DATATYPE_MAP(unsigned, MPI_UNSIGNED) + DIY_MPI_DATATYPE_MAP(long, MPI_LONG) + DIY_MPI_DATATYPE_MAP(unsigned long, MPI_UNSIGNED_LONG) + DIY_MPI_DATATYPE_MAP(long long, MPI_LONG_LONG_INT) + DIY_MPI_DATATYPE_MAP(unsigned long long, MPI_UNSIGNED_LONG_LONG) + DIY_MPI_DATATYPE_MAP(float, MPI_FLOAT) + DIY_MPI_DATATYPE_MAP(double, MPI_DOUBLE) + +#undef DIY_MPI_DATATYPE_MAP + +} +} +} // diy::mpi::detail diff --git a/include/vtkdiy2/mpi/datatypes.hpp b/include/vtkdiy2/mpi/datatypes.hpp index ed89c6b62b5768c84eec4147b849f52cf5f7bd78..a8e2f807074786dc7c1707ffbf13c638ab8a4915 100644 --- a/include/vtkdiy2/mpi/datatypes.hpp +++ b/include/vtkdiy2/mpi/datatypes.hpp @@ -1,17 +1,32 @@ #ifndef DIY_MPI_DATATYPES_HPP #define DIY_MPI_DATATYPES_HPP +#include "config.hpp" + #include <vector> #include <array> +#include <cstddef> namespace diy { namespace mpi { -namespace detail + +struct datatype { - template<class T> MPI_Datatype get_mpi_datatype(); + datatype() = default; + datatype(const DIY_MPI_Datatype& dt) : handle(dt) {} + +#ifndef DIY_MPI_AS_LIB // only available in header-only mode + datatype(const MPI_Datatype& dt) : handle(dt) {} + operator MPI_Datatype() { return handle; } +#endif + + DIY_MPI_Datatype handle; +}; +namespace detail +{ struct true_type {}; struct false_type {}; @@ -19,30 +34,34 @@ namespace detail template<class T> struct is_mpi_datatype { typedef false_type type; }; -#define DIY_MPI_DATATYPE_MAP(cpp_type, mpi_type) \ - template<> inline MPI_Datatype get_mpi_datatype<cpp_type>() { return mpi_type; } \ - template<> struct is_mpi_datatype<cpp_type> { typedef true_type type; }; \ - template<> struct is_mpi_datatype< std::vector<cpp_type> > { typedef true_type type; }; \ - template<size_t D> \ - struct is_mpi_datatype< std::array<cpp_type,D> > { typedef true_type type; }; - - DIY_MPI_DATATYPE_MAP(char, MPI_BYTE); - DIY_MPI_DATATYPE_MAP(unsigned char, MPI_BYTE); - DIY_MPI_DATATYPE_MAP(bool, MPI_BYTE); - DIY_MPI_DATATYPE_MAP(int, MPI_INT); - DIY_MPI_DATATYPE_MAP(unsigned, MPI_UNSIGNED); - DIY_MPI_DATATYPE_MAP(long, MPI_LONG); - DIY_MPI_DATATYPE_MAP(unsigned long, MPI_UNSIGNED_LONG); - DIY_MPI_DATATYPE_MAP(long long, MPI_LONG_LONG_INT); - DIY_MPI_DATATYPE_MAP(unsigned long long, MPI_UNSIGNED_LONG_LONG); - DIY_MPI_DATATYPE_MAP(float, MPI_FLOAT); - DIY_MPI_DATATYPE_MAP(double, MPI_DOUBLE); + template<class T> datatype get_mpi_datatype(); + + #define DIY_MPI_DATATYPE_DEFAULT(cpp_type) \ + template<> DIY_MPI_EXPORT_FUNCTION datatype get_mpi_datatype<cpp_type>(); \ + template<> struct is_mpi_datatype< cpp_type > { typedef true_type type; }; \ + template<> struct is_mpi_datatype< std::vector<cpp_type> > { typedef true_type type; }; \ + template<size_t N> \ + struct is_mpi_datatype< std::array<cpp_type, N> > { typedef true_type type; }; + + DIY_MPI_DATATYPE_DEFAULT(char) + DIY_MPI_DATATYPE_DEFAULT(unsigned char) + DIY_MPI_DATATYPE_DEFAULT(bool) + DIY_MPI_DATATYPE_DEFAULT(int) + DIY_MPI_DATATYPE_DEFAULT(unsigned) + DIY_MPI_DATATYPE_DEFAULT(long) + DIY_MPI_DATATYPE_DEFAULT(unsigned long) + DIY_MPI_DATATYPE_DEFAULT(long long) + DIY_MPI_DATATYPE_DEFAULT(unsigned long long) + DIY_MPI_DATATYPE_DEFAULT(float) + DIY_MPI_DATATYPE_DEFAULT(double) + + #undef DIY_MPI_DATATYPE_DEFAULT /* mpi_datatype: helper routines, specialized for std::vector<...>, std::array<...> */ template<class T> struct mpi_datatype { - static MPI_Datatype datatype() { return get_mpi_datatype<T>(); } + static diy::mpi::datatype datatype() { return get_mpi_datatype<T>(); } static const void* address(const T& x) { return &x; } static void* address(T& x) { return &x; } static int count(const T&) { return 1; } @@ -53,7 +72,7 @@ namespace detail { typedef std::vector<U> VecU; - static MPI_Datatype datatype() { return mpi_datatype<U>::datatype(); } + static diy::mpi::datatype datatype() { return mpi_datatype<U>::datatype(); } static const void* address(const VecU& x) { return x.data(); } static void* address(VecU& x) { return x.data(); } static int count(const VecU& x) { return x.empty() ? 0 : (static_cast<int>(x.size()) * mpi_datatype<U>::count(x[0])); } @@ -64,7 +83,7 @@ namespace detail { typedef std::array<U,D> ArrayU; - static MPI_Datatype datatype() { return mpi_datatype<U>::datatype(); } + static diy::mpi::datatype datatype() { return mpi_datatype<U>::datatype(); } static const void* address(const ArrayU& x) { return x.data(); } static void* address(ArrayU& x) { return x.data(); } static int count(const ArrayU& x) { return x.empty() ? 0 : (static_cast<int>(x.size()) * mpi_datatype<U>::count(x[0])); } @@ -72,36 +91,34 @@ namespace detail } // detail template<class U> -static MPI_Datatype datatype(const U&) +static datatype datatype_of(const U&) { - using Datatype = detail::mpi_datatype<U>; - return Datatype::datatype(); + return detail::mpi_datatype<U>::datatype(); } template<class U> static void* address(const U& x) { - using Datatype = detail::mpi_datatype<U>; - return const_cast<void*>(Datatype::address(x)); + return const_cast<void*>(detail::mpi_datatype<U>::address(x)); } template<class U> static void* address(U& x) { - using Datatype = detail::mpi_datatype<U>; - return Datatype::address(x); + return detail::mpi_datatype<U>::address(x); } template<class U> static int count(const U& x) { - using Datatype = detail::mpi_datatype<U>; - return Datatype::count(x); + return detail::mpi_datatype<U>::count(x); } - - } // mpi } // diy +#ifndef DIY_MPI_AS_LIB +#include "datatypes.cpp" #endif + +#endif // DIY_MPI_DATATYPES_HPP diff --git a/include/vtkdiy2/mpi/diy-mpi-export.h b/include/vtkdiy2/mpi/diy-mpi-export.h new file mode 100644 index 0000000000000000000000000000000000000000..fb0e56111846e3e2ed8b3e6e29992ec8dcb6b956 --- /dev/null +++ b/include/vtkdiy2/mpi/diy-mpi-export.h @@ -0,0 +1,49 @@ +#ifndef DIY_MPI_EXPORT_H +#define DIY_MPI_EXPORT_H + +#if defined(_MSC_VER) +# ifdef DIY_MPI_STATIC_BUILD + /* This is a static component and has no need for exports + elf based static libraries are able to have hidden/default visibility + controls on symbols so we should propagate this information in that + use case + */ +# define DIY_MPI_EXPORT_DEFINE +# define DIY_MPI_IMPORT_DEFINE +# define DIY_MPI_NO_EXPORT_DEFINE +# else +# define DIY_MPI_EXPORT_DEFINE __declspec(dllexport) +# define DIY_MPI_IMPORT_DEFINE __declspec(dllimport) +# define DIY_MPI_NO_EXPORT_DEFINE +# endif +#else +# define DIY_MPI_EXPORT_DEFINE __attribute__((visibility("default"))) +# define DIY_MPI_IMPORT_DEFINE __attribute__((visibility("default"))) +# define DIY_MPI_NO_EXPORT_DEFINE __attribute__((visibility("hidden"))) +#endif + +#ifndef DIY_MPI_EXPORT +# if !defined(DIY_MPI_AS_LIB) +# define DIY_MPI_EXPORT +# define DIY_MPI_EXPORT_FUNCTION inline +# else +# if defined(DIY_HAS_MPI) + /* We are building this library */ +# define DIY_MPI_EXPORT DIY_MPI_EXPORT_DEFINE +# else + /* We are using this library */ +# define DIY_MPI_EXPORT DIY_MPI_IMPORT_DEFINE +# endif +# define DIY_MPI_EXPORT_FUNCTION DIY_MPI_EXPORT +# endif +#endif + +#ifndef DIY_MPI_EXPORT_FUNCTION +#error "DIY_MPI_EXPORT_FUNCTION not defined" +#endif + +#ifndef DIY_MPI_NO_EXPORT +# define DIY_MPI_NO_EXPORT DIY_MPI_NO_EXPORT_DEFINE +#endif + +#endif // DIY_MPI_EXPORT_H diff --git a/include/vtkdiy2/mpi/environment.cpp b/include/vtkdiy2/mpi/environment.cpp new file mode 100644 index 0000000000000000000000000000000000000000..e6ce48bdd518e8219465ed9e96eb0ea879ddc548 --- /dev/null +++ b/include/vtkdiy2/mpi/environment.cpp @@ -0,0 +1,62 @@ +#ifdef DIY_MPI_AS_LIB +#include "environment.hpp" +#endif + +bool diy::mpi::environment::initialized() +{ +#if DIY_HAS_MPI + int flag; + MPI_Initialized(&flag); + return flag != 0; +#else + return true; +#endif +} + +diy::mpi::environment::environment() +{ +#if DIY_HAS_MPI + int argc = 0; char** argv = nullptr; + MPI_Init_thread(&argc, &argv, MPI_THREAD_FUNNELED, &provided_threading); +#else + provided_threading = MPI_THREAD_FUNNELED; +#endif +} + +diy::mpi::environment::environment(int requested_threading) +{ +#if DIY_HAS_MPI + int argc = 0; char** argv = nullptr; + MPI_Init_thread(&argc, &argv, requested_threading, &provided_threading); +#else + provided_threading = requested_threading; +#endif +} + +diy::mpi::environment::environment(int argc, char* argv[]) +{ +#if DIY_HAS_MPI + MPI_Init_thread(&argc, &argv, MPI_THREAD_FUNNELED, &provided_threading); +#else + (void) argc; (void) argv; + provided_threading = MPI_THREAD_FUNNELED; +#endif +} + +diy::mpi::environment::environment(int argc, char* argv[], int requested_threading) +{ +#if DIY_HAS_MPI + MPI_Init_thread(&argc, &argv, requested_threading, &provided_threading); +#else + (void) argc; (void) argv; + provided_threading = requested_threading; +#endif +} + +diy::mpi::environment:: +~environment() +{ +#if DIY_HAS_MPI + MPI_Finalize(); +#endif +} diff --git a/include/vtkdiy2/mpi/environment.hpp b/include/vtkdiy2/mpi/environment.hpp new file mode 100644 index 0000000000000000000000000000000000000000..3ae52301a0bf3e630221edf4d05ec11f192b73fb --- /dev/null +++ b/include/vtkdiy2/mpi/environment.hpp @@ -0,0 +1,35 @@ +#ifndef DIY_MPI_ENVIRONMENT_HPP +#define DIY_MPI_ENVIRONMENT_HPP + +#include "config.hpp" + +namespace diy +{ +namespace mpi +{ + +//! \ingroup MPI +struct environment +{ + DIY_MPI_EXPORT_FUNCTION static bool initialized(); + + DIY_MPI_EXPORT_FUNCTION environment(); + DIY_MPI_EXPORT_FUNCTION environment(int requested_threading); + DIY_MPI_EXPORT_FUNCTION environment(int argc, char* argv[]); + DIY_MPI_EXPORT_FUNCTION environment(int argc, char* argv[], int requested_threading); + + DIY_MPI_EXPORT_FUNCTION ~environment(); + + int threading() const { return provided_threading; } + + int provided_threading; +}; + +} +} // diy::mpi + +#ifndef DIY_MPI_AS_LIB +#include "environment.cpp" +#endif + +#endif // DIY_MPI_ENVIRONMENT_HPP diff --git a/include/vtkdiy2/mpi/io.cpp b/include/vtkdiy2/mpi/io.cpp new file mode 100644 index 0000000000000000000000000000000000000000..37eb216f1e668050ab72b73594581feda4657614 --- /dev/null +++ b/include/vtkdiy2/mpi/io.cpp @@ -0,0 +1,222 @@ +#ifdef DIY_MPI_AS_LIB +#include "io.hpp" +#endif + +#include "status.hpp" + +#ifdef DIY_MPI_AS_LIB +const int diy::mpi::io::file::rdonly = MPI_MODE_RDONLY; +const int diy::mpi::io::file::rdwr = MPI_MODE_RDWR; +const int diy::mpi::io::file::wronly = MPI_MODE_WRONLY; +const int diy::mpi::io::file::create = MPI_MODE_CREATE; +const int diy::mpi::io::file::exclusive = MPI_MODE_EXCL; +const int diy::mpi::io::file::delete_on_close = MPI_MODE_DELETE_ON_CLOSE; +const int diy::mpi::io::file::unique_open = MPI_MODE_UNIQUE_OPEN; +const int diy::mpi::io::file::sequential = MPI_MODE_SEQUENTIAL; +const int diy::mpi::io::file::append = MPI_MODE_APPEND; +#endif + +diy::mpi::io::file:: +file(const communicator& comm__, const std::string& filename, int mode) +: comm_(comm__) +{ +#if DIY_HAS_MPI + int ret = MPI_File_open(diy::mpi::mpi_cast(comm__.handle()), const_cast<char*>(filename.c_str()), mode, MPI_INFO_NULL, &diy::mpi::mpi_cast(fh)); + if (ret) + throw std::runtime_error("DIY cannot open file: " + filename); +#else + (void)comm__; (void)filename; (void)mode; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_open); +#endif +} + +void +diy::mpi::io::file:: +close() +{ +#if DIY_HAS_MPI + if (diy::mpi::mpi_cast(fh) != MPI_FILE_NULL) + MPI_File_close(&diy::mpi::mpi_cast(fh)); +#endif +} + +diy::mpi::io::offset +diy::mpi::io::file:: +size() const +{ +#if DIY_HAS_MPI + MPI_Offset sz; + MPI_File_get_size(diy::mpi::mpi_cast(fh), &sz); + return static_cast<offset>(sz); +#else + DIY_UNSUPPORTED_MPI_CALL(MPI_File_get_size); +#endif +} + +void +diy::mpi::io::file:: +resize(diy::mpi::io::offset size_) +{ +#if DIY_HAS_MPI + MPI_File_set_size(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(size_)); +#else + (void)size_; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_set_size); +#endif +} + +void +diy::mpi::io::file:: +read_at(offset o, char* buffer, size_t size_) +{ +#if DIY_HAS_MPI + status s; + MPI_File_read_at(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(o), buffer, static_cast<int>(size_), MPI_BYTE, &diy::mpi::mpi_cast(s.handle)); +#else + (void)o; (void)buffer; (void)size_; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_read_at); +#endif +} + +void +diy::mpi::io::file:: +read_at_all(offset o, char* buffer, size_t size_) +{ +#if DIY_HAS_MPI + status s; + MPI_File_read_at_all(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(o), buffer, static_cast<int>(size_), MPI_BYTE, &diy::mpi::mpi_cast(s.handle)); +#else + (void)o; (void)buffer; (void)size_; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_read_at_all); +#endif +} + +void +diy::mpi::io::file:: +write_at(offset o, const char* buffer, size_t size_) +{ +#if DIY_HAS_MPI + status s; + MPI_File_write_at(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(o), (void *)buffer, static_cast<int>(size_), MPI_BYTE, &diy::mpi::mpi_cast(s.handle)); +#else + (void)o; (void)buffer; (void)size_; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_write_at); +#endif +} + +void +diy::mpi::io::file:: +write_at_all(offset o, const char* buffer, size_t size_) +{ +#if DIY_HAS_MPI + status s; + MPI_File_write_at_all(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(o), (void *)buffer, static_cast<int>(size_), MPI_BYTE, &diy::mpi::mpi_cast(s.handle)); +#else + (void)o; (void)buffer; (void)size_; + DIY_UNSUPPORTED_MPI_CALL(MPI_File_write_at_all); +#endif +} + +void +diy::mpi::io::file:: +read_bov(const DiscreteBounds& bounds, int ndims, const int dims[], char* buffer, size_t offset, const datatype& dt, bool collective, int chunk) +{ +#if DIY_HAS_MPI + int total = 1; + std::vector<int> subsizes; + for (unsigned i = 0; i < static_cast<unsigned>(ndims); ++i) + { + subsizes.push_back(bounds.max[i] - bounds.min[i] + 1); + total *= subsizes.back(); + } + + MPI_Datatype T_type; + if (chunk == 1) + { + T_type = diy::mpi::mpi_cast(dt.handle); + } + else + { + // create an MPI struct of size chunk to read the data in those chunks + // (this allows to work around MPI-IO weirdness where crucial quantities + // are ints, which are too narrow of a type) + int array_of_blocklengths[] = { chunk }; + MPI_Aint array_of_displacements[] = { 0 }; + MPI_Datatype array_of_types[] = { diy::mpi::mpi_cast(dt.handle) }; + MPI_Type_create_struct(1, array_of_blocklengths, array_of_displacements, array_of_types, &T_type); + MPI_Type_commit(&T_type); + } + + MPI_Datatype fileblk; + MPI_Type_create_subarray(ndims, dims, subsizes.data(), (int*) &bounds.min[0], MPI_ORDER_C, T_type, &fileblk); + MPI_Type_commit(&fileblk); + + MPI_File_set_view(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(offset), T_type, fileblk, (char*)"native", MPI_INFO_NULL); + + mpi::status s; + if (!collective) + MPI_File_read(diy::mpi::mpi_cast(fh), buffer, total, T_type, &mpi_cast(s.handle)); + else + MPI_File_read_all(diy::mpi::mpi_cast(fh), buffer, total, T_type, &mpi_cast(s.handle)); + + if (chunk != 1) + MPI_Type_free(&T_type); + MPI_Type_free(&fileblk); +#else + (void) bounds; (void) ndims; (void) dims, (void) buffer; (void) offset, (void) dt, (void) collective; (void) chunk; + DIY_UNSUPPORTED_MPI_CALL(diy::mpi::io::file::read_bov); +#endif +} + +void +diy::mpi::io::file:: +write_bov(const DiscreteBounds& bounds, const DiscreteBounds& core, int ndims, const int dims[], const char* buffer, size_t offset, const datatype& dt, bool collective, int chunk) +{ +#if DIY_HAS_MPI + std::vector<int> subsizes; + std::vector<int> buffer_shape, buffer_start; + for (unsigned i = 0; i < static_cast<unsigned>(ndims); ++i) + { + buffer_shape.push_back(bounds.max[i] - bounds.min[i] + 1); + buffer_start.push_back(core.min[i] - bounds.min[i]); + subsizes.push_back(core.max[i] - core.min[i] + 1); + } + + MPI_Datatype T_type; + if (chunk == 1) + { + T_type = diy::mpi::mpi_cast(dt.handle); + } + else + { + // assume T is a binary block and create an MPI struct of appropriate size + int array_of_blocklengths[] = { chunk }; + MPI_Aint array_of_displacements[] = { 0 }; + MPI_Datatype array_of_types[] = { diy::mpi::mpi_cast(dt.handle) }; + MPI_Type_create_struct(1, array_of_blocklengths, array_of_displacements, array_of_types, &T_type); + MPI_Type_commit(&T_type); + } + + MPI_Datatype fileblk, subbuffer; + MPI_Type_create_subarray(ndims, dims, subsizes.data(), (int*) &core.min[0], MPI_ORDER_C, T_type, &fileblk); + MPI_Type_create_subarray(ndims, buffer_shape.data(), subsizes.data(), buffer_start.data(), MPI_ORDER_C, T_type, &subbuffer); + MPI_Type_commit(&fileblk); + MPI_Type_commit(&subbuffer); + + MPI_File_set_view(diy::mpi::mpi_cast(fh), static_cast<MPI_Offset>(offset), T_type, fileblk, (char*)"native", MPI_INFO_NULL); + + mpi::status s; + if (!collective) + MPI_File_write(diy::mpi::mpi_cast(fh), (void*)buffer, 1, subbuffer, &mpi_cast(s.handle)); + else + MPI_File_write_all(diy::mpi::mpi_cast(fh), (void*)buffer, 1, subbuffer, &mpi_cast(s.handle)); + + if (chunk != 1) + MPI_Type_free(&T_type); + MPI_Type_free(&fileblk); + MPI_Type_free(&subbuffer); +#else + (void) bounds; (void) core, (void) ndims; (void) dims, (void) buffer; (void) offset, (void) dt, (void) collective; (void) chunk; + DIY_UNSUPPORTED_MPI_CALL(diy::mpi::io::file::write_bov); +#endif +} diff --git a/include/vtkdiy2/mpi/io.hpp b/include/vtkdiy2/mpi/io.hpp index 1ed9792219aa0a5a4cfff23f8f75869a3a0b7ca9..42885906ba69ecfa3926969c93595a8ea1afe454 100644 --- a/include/vtkdiy2/mpi/io.hpp +++ b/include/vtkdiy2/mpi/io.hpp @@ -1,139 +1,82 @@ #ifndef DIY_MPI_IO_HPP #define DIY_MPI_IO_HPP -#include "../constants.h" +#include "config.hpp" +#include "communicator.hpp" + +#include "../types.hpp" #include <vector> #include <string> +#include <stdexcept> namespace diy { namespace mpi { + namespace io { - typedef MPI_Offset offset; +#if !defined(DIY_MPI_AS_LIB) && DIY_HAS_MPI + using offset = MPI_Offset; +#else + using offset = long long; +#endif //! Wraps MPI file IO. \ingroup MPI class file { public: - enum - { - rdonly = MPI_MODE_RDONLY, - rdwr = MPI_MODE_RDWR, - wronly = MPI_MODE_WRONLY, - create = MPI_MODE_CREATE, - exclusive = MPI_MODE_EXCL, - delete_on_close = MPI_MODE_DELETE_ON_CLOSE, - unique_open = MPI_MODE_UNIQUE_OPEN, - sequential = MPI_MODE_SEQUENTIAL, - append = MPI_MODE_APPEND - }; +#ifndef DIY_MPI_AS_LIB + static constexpr int rdonly = MPI_MODE_RDONLY; + static constexpr int rdwr = MPI_MODE_RDWR; + static constexpr int wronly = MPI_MODE_WRONLY; + static constexpr int create = MPI_MODE_CREATE; + static constexpr int exclusive = MPI_MODE_EXCL; + static constexpr int delete_on_close = MPI_MODE_DELETE_ON_CLOSE; + static constexpr int unique_open = MPI_MODE_UNIQUE_OPEN; + static constexpr int sequential = MPI_MODE_SEQUENTIAL; + static constexpr int append = MPI_MODE_APPEND; +#else + static const int rdonly, rdwr, wronly, create, exclusive, delete_on_close, unique_open, sequential, append; +#endif public: - inline file(const communicator& comm, const std::string& filename, int mode); - ~file() { close(); } - inline void close(); + DIY_MPI_EXPORT_FUNCTION file(const communicator& comm, const std::string& filename, int mode); + ~file() { close(); } + DIY_MPI_EXPORT_FUNCTION void close(); - inline offset size() const; - inline void resize(offset size); + DIY_MPI_EXPORT_FUNCTION offset size() const; + DIY_MPI_EXPORT_FUNCTION void resize(offset size); - inline void read_at(offset o, char* buffer, size_t size); - inline void read_at_all(offset o, char* buffer, size_t size); - inline void write_at(offset o, const char* buffer, size_t size); - inline void write_at_all(offset o, const char* buffer, size_t size); + DIY_MPI_EXPORT_FUNCTION void read_at(offset o, char* buffer, size_t size); + DIY_MPI_EXPORT_FUNCTION void read_at_all(offset o, char* buffer, size_t size); + DIY_MPI_EXPORT_FUNCTION void write_at(offset o, const char* buffer, size_t size); + DIY_MPI_EXPORT_FUNCTION void write_at_all(offset o, const char* buffer, size_t size); template<class T> - inline void read_at(offset o, std::vector<T>& data); + inline void read_at(offset o, std::vector<T>& data); template<class T> - inline void read_at_all(offset o, std::vector<T>& data); + inline void read_at_all(offset o, std::vector<T>& data); template<class T> - inline void write_at(offset o, const std::vector<T>& data); + inline void write_at(offset o, const std::vector<T>& data); template<class T> - inline void write_at_all(offset o, const std::vector<T>& data); + inline void write_at_all(offset o, const std::vector<T>& data); - const communicator& - comm() const { return comm_; } + DIY_MPI_EXPORT_FUNCTION void read_bov(const DiscreteBounds& bounds, int ndims, const int dims[], char* buffer, size_t offset, const datatype& dt, bool collective, int chunk); + DIY_MPI_EXPORT_FUNCTION void write_bov(const DiscreteBounds& bounds, const DiscreteBounds& core, int ndims, const int dims[], const char* buffer, size_t offset, const datatype& dt, bool collective, int chunk); - MPI_File& handle() { return fh; } + const communicator& comm() const { return comm_; } private: - const communicator& comm_; - MPI_File fh; + communicator comm_; + protected: // mark protected to avoid the "unused private field" warning + DIY_MPI_File fh; }; } -} -} - -diy::mpi::io::file:: -file(const communicator& comm__, const std::string& filename, int mode) -: comm_(comm__) -{ -#ifndef DIY_NO_MPI - int ret = MPI_File_open(comm__, const_cast<char*>(filename.c_str()), mode, MPI_INFO_NULL, &fh); - if (ret) - throw std::runtime_error("DIY cannot open file: " + filename); -#else - DIY_UNUSED(comm__); - DIY_UNUSED(filename); - DIY_UNUSED(mode); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_open); -#endif -} - -void -diy::mpi::io::file:: -close() -{ -#ifndef DIY_NO_MPI - if (fh != MPI_FILE_NULL) - MPI_File_close(&fh); -#endif -} - -diy::mpi::io::offset -diy::mpi::io::file:: -size() const -{ -#ifndef DIY_NO_MPI - offset sz; - MPI_File_get_size(fh, &sz); - return sz; -#else - DIY_UNSUPPORTED_MPI_CALL(MPI_File_get_size); -#endif -} - -void -diy::mpi::io::file:: -resize(diy::mpi::io::offset size_) -{ -#ifndef DIY_NO_MPI - MPI_File_set_size(fh, size_); -#else - DIY_UNUSED(size_); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_set_size); -#endif -} - -void -diy::mpi::io::file:: -read_at(offset o, char* buffer, size_t size_) -{ -#ifndef DIY_NO_MPI - status s; - MPI_File_read_at(fh, o, buffer, static_cast<int>(size_), detail::get_mpi_datatype<char>(), &s.s); -#else - DIY_UNUSED(o); - DIY_UNUSED(buffer); - DIY_UNUSED(size_); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_read_at); -#endif -} template<class T> void @@ -143,21 +86,6 @@ read_at(offset o, std::vector<T>& data) read_at(o, &data[0], data.size()*sizeof(T)); } -void -diy::mpi::io::file:: -read_at_all(offset o, char* buffer, size_t size_) -{ -#ifndef DIY_NO_MPI - status s; - MPI_File_read_at_all(fh, o, buffer, static_cast<int>(size_), detail::get_mpi_datatype<char>(), &s.s); -#else - DIY_UNUSED(o); - DIY_UNUSED(buffer); - DIY_UNUSED(size_); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_read_at_all); -#endif -} - template<class T> void diy::mpi::io::file:: @@ -166,21 +94,6 @@ read_at_all(offset o, std::vector<T>& data) read_at_all(o, (char*) &data[0], data.size()*sizeof(T)); } -void -diy::mpi::io::file:: -write_at(offset o, const char* buffer, size_t size_) -{ -#ifndef DIY_NO_MPI - status s; - MPI_File_write_at(fh, o, (void *)buffer, static_cast<int>(size_), detail::get_mpi_datatype<char>(), &s.s); -#else - DIY_UNUSED(o); - DIY_UNUSED(buffer); - DIY_UNUSED(size_); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_write_at); -#endif -} - template<class T> void diy::mpi::io::file:: @@ -189,21 +102,6 @@ write_at(offset o, const std::vector<T>& data) write_at(o, (const char*) &data[0], data.size()*sizeof(T)); } -void -diy::mpi::io::file:: -write_at_all(offset o, const char* buffer, size_t size_) -{ -#ifndef DIY_NO_MPI - status s; - MPI_File_write_at_all(fh, o, (void *)buffer, static_cast<int>(size_), detail::get_mpi_datatype<char>(), &s.s); -#else - DIY_UNUSED(o); - DIY_UNUSED(buffer); - DIY_UNUSED(size_); - DIY_UNSUPPORTED_MPI_CALL(MPI_File_write_at_all); -#endif -} - template<class T> void diy::mpi::io::file:: @@ -212,4 +110,11 @@ write_at_all(offset o, const std::vector<T>& data) write_at_all(o, &data[0], data.size()*sizeof(T)); } +} +} // diy::mpi::io + +#ifndef DIY_MPI_AS_LIB +#include "io.cpp" #endif + +#endif // DIY_MPI_IO_HPP diff --git a/include/vtkdiy2/mpi/mpi_cast.hpp b/include/vtkdiy2/mpi/mpi_cast.hpp new file mode 100644 index 0000000000000000000000000000000000000000..a2a0d91d20f54ed98a45adb05eff857b797c765e --- /dev/null +++ b/include/vtkdiy2/mpi/mpi_cast.hpp @@ -0,0 +1,39 @@ +#ifndef DIY_MPI_MPICAST_HPP +#define DIY_MPI_MPICAST_HPP + +/// This header provides convinience functions to cast from diy's type erased MPI objects +/// to thier correct types. + +#ifndef DIY_HAS_MPI +# include <mpi.h> +#endif + +namespace diy +{ +namespace mpi +{ + +#define DEFINE_MPI_CAST(mpitype) \ +inline mpitype& mpi_cast(DIY_##mpitype& obj) { return *reinterpret_cast<mpitype*>(&obj); } \ +inline const mpitype& mpi_cast(const DIY_##mpitype& obj) { return *reinterpret_cast<const mpitype*>(&obj); } \ +inline DIY_##mpitype make_DIY_##mpitype(const mpitype& obj) { DIY_##mpitype ret; mpi_cast(ret) = obj; return ret; } + +#define DEFINE_MPI_CAST_MOVE(mpitype) \ +inline mpitype& mpi_cast(DIY_##mpitype& obj) { return *reinterpret_cast<mpitype*>(&obj); } \ +inline const mpitype& mpi_cast(const DIY_##mpitype& obj) { return *reinterpret_cast<const mpitype*>(&obj); } \ +inline DIY_##mpitype make_DIY_##mpitype(mpitype&& obj) { DIY_##mpitype ret = std::move(obj); return ret; } + +DEFINE_MPI_CAST(MPI_Comm) +DEFINE_MPI_CAST(MPI_Datatype) +DEFINE_MPI_CAST(MPI_Status) +DEFINE_MPI_CAST(MPI_Request) +DEFINE_MPI_CAST(MPI_Op) +DEFINE_MPI_CAST(MPI_File) +DEFINE_MPI_CAST_MOVE(MPI_Win) + +#undef DEFINE_MPI_CAST + +} +} // diy::mpi + +#endif // DIY_MPI_MPICAST_HPP diff --git a/include/vtkdiy2/mpi/mpitypes.hpp.in b/include/vtkdiy2/mpi/mpitypes.hpp.in new file mode 100644 index 0000000000000000000000000000000000000000..4fee00b9364470390a1dd34bb048e66556cc73d8 --- /dev/null +++ b/include/vtkdiy2/mpi/mpitypes.hpp.in @@ -0,0 +1,80 @@ +#ifndef DIY_MPI_MPITYPES_H +#define DIY_MPI_MPITYPES_H + +#include <cstring> + +#cmakedefine TYPESIZE_MPI_Comm @TYPESIZE_MPI_Comm@ +#cmakedefine TYPESIZE_MPI_Datatype @TYPESIZE_MPI_Datatype@ +#cmakedefine TYPESIZE_MPI_Status @TYPESIZE_MPI_Status@ +#cmakedefine TYPESIZE_MPI_Request @TYPESIZE_MPI_Request@ +#cmakedefine TYPESIZE_MPI_Op @TYPESIZE_MPI_Op@ +#cmakedefine TYPESIZE_MPI_File @TYPESIZE_MPI_File@ +#cmakedefine TYPESIZE_MPI_Win @TYPESIZE_MPI_Win@ + +namespace diy +{ +namespace mpi +{ + +#if defined(DIY_HAS_MPI) +# define ASSERT_MPI_TYPE_SIZE(mpitype) static_assert(sizeof(mpitype) <= sizeof(DIY_##mpitype), ""); +#else +# define ASSERT_MPI_TYPE_SIZE(mpitype) +struct MPI_Win; +#endif + +#define DEFINE_DIY_MPI_TYPE(mpitype) \ +struct DIY_##mpitype { \ + void* data[((TYPESIZE_##mpitype) + sizeof(void*) - 1)/sizeof(void*)]; \ +}; \ +ASSERT_MPI_TYPE_SIZE(mpitype) + +#define DEFINE_DIY_MPI_TYPE_MOVE(mpitype) \ + struct DIY_##mpitype \ + { \ + DIY_##mpitype() = default; \ + DIY_##mpitype(const mpitype&) = delete; \ + DIY_##mpitype& operator=(const mpitype&) = delete; \ + DIY_##mpitype(mpitype&& obj) \ + { \ + std::memcpy(data, &obj, TYPESIZE_##mpitype); \ + std::memset(&obj, 0, TYPESIZE_##mpitype); \ + } \ + DIY_##mpitype& operator=(mpitype&& obj) \ + { \ + std::memcpy(data, &obj, TYPESIZE_##mpitype); \ + std::memset(&obj, 0, TYPESIZE_##mpitype); \ + return *this; \ + } \ + operator const mpitype&() const { return *reinterpret_cast<const mpitype*>(data); } \ + void reset() { std::memset(data, 0, TYPESIZE_##mpitype); } \ + \ + private: \ + char* data[TYPESIZE_##mpitype]; \ + }; \ + ASSERT_MPI_TYPE_SIZE(mpitype); + +DEFINE_DIY_MPI_TYPE(MPI_Comm) +DEFINE_DIY_MPI_TYPE(MPI_Datatype) +DEFINE_DIY_MPI_TYPE(MPI_Status) +DEFINE_DIY_MPI_TYPE(MPI_Request) +DEFINE_DIY_MPI_TYPE(MPI_Op) +DEFINE_DIY_MPI_TYPE(MPI_File) +DEFINE_DIY_MPI_TYPE_MOVE(MPI_Win) + +#undef DEFINE_DIY_MPI_TYPE +#undef DEFINE_DIY_MPI_TYPE_MOVE +#undef ASSERT_MPI_TYPE_SIZE + +} +} // diy::mpi + +#undef TYPESIZE_MPI_Comm +#undef TYPESIZE_MPI_Datatype +#undef TYPESIZE_MPI_Status +#undef TYPESIZE_MPI_Request +#undef TYPESIZE_MPI_Op +#undef TYPESIZE_MPI_File +#undef TYPESIZE_MPI_Win + +#endif // DIY_MPI_MPITYPES_H diff --git a/include/vtkdiy2/mpi/no-mpi.hpp b/include/vtkdiy2/mpi/no-mpi.hpp index 7356b098e80b2ce1c93ad8a05b311cc4cc209099..68ffff74bc763f038657fd41dec385a6dd148e99 100644 --- a/include/vtkdiy2/mpi/no-mpi.hpp +++ b/include/vtkdiy2/mpi/no-mpi.hpp @@ -1,9 +1,10 @@ #ifndef DIY_MPI_NO_MPI_HPP #define DIY_MPI_NO_MPI_HPP +#include <cassert> // std::assert +#include <cstdint> // uintptr_t #include <stdexcept> // std::runtime_error - static const int MPI_SUCCESS = 0; static const int MPI_ANY_SOURCE = -1; static const int MPI_ANY_TAG = -1; @@ -33,7 +34,6 @@ DIY_NO_MPI_DATATYPE(long long, MPI_LONG_LONG_INT); DIY_NO_MPI_DATATYPE(unsigned long long, MPI_UNSIGNED_LONG_LONG); DIY_NO_MPI_DATATYPE(float, MPI_FLOAT); DIY_NO_MPI_DATATYPE(double, MPI_DOUBLE); -#endif /* status type */ struct MPI_Status @@ -49,7 +49,7 @@ struct MPI_Status using MPI_Request = int; #define DIY_UNSUPPORTED_MPI_CALL(name) \ - throw std::runtime_error("`" #name "` not supported when DIY_NO_MPI is defined."); + throw std::runtime_error("`" #name "` not supported when DIY_HAS_MPI is false."); /* define operations */ using MPI_Op = int; @@ -61,7 +61,7 @@ static const MPI_Op MPI_LAND = 0; static const MPI_Op MPI_LOR = 0; /* mpi i/o stuff */ -using MPI_Offset = size_t; +using MPI_Offset = long long; using MPI_File = int; static const MPI_File MPI_FILE_NULL = 0; @@ -76,7 +76,39 @@ static const int MPI_MODE_APPEND = 128; static const int MPI_MODE_SEQUENTIAL = 256; /* define window type */ -using MPI_Win = int; +struct MPI_Win { + MPI_Win(): data_(0) {} + MPI_Win(void* data, bool owned = false): data_(uintptr_t(data) | (owned ? 0x1 : 0x0)) + { + // We assume that pointers have at least some higher-byte alignment. + assert(!(uintptr_t(data) & 0x1)); + } + void* data() const { return (void*)(data_ & ~0x1); } + bool owned() const { return data_ & 0x1; } + + // We cannot copy owned windows. + MPI_Win(MPI_Win const&) = delete; + MPI_Win& operator=(MPI_Win const&) = delete; + + // We cannot move owned windows (we don't know how to delete them in general). + MPI_Win(MPI_Win&& rhs): data_(rhs.data_) + { + rhs.data_ = 0; + } + MPI_Win& operator=(MPI_Win&& rhs) + { + if (this == &rhs) + return *this; + + data_ = rhs.data_; + rhs.data_ = 0; + + return *this; + } +private: + uintptr_t data_; +}; +#define MPI_WIN_NULL MPI_Win() /* window fence assertions */ static const int MPI_MODE_NOSTORE = 1; @@ -88,3 +120,5 @@ static const int MPI_MODE_NOCHECK = 16; /* window lock types */ static const int MPI_LOCK_SHARED = 1; static const int MPI_LOCK_EXCLUSIVE = 2; + +#endif // DIY_MPI_NO_MPI_HPP diff --git a/include/vtkdiy2/mpi/operations.cpp b/include/vtkdiy2/mpi/operations.cpp new file mode 100644 index 0000000000000000000000000000000000000000..aa059e3429a9f80297c49ec82d84c851e7adcd3e --- /dev/null +++ b/include/vtkdiy2/mpi/operations.cpp @@ -0,0 +1,33 @@ +#ifdef DIY_MPI_AS_LIB +#include "operations.hpp" +#endif + +#include <functional> + +namespace diy +{ +namespace mpi +{ + +namespace detail +{ + +operation get_builtin_operation(BuiltinOperation id) +{ + operation op{}; + switch(id) + { + case OP_MAXIMUM: op.handle = make_DIY_MPI_Op(MPI_MAX); break; + case OP_MINIMUM: op.handle = make_DIY_MPI_Op(MPI_MIN); break; + case OP_PLUS: op.handle = make_DIY_MPI_Op(MPI_SUM); break; + case OP_MULTIPLIES: op.handle = make_DIY_MPI_Op(MPI_PROD); break; + case OP_LOGICAL_AND: op.handle = make_DIY_MPI_Op(MPI_LAND); break; + case OP_LOGICAL_OR: op.handle = make_DIY_MPI_Op(MPI_LOR); break; + default: break; + } + return op; +} + +} +} +} // diy::mpi::detail diff --git a/include/vtkdiy2/mpi/operations.hpp b/include/vtkdiy2/mpi/operations.hpp index 5a920c0ee08f4e93811db0dc2cd103bdeedb8fc7..ef79a5047176089e07d4f23f3964034cde839524 100644 --- a/include/vtkdiy2/mpi/operations.hpp +++ b/include/vtkdiy2/mpi/operations.hpp @@ -1,5 +1,10 @@ -#include <functional> +#ifndef DIY_MPI_OPERATIONS_HPP +#define DIY_MPI_OPERATIONS_HPP + +#include "config.hpp" + #include <algorithm> // for std::min/max +#include <functional> namespace diy { @@ -7,6 +12,19 @@ namespace mpi { //! \addtogroup MPI //!@{ + struct operation + { + operation() = default; + operation(const DIY_MPI_Op& op) : handle(op) {} + +#ifndef DIY_MPI_AS_LIB // only available in header-only mode + operation(const MPI_Op& op) : handle(op) {} + operator MPI_Op() { return handle; } +#endif + + DIY_MPI_Op handle; + }; + template<class U> struct maximum { const U& operator()(const U& x, const U& y) const { return (std::max)(x,y); } }; template<class U> @@ -15,13 +33,32 @@ namespace mpi namespace detail { - template<class T> struct mpi_op { static MPI_Op get(); }; - template<class U> struct mpi_op< maximum<U> > { static MPI_Op get() { return MPI_MAX; } }; - template<class U> struct mpi_op< minimum<U> > { static MPI_Op get() { return MPI_MIN; } }; - template<class U> struct mpi_op< std::plus<U> > { static MPI_Op get() { return MPI_SUM; } }; - template<class U> struct mpi_op< std::multiplies<U> > { static MPI_Op get() { return MPI_PROD; } }; - template<class U> struct mpi_op< std::logical_and<U> > { static MPI_Op get() { return MPI_LAND; } }; - template<class U> struct mpi_op< std::logical_or<U> > { static MPI_Op get() { return MPI_LOR; } }; -} + enum BuiltinOperation { + OP_MAXIMUM = 0, + OP_MINIMUM, + OP_PLUS, + OP_MULTIPLIES, + OP_LOGICAL_AND, + OP_LOGICAL_OR + }; + + DIY_MPI_EXPORT_FUNCTION operation get_builtin_operation(BuiltinOperation id); + + template<class T> struct mpi_op; + + template<class U> struct mpi_op< maximum<U> > { static operation get() { return get_builtin_operation(OP_MAXIMUM); } }; + template<class U> struct mpi_op< minimum<U> > { static operation get() { return get_builtin_operation(OP_MINIMUM); } }; + template<class U> struct mpi_op< std::plus<U> > { static operation get() { return get_builtin_operation(OP_PLUS); } }; + template<class U> struct mpi_op< std::multiplies<U> > { static operation get() { return get_builtin_operation(OP_MULTIPLIES); } }; + template<class U> struct mpi_op< std::logical_and<U> > { static operation get() { return get_builtin_operation(OP_LOGICAL_AND); } }; + template<class U> struct mpi_op< std::logical_or<U> > { static operation get() { return get_builtin_operation(OP_LOGICAL_OR); } }; } + } +} // diy::mpi + +#ifndef DIY_MPI_AS_LIB +#include "operations.cpp" +#endif + +#endif // DIY_MPI_OPERATIONS_HPP diff --git a/include/vtkdiy2/mpi/optional.hpp b/include/vtkdiy2/mpi/optional.hpp index ab58aaf810816b67624f92b65cc29134704ed6e3..ddbd455621cf7ab6a0f7b0186d7de4442f4c83d6 100644 --- a/include/vtkdiy2/mpi/optional.hpp +++ b/include/vtkdiy2/mpi/optional.hpp @@ -1,3 +1,6 @@ +#ifndef DIY_MPI_OPTIONAL_HPP +#define DIY_MPI_OPTIONAL_HPP + namespace diy { namespace mpi @@ -34,8 +37,8 @@ namespace mpi const void* address() const { return buf_; } private: + alignas(T) char buf_[sizeof(T)]; bool init_; - char buf_[sizeof(T)]; }; } } @@ -53,3 +56,5 @@ operator=(const optional& o) return *this; } + +#endif // DIY_MPI_OPTIONAL_HPP diff --git a/include/vtkdiy2/mpi/point-to-point.cpp b/include/vtkdiy2/mpi/point-to-point.cpp new file mode 100644 index 0000000000000000000000000000000000000000..bba84cebed41d31d350e3fb389d7485f7c6e53bb --- /dev/null +++ b/include/vtkdiy2/mpi/point-to-point.cpp @@ -0,0 +1,106 @@ +#ifdef DIY_MPI_AS_LIB +#include "point-to-point.hpp" +#endif + +namespace diy +{ +namespace mpi +{ + +#ifdef DIY_MPI_AS_LIB +# ifdef _MSC_VER +# define EXPORT_MACRO DIY_MPI_EXPORT +# else +# define EXPORT_MACRO +# endif +EXPORT_MACRO const int any_source = MPI_ANY_SOURCE; +EXPORT_MACRO const int any_tag = MPI_ANY_TAG; +# undef EXPORT_MACRO +#endif + +namespace detail +{ + +void send(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + MPI_Send(data, count, mpi_cast(type.handle), dest, tag, mpi_cast(comm)); +#else + (void) comm; (void) dest; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Send); +#endif +} + +void ssend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + MPI_Ssend(data, count, mpi_cast(type.handle), dest, tag, mpi_cast(comm)); +#else + (void) comm; (void) dest; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Ssend); +#endif +} + +status probe(DIY_MPI_Comm comm, int source, int tag) +{ +#if DIY_HAS_MPI + status s; + MPI_Probe(source, tag, mpi_cast(comm), &mpi_cast(s.handle)); + return s; +#else + (void) comm; (void) source; (void) tag; + DIY_UNSUPPORTED_MPI_CALL(MPI_Probe); +#endif +} + +status recv(DIY_MPI_Comm comm, int source, int tag, void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + status s; + MPI_Recv(data, count, mpi_cast(type.handle), source, tag, mpi_cast(comm), &mpi_cast(s.handle)); + return s; +#else + (void) comm; (void) source; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Recv); +#endif +} + +request isend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + request r; + MPI_Isend(data, count, mpi_cast(type.handle), dest, tag, mpi_cast(comm), &mpi_cast(r.handle)); + return r; +#else + (void) comm; (void) dest; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Isend); +#endif +} + +request issend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + request r; + MPI_Issend(data, count, mpi_cast(type.handle), dest, tag, mpi_cast(comm), &mpi_cast(r.handle)); + return r; +#else + (void) comm; (void) dest; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Issend); +#endif +} + +request irecv(DIY_MPI_Comm comm, int source, int tag, void* data, int count, const datatype& type) +{ +#if DIY_HAS_MPI + request r; + MPI_Irecv(data, count, mpi_cast(type.handle), source, tag, mpi_cast(comm), &mpi_cast(r.handle)); + return r; +#else + (void) comm; (void) source; (void) tag; (void) data; (void) count; (void) type; + DIY_UNSUPPORTED_MPI_CALL(MPI_Irecv); +#endif +} + +} +} +} // diy::mpi::detail diff --git a/include/vtkdiy2/mpi/point-to-point.hpp b/include/vtkdiy2/mpi/point-to-point.hpp index e8651362319fe0c9fd3d7061fefeaf2289fc17a2..150d3c8f0fe3081b042ece2090aa800c0fca08a6 100644 --- a/include/vtkdiy2/mpi/point-to-point.hpp +++ b/include/vtkdiy2/mpi/point-to-point.hpp @@ -1,147 +1,92 @@ +#ifndef DIY_MPI_POINT_TO_POINT_HPP +#define DIY_MPI_POINT_TO_POINT_HPP + +#include "config.hpp" +#include "datatypes.hpp" +#include "request.hpp" +#include "status.hpp" + #include <vector> namespace diy { namespace mpi { -namespace detail -{ - // send - template< class T, class is_mpi_datatype_ = typename is_mpi_datatype<T>::type > - struct send; - template<class T> - struct send<T, true_type> - { - void operator()(MPI_Comm comm, int dest, int tag, const T& x) const - { -#ifndef DIY_NO_MPI - typedef mpi_datatype<T> Datatype; - MPI_Send((void*) Datatype::address(x), - Datatype::count(x), - Datatype::datatype(), - dest, tag, comm); +#ifndef DIY_MPI_AS_LIB +constexpr int any_source = MPI_ANY_SOURCE; +constexpr int any_tag = MPI_ANY_TAG; #else - (void) comm; (void) dest; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Send); +DIY_MPI_EXPORT extern const int any_source; +DIY_MPI_EXPORT extern const int any_tag; #endif - } - }; - // recv - template< class T, class is_mpi_datatype_ = typename is_mpi_datatype<T>::type > - struct recv; +namespace detail +{ + DIY_MPI_EXPORT_FUNCTION void send(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type); + DIY_MPI_EXPORT_FUNCTION void ssend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type); + DIY_MPI_EXPORT_FUNCTION request isend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type); + DIY_MPI_EXPORT_FUNCTION request issend(DIY_MPI_Comm comm, int dest, int tag, const void* data, int count, const datatype& type); + DIY_MPI_EXPORT_FUNCTION status probe(DIY_MPI_Comm comm, int source, int tag); + DIY_MPI_EXPORT_FUNCTION status recv(DIY_MPI_Comm comm, int source, int tag, void* data, int count, const datatype& type); + DIY_MPI_EXPORT_FUNCTION request irecv(DIY_MPI_Comm comm, int source, int tag, void* data, int count, const datatype& type); - template<class T> - struct recv<T, true_type> + template <class T> + inline void send(DIY_MPI_Comm comm, int dest, int tag, const T& x) { - status operator()(MPI_Comm comm, int source, int tag, T& x) const - { -#ifndef DIY_NO_MPI - typedef mpi_datatype<T> Datatype; - status s; - MPI_Recv((void*) Datatype::address(x), - Datatype::count(x), - Datatype::datatype(), - source, tag, comm, &s.s); - return s; -#else - (void) comm; (void) source; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Recv); -#endif - } - }; + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + send(comm, dest, tag, address(x), count(x), datatype_of(x)); + } - template<class U> - struct recv<std::vector<U>, true_type> + template <class T> + inline void ssend(DIY_MPI_Comm comm, int dest, int tag, const T& x) { - status operator()(MPI_Comm comm, int source, int tag, std::vector<U>& x) const - { -#ifndef DIY_NO_MPI - status s; - - MPI_Probe(source, tag, comm, &s.s); - x.resize(s.count<U>()); - MPI_Recv(&x[0], static_cast<int>(x.size()), get_mpi_datatype<U>(), source, tag, comm, &s.s); - return s; -#else - (void) comm; (void) source; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Recv); -#endif - } - }; - - // isend - template< class T, class is_mpi_datatype_ = typename is_mpi_datatype<T>::type > - struct isend; + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + ssend(comm, dest, tag, address(x), count(x), datatype_of(x)); + } - template<class T> - struct isend<T, true_type> + template <class T> + status recv(DIY_MPI_Comm comm, int source, int tag, T& x) { - request operator()(MPI_Comm comm, int dest, int tag, const T& x) const - { -#ifndef DIY_NO_MPI - request r; - typedef mpi_datatype<T> Datatype; - MPI_Isend((void*) Datatype::address(x), - Datatype::count(x), - Datatype::datatype(), - dest, tag, comm, &r.r); - return r; -#else - (void) comm; (void) dest; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Isend); -#endif - } - }; + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + return recv(comm, source, tag, address(x), count(x), datatype_of(x)); + } - // issend - template< class T, class is_mpi_datatype_ = typename is_mpi_datatype<T>::type > - struct issend; + template <class T> + status recv(DIY_MPI_Comm comm, int source, int tag, std::vector<T>& x) + { + auto s = probe(comm, source, tag); + x.resize(static_cast<size_t>(s.count<T>())); + return recv(comm, source, tag, address(x), count(x), datatype_of(x)); + } - template<class T> - struct issend<T, true_type> + template <class T> + request isend(DIY_MPI_Comm comm, int dest, int tag, const T& x) { - request operator()(MPI_Comm comm, int dest, int tag, const T& x) const - { -#ifndef DIY_NO_MPI - request r; - typedef mpi_datatype<T> Datatype; - MPI_Issend((void*) Datatype::address(x), - Datatype::count(x), - Datatype::datatype(), - dest, tag, comm, &r.r); - return r; -#else - (void) comm; (void) dest; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Issend); -#endif - } - }; + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + return isend(comm, dest, tag, address(x), count(x), datatype_of(x)); + } - // irecv - template< class T, class is_mpi_datatype_ = typename is_mpi_datatype<T>::type > - struct irecv; + template <class T> + request issend(DIY_MPI_Comm comm, int dest, int tag, const T& x) + { + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + return issend(comm, dest, tag, address(x), count(x), datatype_of(x)); + } - template<class T> - struct irecv<T, true_type> + template <class T> + request irecv(DIY_MPI_Comm comm, int source, int tag, T& x) { - request operator()(MPI_Comm comm, int source, int tag, T& x) const - { -#ifndef DIY_NO_MPI - request r; - typedef mpi_datatype<T> Datatype; - MPI_Irecv(Datatype::address(x), - Datatype::count(x), - Datatype::datatype(), - source, tag, comm, &r.r); - return r; -#else - (void) comm; (void) source; (void) tag; (void) x; - DIY_UNSUPPORTED_MPI_CALL(MPI_Irecv); -#endif - } - }; -} + static_assert(std::is_same<typename is_mpi_datatype<T>::type, true_type>::value, "is_mpi_datatype<T>::type must be true_type"); + return irecv(comm, source, tag, address(x), count(x), datatype_of(x)); + } + } } +} // diy::mpi::detail + +#ifndef DIY_MPI_AS_LIB +#include "point-to-point.cpp" +#endif + +#endif // DIY_MPI_POINT_TO_POINT_HPP diff --git a/include/vtkdiy2/mpi/request.cpp b/include/vtkdiy2/mpi/request.cpp new file mode 100644 index 0000000000000000000000000000000000000000..59920c9525d26fb3f43dd4f0d41df1a066c0c295 --- /dev/null +++ b/include/vtkdiy2/mpi/request.cpp @@ -0,0 +1,45 @@ +#ifdef DIY_MPI_AS_LIB +#include "request.hpp" +#endif + +#include <algorithm> +#include <iterator> + +#if defined(DIY_MPI_AS_LIB) && !DIY_HAS_MPI +diy::mpi::request::request() +{ + std::fill(std::begin(this->handle.data), std::end(this->handle.data), nullptr); +} +#else +diy::mpi::request::request() = default; +#endif + +diy::mpi::status diy::mpi::request::wait() +{ +#if DIY_HAS_MPI + status s; + MPI_Wait(&mpi_cast(handle), &mpi_cast(s.handle)); + return s; +#else + DIY_UNSUPPORTED_MPI_CALL(diy::mpi::request::wait); +#endif +} + +diy::mpi::optional<diy::mpi::status> diy::mpi::request::test() +{ +#if DIY_HAS_MPI + status s; + int flag; + MPI_Test(&mpi_cast(handle), &flag, &mpi_cast(s.handle)); + if (flag) + return s; +#endif + return optional<status>(); +} + +void diy::mpi::request::cancel() +{ +#if DIY_HAS_MPI + MPI_Cancel(&mpi_cast(handle)); +#endif +} diff --git a/include/vtkdiy2/mpi/request.hpp b/include/vtkdiy2/mpi/request.hpp index b4f999cade1e0192239d28aed6d46376a39d7fb9..8db9369e9e20744cda77780c510e28c8bfa976de 100644 --- a/include/vtkdiy2/mpi/request.hpp +++ b/include/vtkdiy2/mpi/request.hpp @@ -1,50 +1,29 @@ +#ifndef DIY_MPI_REQUEST_HPP +#define DIY_MPI_REQUEST_HPP + +#include "config.hpp" +#include "status.hpp" +#include "optional.hpp" + namespace diy { namespace mpi { struct request { - inline - status wait(); - inline - optional<status> test(); - inline - void cancel(); + DIY_MPI_EXPORT_FUNCTION request(); + DIY_MPI_EXPORT_FUNCTION status wait(); + DIY_MPI_EXPORT_FUNCTION optional<status> test(); + DIY_MPI_EXPORT_FUNCTION void cancel(); - MPI_Request r; + DIY_MPI_Request handle; }; -} -} -diy::mpi::status -diy::mpi::request::wait() -{ -#ifndef DIY_NO_MPI - status s; - MPI_Wait(&r, &s.s); - return s; -#else - DIY_UNSUPPORTED_MPI_CALL(diy::mpi::request::wait); -#endif } +} // diy::mpi -diy::mpi::optional<diy::mpi::status> -diy::mpi::request::test() -{ -#ifndef DIY_NO_MPI - status s; - int flag; - MPI_Test(&r, &flag, &s.s); - if (flag) - return s; +#ifndef DIY_MPI_AS_LIB +#include "request.cpp" #endif - return optional<status>(); -} -void -diy::mpi::request::cancel() -{ -#ifndef DIY_NO_MPI - MPI_Cancel(&r); -#endif -} +#endif // DIY_MPI_REQUEST_HPP diff --git a/include/vtkdiy2/mpi/status.cpp b/include/vtkdiy2/mpi/status.cpp new file mode 100644 index 0000000000000000000000000000000000000000..af2af71062f389a5f827f3c92b5bb8db94842524 --- /dev/null +++ b/include/vtkdiy2/mpi/status.cpp @@ -0,0 +1,30 @@ +#ifdef DIY_MPI_AS_LIB +#include "status.hpp" +#endif + +int diy::mpi::status::source() const { return mpi_cast(handle).MPI_SOURCE; } +int diy::mpi::status::tag() const { return mpi_cast(handle).MPI_TAG; } +int diy::mpi::status::error() const { return mpi_cast(handle).MPI_ERROR; } + +bool diy::mpi::status::cancelled() const +{ +#if DIY_HAS_MPI + int flag; + MPI_Test_cancelled(&mpi_cast(handle), &flag); + return flag; +#else + DIY_UNSUPPORTED_MPI_CALL(diy::mpi::status::cancelled); +#endif +} + +int diy::mpi::status::count(const diy::mpi::datatype& type) const +{ +#if DIY_HAS_MPI + int c; + MPI_Get_count(&mpi_cast(handle), mpi_cast(type.handle), &c); + return c; +#else + (void) type; + DIY_UNSUPPORTED_MPI_CALL(diy::mpi::status::count); +#endif +} diff --git a/include/vtkdiy2/mpi/status.hpp b/include/vtkdiy2/mpi/status.hpp index e90978bd44eda0baa18cd55c7a47a0196b019580..8838561f9372d55a823d79ee5c27ef1078a1862c 100644 --- a/include/vtkdiy2/mpi/status.hpp +++ b/include/vtkdiy2/mpi/status.hpp @@ -1,49 +1,42 @@ +#ifndef DIY_MPI_STATUS_HPP +#define DIY_MPI_STATUS_HPP + +#include "config.hpp" +#include "datatypes.hpp" + namespace diy { namespace mpi { struct status { - int source() const { return s.MPI_SOURCE; } - int tag() const { return s.MPI_TAG; } - int error() const { return s.MPI_ERROR; } + status() = default; + status(const DIY_MPI_Status& s) : handle(s) {} - inline - bool cancelled() const; +#ifndef DIY_MPI_AS_LIB // only available in header-only mode + status(const MPI_Status& s) : handle(s) {} + operator MPI_Status() { return handle; } +#endif - template<class T> - int count() const; + DIY_MPI_EXPORT_FUNCTION int source() const; + DIY_MPI_EXPORT_FUNCTION int tag() const; + DIY_MPI_EXPORT_FUNCTION int error() const; + DIY_MPI_EXPORT_FUNCTION bool cancelled() const; + DIY_MPI_EXPORT_FUNCTION int count(const datatype& type) const; - operator MPI_Status&() { return s; } - operator const MPI_Status&() const { return s; } + template<class T> int count() const + { + return this->count(detail::get_mpi_datatype<T>()); + } - MPI_Status s; + DIY_MPI_Status handle; }; -} -} - -bool -diy::mpi::status::cancelled() const -{ -#ifndef DIY_NO_MPI - int flag; - MPI_Test_cancelled(const_cast<MPI_Status*>(&s), &flag); - return flag; -#else - DIY_UNSUPPORTED_MPI_CALL(diy::mpi::status::cancelled); -#endif } +} // diy::mpi -template<class T> -int -diy::mpi::status::count() const -{ -#ifndef DIY_NO_MPI - int c; - MPI_Get_count(const_cast<MPI_Status*>(&s), detail::get_mpi_datatype<T>(), &c); - return c; -#else - DIY_UNSUPPORTED_MPI_CALL(diy::mpi::status::count); +#ifndef DIY_MPI_AS_LIB +#include "status.cpp" #endif -} + +#endif // DIY_MPI_STATUS_HPP diff --git a/include/vtkdiy2/mpi/window.cpp b/include/vtkdiy2/mpi/window.cpp new file mode 100644 index 0000000000000000000000000000000000000000..ec20d0b3e1c84b33257fe3546bc45e08bb34bcd1 --- /dev/null +++ b/include/vtkdiy2/mpi/window.cpp @@ -0,0 +1,226 @@ +#ifdef DIY_MPI_AS_LIB +#include "window.hpp" +#endif + +#include <algorithm> + +namespace diy +{ +namespace mpi +{ + +#ifdef DIY_MPI_AS_LIB +# ifdef _MSC_VER +# define EXPORT_MACRO DIY_MPI_EXPORT +# else +# define EXPORT_MACRO +# endif +EXPORT_MACRO const int nocheck = MPI_MODE_NOCHECK; +# undef EXPORT_MACRO +#endif + +namespace detail +{ + +DIY_MPI_Win win_allocate(const communicator& comm, void** base, unsigned size, int disp) +{ +#if DIY_HAS_MPI + DIY_MPI_Win win; + MPI_Win_allocate(size, disp, MPI_INFO_NULL, mpi_cast(comm.handle()), base, &mpi_cast(win)); + return win; +#else + (void)comm; (void)disp; + *base = malloc(size); + auto mpi_win = MPI_Win(*base, true); + auto win = make_DIY_MPI_Win(std::move(mpi_win)); + return win; +#endif +} + +DIY_MPI_Win win_create(const communicator& comm, void* base, unsigned size, int disp) +{ +#if DIY_HAS_MPI + DIY_MPI_Win win; + MPI_Win_create(base, size, disp, MPI_INFO_NULL, mpi_cast(comm.handle()), &mpi_cast(win)); + return win; +#else + (void)comm; (void)size; (void)disp; + auto mpi_win = MPI_Win(base); + auto win = make_DIY_MPI_Win(std::move(mpi_win)); + return win; +#endif +} + +void win_free(DIY_MPI_Win& win) +{ +#if DIY_HAS_MPI + MPI_Win_free(&mpi_cast(win)); +#else + auto& mpi_win = mpi_cast(win); + if (mpi_win.owned()) + free(mpi_win.data()); +#endif +} + +void put(const DIY_MPI_Win& win, const void* data, int count, const datatype& type, int rank, unsigned offset) +{ +#if DIY_HAS_MPI + MPI_Put(data, count, mpi_cast(type.handle), rank, offset, count, mpi_cast(type.handle), mpi_cast(win)); +#else + void* buffer = mpi_cast(win).data(); + size_t size = mpi_cast(type.handle); + std::copy_n(static_cast<const int8_t*>(data), + size * static_cast<size_t>(count), + static_cast<int8_t*>(buffer) + (offset * size)); + (void)rank; +#endif +} + +void get(const DIY_MPI_Win& win, void* data, int count, const datatype& type, int rank, unsigned offset) +{ +#if DIY_HAS_MPI + MPI_Get(data, count, mpi_cast(type.handle), rank, offset, count, mpi_cast(type.handle), mpi_cast(win)); +#else + const void* buffer = mpi_cast(win).data(); + size_t size = mpi_cast(type.handle); + std::copy_n(static_cast<const int8_t*>(buffer) + (offset * size), + size * static_cast<size_t>(count), + static_cast<int8_t*>(data)); + (void)rank; +#endif +} + +void fence(const DIY_MPI_Win& win, int assert) +{ +#if DIY_HAS_MPI + MPI_Win_fence(assert, mpi_cast(win)); +#else + (void) win; (void) assert; +#endif +} + +void lock(const DIY_MPI_Win& win, int lock_type, int rank, int assert) +{ +#if DIY_HAS_MPI + MPI_Win_lock(lock_type, rank, assert, mpi_cast(win)); +#else + (void) win; (void) lock_type; (void) rank; (void) assert; +#endif +} + +void unlock(const DIY_MPI_Win& win, int rank) +{ +#if DIY_HAS_MPI + MPI_Win_unlock(rank, mpi_cast(win)); +#else + (void) win; (void) rank; +#endif +} + +void lock_all(const DIY_MPI_Win& win, int assert) +{ +#if DIY_HAS_MPI + MPI_Win_lock_all(assert, mpi_cast(win)); +#else + (void) win; (void) assert; +#endif +} + +void unlock_all(const DIY_MPI_Win& win) +{ +#if DIY_HAS_MPI + MPI_Win_unlock_all(mpi_cast(win)); +#else + (void) win; +#endif +} + +void fetch_and_op(const DIY_MPI_Win& win, + const void* origin, void* result, const datatype& type, + int rank, unsigned offset, + const operation& op) +{ +#if DIY_HAS_MPI + MPI_Fetch_and_op(origin, result, mpi_cast(type.handle), rank, offset, mpi_cast(op.handle), mpi_cast(win)); +#else + (void) win; (void) origin; (void) result; (void) type; (void) rank; (void) offset; (void) op; + DIY_UNSUPPORTED_MPI_CALL(MPI_Fetch_and_op); +#endif +} + +void fetch(const DIY_MPI_Win& win, void* result, const datatype& type, int rank, unsigned offset) +{ +#if DIY_HAS_MPI + MPI_Fetch_and_op(nullptr, result, mpi_cast(type.handle), rank, offset, MPI_NO_OP, mpi_cast(win)); +#else + (void) rank; + const void* buffer = mpi_cast(win).data(); + size_t size = mpi_cast(type.handle); + std::copy_n(static_cast<const int8_t*>(buffer) + (offset * size), + size, + static_cast<int8_t*>(result)); +#endif +} + +void replace(const DIY_MPI_Win& win, const void* value, const datatype& type, int rank, unsigned offset) +{ +#if DIY_HAS_MPI + MPI_Fetch_and_op(value, nullptr, mpi_cast(type.handle), rank, offset, MPI_REPLACE, mpi_cast(win)); +#else + (void) rank; + void* buffer = mpi_cast(win).data(); + size_t size = mpi_cast(type.handle); + std::copy_n(static_cast<const int8_t*>(value), + size, + static_cast<int8_t*>(buffer) + (offset * size)); +#endif +} + +void sync(const DIY_MPI_Win& win) +{ +#if DIY_HAS_MPI + MPI_Win_sync(mpi_cast(win)); +#else + (void) win; +#endif +} + +void flush(const DIY_MPI_Win& win, int rank) +{ +#if DIY_HAS_MPI + MPI_Win_flush(rank, mpi_cast(win)); +#else + (void) win; (void) rank; +#endif +} + +void flush_all(const DIY_MPI_Win& win) +{ +#if DIY_HAS_MPI + MPI_Win_flush_all(mpi_cast(win)); +#else + (void) win; +#endif +} + +void flush_local(const DIY_MPI_Win& win, int rank) +{ +#if DIY_HAS_MPI + MPI_Win_flush_local(rank, mpi_cast(win)); +#else + (void) win; (void) rank; +#endif +} + +void flush_local_all(const DIY_MPI_Win& win) +{ +#if DIY_HAS_MPI + MPI_Win_flush_local_all(mpi_cast(win)); +#else + (void) win; +#endif +} + +} +} +} // diy::mpi::detail diff --git a/include/vtkdiy2/mpi/window.hpp b/include/vtkdiy2/mpi/window.hpp index 7bf941ee29d44883be8719dd39bb5419c5e20ff5..2088ce2a07c5b20d3a7dd5deee5ef2ff9e2a219b 100644 --- a/include/vtkdiy2/mpi/window.hpp +++ b/include/vtkdiy2/mpi/window.hpp @@ -1,10 +1,92 @@ +#ifndef DIY_MPI_WINODW_HPP +#define DIY_MPI_WINODW_HPP + +#include "config.hpp" +#include "communicator.hpp" +#include "operations.hpp" + #include <type_traits> +#include <vector> namespace diy { namespace mpi { +#ifndef DIY_MPI_AS_LIB +constexpr int nocheck = MPI_MODE_NOCHECK; +#else +DIY_MPI_EXPORT extern const int nocheck; +#endif + +namespace detail +{ + +DIY_MPI_EXPORT_FUNCTION +DIY_MPI_Win win_allocate(const communicator& comm, void** base, unsigned size, int disp); + +DIY_MPI_EXPORT_FUNCTION +DIY_MPI_Win win_create(const communicator& comm, void* base, unsigned size, int disp); + +DIY_MPI_EXPORT_FUNCTION +void win_free(DIY_MPI_Win& win); + +DIY_MPI_EXPORT_FUNCTION +void put(const DIY_MPI_Win& win, + const void* data, int count, const datatype& type, + int rank, unsigned offset); + +DIY_MPI_EXPORT_FUNCTION +void get(const DIY_MPI_Win& win, + void* data, int count, const datatype& type, + int rank, unsigned offset); + +DIY_MPI_EXPORT_FUNCTION +void fence(const DIY_MPI_Win& win, int assert); + +DIY_MPI_EXPORT_FUNCTION +void lock(const DIY_MPI_Win& win, int lock_type, int rank, int assert); + +DIY_MPI_EXPORT_FUNCTION +void unlock(const DIY_MPI_Win& win, int rank); + +DIY_MPI_EXPORT_FUNCTION +void lock_all(const DIY_MPI_Win& win, int assert); + +DIY_MPI_EXPORT_FUNCTION +void unlock_all(const DIY_MPI_Win& win); + +DIY_MPI_EXPORT_FUNCTION +void fetch_and_op(const DIY_MPI_Win& win, + const void* origin, void* result, const datatype& type, + int rank, unsigned offset, + const operation& op); + +DIY_MPI_EXPORT_FUNCTION +void fetch(const DIY_MPI_Win& win, void* result, const datatype& type, int rank, unsigned offset); + +DIY_MPI_EXPORT_FUNCTION +void replace(const DIY_MPI_Win& win, + const void* value, const datatype& type, + int rank, unsigned offset); + +DIY_MPI_EXPORT_FUNCTION +void sync(const DIY_MPI_Win& win); + +DIY_MPI_EXPORT_FUNCTION +void flush(const DIY_MPI_Win& win, int rank); + +DIY_MPI_EXPORT_FUNCTION +void flush_all(const DIY_MPI_Win& win); + +DIY_MPI_EXPORT_FUNCTION +void flush_local(const DIY_MPI_Win& win, int rank); + +DIY_MPI_EXPORT_FUNCTION +void flush_local_all(const DIY_MPI_Win& win); + +} // detail + //! \ingroup MPI //! Simple wrapper around MPI window functions. template<class T> @@ -17,8 +99,8 @@ namespace mpi inline ~window(); // moving is Ok - window(window&&) = default; - window& operator=(window&&) = default; + inline window(window&&); + inline window& operator=(window&&); // cannot copy because of the buffer_ window(const window&) = delete; @@ -38,7 +120,7 @@ namespace mpi inline void lock_all(int assert = 0); inline void unlock_all(); - inline void fetch_and_op(const T* origin, T* result, int rank, unsigned offset, MPI_Op op); + inline void fetch_and_op(const T* origin, T* result, int rank, unsigned offset, const operation& op); inline void fetch(T& result, int rank, unsigned offset); inline void replace(const T& value, int rank, unsigned offset); @@ -50,32 +132,57 @@ namespace mpi inline void flush_local_all(); private: - std::vector<T> buffer_; + void* buffer_; int rank_; -#ifndef DIY_NO_MPI - MPI_Win window_; -#endif + DIY_MPI_Win window_; }; + } // mpi } // diy template<class T> diy::mpi::window<T>:: -window(const communicator& comm, unsigned size): - buffer_(size), rank_(comm.rank()) +window(const diy::mpi::communicator& comm, unsigned size): + buffer_(nullptr), rank_(comm.rank()) { -#ifndef DIY_NO_MPI - MPI_Win_create(buffer_.data(), buffer_.size()*sizeof(T), sizeof(T), MPI_INFO_NULL, comm, &window_); -#endif + window_ = detail::win_allocate(comm, &buffer_, static_cast<unsigned>(size*sizeof(T)), static_cast<int>(sizeof(T))); } template<class T> diy::mpi::window<T>:: ~window() { -#ifndef DIY_NO_MPI - MPI_Win_free(&window_); -#endif + if (buffer_) + detail::win_free(window_); +} + +template<class T> +diy::mpi::window<T>:: +window(window&& rhs): + buffer_(rhs.buffer_), rank_(rhs.rank_), window_(std::move(rhs.window_)) +{ + rhs.buffer_ = nullptr; + rhs.window_.reset(); +} + +template<class T> +diy::mpi::window<T>& +diy::mpi::window<T>:: +operator=(window&& rhs) +{ + if (this == &rhs) + return *this; + + if (buffer_) + detail::win_free(window_); + + buffer_ = rhs.buffer_; + rhs.buffer_ = nullptr; + rank_ = rhs.rank_; + window_ = std::move(rhs.window_); + rhs.window_.reset(); + + return *this; } template<class T> @@ -83,15 +190,7 @@ void diy::mpi::window<T>:: put(const T& x, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - MPI_Put(address(x), count(x), datatype(x), - rank, - offset, - count(x), datatype(x), - window_); -#else - buffer_[offset] = x; -#endif + detail::put(window_, address(x), count(x), datatype_of(x), rank, offset); } template<class T> @@ -99,16 +198,7 @@ void diy::mpi::window<T>:: put(const std::vector<T>& x, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - MPI_Put(address(x), count(x), datatype(x), - rank, - offset, - count(x), datatype(x), - window_); -#else - for (size_t i = 0; i < x.size(); ++i) - buffer_[offset + i] = x[i]; -#endif + detail::put(window_, address(x), count(x), datatype_of(x), rank, offset); } template<class T> @@ -116,15 +206,7 @@ void diy::mpi::window<T>:: get(T& x, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - MPI_Get(address(x), count(x), datatype(x), - rank, - offset, - count(x), datatype(x), - window_); -#else - x = buffer_[offset]; -#endif + detail::get(window_, address(x), count(x), datatype_of(x), rank, offset); } template<class T> @@ -132,16 +214,7 @@ void diy::mpi::window<T>:: get(std::vector<T>& x, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - MPI_Get(address(x), count(x), datatype(x), - rank, - offset, - count(x), datatype(x), - window_); -#else - for (size_t i = 0; i < x.size(); ++i) - x[i] = buffer_[offset + i]; -#endif + detail::get(window_, address(x), count(x), datatype_of(x), rank, offset); } template<class T> @@ -149,9 +222,7 @@ void diy::mpi::window<T>:: fence(int assert) { -#ifndef DIY_NO_MPI - MPI_Win_fence(assert, window_); -#endif + detail::fence(window_, assert); } template<class T> @@ -159,9 +230,7 @@ void diy::mpi::window<T>:: lock(int lock_type, int rank, int assert) { -#ifndef DIY_NO_MPI - MPI_Win_lock(lock_type, rank, assert, window_); -#endif + detail::lock(window_, lock_type, rank, assert); } template<class T> @@ -169,9 +238,7 @@ void diy::mpi::window<T>:: unlock(int rank) { -#ifndef DIY_NO_MPI - MPI_Win_unlock(rank, window_); -#endif + detail::unlock(window_, rank); } template<class T> @@ -179,9 +246,7 @@ void diy::mpi::window<T>:: lock_all(int assert) { -#ifndef DIY_NO_MPI - MPI_Win_lock_all(assert, window_); -#endif + detail::lock_all(window_, assert); } template<class T> @@ -189,20 +254,15 @@ void diy::mpi::window<T>:: unlock_all() { -#ifndef DIY_NO_MPI - MPI_Win_unlock_all(window_); -#endif + detail::unlock_all(window_); } + template<class T> void diy::mpi::window<T>:: -fetch_and_op(const T* origin, T* result, int rank, unsigned offset, MPI_Op op) +fetch_and_op(const T* origin, T* result, int rank, unsigned offset, const diy::mpi::operation& op) { -#ifndef DIY_NO_MPI - MPI_Fetch_and_op(origin, result, datatype(*origin), rank, offset, op, window_); -#else - DIY_UNSUPPORTED_MPI_CALL(MPI_Fetch_and_op); -#endif + detail::fetch_and_op(window_, origin, result, datatype_of(*origin), rank, offset, op); } template<class T> @@ -210,12 +270,7 @@ void diy::mpi::window<T>:: fetch(T& result, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - T unused; - fetch_and_op(&unused, &result, rank, offset, MPI_NO_OP); -#else - result = buffer_[offset]; -#endif + detail::fetch(window_, &result, datatype_of(result), rank, offset); } template<class T> @@ -223,12 +278,7 @@ void diy::mpi::window<T>:: replace(const T& value, int rank, unsigned offset) { -#ifndef DIY_NO_MPI - T unused; - fetch_and_op(&value, &unused, rank, offset, MPI_REPLACE); -#else - buffer_[offset] = value; -#endif + detail::replace(window_, &value, datatype_of(value), rank, offset); } template<class T> @@ -236,9 +286,7 @@ void diy::mpi::window<T>:: sync() { -#ifndef DIY_NO_MPI - MPI_Win_sync(window_); -#endif + detail::sync(window_); } template<class T> @@ -246,9 +294,7 @@ void diy::mpi::window<T>:: flush(int rank) { -#ifndef DIY_NO_MPI - MPI_Win_flush(rank, window_); -#endif + detail::flush(window_, rank); } template<class T> @@ -256,9 +302,7 @@ void diy::mpi::window<T>:: flush_all() { -#ifndef DIY_NO_MPI - MPI_Win_flush_all(window_); -#endif + detail::flush_all(window_); } template<class T> @@ -266,9 +310,7 @@ void diy::mpi::window<T>:: flush_local(int rank) { -#ifndef DIY_NO_MPI - MPI_Win_flush_local(rank, window_); -#endif + detail::flush_local(window_, rank); } template<class T> @@ -276,7 +318,11 @@ void diy::mpi::window<T>:: flush_local_all() { -#ifndef DIY_NO_MPI - MPI_Win_flush_local_all(window_); -#endif + detail::flush_local_all(window_); } + +#ifndef DIY_MPI_AS_LIB +#include "window.cpp" +#endif + +#endif // DIY_MPI_WINODW_HPP diff --git a/include/vtkdiy2/no-thread.hpp b/include/vtkdiy2/no-thread.hpp index 218c3067d0572375b136cd1711d53fab0cf1f0f6..12533c0f610d08a9a853d937a722a09834af501b 100644 --- a/include/vtkdiy2/no-thread.hpp +++ b/include/vtkdiy2/no-thread.hpp @@ -18,6 +18,8 @@ namespace diy template<class Function, class... Args> explicit thread(Function&& f, Args&&... args) { f(args...); } // not ideal, since it doesn't support member functions + thread& operator=(thread&&) = default; + void join() {} static unsigned hardware_concurrency() { return 1; } @@ -31,8 +33,13 @@ namespace diy struct lock_guard { lock_guard(T&) {} + void lock() {} + void unlock() {} }; + template<class T, class U> + using concurrent_map = std::map<T,U>; + namespace this_thread { inline unsigned long int get_id() { return 0; } diff --git a/include/vtkdiy2/proxy.hpp b/include/vtkdiy2/proxy.hpp index 00bf8279fa45306e091b5f5157a969f35b93b1e3..8f33c98b773dca50bdb536eb41769091e018e1dd 100644 --- a/include/vtkdiy2/proxy.hpp +++ b/include/vtkdiy2/proxy.hpp @@ -1,6 +1,7 @@ #ifndef DIY_PROXY_HPP #define DIY_PROXY_HPP +#include "coroutine.hpp" namespace diy { @@ -10,17 +11,88 @@ namespace diy template <class T> struct EnqueueIterator; + using IncomingQueues = std::map<int, MemoryBuffer>; + using OutgoingQueues = std::map<BlockID, MemoryBuffer>; + Proxy(Master* master__, int gid__, IExchangeInfo* iexchange__ = 0): gid_(gid__), master_(master__), iexchange_(iexchange__), - incoming_(&master__->incoming(gid__)), - outgoing_(&master__->outgoing(gid__)), - collectives_(&master__->collectives(gid__)) {} + collectives_(&master__->collectives(gid__)) + { + fill_incoming(); + + // move outgoing_ back into proxy, in case it's a multi-foreach round + if (!iexchange_) + for (auto& x : master_->outgoing(gid_)) + { + auto access = x.second.access(); + if (!access->empty()) + { + outgoing_.emplace(x.first, access->back().move()); + access->pop_back(); + } + } + } + + // delete copy constructor to avoid coping incoming_ and outgoing_ (plus it + // won't work otherwise because MemoryBuffer has a deleted copy + // constructor) + Proxy(const Proxy&) =delete; + Proxy(Proxy&&) =default; + Proxy& operator=(const Proxy&) =delete; + Proxy& operator=(Proxy&&) =default; + + ~Proxy() + { + auto& outgoing = master_->outgoing(gid_); + auto& incoming = master_->incoming(gid_); + + // copy out outgoing_ + for (auto& x : outgoing_) + { + outgoing[x.first].access()->emplace_back(std::move(x.second)); + if (iexchange_) + iexchange_->inc_work(); + } + + // move incoming_ back into master, in case it's a multi-foreach round + if (!iexchange_) + for (auto& x : incoming_) + incoming[x.first].access()->emplace_front(std::move(x.second)); + } + + void init() + { + collectives_ = &master()->collectives(gid()); + } int gid() const { return gid_; } + bool fill_incoming() const + { + bool exists = false; + + incoming_.clear(); + + // fill incoming_ + for (auto& x : master_->incoming(gid_)) + { + auto access = x.second.access(); + if (!access->empty()) + { + exists = true; + incoming_.emplace(x.first, access->front().move()); + access->pop_front(); + if (iexchange_) + iexchange_->dec_work(); + } + } + + return exists; + } + //! Enqueue data whose size can be determined automatically, e.g., an STL vector. template<class T> void enqueue(const BlockID& to, //!< target block (gid,proc) @@ -28,13 +100,7 @@ namespace diy void (*save)(BinaryBuffer&, const T&) = &::diy::save //!< optional serialization function ) const { - OutgoingQueues& out = *outgoing_; save(out[to], x); - - if (iexchange_ && iexchange_->fine()) - { - GidSendOrder gid_order; // uninitialized, not needed - master()->comm_exchange(gid_order, iexchange_); - } + save(outgoing_[to], x); } //! Enqueue data whose size is given explicitly by the user, e.g., an array. @@ -45,6 +111,12 @@ namespace diy void (*save)(BinaryBuffer&, const T&) = &::diy::save //!< optional serialization function ) const; + void inline enqueue_blob + (const BlockID& to, //!< target block (gid,proc) + const char* x, //!< pointer to the data + size_t n //!< size in data elements (eg. ints) + ) const; + //! Dequeue data whose size can be determined automatically (e.g., STL vector) and that was //! previously enqueued so that diy knows its size when it is received. //! In this case, diy will allocate the receive buffer; the user does not need to do so. @@ -53,7 +125,7 @@ namespace diy T& x, //!< data (eg. STL vector) void (*load)(BinaryBuffer&, T&) = &::diy::load //!< optional serialization function ) const - { IncomingQueues& in = *incoming_; load(in[from], x); } + { load(incoming_[from], x); } //! Dequeue an array of data whose size is given explicitly by the user. //! In this case, the user needs to allocate the receive buffer prior to calling dequeue. @@ -82,17 +154,20 @@ namespace diy void (*load)(BinaryBuffer&, T&) = &::diy::load //!< optional serialization function ) const { dequeue(from.gid, x, n, load); } + BinaryBlob inline dequeue_blob + (int from) const; + template<class T> EnqueueIterator<T> enqueuer(const T& x, void (*save)(BinaryBuffer&, const T&) = &::diy::save ) const { return EnqueueIterator<T>(this, x, save); } - IncomingQueues* incoming() const { return incoming_; } - MemoryBuffer& incoming(int from) const { return (*incoming_)[from]; } + IncomingQueues* incoming() const { return &incoming_; } + MemoryBuffer& incoming(int from) const { return incoming_[from]; } inline void incoming(std::vector<int>& v) const; // fill v with every gid from which we have a message - OutgoingQueues* outgoing() const { return outgoing_; } - MemoryBuffer& outgoing(const BlockID& to) const { return (*outgoing_)[to]; } + OutgoingQueues* outgoing() const { return &outgoing_; } + MemoryBuffer& outgoing(const BlockID& to) const { return outgoing_[to]; } inline bool empty_incoming_queues() const; inline bool empty_outgoing_queues() const; @@ -134,19 +209,30 @@ namespace diy Master* master() const { return master_; } IExchangeInfo* iexchange() const { return iexchange_; } + // Coroutine machinery + void set_main(coroutine::cothread_t main) { main_ = main; } + void yield() const { coroutine::co_switch(main_); } + void set_done(bool x) { done_ = x; } + bool done() const { return done_; } + private: int gid_; Master* master_; IExchangeInfo* iexchange_; - IncomingQueues* incoming_; - OutgoingQueues* outgoing_; + // TODO: these are marked mutable to not have to undo consts on enqueue/dequeue, in case it breaks things; + // eventually, implement this change + mutable IncomingQueues incoming_; + mutable OutgoingQueues outgoing_; + CollectivesList* collectives_; + + coroutine::cothread_t main_; + bool done_ = false; }; template<class T> - struct Master::Proxy::EnqueueIterator: - public std::iterator<std::output_iterator_tag, void, void, void, void> + struct Master::Proxy::EnqueueIterator { typedef void (*SaveT)(BinaryBuffer&, const T&); @@ -168,10 +254,10 @@ namespace diy struct Master::ProxyWithLink: public Master::Proxy { - ProxyWithLink(const Proxy& proxy, + ProxyWithLink(Proxy&& proxy, void* block__, Link* link__): - Proxy(proxy), + Proxy(std::move(proxy)), block_(block__), link_(link__) {} @@ -188,8 +274,8 @@ void diy::Master::Proxy:: incoming(std::vector<int>& v) const { - for (IncomingQueues::const_iterator it = incoming_->begin(); it != incoming_->end(); ++it) - v.push_back(it->first); + for (auto& x : incoming_) + v.push_back(x.first); } bool @@ -262,19 +348,12 @@ diy::Master::Proxy:: enqueue(const BlockID& to, const T* x, size_t n, void (*save)(BinaryBuffer&, const T&)) const { - OutgoingQueues& out = *outgoing_; - BinaryBuffer& bb = out[to]; + BinaryBuffer& bb = outgoing_[to]; if (save == (void (*)(BinaryBuffer&, const T&)) &::diy::save<T>) diy::save(bb, x, n); // optimized for unspecialized types else for (size_t i = 0; i < n; ++i) save(bb, x[i]); - - if (iexchange_ && iexchange_->fine()) - { - GidSendOrder gid_order; // uninitialized, not needed - master()->comm_exchange(gid_order, iexchange_); - } } template<class T> @@ -283,8 +362,7 @@ diy::Master::Proxy:: dequeue(int from, T* x, size_t n, void (*load)(BinaryBuffer&, T&)) const { - IncomingQueues& in = *incoming_; - BinaryBuffer& bb = in[from]; + BinaryBuffer& bb = incoming_[from]; if (load == (void (*)(BinaryBuffer&, T&)) &::diy::load<T>) diy::load(bb, x, n); // optimized for unspecialized types else @@ -292,5 +370,20 @@ dequeue(int from, T* x, size_t n, load(bb, x[i]); } +void +diy::Master::Proxy:: +enqueue_blob(const BlockID& to, const char* x, size_t n) const +{ + BinaryBuffer& bb = outgoing_[to]; + bb.save_binary_blob(x,n); +} + +diy::BinaryBlob +diy::Master::Proxy:: +dequeue_blob(int from) const +{ + BinaryBuffer& bb = incoming_[from]; + return bb.load_binary_blob(); +} #endif diff --git a/include/vtkdiy2/reduce.hpp b/include/vtkdiy2/reduce.hpp index 0dac8327f57cf6656a37565c753fbf33e1b4d1d1..44e4c8b626806742fa9bdd408bbe26b545c1bda2 100644 --- a/include/vtkdiy2/reduce.hpp +++ b/include/vtkdiy2/reduce.hpp @@ -16,13 +16,13 @@ struct ReduceProxy: public Master::Proxy { typedef std::vector<int> GIDVector; - ReduceProxy(const Master::Proxy& proxy, //!< parent proxy + ReduceProxy(Master::Proxy&& proxy, //!< parent proxy void* block, //!< diy block unsigned round, //!< current round const Assigner& assigner, //!< assigner const GIDVector& incoming_gids, //!< incoming gids in this group const GIDVector& outgoing_gids): //!< outgoing gids in this group - Master::Proxy(proxy), + Master::Proxy(std::move(proxy)), block_(block), round_(round), assigner_(assigner) @@ -46,13 +46,13 @@ struct ReduceProxy: public Master::Proxy } } - ReduceProxy(const Master::Proxy& proxy, //!< parent proxy + ReduceProxy(Master::Proxy&& proxy, //!< parent proxy void* block, //!< diy block unsigned round, //!< current round const Assigner& assigner, const Link& in_link, const Link& out_link): - Master::Proxy(proxy), + Master::Proxy(std::move(proxy)), block_(block), round_(round), assigner_(assigner), @@ -138,7 +138,7 @@ void reduce(Master& master, //!< master object } } master.set_expected(expected); - master.flush(); + master.flush(false); } // final round log->debug("Round {}", round); @@ -170,7 +170,7 @@ namespace detail { using Callback = std::function<void(Block*, const ReduceProxy&, const Partners&)>; - ReductionFunctor(unsigned round_, const Callback& reduce_, const Partners& partners_, const Assigner& assigner_): + ReductionFunctor(int round_, const Callback& reduce_, const Partners& partners_, const Assigner& assigner_): round(round_), reduce(reduce_), partners(partners_), assigner(assigner_) {} void operator()(Block* b, const Master::ProxyWithLink& cp) const @@ -180,20 +180,20 @@ namespace detail std::vector<int> incoming_gids, outgoing_gids; if (round > 0) partners.incoming(round, cp.gid(), incoming_gids, *cp.master()); // receive from the previous round - if (round < partners.rounds()) + if (round < static_cast<int>(partners.rounds())) partners.outgoing(round, cp.gid(), outgoing_gids, *cp.master()); // send to the next round - ReduceProxy rp(cp, b, round, assigner, incoming_gids, outgoing_gids); + ReduceProxy rp(std::move(const_cast<Master::ProxyWithLink&>(cp)), b, round, assigner, incoming_gids, outgoing_gids); reduce(b, rp, partners); // touch the outgoing queues to make sure they exist - Master::OutgoingQueues& outgoing = *cp.outgoing(); - if (outgoing.size() < (size_t) rp.out_link().size()) - for (int j = 0; j < rp.out_link().size(); ++j) - outgoing[rp.out_link().target(j)]; // touch the outgoing queue, creating it if necessary + Master::Proxy::OutgoingQueues& outgoing = *rp.outgoing(); + if (outgoing.size() < static_cast<size_t>(rp.out_link().size())) + for (BlockID target : rp.out_link().neighbors()) + outgoing[target]; // touch the outgoing queue, creating it if necessary } - unsigned round; + int round; Callback reduce; Partners partners; const Assigner& assigner; diff --git a/include/vtkdiy2/resolve.hpp b/include/vtkdiy2/resolve.hpp index 78e4050ee70fea0793c88c42f3f54f68e884579f..07158df2647697329a71c85cb0edea755038d47b 100644 --- a/include/vtkdiy2/resolve.hpp +++ b/include/vtkdiy2/resolve.hpp @@ -20,7 +20,7 @@ record_local_gids(const diy::Master& master, diy::DynamicAssigner& assigner) { // figure out local ranks std::vector<std::tuple<int,int>> local_gids; - for (int i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) local_gids.emplace_back(std::make_tuple(master.communicator().rank(), master.gid(i))); assigner.set_ranks(local_gids); @@ -32,7 +32,7 @@ update_links(diy::Master& master, const diy::DynamicAssigner& assigner) { // figure out all the gids we need std::vector<int> nbr_gids; - for (int i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) { auto* link = master.link(i); for (auto blockid : link->neighbors()) @@ -52,7 +52,7 @@ update_links(diy::Master& master, const diy::DynamicAssigner& assigner) gid_to_proc[nbr_gids[i]] = nbr_procs[i]; // fix the procs in links - for (int i = 0; i < master.size(); ++i) + for (int i = 0; i < static_cast<int>(master.size()); ++i) { auto* link = master.link(i); for (auto& blockid : link->neighbors()) diff --git a/include/vtkdiy2/serialization.hpp b/include/vtkdiy2/serialization.hpp index 6109b69b443d342dfe7100393f7e2f8ac10f6c76..41055737dc9fa5072495caf05725d2e89d1b04b9 100644 --- a/include/vtkdiy2/serialization.hpp +++ b/include/vtkdiy2/serialization.hpp @@ -1,20 +1,30 @@ #ifndef DIY_SERIALIZATION_HPP #define DIY_SERIALIZATION_HPP -#include <vector> -#include <valarray> +#include <cassert> +#include <fstream> +#include <functional> #include <map> +#include <memory> #include <set> #include <string> -#include <fstream> - #include <tuple> +#include <type_traits> // this is used for a safety check for default serialization #include <unordered_map> #include <unordered_set> -#include <type_traits> // this is used for a safety check for default serialization +#include <valarray> +#include <vector> namespace diy { + struct BinaryBlob + { + using Deleter = std::function<void(const char[])>; + using Pointer = std::unique_ptr<const char[], Deleter>; + Pointer pointer; + size_t size; + }; + //! A serialization buffer. \ingroup Serialization struct BinaryBuffer { @@ -23,23 +33,43 @@ namespace diy virtual inline void append_binary(const char* x, size_t count) =0; //!< append `count` bytes from `x` to end of buffer virtual void load_binary(char* x, size_t count) =0; //!< copy `count` bytes into `x` from the buffer virtual void load_binary_back(char* x, size_t count) =0; //!< copy `count` bytes into `x` from the back of the buffer + virtual char* grow(size_t count) =0; //!< allocate enough space for `count` bytes and return the pointer to the beginning + virtual char* advance(size_t count) =0; //!< advance buffer position by `count` bytes and return the pointer to the beginning + + virtual void save_binary_blob(const char*, size_t) =0; + virtual void save_binary_blob(const char*, size_t, BinaryBlob::Deleter) = 0; + virtual BinaryBlob load_binary_blob() =0; }; struct MemoryBuffer: public BinaryBuffer { + using Blob = BinaryBlob; + MemoryBuffer(size_t position_ = 0): position(position_) {} + MemoryBuffer(MemoryBuffer&&) =default; + MemoryBuffer(const MemoryBuffer&) =delete; + MemoryBuffer& operator=(MemoryBuffer&&) =default; + MemoryBuffer& operator=(const MemoryBuffer&) =delete; + virtual inline void save_binary(const char* x, size_t count) override; //!< copy `count` bytes from `x` into the buffer virtual inline void append_binary(const char* x, size_t count) override; //!< append `count` bytes from `x` to end of buffer virtual inline void load_binary(char* x, size_t count) override; //!< copy `count` bytes into `x` from the buffer virtual inline void load_binary_back(char* x, size_t count) override; //!< copy `count` bytes into `x` from the back of the buffer + virtual inline char* grow(size_t count) override; //!< allocate enough space for `count` bytes and return the pointer to the beginning + virtual inline char* advance(size_t count) override; //!< advance buffer position by `count` bytes and return the pointer to the beginning + + virtual inline void save_binary_blob(const char* x, size_t count) override; + virtual inline void save_binary_blob(const char* x, size_t count, Blob::Deleter deleter) override; + virtual inline Blob load_binary_blob() override; + size_t nblobs() const { return blobs.size(); } void clear() { buffer.clear(); reset(); } void wipe() { std::vector<char>().swap(buffer); reset(); } void reset() { position = 0; } void skip(size_t s) { position += s; } - void swap(MemoryBuffer& o) { std::swap(position, o.position); buffer.swap(o.buffer); } + void swap(MemoryBuffer& o) { std::swap(position, o.position); buffer.swap(o.buffer); std::swap(blob_position, o.blob_position); blobs.swap(o.blobs); } bool empty() const { return buffer.empty(); } size_t size() const { return buffer.size(); } void reserve(size_t s) { buffer.reserve(s); } @@ -52,7 +82,7 @@ namespace diy static float growth_multiplier() { return 1.5; } // simple file IO - void write(const std::string& fn) const { std::ofstream out(fn.c_str()); out.write(&buffer[0], size()); } + void write(const std::string& fn) const { std::ofstream out(fn.c_str()); out.write(&buffer[0], static_cast<std::streamsize>(size())); } void read(const std::string& fn) { std::ifstream in(fn.c_str(), std::ios::binary | std::ios::ate); @@ -64,6 +94,9 @@ namespace diy size_t position; std::vector<char> buffer; + + size_t blob_position = 0; + std::vector<Blob> blobs; }; namespace detail @@ -92,14 +125,23 @@ namespace diy template<class T> struct Serialization: public detail::Default { -#if (defined(__clang__) && !defined(__ppc64__)) || (defined(__GNUC__) && __GNUC__ >= 5) - //exempt power-pc clang variants due to: https://gitlab.kitware.com/vtk/vtk-m/issues/201 +// GCC release date mapping +// 20160726 == 4.9.4 +// 20150626 == 4.9.3 +// 20150623 == 4.8.5 +// 20150422 == 5.1 +// 20141030 == 4.9.2 +// See https://gcc.gnu.org/onlinedocs/libstdc++/manual/abi.html#abi.versioning.__GLIBCXX__ +#if !(defined(__GLIBCXX__) && \ + (__GLIBCXX__ < 20150422 || __GLIBCXX__ == 20160726 || __GLIBCXX__ == 20150626 || \ + __GLIBCXX__ == 20150623)) + //exempt glibcxx-4 variants as they don't have is_trivially_copyable implemented static_assert(std::is_trivially_copyable<T>::value, "Default serialization works only for trivially copyable types"); #endif static void save(BinaryBuffer& bb, const T& x) { bb.save_binary((const char*) &x, sizeof(T)); } static void load(BinaryBuffer& bb, T& x) { bb.load_binary((char*) &x, sizeof(T)); } - static size_t size(const T& x) { return sizeof(T); } + static size_t size(const T&) { return sizeof(T); } }; //! Saves `x` to `bb` by calling `diy::Serialization<T>::save(bb,x)`. @@ -124,7 +166,7 @@ namespace diy template<class T> void load_back(BinaryBuffer& bb, T& x) { bb.load_binary_back((char*) &x, sizeof(T)); } - //@} + //!@} namespace detail @@ -206,7 +248,7 @@ namespace diy { size_t s; diy::load(bb, s); - v.resize(s); + v.resize(s, U()); if (s > 0) diy::load(bb, &v[0], s); } @@ -229,7 +271,7 @@ namespace diy { size_t s; diy::load(bb, s); - v.resize(s); + v.resize(s, U()); if (s > 0) diy::load(bb, &v[0], s); } @@ -428,17 +470,7 @@ void diy::MemoryBuffer:: save_binary(const char* x, size_t count) { - if (position + count > buffer.capacity()) - { - double newsize = static_cast<double>(position + count) * growth_multiplier(); // if we have to grow, grow geometrically - buffer.reserve(static_cast<size_t>(newsize)); - } - - if (position + count > buffer.size()) - buffer.resize(position + count); - - std::copy_n(x, count, &buffer[position]); - position += count; + std::copy_n(x, count, grow(count)); } void @@ -493,6 +525,58 @@ load_binary_back(char* x, size_t count) buffer.resize(buffer.size() - count); } +char* +diy::MemoryBuffer:: +grow(size_t count) +{ + if (position + count > buffer.capacity()) + { + double newsize = static_cast<double>(position + count) * growth_multiplier(); // if we have to grow, grow geometrically + buffer.reserve(static_cast<size_t>(newsize)); + } + + if (position + count > buffer.size()) + buffer.resize(position + count); + + char* destination = &buffer[position]; + + position += count; + + return destination; +} + +char* +diy::MemoryBuffer:: +advance(size_t count) +{ + char* origin = &buffer[position]; + position += count; + return origin; +} + + +void +diy::MemoryBuffer:: +save_binary_blob(const char* x, size_t count) +{ + // empty deleter means we don't take ownership + save_binary_blob(x, count, [](const char[]) {}); +} + +void +diy::MemoryBuffer:: +save_binary_blob(const char* x, size_t count, Blob::Deleter deleter) +{ + blobs.emplace_back(Blob { Blob::Pointer {x, deleter}, count }); +} + +diy::MemoryBuffer::Blob +diy::MemoryBuffer:: +load_binary_blob() +{ + return std::move(blobs[blob_position++]); +} + void diy::MemoryBuffer:: copy(MemoryBuffer& from, MemoryBuffer& to) diff --git a/include/vtkdiy2/stats.hpp b/include/vtkdiy2/stats.hpp index 837f038c0139a1dac07b4274ce59674108c40570..95520019fe12f873d0f6892d8e4596c44ccc9132 100644 --- a/include/vtkdiy2/stats.hpp +++ b/include/vtkdiy2/stats.hpp @@ -148,8 +148,8 @@ struct Profiler void operator<<(std::string name) { enter(name); } void operator>>(std::string name) { exit(name); } - void enter(std::string name) {} - void exit(std::string name) {} + void enter(std::string) {} + void exit(std::string) {} void output(std::ostream& out, std::string = "") const { @@ -173,7 +173,7 @@ struct Annotation { struct Guard { - Guard(Annotation& a) {} + Guard(Annotation&) {} }; Annotation(const char*) {} @@ -206,7 +206,7 @@ struct Profiler void enter(std::string name) { CALI_MARK_BEGIN(name.c_str()); } void exit(std::string name) { CALI_MARK_END(name.c_str()); } - void output(std::ostream& out, std::string = "") const {} + void output(std::ostream&, std::string = "") const {} void clear() {} Scoped scoped(std::string name) { return Scoped(*this, name); } diff --git a/include/vtkdiy2/storage.hpp b/include/vtkdiy2/storage.hpp index f34998bd644d8e2e3964783c2c944a9cd4236a6c..b1da3d3620cc06a665cac373530e7ed1f60e046e 100644 --- a/include/vtkdiy2/storage.hpp +++ b/include/vtkdiy2/storage.hpp @@ -15,8 +15,8 @@ namespace diy { namespace detail { - typedef void (*Save)(const void*, BinaryBuffer& buf); - typedef void (*Load)(void*, BinaryBuffer& buf); + using Save = std::function<void(const void*, BinaryBuffer&)>; + using Load = std::function<void(void*, BinaryBuffer&)>; struct FileBuffer: public BinaryBuffer { @@ -26,7 +26,7 @@ namespace diy virtual inline void save_binary(const char* x, size_t count) override { fwrite(x, 1, count, file); head += count; } virtual inline void append_binary(const char* x, size_t count) override { - size_t temp_pos = ftell(file); + auto temp_pos = ftell(file); fseek(file, static_cast<long>(tail), SEEK_END); fwrite(x, 1, count, file); tail += count; @@ -34,6 +34,16 @@ namespace diy } virtual inline void load_binary(char* x, size_t count) override { auto n = fread(x, 1, count, file); DIY_UNUSED(n);} virtual inline void load_binary_back(char* x, size_t count) override { fseek(file, static_cast<long>(tail), SEEK_END); auto n = fread(x, 1, count, file); tail += count; fseek(file, static_cast<long>(head), SEEK_SET); DIY_UNUSED(n);} + virtual inline char* grow(size_t) override { throw std::runtime_error("Cannot grow a FileBuffer"); } + virtual inline char* advance(size_t) override { throw std::runtime_error("Cannot advance a FileBuffer"); } + + // TODO: for now, we just throw, but obviously it should be possile to store binary blobs in a file; might want to fall back + using Blob = BinaryBlob; + virtual inline void save_binary_blob(const char*, size_t) override { throw std::runtime_error("Cannot save binary blobs in a FileBuffer"); } + + virtual inline void save_binary_blob(const char*, size_t, Blob::Deleter) override { throw std::runtime_error("Cannot save binary blobs in a FileBuffer"); } + + virtual inline Blob load_binary_blob() override { throw std::runtime_error("Cannot load binary blobs from a FileBuffer"); } size_t size() const { return head; } diff --git a/include/vtkdiy2/fmt/chrono.h b/include/vtkdiy2/thirdparty/fmt/chrono.h similarity index 60% rename from include/vtkdiy2/fmt/chrono.h rename to include/vtkdiy2/thirdparty/fmt/chrono.h index c965cf7810447afb8ceb7ee34f84e4ec8904f8ad..1a3b8d5e5cd8245fd0ac67a09be1c7c0e82cf252 100644 --- a/include/vtkdiy2/fmt/chrono.h +++ b/include/vtkdiy2/thirdparty/fmt/chrono.h @@ -8,35 +8,285 @@ #ifndef FMT_CHRONO_H_ #define FMT_CHRONO_H_ -#include "format.h" -#include "locale.h" - #include <chrono> #include <ctime> #include <locale> #include <sstream> -// enable safe chrono durations, unless explicitly disabled +#include "format.h" +#include "locale.h" + +FMT_BEGIN_NAMESPACE + +// Enable safe chrono durations, unless explicitly disabled. #ifndef FMT_SAFE_DURATION_CAST # define FMT_SAFE_DURATION_CAST 1 #endif - #if FMT_SAFE_DURATION_CAST -# include "safe-duration-cast.h" -#endif -FMT_BEGIN_NAMESPACE +// For conversion between std::chrono::durations without undefined +// behaviour or erroneous results. +// This is a stripped down version of duration_cast, for inclusion in fmt. +// See https://github.com/pauldreik/safe_duration_cast +// +// Copyright Paul Dreik 2019 +namespace safe_duration_cast { + +template <typename To, typename From, + FMT_ENABLE_IF(!std::is_same<From, To>::value && + std::numeric_limits<From>::is_signed == + std::numeric_limits<To>::is_signed)> +FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) { + ec = 0; + using F = std::numeric_limits<From>; + using T = std::numeric_limits<To>; + static_assert(F::is_integer, "From must be integral"); + static_assert(T::is_integer, "To must be integral"); + + // A and B are both signed, or both unsigned. + if (F::digits <= T::digits) { + // From fits in To without any problem. + } else { + // From does not always fit in To, resort to a dynamic check. + if (from < (T::min)() || from > (T::max)()) { + // outside range. + ec = 1; + return {}; + } + } + return static_cast<To>(from); +} + +/** + * converts From to To, without loss. If the dynamic value of from + * can't be converted to To without loss, ec is set. + */ +template <typename To, typename From, + FMT_ENABLE_IF(!std::is_same<From, To>::value && + std::numeric_limits<From>::is_signed != + std::numeric_limits<To>::is_signed)> +FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) { + ec = 0; + using F = std::numeric_limits<From>; + using T = std::numeric_limits<To>; + static_assert(F::is_integer, "From must be integral"); + static_assert(T::is_integer, "To must be integral"); + + if (detail::const_check(F::is_signed && !T::is_signed)) { + // From may be negative, not allowed! + if (fmt::detail::is_negative(from)) { + ec = 1; + return {}; + } + // From is positive. Can it always fit in To? + if (F::digits > T::digits && + from > static_cast<From>(detail::max_value<To>())) { + ec = 1; + return {}; + } + } + + if (!F::is_signed && T::is_signed && F::digits >= T::digits && + from > static_cast<From>(detail::max_value<To>())) { + ec = 1; + return {}; + } + return static_cast<To>(from); // Lossless conversion. +} + +template <typename To, typename From, + FMT_ENABLE_IF(std::is_same<From, To>::value)> +FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) { + ec = 0; + return from; +} // function + +// clang-format off +/** + * converts From to To if possible, otherwise ec is set. + * + * input | output + * ---------------------------------|--------------- + * NaN | NaN + * Inf | Inf + * normal, fits in output | converted (possibly lossy) + * normal, does not fit in output | ec is set + * subnormal | best effort + * -Inf | -Inf + */ +// clang-format on +template <typename To, typename From, + FMT_ENABLE_IF(!std::is_same<From, To>::value)> +FMT_CONSTEXPR To safe_float_conversion(const From from, int& ec) { + ec = 0; + using T = std::numeric_limits<To>; + static_assert(std::is_floating_point<From>::value, "From must be floating"); + static_assert(std::is_floating_point<To>::value, "To must be floating"); + + // catch the only happy case + if (std::isfinite(from)) { + if (from >= T::lowest() && from <= (T::max)()) { + return static_cast<To>(from); + } + // not within range. + ec = 1; + return {}; + } + + // nan and inf will be preserved + return static_cast<To>(from); +} // function + +template <typename To, typename From, + FMT_ENABLE_IF(std::is_same<From, To>::value)> +FMT_CONSTEXPR To safe_float_conversion(const From from, int& ec) { + ec = 0; + static_assert(std::is_floating_point<From>::value, "From must be floating"); + return from; +} + +/** + * safe duration cast between integral durations + */ +template <typename To, typename FromRep, typename FromPeriod, + FMT_ENABLE_IF(std::is_integral<FromRep>::value), + FMT_ENABLE_IF(std::is_integral<typename To::rep>::value)> +To safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from, + int& ec) { + using From = std::chrono::duration<FromRep, FromPeriod>; + ec = 0; + // the basic idea is that we need to convert from count() in the from type + // to count() in the To type, by multiplying it with this: + struct Factor + : std::ratio_divide<typename From::period, typename To::period> {}; + + static_assert(Factor::num > 0, "num must be positive"); + static_assert(Factor::den > 0, "den must be positive"); + + // the conversion is like this: multiply from.count() with Factor::num + // /Factor::den and convert it to To::rep, all this without + // overflow/underflow. let's start by finding a suitable type that can hold + // both To, From and Factor::num + using IntermediateRep = + typename std::common_type<typename From::rep, typename To::rep, + decltype(Factor::num)>::type; + + // safe conversion to IntermediateRep + IntermediateRep count = + lossless_integral_conversion<IntermediateRep>(from.count(), ec); + if (ec) return {}; + // multiply with Factor::num without overflow or underflow + if (detail::const_check(Factor::num != 1)) { + const auto max1 = detail::max_value<IntermediateRep>() / Factor::num; + if (count > max1) { + ec = 1; + return {}; + } + const auto min1 = + (std::numeric_limits<IntermediateRep>::min)() / Factor::num; + if (count < min1) { + ec = 1; + return {}; + } + count *= Factor::num; + } + + if (detail::const_check(Factor::den != 1)) count /= Factor::den; + auto tocount = lossless_integral_conversion<typename To::rep>(count, ec); + return ec ? To() : To(tocount); +} + +/** + * safe duration_cast between floating point durations + */ +template <typename To, typename FromRep, typename FromPeriod, + FMT_ENABLE_IF(std::is_floating_point<FromRep>::value), + FMT_ENABLE_IF(std::is_floating_point<typename To::rep>::value)> +To safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from, + int& ec) { + using From = std::chrono::duration<FromRep, FromPeriod>; + ec = 0; + if (std::isnan(from.count())) { + // nan in, gives nan out. easy. + return To{std::numeric_limits<typename To::rep>::quiet_NaN()}; + } + // maybe we should also check if from is denormal, and decide what to do about + // it. + + // +-inf should be preserved. + if (std::isinf(from.count())) { + return To{from.count()}; + } + + // the basic idea is that we need to convert from count() in the from type + // to count() in the To type, by multiplying it with this: + struct Factor + : std::ratio_divide<typename From::period, typename To::period> {}; + + static_assert(Factor::num > 0, "num must be positive"); + static_assert(Factor::den > 0, "den must be positive"); + + // the conversion is like this: multiply from.count() with Factor::num + // /Factor::den and convert it to To::rep, all this without + // overflow/underflow. let's start by finding a suitable type that can hold + // both To, From and Factor::num + using IntermediateRep = + typename std::common_type<typename From::rep, typename To::rep, + decltype(Factor::num)>::type; + + // force conversion of From::rep -> IntermediateRep to be safe, + // even if it will never happen be narrowing in this context. + IntermediateRep count = + safe_float_conversion<IntermediateRep>(from.count(), ec); + if (ec) { + return {}; + } + + // multiply with Factor::num without overflow or underflow + if (Factor::num != 1) { + constexpr auto max1 = detail::max_value<IntermediateRep>() / + static_cast<IntermediateRep>(Factor::num); + if (count > max1) { + ec = 1; + return {}; + } + constexpr auto min1 = std::numeric_limits<IntermediateRep>::lowest() / + static_cast<IntermediateRep>(Factor::num); + if (count < min1) { + ec = 1; + return {}; + } + count *= static_cast<IntermediateRep>(Factor::num); + } + + // this can't go wrong, right? den>0 is checked earlier. + if (Factor::den != 1) { + using common_t = typename std::common_type<IntermediateRep, intmax_t>::type; + count /= static_cast<common_t>(Factor::den); + } + + // convert to the to type, safely + using ToRep = typename To::rep; + + const ToRep tocount = safe_float_conversion<ToRep>(count, ec); + if (ec) { + return {}; + } + return To{tocount}; +} +} // namespace safe_duration_cast +#endif // Prevents expansion of a preceding token as a function-style macro. // Usage: f FMT_NOMACRO() #define FMT_NOMACRO -namespace internal { +namespace detail { inline null<> localtime_r FMT_NOMACRO(...) { return null<>(); } inline null<> localtime_s(...) { return null<>(); } inline null<> gmtime_r(...) { return null<>(); } inline null<> gmtime_s(...) { return null<>(); } -} // namespace internal +} // namespace detail // Thread-safe replacement for std::localtime inline std::tm localtime(std::time_t time) { @@ -47,22 +297,22 @@ inline std::tm localtime(std::time_t time) { dispatcher(std::time_t t) : time_(t) {} bool run() { - using namespace fmt::internal; + using namespace fmt::detail; return handle(localtime_r(&time_, &tm_)); } bool handle(std::tm* tm) { return tm != nullptr; } - bool handle(internal::null<>) { - using namespace fmt::internal; + bool handle(detail::null<>) { + using namespace fmt::detail; return fallback(localtime_s(&tm_, &time_)); } bool fallback(int res) { return res == 0; } #if !FMT_MSC_VER - bool fallback(internal::null<>) { - using namespace fmt::internal; + bool fallback(detail::null<>) { + using namespace fmt::detail; std::tm* tm = std::localtime(&time_); if (tm) tm_ = *tm; return tm != nullptr; @@ -75,6 +325,11 @@ inline std::tm localtime(std::time_t time) { return lt.tm_; } +inline std::tm localtime( + std::chrono::time_point<std::chrono::system_clock> time_point) { + return localtime(std::chrono::system_clock::to_time_t(time_point)); +} + // Thread-safe replacement for std::gmtime inline std::tm gmtime(std::time_t time) { struct dispatcher { @@ -84,21 +339,21 @@ inline std::tm gmtime(std::time_t time) { dispatcher(std::time_t t) : time_(t) {} bool run() { - using namespace fmt::internal; + using namespace fmt::detail; return handle(gmtime_r(&time_, &tm_)); } bool handle(std::tm* tm) { return tm != nullptr; } - bool handle(internal::null<>) { - using namespace fmt::internal; + bool handle(detail::null<>) { + using namespace fmt::detail; return fallback(gmtime_s(&tm_, &time_)); } bool fallback(int res) { return res == 0; } #if !FMT_MSC_VER - bool fallback(internal::null<>) { + bool fallback(detail::null<>) { std::tm* tm = std::gmtime(&time_); if (tm) tm_ = *tm; return tm != nullptr; @@ -111,17 +366,33 @@ inline std::tm gmtime(std::time_t time) { return gt.tm_; } -namespace internal { -inline std::size_t strftime(char* str, std::size_t count, const char* format, - const std::tm* time) { +inline std::tm gmtime( + std::chrono::time_point<std::chrono::system_clock> time_point) { + return gmtime(std::chrono::system_clock::to_time_t(time_point)); +} + +namespace detail { +inline size_t strftime(char* str, size_t count, const char* format, + const std::tm* time) { return std::strftime(str, count, format, time); } -inline std::size_t strftime(wchar_t* str, std::size_t count, - const wchar_t* format, const std::tm* time) { +inline size_t strftime(wchar_t* str, size_t count, const wchar_t* format, + const std::tm* time) { return std::wcsftime(str, count, format, time); } -} // namespace internal +} // namespace detail + +template <typename Char> +struct formatter<std::chrono::time_point<std::chrono::system_clock>, Char> + : formatter<std::tm, Char> { + template <typename FormatContext> + auto format(std::chrono::time_point<std::chrono::system_clock> val, + FormatContext& ctx) -> decltype(ctx.out()) { + std::tm time = localtime(val); + return formatter<std::tm, Char>::format(time, ctx); + } +}; template <typename Char> struct formatter<std::tm, Char> { template <typename ParseContext> @@ -130,7 +401,7 @@ template <typename Char> struct formatter<std::tm, Char> { if (it != ctx.end() && *it == ':') ++it; auto end = it; while (end != ctx.end() && *end != '}') ++end; - tm_format.reserve(internal::to_unsigned(end - it + 1)); + tm_format.reserve(detail::to_unsigned(end - it + 1)); tm_format.append(it, end); tm_format.push_back('\0'); return end; @@ -139,11 +410,10 @@ template <typename Char> struct formatter<std::tm, Char> { template <typename FormatContext> auto format(const std::tm& tm, FormatContext& ctx) -> decltype(ctx.out()) { basic_memory_buffer<Char> buf; - std::size_t start = buf.size(); + size_t start = buf.size(); for (;;) { - std::size_t size = buf.capacity() - start; - std::size_t count = - internal::strftime(&buf[start], size, &tm_format[0], &tm); + size_t size = buf.capacity() - start; + size_t count = detail::strftime(&buf[start], size, &tm_format[0], &tm); if (count != 0) { buf.resize(start + count); break; @@ -155,7 +425,7 @@ template <typename Char> struct formatter<std::tm, Char> { // https://github.com/fmtlib/fmt/issues/367 break; } - const std::size_t MIN_GROWTH = 10; + const size_t MIN_GROWTH = 10; buf.reserve(buf.capacity() + (size > MIN_GROWTH ? size : MIN_GROWTH)); } return std::copy(buf.begin(), buf.end(), ctx.out()); @@ -164,7 +434,7 @@ template <typename Char> struct formatter<std::tm, Char> { basic_memory_buffer<Char> tm_format; }; -namespace internal { +namespace detail { template <typename Period> FMT_CONSTEXPR const char* get_units() { return nullptr; } @@ -220,12 +490,12 @@ FMT_CONSTEXPR const Char* parse_chrono_format(const Char* begin, handler.on_text(ptr - 1, ptr); break; case 'n': { - const char newline[] = "\n"; + const Char newline[] = {'\n'}; handler.on_text(newline, newline + 1); break; } case 't': { - const char tab[] = "\t"; + const Char tab[] = {'\t'}; handler.on_text(tab, tab + 1); break; } @@ -421,7 +691,7 @@ inline int to_nonnegative_int(T value, int upper) { template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> inline T mod(T x, int y) { - return x % y; + return x % static_cast<T>(y); } template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)> inline T mod(T x, int y) { @@ -484,18 +754,36 @@ inline std::chrono::duration<Rep, std::milli> get_milliseconds( return std::chrono::duration<Rep, std::milli>(static_cast<Rep>(ms)); } -template <typename Rep, typename OutputIt> -OutputIt format_chrono_duration_value(OutputIt out, Rep val, int precision) { - if (precision >= 0) return format_to(out, "{:.{}f}", val, precision); - return format_to(out, std::is_floating_point<Rep>::value ? "{:g}" : "{}", +template <typename Char, typename Rep, typename OutputIt> +OutputIt format_duration_value(OutputIt out, Rep val, int precision) { + const Char pr_f[] = {'{', ':', '.', '{', '}', 'f', '}', 0}; + if (precision >= 0) return format_to(out, pr_f, val, precision); + const Char fp_f[] = {'{', ':', 'g', '}', 0}; + const Char format[] = {'{', '}', 0}; + return format_to(out, std::is_floating_point<Rep>::value ? fp_f : format, val); } +template <typename Char, typename OutputIt> +OutputIt copy_unit(string_view unit, OutputIt out, Char) { + return std::copy(unit.begin(), unit.end(), out); +} + +template <typename OutputIt> +OutputIt copy_unit(string_view unit, OutputIt out, wchar_t) { + // This works when wchar_t is UTF-32 because units only contain characters + // that have the same representation in UTF-16 and UTF-32. + utf8_to_utf16 u(unit); + return std::copy(u.c_str(), u.c_str() + u.size(), out); +} -template <typename Period, typename OutputIt> -static OutputIt format_chrono_duration_unit(OutputIt out) { - if (const char* unit = get_units<Period>()) return format_to(out, "{}", unit); - if (Period::den == 1) return format_to(out, "[{}]s", Period::num); - return format_to(out, "[{}/{}]s", Period::num, Period::den); +template <typename Char, typename Period, typename OutputIt> +OutputIt format_duration_unit(OutputIt out) { + if (const char* unit = get_units<Period>()) + return copy_unit(string_view(unit), out, Char()); + const Char num_f[] = {'[', '{', '}', ']', 's', 0}; + if (const_check(Period::den == 1)) return format_to(out, num_f, Period::num); + const Char num_def_f[] = {'[', '{', '}', '/', '{', '}', ']', 's', 0}; + return format_to(out, num_def_f, Period::num, Period::den); } template <typename FormatContext, typename OutputIt, typename Rep, @@ -518,7 +806,10 @@ struct chrono_formatter { explicit chrono_formatter(FormatContext& ctx, OutputIt o, std::chrono::duration<Rep, Period> d) - : context(ctx), out(o), val(d.count()), negative(false) { + : context(ctx), + out(o), + val(static_cast<rep>(d.count())), + negative(false) { if (d.count() < 0) { val = 0 - val; negative = true; @@ -582,24 +873,24 @@ struct chrono_formatter { void write(Rep value, int width) { write_sign(); if (isnan(value)) return write_nan(); - uint32_or_64_t<int> n = to_unsigned( - to_nonnegative_int(value, (std::numeric_limits<int>::max)())); - int num_digits = internal::count_digits(n); + uint32_or_64_or_128_t<int> n = + to_unsigned(to_nonnegative_int(value, max_value<int>())); + int num_digits = detail::count_digits(n); if (width > num_digits) out = std::fill_n(out, width - num_digits, '0'); - out = format_decimal<char_type>(out, n, num_digits); + out = format_decimal<char_type>(out, n, num_digits).end; } void write_nan() { std::copy_n("nan", 3, out); } void write_pinf() { std::copy_n("inf", 3, out); } void write_ninf() { std::copy_n("-inf", 4, out); } - void format_localized(const tm& time, const char* format) { + void format_localized(const tm& time, char format, char modifier = 0) { if (isnan(val)) return write_nan(); auto locale = context.locale().template get<std::locale>(); auto& facet = std::use_facet<std::time_put<char_type>>(locale); std::basic_ostringstream<char_type> os; os.imbue(locale); - facet.put(os, os, ' ', &time, format, format + std::strlen(format)); + facet.put(os, os, ' ', &time, format, modifier); auto str = os.str(); std::copy(str.begin(), str.end(), out); } @@ -629,7 +920,7 @@ struct chrono_formatter { if (ns == numeric_system::standard) return write(hour(), 2); auto time = tm(); time.tm_hour = to_nonnegative_int(hour(), 24); - format_localized(time, "%OH"); + format_localized(time, 'H', 'O'); } void on_12_hour(numeric_system ns) { @@ -638,7 +929,7 @@ struct chrono_formatter { if (ns == numeric_system::standard) return write(hour12(), 2); auto time = tm(); time.tm_hour = to_nonnegative_int(hour12(), 12); - format_localized(time, "%OI"); + format_localized(time, 'I', 'O'); } void on_minute(numeric_system ns) { @@ -647,7 +938,7 @@ struct chrono_formatter { if (ns == numeric_system::standard) return write(minute(), 2); auto time = tm(); time.tm_min = to_nonnegative_int(minute(), 60); - format_localized(time, "%OM"); + format_localized(time, 'M', 'O'); } void on_second(numeric_system ns) { @@ -672,13 +963,12 @@ struct chrono_formatter { } auto time = tm(); time.tm_sec = to_nonnegative_int(second(), 60); - format_localized(time, "%OS"); + format_localized(time, 'S', 'O'); } void on_12_hour_time() { if (handle_nan_inf()) return; - - format_localized(time(), "%r"); + format_localized(time(), 'r'); } void on_24_hour_time() { @@ -702,25 +992,27 @@ struct chrono_formatter { void on_am_pm() { if (handle_nan_inf()) return; - format_localized(time(), "%p"); + format_localized(time(), 'p'); } void on_duration_value() { if (handle_nan_inf()) return; write_sign(); - out = format_chrono_duration_value(out, val, precision); + out = format_duration_value<char_type>(out, val, precision); } - void on_duration_unit() { out = format_chrono_duration_unit<Period>(out); } + void on_duration_unit() { + out = format_duration_unit<char_type, Period>(out); + } }; -} // namespace internal +} // namespace detail template <typename Rep, typename Period, typename Char> struct formatter<std::chrono::duration<Rep, Period>, Char> { private: basic_format_specs<Char> specs; int precision; - using arg_ref_type = internal::arg_ref<Char>; + using arg_ref_type = detail::arg_ref<Char>; arg_ref_type width_ref; arg_ref_type precision_ref; mutable basic_string_view<Char> format_str; @@ -728,7 +1020,7 @@ struct formatter<std::chrono::duration<Rep, Period>, Char> { struct spec_handler { formatter& f; - basic_parse_context<Char>& context; + basic_format_parse_context<Char>& context; basic_string_view<Char> format_str; template <typename Id> FMT_CONSTEXPR arg_ref_type make_arg_ref(Id arg_id) { @@ -738,19 +1030,18 @@ struct formatter<std::chrono::duration<Rep, Period>, Char> { FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<Char> arg_id) { context.check_arg_id(arg_id); - const auto str_val = internal::string_view_metadata(format_str, arg_id); - return arg_ref_type(str_val); + return arg_ref_type(arg_id); } - FMT_CONSTEXPR arg_ref_type make_arg_ref(internal::auto_id) { + FMT_CONSTEXPR arg_ref_type make_arg_ref(detail::auto_id) { return arg_ref_type(context.next_arg_id()); } void on_error(const char* msg) { FMT_THROW(format_error(msg)); } - void on_fill(Char fill) { f.specs.fill[0] = fill; } + void on_fill(basic_string_view<Char> fill) { f.specs.fill = fill; } void on_align(align_t align) { f.specs.align = align; } - void on_width(unsigned width) { f.specs.width = width; } - void on_precision(unsigned precision) { f.precision = precision; } + void on_width(int width) { f.specs.width = width; } + void on_precision(int _precision) { f.precision = _precision; } void end_precision() {} template <typename Id> void on_dynamic_width(Id arg_id) { @@ -762,38 +1053,38 @@ struct formatter<std::chrono::duration<Rep, Period>, Char> { } }; - using iterator = typename basic_parse_context<Char>::iterator; + using iterator = typename basic_format_parse_context<Char>::iterator; struct parse_range { iterator begin; iterator end; }; - FMT_CONSTEXPR parse_range do_parse(basic_parse_context<Char>& ctx) { + FMT_CONSTEXPR parse_range do_parse(basic_format_parse_context<Char>& ctx) { auto begin = ctx.begin(), end = ctx.end(); if (begin == end || *begin == '}') return {begin, begin}; spec_handler handler{*this, ctx, format_str}; - begin = internal::parse_align(begin, end, handler); + begin = detail::parse_align(begin, end, handler); if (begin == end) return {begin, begin}; - begin = internal::parse_width(begin, end, handler); + begin = detail::parse_width(begin, end, handler); if (begin == end) return {begin, begin}; if (*begin == '.') { if (std::is_floating_point<Rep>::value) - begin = internal::parse_precision(begin, end, handler); + begin = detail::parse_precision(begin, end, handler); else handler.on_error("precision not allowed for this argument type"); } - end = parse_chrono_format(begin, end, internal::chrono_format_checker()); + end = parse_chrono_format(begin, end, detail::chrono_format_checker()); return {begin, end}; } public: formatter() : precision(-1) {} - FMT_CONSTEXPR auto parse(basic_parse_context<Char>& ctx) + FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx) -> decltype(ctx.begin()) { auto range = do_parse(ctx); format_str = basic_string_view<Char>( - &*range.begin, internal::to_unsigned(range.end - range.begin)); + &*range.begin, detail::to_unsigned(range.end - range.begin)); return range.end; } @@ -804,23 +1095,21 @@ struct formatter<std::chrono::duration<Rep, Period>, Char> { // is not specified. basic_memory_buffer<Char> buf; auto out = std::back_inserter(buf); - using range = internal::output_range<decltype(ctx.out()), Char>; - internal::basic_writer<range> w(range(ctx.out())); - internal::handle_dynamic_spec<internal::width_checker>( - specs.width, width_ref, ctx, format_str.begin()); - internal::handle_dynamic_spec<internal::precision_checker>( - precision, precision_ref, ctx, format_str.begin()); + detail::handle_dynamic_spec<detail::width_checker>(specs.width, width_ref, + ctx); + detail::handle_dynamic_spec<detail::precision_checker>(precision, + precision_ref, ctx); if (begin == end || *begin == '}') { - out = internal::format_chrono_duration_value(out, d.count(), precision); - internal::format_chrono_duration_unit<Period>(out); + out = detail::format_duration_value<Char>(out, d.count(), precision); + detail::format_duration_unit<Char, Period>(out); } else { - internal::chrono_formatter<FormatContext, decltype(out), Rep, Period> f( + detail::chrono_formatter<FormatContext, decltype(out), Rep, Period> f( ctx, out, d); f.precision = precision; parse_chrono_format(begin, end, f); } - w.write(buf.data(), buf.size(), specs); - return w.out(); + return detail::write( + ctx.out(), basic_string_view<Char>(buf.data(), buf.size()), specs); } }; diff --git a/include/vtkdiy2/fmt/color.h b/include/vtkdiy2/thirdparty/fmt/color.h similarity index 81% rename from include/vtkdiy2/fmt/color.h rename to include/vtkdiy2/thirdparty/fmt/color.h index d9d315599f0138831ee7c56ca25739c43b60a012..94e3419d1df35b2416192b678a616a540e433d06 100644 --- a/include/vtkdiy2/fmt/color.h +++ b/include/vtkdiy2/thirdparty/fmt/color.h @@ -198,7 +198,7 @@ struct rgb { uint8_t b; }; -namespace internal { +namespace detail { // color is a struct of either a rgb color or a terminal color. struct color_type { @@ -221,7 +221,7 @@ struct color_type { uint32_t rgb_color; } value; }; -} // namespace internal +} // namespace detail // Experimental text formatting support. class text_style { @@ -298,22 +298,22 @@ class text_style { FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT { return static_cast<uint8_t>(ems) != 0; } - FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT { - assert(has_foreground() && "no foreground specified for this style"); + FMT_CONSTEXPR detail::color_type get_foreground() const FMT_NOEXCEPT { + FMT_ASSERT(has_foreground(), "no foreground specified for this style"); return foreground_color; } - FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT { - assert(has_background() && "no background specified for this style"); + FMT_CONSTEXPR detail::color_type get_background() const FMT_NOEXCEPT { + FMT_ASSERT(has_background(), "no background specified for this style"); return background_color; } FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT { - assert(has_emphasis() && "no emphasis specified for this style"); + FMT_ASSERT(has_emphasis(), "no emphasis specified for this style"); return ems; } private: FMT_CONSTEXPR text_style(bool is_foreground, - internal::color_type text_color) FMT_NOEXCEPT + detail::color_type text_color) FMT_NOEXCEPT : set_foreground_color(), set_background_color(), ems() { @@ -326,23 +326,23 @@ class text_style { } } - friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground) + friend FMT_CONSTEXPR_DECL text_style fg(detail::color_type foreground) FMT_NOEXCEPT; - friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background) + friend FMT_CONSTEXPR_DECL text_style bg(detail::color_type background) FMT_NOEXCEPT; - internal::color_type foreground_color; - internal::color_type background_color; + detail::color_type foreground_color; + detail::color_type background_color; bool set_foreground_color; bool set_background_color; emphasis ems; }; -FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT { +FMT_CONSTEXPR text_style fg(detail::color_type foreground) FMT_NOEXCEPT { return text_style(/*is_foreground=*/true, foreground); } -FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT { +FMT_CONSTEXPR text_style bg(detail::color_type background) FMT_NOEXCEPT { return text_style(/*is_foreground=*/false, background); } @@ -350,21 +350,21 @@ FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT { return text_style(lhs) | rhs; } -namespace internal { +namespace detail { template <typename Char> struct ansi_color_escape { - FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color, + FMT_CONSTEXPR ansi_color_escape(detail::color_type text_color, const char* esc) FMT_NOEXCEPT { // If we have a terminal color, we need to output another escape code // sequence. if (!text_color.is_rgb) { - bool is_background = esc == internal::data::background_color; + bool is_background = esc == detail::data::background_color; uint32_t value = text_color.value.term_color; // Background ASCII codes are the same as the foreground ones but with // 10 more. if (is_background) value += 10u; - std::size_t index = 0; + size_t index = 0; buffer[index++] = static_cast<Char>('\x1b'); buffer[index++] = static_cast<Char>('['); @@ -398,7 +398,7 @@ template <typename Char> struct ansi_color_escape { if (em_bits & static_cast<uint8_t>(emphasis::strikethrough)) em_codes[3] = 9; - std::size_t index = 0; + size_t index = 0; for (int i = 0; i < 4; ++i) { if (!em_codes[i]) continue; buffer[index++] = static_cast<Char>('\x1b'); @@ -412,7 +412,7 @@ template <typename Char> struct ansi_color_escape { FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; } FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT { - return buffer + std::strlen(buffer); + return buffer + std::char_traits<Char>::length(buffer); } private: @@ -429,14 +429,14 @@ template <typename Char> struct ansi_color_escape { template <typename Char> FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color( - internal::color_type foreground) FMT_NOEXCEPT { - return ansi_color_escape<Char>(foreground, internal::data::foreground_color); + detail::color_type foreground) FMT_NOEXCEPT { + return ansi_color_escape<Char>(foreground, detail::data::foreground_color); } template <typename Char> FMT_CONSTEXPR ansi_color_escape<Char> make_background_color( - internal::color_type background) FMT_NOEXCEPT { - return ansi_color_escape<Char>(background, internal::data::background_color); + detail::color_type background) FMT_NOEXCEPT { + return ansi_color_escape<Char>(background, detail::data::background_color); } template <typename Char> @@ -455,90 +455,71 @@ inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT { } template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT { - fputs(internal::data::reset_color, stream); + fputs(detail::data::reset_color, stream); } template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT { - fputs(internal::data::wreset_color, stream); + fputs(detail::data::wreset_color, stream); } template <typename Char> -inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT { +inline void reset_color(buffer<Char>& buffer) FMT_NOEXCEPT { const char* begin = data::reset_color; const char* end = begin + sizeof(data::reset_color) - 1; buffer.append(begin, end); } template <typename Char> -std::basic_string<Char> vformat(const text_style& ts, - basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char> > args) { - basic_memory_buffer<Char> buffer; +void vformat_to(buffer<Char>& buf, const text_style& ts, + basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { bool has_style = false; if (ts.has_emphasis()) { has_style = true; - ansi_color_escape<Char> escape = make_emphasis<Char>(ts.get_emphasis()); - buffer.append(escape.begin(), escape.end()); + auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis()); + buf.append(emphasis.begin(), emphasis.end()); } if (ts.has_foreground()) { has_style = true; - ansi_color_escape<Char> escape = - make_foreground_color<Char>(ts.get_foreground()); - buffer.append(escape.begin(), escape.end()); + auto foreground = detail::make_foreground_color<Char>(ts.get_foreground()); + buf.append(foreground.begin(), foreground.end()); } if (ts.has_background()) { has_style = true; - ansi_color_escape<Char> escape = - make_background_color<Char>(ts.get_background()); - buffer.append(escape.begin(), escape.end()); + auto background = detail::make_background_color<Char>(ts.get_background()); + buf.append(background.begin(), background.end()); } - internal::vformat_to(buffer, format_str, args); - if (has_style) { - reset_color<Char>(buffer); - } - return fmt::to_string(buffer); + detail::vformat_to(buf, format_str, args); + if (has_style) detail::reset_color<Char>(buf); } -} // namespace internal +} // namespace detail -template <typename S, typename Char = char_t<S> > +template <typename S, typename Char = char_t<S>> void vprint(std::FILE* f, const text_style& ts, const S& format, - basic_format_args<buffer_context<Char> > args) { - bool has_style = false; - if (ts.has_emphasis()) { - has_style = true; - internal::fputs<Char>(internal::make_emphasis<Char>(ts.get_emphasis()), f); - } - if (ts.has_foreground()) { - has_style = true; - internal::fputs<Char>( - internal::make_foreground_color<Char>(ts.get_foreground()), f); - } - if (ts.has_background()) { - has_style = true; - internal::fputs<Char>( - internal::make_background_color<Char>(ts.get_background()), f); - } - vprint(f, format, args); - if (has_style) { - internal::reset_color<Char>(f); - } + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + basic_memory_buffer<Char> buf; + detail::vformat_to(buf, ts, to_string_view(format), args); + buf.push_back(Char(0)); + detail::fputs(buf.data(), f); } /** + \rst Formats a string and prints it to the specified file stream using ANSI escape sequences to specify text formatting. - Example: + + **Example**:: + fmt::print(fmt::emphasis::bold | fg(fmt::color::red), "Elapsed time: {0:.2f} seconds", 1.23); + \endrst */ template <typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value)> + FMT_ENABLE_IF(detail::is_string<S>::value)> void print(std::FILE* f, const text_style& ts, const S& format_str, const Args&... args) { - internal::check_format_string<Args...>(format_str); - using context = buffer_context<char_t<S> >; - format_arg_store<context, Args...> as{args...}; - vprint(f, ts, format_str, basic_format_args<context>(as)); + vprint(f, ts, format_str, + fmt::make_args_checked<Args...>(format_str, args...)); } /** @@ -549,16 +530,18 @@ void print(std::FILE* f, const text_style& ts, const S& format_str, "Elapsed time: {0:.2f} seconds", 1.23); */ template <typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value)> + FMT_ENABLE_IF(detail::is_string<S>::value)> void print(const text_style& ts, const S& format_str, const Args&... args) { return print(stdout, ts, format_str, args...); } -template <typename S, typename Char = char_t<S> > +template <typename S, typename Char = char_t<S>> inline std::basic_string<Char> vformat( const text_style& ts, const S& format_str, - basic_format_args<buffer_context<Char> > args) { - return internal::vformat(ts, to_string_view(format_str), args); + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + basic_memory_buffer<Char> buf; + detail::vformat_to(buf, ts, to_string_view(format_str), args); + return fmt::to_string(buf); } /** @@ -573,11 +556,46 @@ inline std::basic_string<Char> vformat( "The answer is {}", 42); \endrst */ -template <typename S, typename... Args, typename Char = char_t<S> > +template <typename S, typename... Args, typename Char = char_t<S>> inline std::basic_string<Char> format(const text_style& ts, const S& format_str, const Args&... args) { - return internal::vformat(ts, to_string_view(format_str), - {internal::make_args_checked(format_str, args...)}); + return vformat(ts, to_string_view(format_str), + fmt::make_args_checked<Args...>(format_str, args...)); +} + +/** + Formats a string with the given text_style and writes the output to ``out``. + */ +template <typename OutputIt, typename Char, + FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value)> +OutputIt vformat_to( + OutputIt out, const text_style& ts, basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + decltype(detail::get_buffer<Char>(out)) buf(detail::get_buffer_init(out)); + detail::vformat_to(buf, ts, format_str, args); + return detail::get_iterator(buf); +} + +/** + \rst + Formats arguments with the given text_style, writes the result to the output + iterator ``out`` and returns the iterator past the end of the output range. + + **Example**:: + + std::vector<char> out; + fmt::format_to(std::back_inserter(out), + fmt::emphasis::bold | fg(fmt::color::red), "{}", 42); + \endrst +*/ +template <typename OutputIt, typename S, typename... Args, + bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value&& + detail::is_string<S>::value> +inline auto format_to(OutputIt out, const text_style& ts, const S& format_str, + Args&&... args) -> + typename std::enable_if<enable, OutputIt>::type { + return vformat_to(out, ts, to_string_view(format_str), + fmt::make_args_checked<Args...>(format_str, args...)); } FMT_END_NAMESPACE diff --git a/include/vtkdiy2/thirdparty/fmt/compile.h b/include/vtkdiy2/thirdparty/fmt/compile.h new file mode 100644 index 0000000000000000000000000000000000000000..3a33b02014ceef2f9ec58ff9ab072777e334b8bd --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/compile.h @@ -0,0 +1,701 @@ +// Formatting library for C++ - experimental format string compilation +// +// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors +// All rights reserved. +// +// For the license information refer to format.h. + +#ifndef FMT_COMPILE_H_ +#define FMT_COMPILE_H_ + +#include <vector> + +#include "format.h" + +FMT_BEGIN_NAMESPACE +namespace detail { + +// A compile-time string which is compiled into fast formatting code. +class compiled_string {}; + +template <typename S> +struct is_compiled_string : std::is_base_of<compiled_string, S> {}; + +/** + \rst + Converts a string literal *s* into a format string that will be parsed at + compile time and converted into efficient formatting code. Requires C++17 + ``constexpr if`` compiler support. + + **Example**:: + + // Converts 42 into std::string using the most efficient method and no + // runtime format string processing. + std::string s = fmt::format(FMT_COMPILE("{}"), 42); + \endrst + */ +#define FMT_COMPILE(s) FMT_STRING_IMPL(s, fmt::detail::compiled_string) + +template <typename T, typename... Tail> +const T& first(const T& value, const Tail&...) { + return value; +} + +// Part of a compiled format string. It can be either literal text or a +// replacement field. +template <typename Char> struct format_part { + enum class kind { arg_index, arg_name, text, replacement }; + + struct replacement { + arg_ref<Char> arg_id; + dynamic_format_specs<Char> specs; + }; + + kind part_kind; + union value { + int arg_index; + basic_string_view<Char> str; + replacement repl; + + FMT_CONSTEXPR value(int index = 0) : arg_index(index) {} + FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {} + FMT_CONSTEXPR value(replacement r) : repl(r) {} + } val; + // Position past the end of the argument id. + const Char* arg_id_end = nullptr; + + FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {}) + : part_kind(k), val(v) {} + + static FMT_CONSTEXPR format_part make_arg_index(int index) { + return format_part(kind::arg_index, index); + } + static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) { + return format_part(kind::arg_name, name); + } + static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) { + return format_part(kind::text, text); + } + static FMT_CONSTEXPR format_part make_replacement(replacement repl) { + return format_part(kind::replacement, repl); + } +}; + +template <typename Char> struct part_counter { + unsigned num_parts = 0; + + FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) { + if (begin != end) ++num_parts; + } + + FMT_CONSTEXPR int on_arg_id() { return ++num_parts, 0; } + FMT_CONSTEXPR int on_arg_id(int) { return ++num_parts, 0; } + FMT_CONSTEXPR int on_arg_id(basic_string_view<Char>) { + return ++num_parts, 0; + } + + FMT_CONSTEXPR void on_replacement_field(int, const Char*) {} + + FMT_CONSTEXPR const Char* on_format_specs(int, const Char* begin, + const Char* end) { + // Find the matching brace. + unsigned brace_counter = 0; + for (; begin != end; ++begin) { + if (*begin == '{') { + ++brace_counter; + } else if (*begin == '}') { + if (brace_counter == 0u) break; + --brace_counter; + } + } + return begin; + } + + FMT_CONSTEXPR void on_error(const char*) {} +}; + +// Counts the number of parts in a format string. +template <typename Char> +FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) { + part_counter<Char> counter; + parse_format_string<true>(format_str, counter); + return counter.num_parts; +} + +template <typename Char, typename PartHandler> +class format_string_compiler : public error_handler { + private: + using part = format_part<Char>; + + PartHandler handler_; + part part_; + basic_string_view<Char> format_str_; + basic_format_parse_context<Char> parse_context_; + + public: + FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str, + PartHandler handler) + : handler_(handler), + format_str_(format_str), + parse_context_(format_str) {} + + FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) { + if (begin != end) + handler_(part::make_text({begin, to_unsigned(end - begin)})); + } + + FMT_CONSTEXPR int on_arg_id() { + part_ = part::make_arg_index(parse_context_.next_arg_id()); + return 0; + } + + FMT_CONSTEXPR int on_arg_id(int id) { + parse_context_.check_arg_id(id); + part_ = part::make_arg_index(id); + return 0; + } + + FMT_CONSTEXPR int on_arg_id(basic_string_view<Char> id) { + part_ = part::make_arg_name(id); + return 0; + } + + FMT_CONSTEXPR void on_replacement_field(int, const Char* ptr) { + part_.arg_id_end = ptr; + handler_(part_); + } + + FMT_CONSTEXPR const Char* on_format_specs(int, const Char* begin, + const Char* end) { + auto repl = typename part::replacement(); + dynamic_specs_handler<basic_format_parse_context<Char>> handler( + repl.specs, parse_context_); + auto it = parse_format_specs(begin, end, handler); + if (*it != '}') on_error("missing '}' in format string"); + repl.arg_id = part_.part_kind == part::kind::arg_index + ? arg_ref<Char>(part_.val.arg_index) + : arg_ref<Char>(part_.val.str); + auto part = part::make_replacement(repl); + part.arg_id_end = begin; + handler_(part); + return it; + } +}; + +// Compiles a format string and invokes handler(part) for each parsed part. +template <bool IS_CONSTEXPR, typename Char, typename PartHandler> +FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str, + PartHandler handler) { + parse_format_string<IS_CONSTEXPR>( + format_str, + format_string_compiler<Char, PartHandler>(format_str, handler)); +} + +template <typename OutputIt, typename Context, typename Id> +void format_arg( + basic_format_parse_context<typename Context::char_type>& parse_ctx, + Context& ctx, Id arg_id) { + ctx.advance_to(visit_format_arg( + arg_formatter<OutputIt, typename Context::char_type>(ctx, &parse_ctx), + ctx.arg(arg_id))); +} + +// vformat_to is defined in a subnamespace to prevent ADL. +namespace cf { +template <typename Context, typename OutputIt, typename CompiledFormat> +auto vformat_to(OutputIt out, CompiledFormat& cf, + basic_format_args<Context> args) -> typename Context::iterator { + using char_type = typename Context::char_type; + basic_format_parse_context<char_type> parse_ctx( + to_string_view(cf.format_str_)); + Context ctx(out, args); + + const auto& parts = cf.parts(); + for (auto part_it = std::begin(parts); part_it != std::end(parts); + ++part_it) { + const auto& part = *part_it; + const auto& value = part.val; + + using format_part_t = format_part<char_type>; + switch (part.part_kind) { + case format_part_t::kind::text: { + const auto text = value.str; + auto output = ctx.out(); + auto&& it = reserve(output, text.size()); + it = std::copy_n(text.begin(), text.size(), it); + ctx.advance_to(output); + break; + } + + case format_part_t::kind::arg_index: + advance_to(parse_ctx, part.arg_id_end); + detail::format_arg<OutputIt>(parse_ctx, ctx, value.arg_index); + break; + + case format_part_t::kind::arg_name: + advance_to(parse_ctx, part.arg_id_end); + detail::format_arg<OutputIt>(parse_ctx, ctx, value.str); + break; + + case format_part_t::kind::replacement: { + const auto& arg_id_value = value.repl.arg_id.val; + const auto arg = value.repl.arg_id.kind == arg_id_kind::index + ? ctx.arg(arg_id_value.index) + : ctx.arg(arg_id_value.name); + + auto specs = value.repl.specs; + + handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx); + handle_dynamic_spec<precision_checker>(specs.precision, + specs.precision_ref, ctx); + + error_handler h; + numeric_specs_checker<error_handler> checker(h, arg.type()); + if (specs.align == align::numeric) checker.require_numeric_argument(); + if (specs.sign != sign::none) checker.check_sign(); + if (specs.alt) checker.require_numeric_argument(); + if (specs.precision >= 0) checker.check_precision(); + + advance_to(parse_ctx, part.arg_id_end); + ctx.advance_to( + visit_format_arg(arg_formatter<OutputIt, typename Context::char_type>( + ctx, nullptr, &specs), + arg)); + break; + } + } + } + return ctx.out(); +} +} // namespace cf + +struct basic_compiled_format {}; + +template <typename S, typename = void> +struct compiled_format_base : basic_compiled_format { + using char_type = char_t<S>; + using parts_container = std::vector<detail::format_part<char_type>>; + + parts_container compiled_parts; + + explicit compiled_format_base(basic_string_view<char_type> format_str) { + compile_format_string<false>(format_str, + [this](const format_part<char_type>& part) { + compiled_parts.push_back(part); + }); + } + + const parts_container& parts() const { return compiled_parts; } +}; + +template <typename Char, unsigned N> struct format_part_array { + format_part<Char> data[N] = {}; + FMT_CONSTEXPR format_part_array() = default; +}; + +template <typename Char, unsigned N> +FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts( + basic_string_view<Char> format_str) { + format_part_array<Char, N> parts; + unsigned counter = 0; + // This is not a lambda for compatibility with older compilers. + struct { + format_part<Char>* parts; + unsigned* counter; + FMT_CONSTEXPR void operator()(const format_part<Char>& part) { + parts[(*counter)++] = part; + } + } collector{parts.data, &counter}; + compile_format_string<true>(format_str, collector); + if (counter < N) { + parts.data[counter] = + format_part<Char>::make_text(basic_string_view<Char>()); + } + return parts; +} + +template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) { + return (a < b) ? b : a; +} + +template <typename S> +struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>> + : basic_compiled_format { + using char_type = char_t<S>; + + FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {} + +// Workaround for old compilers. Format string compilation will not be +// performed there anyway. +#if FMT_USE_CONSTEXPR + static FMT_CONSTEXPR_DECL const unsigned num_format_parts = + constexpr_max(count_parts(to_string_view(S())), 1u); +#else + static const unsigned num_format_parts = 1; +#endif + + using parts_container = format_part<char_type>[num_format_parts]; + + const parts_container& parts() const { + static FMT_CONSTEXPR_DECL const auto compiled_parts = + compile_to_parts<char_type, num_format_parts>( + detail::to_string_view(S())); + return compiled_parts.data; + } +}; + +template <typename S, typename... Args> +class compiled_format : private compiled_format_base<S> { + public: + using typename compiled_format_base<S>::char_type; + + private: + basic_string_view<char_type> format_str_; + + template <typename Context, typename OutputIt, typename CompiledFormat> + friend auto cf::vformat_to(OutputIt out, CompiledFormat& cf, + basic_format_args<Context> args) -> + typename Context::iterator; + + public: + compiled_format() = delete; + explicit constexpr compiled_format(basic_string_view<char_type> format_str) + : compiled_format_base<S>(format_str), format_str_(format_str) {} +}; + +#ifdef __cpp_if_constexpr +template <typename... Args> struct type_list {}; + +// Returns a reference to the argument at index N from [first, rest...]. +template <int N, typename T, typename... Args> +constexpr const auto& get([[maybe_unused]] const T& first, + [[maybe_unused]] const Args&... rest) { + static_assert(N < 1 + sizeof...(Args), "index is out of bounds"); + if constexpr (N == 0) + return first; + else + return get<N - 1>(rest...); +} + +template <int N, typename> struct get_type_impl; + +template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> { + using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>; +}; + +template <int N, typename T> +using get_type = typename get_type_impl<N, T>::type; + +template <typename T> struct is_compiled_format : std::false_type {}; + +template <typename Char> struct text { + basic_string_view<Char> data; + using char_type = Char; + + template <typename OutputIt, typename... Args> + OutputIt format(OutputIt out, const Args&...) const { + return write<Char>(out, data); + } +}; + +template <typename Char> +struct is_compiled_format<text<Char>> : std::true_type {}; + +template <typename Char> +constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos, + size_t size) { + return {{&s[pos], size}}; +} + +template <typename Char> struct code_unit { + Char value; + using char_type = Char; + + template <typename OutputIt, typename... Args> + OutputIt format(OutputIt out, const Args&...) const { + return write<Char>(out, value); + } +}; + +template <typename Char> +struct is_compiled_format<code_unit<Char>> : std::true_type {}; + +// A replacement field that refers to argument N. +template <typename Char, typename T, int N> struct field { + using char_type = Char; + + template <typename OutputIt, typename... Args> + OutputIt format(OutputIt out, const Args&... args) const { + // This ensures that the argument type is convertile to `const T&`. + const T& arg = get<N>(args...); + return write<Char>(out, arg); + } +}; + +template <typename Char, typename T, int N> +struct is_compiled_format<field<Char, T, N>> : std::true_type {}; + +// A replacement field that refers to argument N and has format specifiers. +template <typename Char, typename T, int N> struct spec_field { + using char_type = Char; + mutable formatter<T, Char> fmt; + + template <typename OutputIt, typename... Args> + OutputIt format(OutputIt out, const Args&... args) const { + // This ensures that the argument type is convertile to `const T&`. + const T& arg = get<N>(args...); + const auto& vargs = + make_format_args<basic_format_context<OutputIt, Char>>(args...); + basic_format_context<OutputIt, Char> ctx(out, vargs); + return fmt.format(arg, ctx); + } +}; + +template <typename Char, typename T, int N> +struct is_compiled_format<spec_field<Char, T, N>> : std::true_type {}; + +template <typename L, typename R> struct concat { + L lhs; + R rhs; + using char_type = typename L::char_type; + + template <typename OutputIt, typename... Args> + OutputIt format(OutputIt out, const Args&... args) const { + out = lhs.format(out, args...); + return rhs.format(out, args...); + } +}; + +template <typename L, typename R> +struct is_compiled_format<concat<L, R>> : std::true_type {}; + +template <typename L, typename R> +constexpr concat<L, R> make_concat(L lhs, R rhs) { + return {lhs, rhs}; +} + +struct unknown_format {}; + +template <typename Char> +constexpr size_t parse_text(basic_string_view<Char> str, size_t pos) { + for (size_t size = str.size(); pos != size; ++pos) { + if (str[pos] == '{' || str[pos] == '}') break; + } + return pos; +} + +template <typename Args, size_t POS, int ID, typename S> +constexpr auto compile_format_string(S format_str); + +template <typename Args, size_t POS, int ID, typename T, typename S> +constexpr auto parse_tail(T head, S format_str) { + if constexpr (POS != + basic_string_view<typename S::char_type>(format_str).size()) { + constexpr auto tail = compile_format_string<Args, POS, ID>(format_str); + if constexpr (std::is_same<remove_cvref_t<decltype(tail)>, + unknown_format>()) + return tail; + else + return make_concat(head, tail); + } else { + return head; + } +} + +template <typename T, typename Char> struct parse_specs_result { + formatter<T, Char> fmt; + size_t end; + int next_arg_id; +}; + +template <typename T, typename Char> +constexpr parse_specs_result<T, Char> parse_specs(basic_string_view<Char> str, + size_t pos, int arg_id) { + str.remove_prefix(pos); + auto ctx = basic_format_parse_context<Char>(str, {}, arg_id + 1); + auto f = formatter<T, Char>(); + auto end = f.parse(ctx); + return {f, pos + (end - str.data()) + 1, ctx.next_arg_id()}; +} + +// Compiles a non-empty format string and returns the compiled representation +// or unknown_format() on unrecognized input. +template <typename Args, size_t POS, int ID, typename S> +constexpr auto compile_format_string(S format_str) { + using char_type = typename S::char_type; + constexpr basic_string_view<char_type> str = format_str; + if constexpr (str[POS] == '{') { + if (POS + 1 == str.size()) + throw format_error("unmatched '{' in format string"); + if constexpr (str[POS + 1] == '{') { + return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str); + } else if constexpr (str[POS + 1] == '}') { + using type = get_type<ID, Args>; + return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(), + format_str); + } else if constexpr (str[POS + 1] == ':') { + using type = get_type<ID, Args>; + constexpr auto result = parse_specs<type>(str, POS + 2, ID); + return parse_tail<Args, result.end, result.next_arg_id>( + spec_field<char_type, type, ID>{result.fmt}, format_str); + } else { + return unknown_format(); + } + } else if constexpr (str[POS] == '}') { + if (POS + 1 == str.size()) + throw format_error("unmatched '}' in format string"); + return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str); + } else { + constexpr auto end = parse_text(str, POS + 1); + if constexpr (end - POS > 1) { + return parse_tail<Args, end, ID>(make_text(str, POS, end - POS), + format_str); + } else { + return parse_tail<Args, end, ID>(code_unit<char_type>{str[POS]}, + format_str); + } + } +} + +template <typename... Args, typename S, + FMT_ENABLE_IF(is_compile_string<S>::value || + detail::is_compiled_string<S>::value)> +constexpr auto compile(S format_str) { + constexpr basic_string_view<typename S::char_type> str = format_str; + if constexpr (str.size() == 0) { + return detail::make_text(str, 0, 0); + } else { + constexpr auto result = + detail::compile_format_string<detail::type_list<Args...>, 0, 0>( + format_str); + if constexpr (std::is_same<remove_cvref_t<decltype(result)>, + detail::unknown_format>()) { + return detail::compiled_format<S, Args...>(to_string_view(format_str)); + } else { + return result; + } + } +} +#else +template <typename... Args, typename S, + FMT_ENABLE_IF(is_compile_string<S>::value)> +constexpr auto compile(S format_str) -> detail::compiled_format<S, Args...> { + return detail::compiled_format<S, Args...>(to_string_view(format_str)); +} +#endif // __cpp_if_constexpr + +// Compiles the format string which must be a string literal. +template <typename... Args, typename Char, size_t N> +auto compile(const Char (&format_str)[N]) + -> detail::compiled_format<const Char*, Args...> { + return detail::compiled_format<const Char*, Args...>( + basic_string_view<Char>(format_str, N - 1)); +} +} // namespace detail + +// DEPRECATED! use FMT_COMPILE instead. +template <typename... Args> +FMT_DEPRECATED auto compile(const Args&... args) + -> decltype(detail::compile(args...)) { + return detail::compile(args...); +} + +#if FMT_USE_CONSTEXPR +# ifdef __cpp_if_constexpr + +template <typename CompiledFormat, typename... Args, + typename Char = typename CompiledFormat::char_type, + FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)> +FMT_INLINE std::basic_string<Char> format(const CompiledFormat& cf, + const Args&... args) { + basic_memory_buffer<Char> buffer; + cf.format(detail::buffer_appender<Char>(buffer), args...); + return to_string(buffer); +} + +template <typename OutputIt, typename CompiledFormat, typename... Args, + FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)> +OutputIt format_to(OutputIt out, const CompiledFormat& cf, + const Args&... args) { + return cf.format(out, args...); +} +# endif // __cpp_if_constexpr +#endif // FMT_USE_CONSTEXPR + +template <typename CompiledFormat, typename... Args, + typename Char = typename CompiledFormat::char_type, + FMT_ENABLE_IF(std::is_base_of<detail::basic_compiled_format, + CompiledFormat>::value)> +std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) { + basic_memory_buffer<Char> buffer; + using context = buffer_context<Char>; + detail::cf::vformat_to<context>(detail::buffer_appender<Char>(buffer), cf, + make_format_args<context>(args...)); + return to_string(buffer); +} + +template <typename S, typename... Args, + FMT_ENABLE_IF(detail::is_compiled_string<S>::value)> +FMT_INLINE std::basic_string<typename S::char_type> format(const S&, + Args&&... args) { +#ifdef __cpp_if_constexpr + if constexpr (std::is_same<typename S::char_type, char>::value) { + constexpr basic_string_view<typename S::char_type> str = S(); + if (str.size() == 2 && str[0] == '{' && str[1] == '}') + return fmt::to_string(detail::first(args...)); + } +#endif + constexpr auto compiled = detail::compile<Args...>(S()); + return format(compiled, std::forward<Args>(args)...); +} + +template <typename OutputIt, typename CompiledFormat, typename... Args, + FMT_ENABLE_IF(std::is_base_of<detail::basic_compiled_format, + CompiledFormat>::value)> +OutputIt format_to(OutputIt out, const CompiledFormat& cf, + const Args&... args) { + using char_type = typename CompiledFormat::char_type; + using context = format_context_t<OutputIt, char_type>; + return detail::cf::vformat_to<context>(out, cf, + make_format_args<context>(args...)); +} + +template <typename OutputIt, typename S, typename... Args, + FMT_ENABLE_IF(detail::is_compiled_string<S>::value)> +OutputIt format_to(OutputIt out, const S&, const Args&... args) { + constexpr auto compiled = detail::compile<Args...>(S()); + return format_to(out, compiled, args...); +} + +template <typename OutputIt, typename CompiledFormat, typename... Args> +auto format_to_n(OutputIt out, size_t n, const CompiledFormat& cf, + const Args&... args) -> + typename std::enable_if< + detail::is_output_iterator<OutputIt, + typename CompiledFormat::char_type>::value && + std::is_base_of<detail::basic_compiled_format, + CompiledFormat>::value, + format_to_n_result<OutputIt>>::type { + auto it = + format_to(detail::truncating_iterator<OutputIt>(out, n), cf, args...); + return {it.base(), it.count()}; +} + +template <typename OutputIt, typename S, typename... Args, + FMT_ENABLE_IF(detail::is_compiled_string<S>::value)> +format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n, const S&, + const Args&... args) { + constexpr auto compiled = detail::compile<Args...>(S()); + auto it = format_to(detail::truncating_iterator<OutputIt>(out, n), compiled, + args...); + return {it.base(), it.count()}; +} + +template <typename CompiledFormat, typename... Args> +size_t formatted_size(const CompiledFormat& cf, const Args&... args) { + return format_to(detail::counting_iterator(), cf, args...).count(); +} + +FMT_END_NAMESPACE + +#endif // FMT_COMPILE_H_ diff --git a/include/vtkdiy2/thirdparty/fmt/core.h b/include/vtkdiy2/thirdparty/fmt/core.h new file mode 100644 index 0000000000000000000000000000000000000000..0a81e0ccd953aa4775289ff8ac73b6cbc6e3f16f --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/core.h @@ -0,0 +1,2122 @@ +// Formatting library for C++ - the core API +// +// Copyright (c) 2012 - present, Victor Zverovich +// All rights reserved. +// +// For the license information refer to format.h. + +#ifndef FMT_CORE_H_ +#define FMT_CORE_H_ + +#include <cstdio> // std::FILE +#include <cstring> +#include <functional> +#include <iterator> +#include <memory> +#include <string> +#include <type_traits> +#include <vector> + +// The fmt library version in the form major * 10000 + minor * 100 + patch. +#define FMT_VERSION 70103 + +#ifdef __clang__ +# define FMT_CLANG_VERSION (__clang_major__ * 100 + __clang_minor__) +#else +# define FMT_CLANG_VERSION 0 +#endif + +#if defined(__GNUC__) && !defined(__clang__) +# define FMT_GCC_VERSION (__GNUC__ * 100 + __GNUC_MINOR__) +#else +# define FMT_GCC_VERSION 0 +#endif + +#if defined(__INTEL_COMPILER) +# define FMT_ICC_VERSION __INTEL_COMPILER +#else +# define FMT_ICC_VERSION 0 +#endif + +#if __cplusplus >= 201103L || defined(__GXX_EXPERIMENTAL_CXX0X__) +# define FMT_HAS_GXX_CXX11 FMT_GCC_VERSION +#else +# define FMT_HAS_GXX_CXX11 0 +#endif + +#ifdef __NVCC__ +# define FMT_NVCC __NVCC__ +#else +# define FMT_NVCC 0 +#endif + +#ifdef _MSC_VER +# define FMT_MSC_VER _MSC_VER +# define FMT_SUPPRESS_MSC_WARNING(n) __pragma(warning(suppress : n)) +#else +# define FMT_MSC_VER 0 +# define FMT_SUPPRESS_MSC_WARNING(n) +#endif + +#ifdef __has_feature +# define FMT_HAS_FEATURE(x) __has_feature(x) +#else +# define FMT_HAS_FEATURE(x) 0 +#endif + +#if defined(__has_include) && !defined(__INTELLISENSE__) && \ + (!FMT_ICC_VERSION || FMT_ICC_VERSION >= 1600) +# define FMT_HAS_INCLUDE(x) __has_include(x) +#else +# define FMT_HAS_INCLUDE(x) 0 +#endif + +#ifdef __has_cpp_attribute +# define FMT_HAS_CPP_ATTRIBUTE(x) __has_cpp_attribute(x) +#else +# define FMT_HAS_CPP_ATTRIBUTE(x) 0 +#endif + +#define FMT_HAS_CPP14_ATTRIBUTE(attribute) \ + (__cplusplus >= 201402L && FMT_HAS_CPP_ATTRIBUTE(attribute)) + +#define FMT_HAS_CPP17_ATTRIBUTE(attribute) \ + (__cplusplus >= 201703L && FMT_HAS_CPP_ATTRIBUTE(attribute)) + +// Check if relaxed C++14 constexpr is supported. +// GCC doesn't allow throw in constexpr until version 6 (bug 67371). +#ifndef FMT_USE_CONSTEXPR +# define FMT_USE_CONSTEXPR \ + (FMT_HAS_FEATURE(cxx_relaxed_constexpr) || FMT_MSC_VER >= 1910 || \ + (FMT_GCC_VERSION >= 600 && __cplusplus >= 201402L)) && \ + !FMT_NVCC && !FMT_ICC_VERSION +#endif +#if FMT_USE_CONSTEXPR +# define FMT_CONSTEXPR constexpr +# define FMT_CONSTEXPR_DECL constexpr +#else +# define FMT_CONSTEXPR inline +# define FMT_CONSTEXPR_DECL +#endif + +#ifndef FMT_OVERRIDE +# if FMT_HAS_FEATURE(cxx_override_control) || \ + (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900 +# define FMT_OVERRIDE override +# else +# define FMT_OVERRIDE +# endif +#endif + +// Check if exceptions are disabled. +#ifndef FMT_EXCEPTIONS +# if (defined(__GNUC__) && !defined(__EXCEPTIONS)) || \ + FMT_MSC_VER && !_HAS_EXCEPTIONS +# define FMT_EXCEPTIONS 0 +# else +# define FMT_EXCEPTIONS 1 +# endif +#endif + +// Define FMT_USE_NOEXCEPT to make fmt use noexcept (C++11 feature). +#ifndef FMT_USE_NOEXCEPT +# define FMT_USE_NOEXCEPT 0 +#endif + +#if FMT_USE_NOEXCEPT || FMT_HAS_FEATURE(cxx_noexcept) || \ + (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900 +# define FMT_DETECTED_NOEXCEPT noexcept +# define FMT_HAS_CXX11_NOEXCEPT 1 +#else +# define FMT_DETECTED_NOEXCEPT throw() +# define FMT_HAS_CXX11_NOEXCEPT 0 +#endif + +#ifndef FMT_NOEXCEPT +# if FMT_EXCEPTIONS || FMT_HAS_CXX11_NOEXCEPT +# define FMT_NOEXCEPT FMT_DETECTED_NOEXCEPT +# else +# define FMT_NOEXCEPT +# endif +#endif + +// [[noreturn]] is disabled on MSVC and NVCC because of bogus unreachable code +// warnings. +#if FMT_EXCEPTIONS && FMT_HAS_CPP_ATTRIBUTE(noreturn) && !FMT_MSC_VER && \ + !FMT_NVCC +# define FMT_NORETURN [[noreturn]] +#else +# define FMT_NORETURN +#endif + +#ifndef FMT_DEPRECATED +# if FMT_HAS_CPP14_ATTRIBUTE(deprecated) || FMT_MSC_VER >= 1900 +# define FMT_DEPRECATED [[deprecated]] +# else +# if (defined(__GNUC__) && !defined(__LCC__)) || defined(__clang__) +# define FMT_DEPRECATED __attribute__((deprecated)) +# elif FMT_MSC_VER +# define FMT_DEPRECATED __declspec(deprecated) +# else +# define FMT_DEPRECATED /* deprecated */ +# endif +# endif +#endif + +// Workaround broken [[deprecated]] in the Intel, PGI and NVCC compilers. +#if FMT_ICC_VERSION || defined(__PGI) || FMT_NVCC +# define FMT_DEPRECATED_ALIAS +#else +# define FMT_DEPRECATED_ALIAS FMT_DEPRECATED +#endif + +#ifndef FMT_INLINE +# if FMT_GCC_VERSION || FMT_CLANG_VERSION +# define FMT_INLINE inline __attribute__((always_inline)) +# else +# define FMT_INLINE inline +# endif +#endif + +#ifndef FMT_USE_INLINE_NAMESPACES +# if FMT_HAS_FEATURE(cxx_inline_namespaces) || FMT_GCC_VERSION >= 404 || \ + (FMT_MSC_VER >= 1900 && !_MANAGED) +# define FMT_USE_INLINE_NAMESPACES 1 +# else +# define FMT_USE_INLINE_NAMESPACES 0 +# endif +#endif + +#ifndef FMT_BEGIN_NAMESPACE +# if FMT_USE_INLINE_NAMESPACES +# define FMT_INLINE_NAMESPACE inline namespace +# define FMT_END_NAMESPACE \ + } \ + } +# else +# define FMT_INLINE_NAMESPACE namespace +# define FMT_END_NAMESPACE \ + } \ + using namespace v7; \ + } +# endif +# define FMT_BEGIN_NAMESPACE \ + namespace fmt { \ + FMT_INLINE_NAMESPACE v7 { +#endif + +#if !defined(FMT_HEADER_ONLY) && defined(_WIN32) +# define FMT_CLASS_API FMT_SUPPRESS_MSC_WARNING(4275) +# ifdef FMT_EXPORT +# define FMT_API __declspec(dllexport) +# define FMT_EXTERN_TEMPLATE_API FMT_API +# define FMT_EXPORTED +# elif defined(FMT_SHARED) +# define FMT_API __declspec(dllimport) +# define FMT_EXTERN_TEMPLATE_API FMT_API +# endif +#else +# define FMT_CLASS_API +#endif +#ifndef FMT_API +# define FMT_API +#endif +#ifndef FMT_EXTERN_TEMPLATE_API +# define FMT_EXTERN_TEMPLATE_API +#endif +#ifndef FMT_INSTANTIATION_DEF_API +# define FMT_INSTANTIATION_DEF_API FMT_API +#endif + +#ifndef FMT_HEADER_ONLY +# define FMT_EXTERN extern +#else +# define FMT_EXTERN +#endif + +// libc++ supports string_view in pre-c++17. +#if (FMT_HAS_INCLUDE(<string_view>) && \ + (__cplusplus > 201402L || defined(_LIBCPP_VERSION))) || \ + (defined(_MSVC_LANG) && _MSVC_LANG > 201402L && _MSC_VER >= 1910) +# include <string_view> +# define FMT_USE_STRING_VIEW +#elif FMT_HAS_INCLUDE("experimental/string_view") && __cplusplus >= 201402L +# include <experimental/string_view> +# define FMT_USE_EXPERIMENTAL_STRING_VIEW +#endif + +#ifndef FMT_UNICODE +# define FMT_UNICODE !FMT_MSC_VER +#endif +#if FMT_UNICODE && FMT_MSC_VER +# pragma execution_character_set("utf-8") +#endif + +FMT_BEGIN_NAMESPACE + +// Implementations of enable_if_t and other metafunctions for older systems. +template <bool B, class T = void> +using enable_if_t = typename std::enable_if<B, T>::type; +template <bool B, class T, class F> +using conditional_t = typename std::conditional<B, T, F>::type; +template <bool B> using bool_constant = std::integral_constant<bool, B>; +template <typename T> +using remove_reference_t = typename std::remove_reference<T>::type; +template <typename T> +using remove_const_t = typename std::remove_const<T>::type; +template <typename T> +using remove_cvref_t = typename std::remove_cv<remove_reference_t<T>>::type; +template <typename T> struct type_identity { using type = T; }; +template <typename T> using type_identity_t = typename type_identity<T>::type; + +struct monostate {}; + +// An enable_if helper to be used in template parameters which results in much +// shorter symbols: https://godbolt.org/z/sWw4vP. Extra parentheses are needed +// to workaround a bug in MSVC 2019 (see #1140 and #1186). +#define FMT_ENABLE_IF(...) enable_if_t<(__VA_ARGS__), int> = 0 + +namespace detail { + +// A helper function to suppress "conditional expression is constant" warnings. +template <typename T> constexpr T const_check(T value) { return value; } + +FMT_NORETURN FMT_API void assert_fail(const char* file, int line, + const char* message); + +#ifndef FMT_ASSERT +# ifdef NDEBUG +// FMT_ASSERT is not empty to avoid -Werror=empty-body. +# define FMT_ASSERT(condition, message) ((void)0) +# else +# define FMT_ASSERT(condition, message) \ + ((condition) /* void() fails with -Winvalid-constexpr on clang 4.0.1 */ \ + ? (void)0 \ + : ::fmt::detail::assert_fail(__FILE__, __LINE__, (message))) +# endif +#endif + +#if defined(FMT_USE_STRING_VIEW) +template <typename Char> using std_string_view = std::basic_string_view<Char>; +#elif defined(FMT_USE_EXPERIMENTAL_STRING_VIEW) +template <typename Char> +using std_string_view = std::experimental::basic_string_view<Char>; +#else +template <typename T> struct std_string_view {}; +#endif + +#ifdef FMT_USE_INT128 +// Do nothing. +#elif defined(__SIZEOF_INT128__) && !FMT_NVCC && \ + !(FMT_CLANG_VERSION && FMT_MSC_VER) +# define FMT_USE_INT128 1 +using int128_t = __int128_t; +using uint128_t = __uint128_t; +#else +# define FMT_USE_INT128 0 +#endif +#if !FMT_USE_INT128 +struct int128_t {}; +struct uint128_t {}; +#endif + +// Casts a nonnegative integer to unsigned. +template <typename Int> +FMT_CONSTEXPR typename std::make_unsigned<Int>::type to_unsigned(Int value) { + FMT_ASSERT(value >= 0, "negative value"); + return static_cast<typename std::make_unsigned<Int>::type>(value); +} + +FMT_SUPPRESS_MSC_WARNING(4566) constexpr unsigned char micro[] = "\u00B5"; + +template <typename Char> constexpr bool is_unicode() { + return FMT_UNICODE || sizeof(Char) != 1 || + (sizeof(micro) == 3 && micro[0] == 0xC2 && micro[1] == 0xB5); +} + +#ifdef __cpp_char8_t +using char8_type = char8_t; +#else +enum char8_type : unsigned char {}; +#endif +} // namespace detail + +#ifdef FMT_USE_INTERNAL +namespace internal = detail; // DEPRECATED +#endif + +/** + An implementation of ``std::basic_string_view`` for pre-C++17. It provides a + subset of the API. ``fmt::basic_string_view`` is used for format strings even + if ``std::string_view`` is available to prevent issues when a library is + compiled with a different ``-std`` option than the client code (which is not + recommended). + */ +template <typename Char> class basic_string_view { + private: + const Char* data_; + size_t size_; + + public: + using value_type = Char; + using iterator = const Char*; + + constexpr basic_string_view() FMT_NOEXCEPT : data_(nullptr), size_(0) {} + + /** Constructs a string reference object from a C string and a size. */ + constexpr basic_string_view(const Char* s, size_t count) FMT_NOEXCEPT + : data_(s), + size_(count) {} + + /** + \rst + Constructs a string reference object from a C string computing + the size with ``std::char_traits<Char>::length``. + \endrst + */ +#if __cplusplus >= 201703L // C++17's char_traits::length() is constexpr. + FMT_CONSTEXPR +#endif + basic_string_view(const Char* s) + : data_(s), size_(std::char_traits<Char>::length(s)) {} + + /** Constructs a string reference from a ``std::basic_string`` object. */ + template <typename Traits, typename Alloc> + FMT_CONSTEXPR basic_string_view( + const std::basic_string<Char, Traits, Alloc>& s) FMT_NOEXCEPT + : data_(s.data()), + size_(s.size()) {} + + template <typename S, FMT_ENABLE_IF(std::is_same< + S, detail::std_string_view<Char>>::value)> + FMT_CONSTEXPR basic_string_view(S s) FMT_NOEXCEPT : data_(s.data()), + size_(s.size()) {} + + /** Returns a pointer to the string data. */ + constexpr const Char* data() const { return data_; } + + /** Returns the string size. */ + constexpr size_t size() const { return size_; } + + constexpr iterator begin() const { return data_; } + constexpr iterator end() const { return data_ + size_; } + + constexpr const Char& operator[](size_t pos) const { return data_[pos]; } + + FMT_CONSTEXPR void remove_prefix(size_t n) { + data_ += n; + size_ -= n; + } + + // Lexicographically compare this string reference to other. + int compare(basic_string_view other) const { + size_t str_size = size_ < other.size_ ? size_ : other.size_; + int result = std::char_traits<Char>::compare(data_, other.data_, str_size); + if (result == 0) + result = size_ == other.size_ ? 0 : (size_ < other.size_ ? -1 : 1); + return result; + } + + friend bool operator==(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) == 0; + } + friend bool operator!=(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) != 0; + } + friend bool operator<(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) < 0; + } + friend bool operator<=(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) <= 0; + } + friend bool operator>(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) > 0; + } + friend bool operator>=(basic_string_view lhs, basic_string_view rhs) { + return lhs.compare(rhs) >= 0; + } +}; + +using string_view = basic_string_view<char>; +using wstring_view = basic_string_view<wchar_t>; + +/** Specifies if ``T`` is a character type. Can be specialized by users. */ +template <typename T> struct is_char : std::false_type {}; +template <> struct is_char<char> : std::true_type {}; +template <> struct is_char<wchar_t> : std::true_type {}; +template <> struct is_char<detail::char8_type> : std::true_type {}; +template <> struct is_char<char16_t> : std::true_type {}; +template <> struct is_char<char32_t> : std::true_type {}; + +/** + \rst + Returns a string view of `s`. In order to add custom string type support to + {fmt} provide an overload of `to_string_view` for it in the same namespace as + the type for the argument-dependent lookup to work. + + **Example**:: + + namespace my_ns { + inline string_view to_string_view(const my_string& s) { + return {s.data(), s.length()}; + } + } + std::string message = fmt::format(my_string("The answer is {}"), 42); + \endrst + */ +template <typename Char, FMT_ENABLE_IF(is_char<Char>::value)> +inline basic_string_view<Char> to_string_view(const Char* s) { + return s; +} + +template <typename Char, typename Traits, typename Alloc> +inline basic_string_view<Char> to_string_view( + const std::basic_string<Char, Traits, Alloc>& s) { + return s; +} + +template <typename Char> +inline basic_string_view<Char> to_string_view(basic_string_view<Char> s) { + return s; +} + +template <typename Char, + FMT_ENABLE_IF(!std::is_empty<detail::std_string_view<Char>>::value)> +inline basic_string_view<Char> to_string_view(detail::std_string_view<Char> s) { + return s; +} + +// A base class for compile-time strings. It is defined in the fmt namespace to +// make formatting functions visible via ADL, e.g. format(FMT_STRING("{}"), 42). +struct compile_string {}; + +template <typename S> +struct is_compile_string : std::is_base_of<compile_string, S> {}; + +template <typename S, FMT_ENABLE_IF(is_compile_string<S>::value)> +constexpr basic_string_view<typename S::char_type> to_string_view(const S& s) { + return s; +} + +namespace detail { +void to_string_view(...); +using fmt::v7::to_string_view; + +// Specifies whether S is a string type convertible to fmt::basic_string_view. +// It should be a constexpr function but MSVC 2017 fails to compile it in +// enable_if and MSVC 2015 fails to compile it as an alias template. +template <typename S> +struct is_string : std::is_class<decltype(to_string_view(std::declval<S>()))> { +}; + +template <typename S, typename = void> struct char_t_impl {}; +template <typename S> struct char_t_impl<S, enable_if_t<is_string<S>::value>> { + using result = decltype(to_string_view(std::declval<S>())); + using type = typename result::value_type; +}; + +// Reports a compile-time error if S is not a valid format string. +template <typename..., typename S, FMT_ENABLE_IF(!is_compile_string<S>::value)> +FMT_INLINE void check_format_string(const S&) { +#ifdef FMT_ENFORCE_COMPILE_STRING + static_assert(is_compile_string<S>::value, + "FMT_ENFORCE_COMPILE_STRING requires all format strings to use " + "FMT_STRING."); +#endif +} +template <typename..., typename S, FMT_ENABLE_IF(is_compile_string<S>::value)> +void check_format_string(S); + +struct error_handler { + constexpr error_handler() = default; + constexpr error_handler(const error_handler&) = default; + + // This function is intentionally not constexpr to give a compile-time error. + FMT_NORETURN FMT_API void on_error(const char* message); +}; +} // namespace detail + +/** String's character type. */ +template <typename S> using char_t = typename detail::char_t_impl<S>::type; + +/** + \rst + Parsing context consisting of a format string range being parsed and an + argument counter for automatic indexing. + + You can use one of the following type aliases for common character types: + + +-----------------------+-------------------------------------+ + | Type | Definition | + +=======================+=====================================+ + | format_parse_context | basic_format_parse_context<char> | + +-----------------------+-------------------------------------+ + | wformat_parse_context | basic_format_parse_context<wchar_t> | + +-----------------------+-------------------------------------+ + \endrst + */ +template <typename Char, typename ErrorHandler = detail::error_handler> +class basic_format_parse_context : private ErrorHandler { + private: + basic_string_view<Char> format_str_; + int next_arg_id_; + + public: + using char_type = Char; + using iterator = typename basic_string_view<Char>::iterator; + + explicit constexpr basic_format_parse_context( + basic_string_view<Char> format_str, ErrorHandler eh = {}, + int next_arg_id = 0) + : ErrorHandler(eh), format_str_(format_str), next_arg_id_(next_arg_id) {} + + /** + Returns an iterator to the beginning of the format string range being + parsed. + */ + constexpr iterator begin() const FMT_NOEXCEPT { return format_str_.begin(); } + + /** + Returns an iterator past the end of the format string range being parsed. + */ + constexpr iterator end() const FMT_NOEXCEPT { return format_str_.end(); } + + /** Advances the begin iterator to ``it``. */ + FMT_CONSTEXPR void advance_to(iterator it) { + format_str_.remove_prefix(detail::to_unsigned(it - begin())); + } + + /** + Reports an error if using the manual argument indexing; otherwise returns + the next argument index and switches to the automatic indexing. + */ + FMT_CONSTEXPR int next_arg_id() { + // Don't check if the argument id is valid to avoid overhead and because it + // will be checked during formatting anyway. + if (next_arg_id_ >= 0) return next_arg_id_++; + on_error("cannot switch from manual to automatic argument indexing"); + return 0; + } + + /** + Reports an error if using the automatic argument indexing; otherwise + switches to the manual indexing. + */ + FMT_CONSTEXPR void check_arg_id(int) { + if (next_arg_id_ > 0) + on_error("cannot switch from automatic to manual argument indexing"); + else + next_arg_id_ = -1; + } + + FMT_CONSTEXPR void check_arg_id(basic_string_view<Char>) {} + + FMT_CONSTEXPR void on_error(const char* message) { + ErrorHandler::on_error(message); + } + + constexpr ErrorHandler error_handler() const { return *this; } +}; + +using format_parse_context = basic_format_parse_context<char>; +using wformat_parse_context = basic_format_parse_context<wchar_t>; + +template <typename Context> class basic_format_arg; +template <typename Context> class basic_format_args; +template <typename Context> class dynamic_format_arg_store; + +// A formatter for objects of type T. +template <typename T, typename Char = char, typename Enable = void> +struct formatter { + // A deleted default constructor indicates a disabled formatter. + formatter() = delete; +}; + +// Specifies if T has an enabled formatter specialization. A type can be +// formattable even if it doesn't have a formatter e.g. via a conversion. +template <typename T, typename Context> +using has_formatter = + std::is_constructible<typename Context::template formatter_type<T>>; + +// Checks whether T is a container with contiguous storage. +template <typename T> struct is_contiguous : std::false_type {}; +template <typename Char> +struct is_contiguous<std::basic_string<Char>> : std::true_type {}; + +namespace detail { + +// Extracts a reference to the container from back_insert_iterator. +template <typename Container> +inline Container& get_container(std::back_insert_iterator<Container> it) { + using bi_iterator = std::back_insert_iterator<Container>; + struct accessor : bi_iterator { + accessor(bi_iterator iter) : bi_iterator(iter) {} + using bi_iterator::container; + }; + return *accessor(it).container; +} + +/** + \rst + A contiguous memory buffer with an optional growing ability. It is an internal + class and shouldn't be used directly, only via `~fmt::basic_memory_buffer`. + \endrst + */ +template <typename T> class buffer { + private: + T* ptr_; + size_t size_; + size_t capacity_; + + protected: + // Don't initialize ptr_ since it is not accessed to save a few cycles. + FMT_SUPPRESS_MSC_WARNING(26495) + buffer(size_t sz) FMT_NOEXCEPT : size_(sz), capacity_(sz) {} + + buffer(T* p = nullptr, size_t sz = 0, size_t cap = 0) FMT_NOEXCEPT + : ptr_(p), + size_(sz), + capacity_(cap) {} + + ~buffer() = default; + + /** Sets the buffer data and capacity. */ + void set(T* buf_data, size_t buf_capacity) FMT_NOEXCEPT { + ptr_ = buf_data; + capacity_ = buf_capacity; + } + + /** Increases the buffer capacity to hold at least *capacity* elements. */ + virtual void grow(size_t capacity) = 0; + + public: + using value_type = T; + using const_reference = const T&; + + buffer(const buffer&) = delete; + void operator=(const buffer&) = delete; + + T* begin() FMT_NOEXCEPT { return ptr_; } + T* end() FMT_NOEXCEPT { return ptr_ + size_; } + + const T* begin() const FMT_NOEXCEPT { return ptr_; } + const T* end() const FMT_NOEXCEPT { return ptr_ + size_; } + + /** Returns the size of this buffer. */ + size_t size() const FMT_NOEXCEPT { return size_; } + + /** Returns the capacity of this buffer. */ + size_t capacity() const FMT_NOEXCEPT { return capacity_; } + + /** Returns a pointer to the buffer data. */ + T* data() FMT_NOEXCEPT { return ptr_; } + + /** Returns a pointer to the buffer data. */ + const T* data() const FMT_NOEXCEPT { return ptr_; } + + /** Clears this buffer. */ + void clear() { size_ = 0; } + + // Tries resizing the buffer to contain *count* elements. If T is a POD type + // the new elements may not be initialized. + void try_resize(size_t count) { + try_reserve(count); + size_ = count <= capacity_ ? count : capacity_; + } + + // Tries increasing the buffer capacity to *new_capacity*. It can increase the + // capacity by a smaller amount than requested but guarantees there is space + // for at least one additional element either by increasing the capacity or by + // flushing the buffer if it is full. + void try_reserve(size_t new_capacity) { + if (new_capacity > capacity_) grow(new_capacity); + } + + void push_back(const T& value) { + try_reserve(size_ + 1); + ptr_[size_++] = value; + } + + /** Appends data to the end of the buffer. */ + template <typename U> void append(const U* begin, const U* end); + + template <typename I> T& operator[](I index) { return ptr_[index]; } + template <typename I> const T& operator[](I index) const { + return ptr_[index]; + } +}; + +struct buffer_traits { + explicit buffer_traits(size_t) {} + size_t count() const { return 0; } + size_t limit(size_t size) { return size; } +}; + +class fixed_buffer_traits { + private: + size_t count_ = 0; + size_t limit_; + + public: + explicit fixed_buffer_traits(size_t limit) : limit_(limit) {} + size_t count() const { return count_; } + size_t limit(size_t size) { + size_t n = limit_ > count_ ? limit_ - count_ : 0; + count_ += size; + return size < n ? size : n; + } +}; + +// A buffer that writes to an output iterator when flushed. +template <typename OutputIt, typename T, typename Traits = buffer_traits> +class iterator_buffer final : public Traits, public buffer<T> { + private: + OutputIt out_; + enum { buffer_size = 256 }; + T data_[buffer_size]; + + protected: + void grow(size_t) final FMT_OVERRIDE { + if (this->size() == buffer_size) flush(); + } + void flush(); + + public: + explicit iterator_buffer(OutputIt out, size_t n = buffer_size) + : Traits(n), + buffer<T>(data_, 0, buffer_size), + out_(out) {} + ~iterator_buffer() { flush(); } + + OutputIt out() { + flush(); + return out_; + } + size_t count() const { return Traits::count() + this->size(); } +}; + +template <typename T> class iterator_buffer<T*, T> final : public buffer<T> { + protected: + void grow(size_t) final FMT_OVERRIDE {} + + public: + explicit iterator_buffer(T* out, size_t = 0) : buffer<T>(out, 0, ~size_t()) {} + + T* out() { return &*this->end(); } +}; + +// A buffer that writes to a container with the contiguous storage. +template <typename Container> +class iterator_buffer<std::back_insert_iterator<Container>, + enable_if_t<is_contiguous<Container>::value, + typename Container::value_type>> + final : public buffer<typename Container::value_type> { + private: + Container& container_; + + protected: + void grow(size_t capacity) final FMT_OVERRIDE { + container_.resize(capacity); + this->set(&container_[0], capacity); + } + + public: + explicit iterator_buffer(Container& c) + : buffer<typename Container::value_type>(c.size()), container_(c) {} + explicit iterator_buffer(std::back_insert_iterator<Container> out, size_t = 0) + : iterator_buffer(get_container(out)) {} + std::back_insert_iterator<Container> out() { + return std::back_inserter(container_); + } +}; + +// A buffer that counts the number of code units written discarding the output. +template <typename T = char> class counting_buffer final : public buffer<T> { + private: + enum { buffer_size = 256 }; + T data_[buffer_size]; + size_t count_ = 0; + + protected: + void grow(size_t) final FMT_OVERRIDE { + if (this->size() != buffer_size) return; + count_ += this->size(); + this->clear(); + } + + public: + counting_buffer() : buffer<T>(data_, 0, buffer_size) {} + + size_t count() { return count_ + this->size(); } +}; + +// An output iterator that appends to the buffer. +// It is used to reduce symbol sizes for the common case. +template <typename T> +class buffer_appender : public std::back_insert_iterator<buffer<T>> { + using base = std::back_insert_iterator<buffer<T>>; + + public: + explicit buffer_appender(buffer<T>& buf) : base(buf) {} + buffer_appender(base it) : base(it) {} + + buffer_appender& operator++() { + base::operator++(); + return *this; + } + + buffer_appender operator++(int) { + buffer_appender tmp = *this; + ++*this; + return tmp; + } +}; + +// Maps an output iterator into a buffer. +template <typename T, typename OutputIt> +iterator_buffer<OutputIt, T> get_buffer(OutputIt); +template <typename T> buffer<T>& get_buffer(buffer_appender<T>); + +template <typename OutputIt> OutputIt get_buffer_init(OutputIt out) { + return out; +} +template <typename T> buffer<T>& get_buffer_init(buffer_appender<T> out) { + return get_container(out); +} + +template <typename Buffer> +auto get_iterator(Buffer& buf) -> decltype(buf.out()) { + return buf.out(); +} +template <typename T> buffer_appender<T> get_iterator(buffer<T>& buf) { + return buffer_appender<T>(buf); +} + +template <typename T, typename Char = char, typename Enable = void> +struct fallback_formatter { + fallback_formatter() = delete; +}; + +// Specifies if T has an enabled fallback_formatter specialization. +template <typename T, typename Context> +using has_fallback_formatter = + std::is_constructible<fallback_formatter<T, typename Context::char_type>>; + +struct view {}; + +template <typename Char, typename T> struct named_arg : view { + const Char* name; + const T& value; + named_arg(const Char* n, const T& v) : name(n), value(v) {} +}; + +template <typename Char> struct named_arg_info { + const Char* name; + int id; +}; + +template <typename T, typename Char, size_t NUM_ARGS, size_t NUM_NAMED_ARGS> +struct arg_data { + // args_[0].named_args points to named_args_ to avoid bloating format_args. + // +1 to workaround a bug in gcc 7.5 that causes duplicated-branches warning. + T args_[1 + (NUM_ARGS != 0 ? NUM_ARGS : +1)]; + named_arg_info<Char> named_args_[NUM_NAMED_ARGS]; + + template <typename... U> + arg_data(const U&... init) : args_{T(named_args_, NUM_NAMED_ARGS), init...} {} + arg_data(const arg_data& other) = delete; + const T* args() const { return args_ + 1; } + named_arg_info<Char>* named_args() { return named_args_; } +}; + +template <typename T, typename Char, size_t NUM_ARGS> +struct arg_data<T, Char, NUM_ARGS, 0> { + // +1 to workaround a bug in gcc 7.5 that causes duplicated-branches warning. + T args_[NUM_ARGS != 0 ? NUM_ARGS : +1]; + + template <typename... U> + FMT_INLINE arg_data(const U&... init) : args_{init...} {} + FMT_INLINE const T* args() const { return args_; } + FMT_INLINE std::nullptr_t named_args() { return nullptr; } +}; + +template <typename Char> +inline void init_named_args(named_arg_info<Char>*, int, int) {} + +template <typename Char, typename T, typename... Tail> +void init_named_args(named_arg_info<Char>* named_args, int arg_count, + int named_arg_count, const T&, const Tail&... args) { + init_named_args(named_args, arg_count + 1, named_arg_count, args...); +} + +template <typename Char, typename T, typename... Tail> +void init_named_args(named_arg_info<Char>* named_args, int arg_count, + int named_arg_count, const named_arg<Char, T>& arg, + const Tail&... args) { + named_args[named_arg_count++] = {arg.name, arg_count}; + init_named_args(named_args, arg_count + 1, named_arg_count, args...); +} + +template <typename... Args> +FMT_INLINE void init_named_args(std::nullptr_t, int, int, const Args&...) {} + +template <typename T> struct is_named_arg : std::false_type {}; + +template <typename T, typename Char> +struct is_named_arg<named_arg<Char, T>> : std::true_type {}; + +template <bool B = false> constexpr size_t count() { return B ? 1 : 0; } +template <bool B1, bool B2, bool... Tail> constexpr size_t count() { + return (B1 ? 1 : 0) + count<B2, Tail...>(); +} + +template <typename... Args> constexpr size_t count_named_args() { + return count<is_named_arg<Args>::value...>(); +} + +enum class type { + none_type, + // Integer types should go first, + int_type, + uint_type, + long_long_type, + ulong_long_type, + int128_type, + uint128_type, + bool_type, + char_type, + last_integer_type = char_type, + // followed by floating-point types. + float_type, + double_type, + long_double_type, + last_numeric_type = long_double_type, + cstring_type, + string_type, + pointer_type, + custom_type +}; + +// Maps core type T to the corresponding type enum constant. +template <typename T, typename Char> +struct type_constant : std::integral_constant<type, type::custom_type> {}; + +#define FMT_TYPE_CONSTANT(Type, constant) \ + template <typename Char> \ + struct type_constant<Type, Char> \ + : std::integral_constant<type, type::constant> {} + +FMT_TYPE_CONSTANT(int, int_type); +FMT_TYPE_CONSTANT(unsigned, uint_type); +FMT_TYPE_CONSTANT(long long, long_long_type); +FMT_TYPE_CONSTANT(unsigned long long, ulong_long_type); +FMT_TYPE_CONSTANT(int128_t, int128_type); +FMT_TYPE_CONSTANT(uint128_t, uint128_type); +FMT_TYPE_CONSTANT(bool, bool_type); +FMT_TYPE_CONSTANT(Char, char_type); +FMT_TYPE_CONSTANT(float, float_type); +FMT_TYPE_CONSTANT(double, double_type); +FMT_TYPE_CONSTANT(long double, long_double_type); +FMT_TYPE_CONSTANT(const Char*, cstring_type); +FMT_TYPE_CONSTANT(basic_string_view<Char>, string_type); +FMT_TYPE_CONSTANT(const void*, pointer_type); + +constexpr bool is_integral_type(type t) { + return t > type::none_type && t <= type::last_integer_type; +} + +constexpr bool is_arithmetic_type(type t) { + return t > type::none_type && t <= type::last_numeric_type; +} + +template <typename Char> struct string_value { + const Char* data; + size_t size; +}; + +template <typename Char> struct named_arg_value { + const named_arg_info<Char>* data; + size_t size; +}; + +template <typename Context> struct custom_value { + using parse_context = typename Context::parse_context_type; + const void* value; + void (*format)(const void* arg, parse_context& parse_ctx, Context& ctx); +}; + +// A formatting argument value. +template <typename Context> class value { + public: + using char_type = typename Context::char_type; + + union { + int int_value; + unsigned uint_value; + long long long_long_value; + unsigned long long ulong_long_value; + int128_t int128_value; + uint128_t uint128_value; + bool bool_value; + char_type char_value; + float float_value; + double double_value; + long double long_double_value; + const void* pointer; + string_value<char_type> string; + custom_value<Context> custom; + named_arg_value<char_type> named_args; + }; + + constexpr FMT_INLINE value(int val = 0) : int_value(val) {} + constexpr FMT_INLINE value(unsigned val) : uint_value(val) {} + FMT_INLINE value(long long val) : long_long_value(val) {} + FMT_INLINE value(unsigned long long val) : ulong_long_value(val) {} + FMT_INLINE value(int128_t val) : int128_value(val) {} + FMT_INLINE value(uint128_t val) : uint128_value(val) {} + FMT_INLINE value(float val) : float_value(val) {} + FMT_INLINE value(double val) : double_value(val) {} + FMT_INLINE value(long double val) : long_double_value(val) {} + FMT_INLINE value(bool val) : bool_value(val) {} + FMT_INLINE value(char_type val) : char_value(val) {} + FMT_INLINE value(const char_type* val) { string.data = val; } + FMT_INLINE value(basic_string_view<char_type> val) { + string.data = val.data(); + string.size = val.size(); + } + FMT_INLINE value(const void* val) : pointer(val) {} + FMT_INLINE value(const named_arg_info<char_type>* args, size_t size) + : named_args{args, size} {} + + template <typename T> FMT_INLINE value(const T& val) { + custom.value = &val; + // Get the formatter type through the context to allow different contexts + // have different extension points, e.g. `formatter<T>` for `format` and + // `printf_formatter<T>` for `printf`. + custom.format = format_custom_arg< + T, conditional_t<has_formatter<T, Context>::value, + typename Context::template formatter_type<T>, + fallback_formatter<T, char_type>>>; + } + + private: + // Formats an argument of a custom type, such as a user-defined class. + template <typename T, typename Formatter> + static void format_custom_arg(const void* arg, + typename Context::parse_context_type& parse_ctx, + Context& ctx) { + Formatter f; + parse_ctx.advance_to(f.parse(parse_ctx)); + ctx.advance_to(f.format(*static_cast<const T*>(arg), ctx)); + } +}; + +template <typename Context, typename T> +FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value); + +// To minimize the number of types we need to deal with, long is translated +// either to int or to long long depending on its size. +enum { long_short = sizeof(long) == sizeof(int) }; +using long_type = conditional_t<long_short, int, long long>; +using ulong_type = conditional_t<long_short, unsigned, unsigned long long>; + +struct unformattable {}; + +// Maps formatting arguments to core types. +template <typename Context> struct arg_mapper { + using char_type = typename Context::char_type; + + FMT_CONSTEXPR int map(signed char val) { return val; } + FMT_CONSTEXPR unsigned map(unsigned char val) { return val; } + FMT_CONSTEXPR int map(short val) { return val; } + FMT_CONSTEXPR unsigned map(unsigned short val) { return val; } + FMT_CONSTEXPR int map(int val) { return val; } + FMT_CONSTEXPR unsigned map(unsigned val) { return val; } + FMT_CONSTEXPR long_type map(long val) { return val; } + FMT_CONSTEXPR ulong_type map(unsigned long val) { return val; } + FMT_CONSTEXPR long long map(long long val) { return val; } + FMT_CONSTEXPR unsigned long long map(unsigned long long val) { return val; } + FMT_CONSTEXPR int128_t map(int128_t val) { return val; } + FMT_CONSTEXPR uint128_t map(uint128_t val) { return val; } + FMT_CONSTEXPR bool map(bool val) { return val; } + + template <typename T, FMT_ENABLE_IF(is_char<T>::value)> + FMT_CONSTEXPR char_type map(T val) { + static_assert( + std::is_same<T, char>::value || std::is_same<T, char_type>::value, + "mixing character types is disallowed"); + return val; + } + + FMT_CONSTEXPR float map(float val) { return val; } + FMT_CONSTEXPR double map(double val) { return val; } + FMT_CONSTEXPR long double map(long double val) { return val; } + + FMT_CONSTEXPR const char_type* map(char_type* val) { return val; } + FMT_CONSTEXPR const char_type* map(const char_type* val) { return val; } + template <typename T, FMT_ENABLE_IF(is_string<T>::value)> + FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) { + static_assert(std::is_same<char_type, char_t<T>>::value, + "mixing character types is disallowed"); + return to_string_view(val); + } + template <typename T, + FMT_ENABLE_IF( + std::is_constructible<basic_string_view<char_type>, T>::value && + !is_string<T>::value && !has_formatter<T, Context>::value && + !has_fallback_formatter<T, Context>::value)> + FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) { + return basic_string_view<char_type>(val); + } + template < + typename T, + FMT_ENABLE_IF( + std::is_constructible<std_string_view<char_type>, T>::value && + !std::is_constructible<basic_string_view<char_type>, T>::value && + !is_string<T>::value && !has_formatter<T, Context>::value && + !has_fallback_formatter<T, Context>::value)> + FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) { + return std_string_view<char_type>(val); + } + FMT_CONSTEXPR const char* map(const signed char* val) { + static_assert(std::is_same<char_type, char>::value, "invalid string type"); + return reinterpret_cast<const char*>(val); + } + FMT_CONSTEXPR const char* map(const unsigned char* val) { + static_assert(std::is_same<char_type, char>::value, "invalid string type"); + return reinterpret_cast<const char*>(val); + } + FMT_CONSTEXPR const char* map(signed char* val) { + const auto* const_val = val; + return map(const_val); + } + FMT_CONSTEXPR const char* map(unsigned char* val) { + const auto* const_val = val; + return map(const_val); + } + + FMT_CONSTEXPR const void* map(void* val) { return val; } + FMT_CONSTEXPR const void* map(const void* val) { return val; } + FMT_CONSTEXPR const void* map(std::nullptr_t val) { return val; } + template <typename T> FMT_CONSTEXPR int map(const T*) { + // Formatting of arbitrary pointers is disallowed. If you want to output + // a pointer cast it to "void *" or "const void *". In particular, this + // forbids formatting of "[const] volatile char *" which is printed as bool + // by iostreams. + static_assert(!sizeof(T), "formatting of non-void pointers is disallowed"); + return 0; + } + + template <typename T, + FMT_ENABLE_IF(std::is_enum<T>::value && + !has_formatter<T, Context>::value && + !has_fallback_formatter<T, Context>::value)> + FMT_CONSTEXPR auto map(const T& val) + -> decltype(std::declval<arg_mapper>().map( + static_cast<typename std::underlying_type<T>::type>(val))) { + return map(static_cast<typename std::underlying_type<T>::type>(val)); + } + template <typename T, + FMT_ENABLE_IF(!is_string<T>::value && !is_char<T>::value && + (has_formatter<T, Context>::value || + has_fallback_formatter<T, Context>::value))> + FMT_CONSTEXPR const T& map(const T& val) { + return val; + } + + template <typename T> + FMT_CONSTEXPR auto map(const named_arg<char_type, T>& val) + -> decltype(std::declval<arg_mapper>().map(val.value)) { + return map(val.value); + } + + unformattable map(...) { return {}; } +}; + +// A type constant after applying arg_mapper<Context>. +template <typename T, typename Context> +using mapped_type_constant = + type_constant<decltype(arg_mapper<Context>().map(std::declval<const T&>())), + typename Context::char_type>; + +enum { packed_arg_bits = 4 }; +// Maximum number of arguments with packed types. +enum { max_packed_args = 62 / packed_arg_bits }; +enum : unsigned long long { is_unpacked_bit = 1ULL << 63 }; +enum : unsigned long long { has_named_args_bit = 1ULL << 62 }; +} // namespace detail + +// A formatting argument. It is a trivially copyable/constructible type to +// allow storage in basic_memory_buffer. +template <typename Context> class basic_format_arg { + private: + detail::value<Context> value_; + detail::type type_; + + template <typename ContextType, typename T> + friend FMT_CONSTEXPR basic_format_arg<ContextType> detail::make_arg( + const T& value); + + template <typename Visitor, typename Ctx> + friend FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis, + const basic_format_arg<Ctx>& arg) + -> decltype(vis(0)); + + friend class basic_format_args<Context>; + friend class dynamic_format_arg_store<Context>; + + using char_type = typename Context::char_type; + + template <typename T, typename Char, size_t NUM_ARGS, size_t NUM_NAMED_ARGS> + friend struct detail::arg_data; + + basic_format_arg(const detail::named_arg_info<char_type>* args, size_t size) + : value_(args, size) {} + + public: + class handle { + public: + explicit handle(detail::custom_value<Context> custom) : custom_(custom) {} + + void format(typename Context::parse_context_type& parse_ctx, + Context& ctx) const { + custom_.format(custom_.value, parse_ctx, ctx); + } + + private: + detail::custom_value<Context> custom_; + }; + + constexpr basic_format_arg() : type_(detail::type::none_type) {} + + constexpr explicit operator bool() const FMT_NOEXCEPT { + return type_ != detail::type::none_type; + } + + detail::type type() const { return type_; } + + bool is_integral() const { return detail::is_integral_type(type_); } + bool is_arithmetic() const { return detail::is_arithmetic_type(type_); } +}; + +/** + \rst + Visits an argument dispatching to the appropriate visit method based on + the argument type. For example, if the argument type is ``double`` then + ``vis(value)`` will be called with the value of type ``double``. + \endrst + */ +template <typename Visitor, typename Context> +FMT_CONSTEXPR_DECL FMT_INLINE auto visit_format_arg( + Visitor&& vis, const basic_format_arg<Context>& arg) -> decltype(vis(0)) { + using char_type = typename Context::char_type; + switch (arg.type_) { + case detail::type::none_type: + break; + case detail::type::int_type: + return vis(arg.value_.int_value); + case detail::type::uint_type: + return vis(arg.value_.uint_value); + case detail::type::long_long_type: + return vis(arg.value_.long_long_value); + case detail::type::ulong_long_type: + return vis(arg.value_.ulong_long_value); +#if FMT_USE_INT128 + case detail::type::int128_type: + return vis(arg.value_.int128_value); + case detail::type::uint128_type: + return vis(arg.value_.uint128_value); +#else + case detail::type::int128_type: + case detail::type::uint128_type: + break; +#endif + case detail::type::bool_type: + return vis(arg.value_.bool_value); + case detail::type::char_type: + return vis(arg.value_.char_value); + case detail::type::float_type: + return vis(arg.value_.float_value); + case detail::type::double_type: + return vis(arg.value_.double_value); + case detail::type::long_double_type: + return vis(arg.value_.long_double_value); + case detail::type::cstring_type: + return vis(arg.value_.string.data); + case detail::type::string_type: + return vis(basic_string_view<char_type>(arg.value_.string.data, + arg.value_.string.size)); + case detail::type::pointer_type: + return vis(arg.value_.pointer); + case detail::type::custom_type: + return vis(typename basic_format_arg<Context>::handle(arg.value_.custom)); + } + return vis(monostate()); +} + +template <typename T> struct formattable : std::false_type {}; + +namespace detail { + +// A workaround for gcc 4.8 to make void_t work in a SFINAE context. +template <typename... Ts> struct void_t_impl { using type = void; }; +template <typename... Ts> +using void_t = typename detail::void_t_impl<Ts...>::type; + +template <typename It, typename T, typename Enable = void> +struct is_output_iterator : std::false_type {}; + +template <typename It, typename T> +struct is_output_iterator< + It, T, + void_t<typename std::iterator_traits<It>::iterator_category, + decltype(*std::declval<It>() = std::declval<T>())>> + : std::true_type {}; + +template <typename OutputIt> +struct is_back_insert_iterator : std::false_type {}; +template <typename Container> +struct is_back_insert_iterator<std::back_insert_iterator<Container>> + : std::true_type {}; + +template <typename OutputIt> +struct is_contiguous_back_insert_iterator : std::false_type {}; +template <typename Container> +struct is_contiguous_back_insert_iterator<std::back_insert_iterator<Container>> + : is_contiguous<Container> {}; +template <typename Char> +struct is_contiguous_back_insert_iterator<buffer_appender<Char>> + : std::true_type {}; + +// A type-erased reference to an std::locale to avoid heavy <locale> include. +class locale_ref { + private: + const void* locale_; // A type-erased pointer to std::locale. + + public: + locale_ref() : locale_(nullptr) {} + template <typename Locale> explicit locale_ref(const Locale& loc); + + explicit operator bool() const FMT_NOEXCEPT { return locale_ != nullptr; } + + template <typename Locale> Locale get() const; +}; + +template <typename> constexpr unsigned long long encode_types() { return 0; } + +template <typename Context, typename Arg, typename... Args> +constexpr unsigned long long encode_types() { + return static_cast<unsigned>(mapped_type_constant<Arg, Context>::value) | + (encode_types<Context, Args...>() << packed_arg_bits); +} + +template <typename Context, typename T> +FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value) { + basic_format_arg<Context> arg; + arg.type_ = mapped_type_constant<T, Context>::value; + arg.value_ = arg_mapper<Context>().map(value); + return arg; +} + +template <typename T> int check(unformattable) { + static_assert( + formattable<T>(), + "Cannot format an argument. To make type T formattable provide a " + "formatter<T> specialization: https://fmt.dev/latest/api.html#udt"); + return 0; +} +template <typename T, typename U> inline const U& check(const U& val) { + return val; +} + +// The type template parameter is there to avoid an ODR violation when using +// a fallback formatter in one translation unit and an implicit conversion in +// another (not recommended). +template <bool IS_PACKED, typename Context, type, typename T, + FMT_ENABLE_IF(IS_PACKED)> +inline value<Context> make_arg(const T& val) { + return check<T>(arg_mapper<Context>().map(val)); +} + +template <bool IS_PACKED, typename Context, type, typename T, + FMT_ENABLE_IF(!IS_PACKED)> +inline basic_format_arg<Context> make_arg(const T& value) { + return make_arg<Context>(value); +} + +template <typename T> struct is_reference_wrapper : std::false_type {}; +template <typename T> +struct is_reference_wrapper<std::reference_wrapper<T>> : std::true_type {}; + +template <typename T> const T& unwrap(const T& v) { return v; } +template <typename T> const T& unwrap(const std::reference_wrapper<T>& v) { + return static_cast<const T&>(v); +} + +class dynamic_arg_list { + // Workaround for clang's -Wweak-vtables. Unlike for regular classes, for + // templates it doesn't complain about inability to deduce single translation + // unit for placing vtable. So storage_node_base is made a fake template. + template <typename = void> struct node { + virtual ~node() = default; + std::unique_ptr<node<>> next; + }; + + template <typename T> struct typed_node : node<> { + T value; + + template <typename Arg> + FMT_CONSTEXPR typed_node(const Arg& arg) : value(arg) {} + + template <typename Char> + FMT_CONSTEXPR typed_node(const basic_string_view<Char>& arg) + : value(arg.data(), arg.size()) {} + }; + + std::unique_ptr<node<>> head_; + + public: + template <typename T, typename Arg> const T& push(const Arg& arg) { + auto new_node = std::unique_ptr<typed_node<T>>(new typed_node<T>(arg)); + auto& value = new_node->value; + new_node->next = std::move(head_); + head_ = std::move(new_node); + return value; + } +}; +} // namespace detail + +// Formatting context. +template <typename OutputIt, typename Char> class basic_format_context { + public: + /** The character type for the output. */ + using char_type = Char; + + private: + OutputIt out_; + basic_format_args<basic_format_context> args_; + detail::locale_ref loc_; + + public: + using iterator = OutputIt; + using format_arg = basic_format_arg<basic_format_context>; + using parse_context_type = basic_format_parse_context<Char>; + template <typename T> using formatter_type = formatter<T, char_type>; + + basic_format_context(const basic_format_context&) = delete; + void operator=(const basic_format_context&) = delete; + /** + Constructs a ``basic_format_context`` object. References to the arguments are + stored in the object so make sure they have appropriate lifetimes. + */ + basic_format_context(OutputIt out, + basic_format_args<basic_format_context> ctx_args, + detail::locale_ref loc = detail::locale_ref()) + : out_(out), args_(ctx_args), loc_(loc) {} + + format_arg arg(int id) const { return args_.get(id); } + format_arg arg(basic_string_view<char_type> name) { return args_.get(name); } + int arg_id(basic_string_view<char_type> name) { return args_.get_id(name); } + const basic_format_args<basic_format_context>& args() const { return args_; } + + detail::error_handler error_handler() { return {}; } + void on_error(const char* message) { error_handler().on_error(message); } + + // Returns an iterator to the beginning of the output range. + iterator out() { return out_; } + + // Advances the begin iterator to ``it``. + void advance_to(iterator it) { + if (!detail::is_back_insert_iterator<iterator>()) out_ = it; + } + + detail::locale_ref locale() { return loc_; } +}; + +template <typename Char> +using buffer_context = + basic_format_context<detail::buffer_appender<Char>, Char>; +using format_context = buffer_context<char>; +using wformat_context = buffer_context<wchar_t>; + +// Workaround an alias issue: https://stackoverflow.com/q/62767544/471164. +#define FMT_BUFFER_CONTEXT(Char) \ + basic_format_context<detail::buffer_appender<Char>, Char> + +/** + \rst + An array of references to arguments. It can be implicitly converted into + `~fmt::basic_format_args` for passing into type-erased formatting functions + such as `~fmt::vformat`. + \endrst + */ +template <typename Context, typename... Args> +class format_arg_store +#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409 + // Workaround a GCC template argument substitution bug. + : public basic_format_args<Context> +#endif +{ + private: + static const size_t num_args = sizeof...(Args); + static const size_t num_named_args = detail::count_named_args<Args...>(); + static const bool is_packed = num_args <= detail::max_packed_args; + + using value_type = conditional_t<is_packed, detail::value<Context>, + basic_format_arg<Context>>; + + detail::arg_data<value_type, typename Context::char_type, num_args, + num_named_args> + data_; + + friend class basic_format_args<Context>; + + static constexpr unsigned long long desc = + (is_packed ? detail::encode_types<Context, Args...>() + : detail::is_unpacked_bit | num_args) | + (num_named_args != 0 + ? static_cast<unsigned long long>(detail::has_named_args_bit) + : 0); + + public: + format_arg_store(const Args&... args) + : +#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409 + basic_format_args<Context>(*this), +#endif + data_{detail::make_arg< + is_packed, Context, + detail::mapped_type_constant<Args, Context>::value>(args)...} { + detail::init_named_args(data_.named_args(), 0, 0, args...); + } +}; + +/** + \rst + Constructs a `~fmt::format_arg_store` object that contains references to + arguments and can be implicitly converted to `~fmt::format_args`. `Context` + can be omitted in which case it defaults to `~fmt::context`. + See `~fmt::arg` for lifetime considerations. + \endrst + */ +template <typename Context = format_context, typename... Args> +inline format_arg_store<Context, Args...> make_format_args( + const Args&... args) { + return {args...}; +} + +/** + \rst + Constructs a `~fmt::format_arg_store` object that contains references + to arguments and can be implicitly converted to `~fmt::format_args`. + If ``format_str`` is a compile-time string then `make_args_checked` checks + its validity at compile time. + \endrst + */ +template <typename... Args, typename S, typename Char = char_t<S>> +inline auto make_args_checked(const S& format_str, + const remove_reference_t<Args>&... args) + -> format_arg_store<buffer_context<Char>, remove_reference_t<Args>...> { + static_assert( + detail::count<( + std::is_base_of<detail::view, remove_reference_t<Args>>::value && + std::is_reference<Args>::value)...>() == 0, + "passing views as lvalues is disallowed"); + detail::check_format_string<Args...>(format_str); + return {args...}; +} + +/** + \rst + Returns a named argument to be used in a formatting function. It should only + be used in a call to a formatting function. + + **Example**:: + + fmt::print("Elapsed time: {s:.2f} seconds", fmt::arg("s", 1.23)); + \endrst + */ +template <typename Char, typename T> +inline detail::named_arg<Char, T> arg(const Char* name, const T& arg) { + static_assert(!detail::is_named_arg<T>(), "nested named arguments"); + return {name, arg}; +} + +/** + \rst + A dynamic version of `fmt::format_arg_store`. + It's equipped with a storage to potentially temporary objects which lifetimes + could be shorter than the format arguments object. + + It can be implicitly converted into `~fmt::basic_format_args` for passing + into type-erased formatting functions such as `~fmt::vformat`. + \endrst + */ +template <typename Context> +class dynamic_format_arg_store +#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409 + // Workaround a GCC template argument substitution bug. + : public basic_format_args<Context> +#endif +{ + private: + using char_type = typename Context::char_type; + + template <typename T> struct need_copy { + static constexpr detail::type mapped_type = + detail::mapped_type_constant<T, Context>::value; + + enum { + value = !(detail::is_reference_wrapper<T>::value || + std::is_same<T, basic_string_view<char_type>>::value || + std::is_same<T, detail::std_string_view<char_type>>::value || + (mapped_type != detail::type::cstring_type && + mapped_type != detail::type::string_type && + mapped_type != detail::type::custom_type)) + }; + }; + + template <typename T> + using stored_type = conditional_t<detail::is_string<T>::value, + std::basic_string<char_type>, T>; + + // Storage of basic_format_arg must be contiguous. + std::vector<basic_format_arg<Context>> data_; + std::vector<detail::named_arg_info<char_type>> named_info_; + + // Storage of arguments not fitting into basic_format_arg must grow + // without relocation because items in data_ refer to it. + detail::dynamic_arg_list dynamic_args_; + + friend class basic_format_args<Context>; + + unsigned long long get_types() const { + return detail::is_unpacked_bit | data_.size() | + (named_info_.empty() + ? 0ULL + : static_cast<unsigned long long>(detail::has_named_args_bit)); + } + + const basic_format_arg<Context>* data() const { + return named_info_.empty() ? data_.data() : data_.data() + 1; + } + + template <typename T> void emplace_arg(const T& arg) { + data_.emplace_back(detail::make_arg<Context>(arg)); + } + + template <typename T> + void emplace_arg(const detail::named_arg<char_type, T>& arg) { + if (named_info_.empty()) { + constexpr const detail::named_arg_info<char_type>* zero_ptr{nullptr}; + data_.insert(data_.begin(), {zero_ptr, 0}); + } + data_.emplace_back(detail::make_arg<Context>(detail::unwrap(arg.value))); + auto pop_one = [](std::vector<basic_format_arg<Context>>* data) { + data->pop_back(); + }; + std::unique_ptr<std::vector<basic_format_arg<Context>>, decltype(pop_one)> + guard{&data_, pop_one}; + named_info_.push_back({arg.name, static_cast<int>(data_.size() - 2u)}); + data_[0].value_.named_args = {named_info_.data(), named_info_.size()}; + guard.release(); + } + + public: + /** + \rst + Adds an argument into the dynamic store for later passing to a formatting + function. + + Note that custom types and string types (but not string views) are copied + into the store dynamically allocating memory if necessary. + + **Example**:: + + fmt::dynamic_format_arg_store<fmt::format_context> store; + store.push_back(42); + store.push_back("abc"); + store.push_back(1.5f); + std::string result = fmt::vformat("{} and {} and {}", store); + \endrst + */ + template <typename T> void push_back(const T& arg) { + if (detail::const_check(need_copy<T>::value)) + emplace_arg(dynamic_args_.push<stored_type<T>>(arg)); + else + emplace_arg(detail::unwrap(arg)); + } + + /** + \rst + Adds a reference to the argument into the dynamic store for later passing to + a formatting function. Supports named arguments wrapped in + ``std::reference_wrapper`` via ``std::ref()``/``std::cref()``. + + **Example**:: + + fmt::dynamic_format_arg_store<fmt::format_context> store; + char str[] = "1234567890"; + store.push_back(std::cref(str)); + int a1_val{42}; + auto a1 = fmt::arg("a1_", a1_val); + store.push_back(std::cref(a1)); + + // Changing str affects the output but only for string and custom types. + str[0] = 'X'; + + std::string result = fmt::vformat("{} and {a1_}"); + assert(result == "X234567890 and 42"); + \endrst + */ + template <typename T> void push_back(std::reference_wrapper<T> arg) { + static_assert( + detail::is_named_arg<typename std::remove_cv<T>::type>::value || + need_copy<T>::value, + "objects of built-in types and string views are always copied"); + emplace_arg(arg.get()); + } + + /** + Adds named argument into the dynamic store for later passing to a formatting + function. ``std::reference_wrapper`` is supported to avoid copying of the + argument. + */ + template <typename T> + void push_back(const detail::named_arg<char_type, T>& arg) { + const char_type* arg_name = + dynamic_args_.push<std::basic_string<char_type>>(arg.name).c_str(); + if (detail::const_check(need_copy<T>::value)) { + emplace_arg( + fmt::arg(arg_name, dynamic_args_.push<stored_type<T>>(arg.value))); + } else { + emplace_arg(fmt::arg(arg_name, arg.value)); + } + } + + /** Erase all elements from the store */ + void clear() { + data_.clear(); + named_info_.clear(); + dynamic_args_ = detail::dynamic_arg_list(); + } + + /** + \rst + Reserves space to store at least *new_cap* arguments including + *new_cap_named* named arguments. + \endrst + */ + void reserve(size_t new_cap, size_t new_cap_named) { + FMT_ASSERT(new_cap >= new_cap_named, + "Set of arguments includes set of named arguments"); + data_.reserve(new_cap); + named_info_.reserve(new_cap_named); + } +}; + +/** + \rst + A view of a collection of formatting arguments. To avoid lifetime issues it + should only be used as a parameter type in type-erased functions such as + ``vformat``:: + + void vlog(string_view format_str, format_args args); // OK + format_args args = make_format_args(42); // Error: dangling reference + \endrst + */ +template <typename Context> class basic_format_args { + public: + using size_type = int; + using format_arg = basic_format_arg<Context>; + + private: + // A descriptor that contains information about formatting arguments. + // If the number of arguments is less or equal to max_packed_args then + // argument types are passed in the descriptor. This reduces binary code size + // per formatting function call. + unsigned long long desc_; + union { + // If is_packed() returns true then argument values are stored in values_; + // otherwise they are stored in args_. This is done to improve cache + // locality and reduce compiled code size since storing larger objects + // may require more code (at least on x86-64) even if the same amount of + // data is actually copied to stack. It saves ~10% on the bloat test. + const detail::value<Context>* values_; + const format_arg* args_; + }; + + bool is_packed() const { return (desc_ & detail::is_unpacked_bit) == 0; } + bool has_named_args() const { + return (desc_ & detail::has_named_args_bit) != 0; + } + + detail::type type(int index) const { + int shift = index * detail::packed_arg_bits; + unsigned int mask = (1 << detail::packed_arg_bits) - 1; + return static_cast<detail::type>((desc_ >> shift) & mask); + } + + basic_format_args(unsigned long long desc, + const detail::value<Context>* values) + : desc_(desc), values_(values) {} + basic_format_args(unsigned long long desc, const format_arg* args) + : desc_(desc), args_(args) {} + + public: + basic_format_args() : desc_(0) {} + + /** + \rst + Constructs a `basic_format_args` object from `~fmt::format_arg_store`. + \endrst + */ + template <typename... Args> + FMT_INLINE basic_format_args(const format_arg_store<Context, Args...>& store) + : basic_format_args(store.desc, store.data_.args()) {} + + /** + \rst + Constructs a `basic_format_args` object from + `~fmt::dynamic_format_arg_store`. + \endrst + */ + FMT_INLINE basic_format_args(const dynamic_format_arg_store<Context>& store) + : basic_format_args(store.get_types(), store.data()) {} + + /** + \rst + Constructs a `basic_format_args` object from a dynamic set of arguments. + \endrst + */ + basic_format_args(const format_arg* args, int count) + : basic_format_args(detail::is_unpacked_bit | detail::to_unsigned(count), + args) {} + + /** Returns the argument with the specified id. */ + format_arg get(int id) const { + format_arg arg; + if (!is_packed()) { + if (id < max_size()) arg = args_[id]; + return arg; + } + if (id >= detail::max_packed_args) return arg; + arg.type_ = type(id); + if (arg.type_ == detail::type::none_type) return arg; + arg.value_ = values_[id]; + return arg; + } + + template <typename Char> format_arg get(basic_string_view<Char> name) const { + int id = get_id(name); + return id >= 0 ? get(id) : format_arg(); + } + + template <typename Char> int get_id(basic_string_view<Char> name) const { + if (!has_named_args()) return -1; + const auto& named_args = + (is_packed() ? values_[-1] : args_[-1].value_).named_args; + for (size_t i = 0; i < named_args.size; ++i) { + if (named_args.data[i].name == name) return named_args.data[i].id; + } + return -1; + } + + int max_size() const { + unsigned long long max_packed = detail::max_packed_args; + return static_cast<int>(is_packed() ? max_packed + : desc_ & ~detail::is_unpacked_bit); + } +}; + +#ifdef FMT_ARM_ABI_COMPATIBILITY +/** An alias to ``basic_format_args<format_context>``. */ +// Separate types would result in shorter symbols but break ABI compatibility +// between clang and gcc on ARM (#1919). +using format_args = basic_format_args<format_context>; +using wformat_args = basic_format_args<wformat_context>; +#else +// DEPRECATED! These are kept for ABI compatibility. +// It is a separate type rather than an alias to make symbols readable. +struct format_args : basic_format_args<format_context> { + template <typename... Args> + FMT_INLINE format_args(const Args&... args) : basic_format_args(args...) {} +}; +struct wformat_args : basic_format_args<wformat_context> { + using basic_format_args::basic_format_args; +}; +#endif + +namespace detail { + +template <typename Char, FMT_ENABLE_IF(!std::is_same<Char, char>::value)> +std::basic_string<Char> vformat( + basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args); + +FMT_API std::string vformat(string_view format_str, format_args args); + +template <typename Char> +void vformat_to( + buffer<Char>& buf, basic_string_view<Char> format_str, + basic_format_args<FMT_BUFFER_CONTEXT(type_identity_t<Char>)> args, + detail::locale_ref loc = {}); + +template <typename Char, typename Args, + FMT_ENABLE_IF(!std::is_same<Char, char>::value)> +inline void vprint_mojibake(std::FILE*, basic_string_view<Char>, const Args&) {} + +FMT_API void vprint_mojibake(std::FILE*, string_view, format_args); +#ifndef _WIN32 +inline void vprint_mojibake(std::FILE*, string_view, format_args) {} +#endif +} // namespace detail + +/** Formats a string and writes the output to ``out``. */ +// GCC 8 and earlier cannot handle std::back_insert_iterator<Container> with +// vformat_to<ArgFormatter>(...) overload, so SFINAE on iterator type instead. +template <typename OutputIt, typename S, typename Char = char_t<S>, + bool enable = detail::is_output_iterator<OutputIt, Char>::value> +auto vformat_to(OutputIt out, const S& format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) + -> typename std::enable_if<enable, OutputIt>::type { + decltype(detail::get_buffer<Char>(out)) buf(detail::get_buffer_init(out)); + detail::vformat_to(buf, to_string_view(format_str), args); + return detail::get_iterator(buf); +} + +/** + \rst + Formats arguments, writes the result to the output iterator ``out`` and returns + the iterator past the end of the output range. + + **Example**:: + + std::vector<char> out; + fmt::format_to(std::back_inserter(out), "{}", 42); + \endrst + */ +// We cannot use FMT_ENABLE_IF because of a bug in gcc 8.3. +template <typename OutputIt, typename S, typename... Args, + bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value> +inline auto format_to(OutputIt out, const S& format_str, Args&&... args) -> + typename std::enable_if<enable, OutputIt>::type { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return vformat_to(out, to_string_view(format_str), vargs); +} + +template <typename OutputIt> struct format_to_n_result { + /** Iterator past the end of the output range. */ + OutputIt out; + /** Total (not truncated) output size. */ + size_t size; +}; + +template <typename OutputIt, typename Char, typename... Args, + FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value)> +inline format_to_n_result<OutputIt> vformat_to_n( + OutputIt out, size_t n, basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + detail::iterator_buffer<OutputIt, Char, detail::fixed_buffer_traits> buf(out, + n); + detail::vformat_to(buf, format_str, args); + return {buf.out(), buf.count()}; +} + +/** + \rst + Formats arguments, writes up to ``n`` characters of the result to the output + iterator ``out`` and returns the total output size and the iterator past the + end of the output range. + \endrst + */ +template <typename OutputIt, typename S, typename... Args, + bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value> +inline auto format_to_n(OutputIt out, size_t n, const S& format_str, + const Args&... args) -> + typename std::enable_if<enable, format_to_n_result<OutputIt>>::type { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return vformat_to_n(out, n, to_string_view(format_str), vargs); +} + +/** + Returns the number of characters in the output of + ``format(format_str, args...)``. + */ +template <typename... Args> +inline size_t formatted_size(string_view format_str, Args&&... args) { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + detail::counting_buffer<> buf; + detail::vformat_to(buf, format_str, vargs); + return buf.count(); +} + +template <typename S, typename Char = char_t<S>> +FMT_INLINE std::basic_string<Char> vformat( + const S& format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + return detail::vformat(to_string_view(format_str), args); +} + +/** + \rst + Formats arguments and returns the result as a string. + + **Example**:: + + #include <fmt/core.h> + std::string message = fmt::format("The answer is {}", 42); + \endrst +*/ +// Pass char_t as a default template parameter instead of using +// std::basic_string<char_t<S>> to reduce the symbol size. +template <typename S, typename... Args, typename Char = char_t<S>> +FMT_INLINE std::basic_string<Char> format(const S& format_str, Args&&... args) { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return detail::vformat(to_string_view(format_str), vargs); +} + +FMT_API void vprint(string_view, format_args); +FMT_API void vprint(std::FILE*, string_view, format_args); + +/** + \rst + Formats ``args`` according to specifications in ``format_str`` and writes the + output to the file ``f``. Strings are assumed to be Unicode-encoded unless the + ``FMT_UNICODE`` macro is set to 0. + + **Example**:: + + fmt::print(stderr, "Don't {}!", "panic"); + \endrst + */ +template <typename S, typename... Args, typename Char = char_t<S>> +inline void print(std::FILE* f, const S& format_str, Args&&... args) { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return detail::is_unicode<Char>() + ? vprint(f, to_string_view(format_str), vargs) + : detail::vprint_mojibake(f, to_string_view(format_str), vargs); +} + +/** + \rst + Formats ``args`` according to specifications in ``format_str`` and writes + the output to ``stdout``. Strings are assumed to be Unicode-encoded unless + the ``FMT_UNICODE`` macro is set to 0. + + **Example**:: + + fmt::print("Elapsed time: {0:.2f} seconds", 1.23); + \endrst + */ +template <typename S, typename... Args, typename Char = char_t<S>> +inline void print(const S& format_str, Args&&... args) { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return detail::is_unicode<Char>() + ? vprint(to_string_view(format_str), vargs) + : detail::vprint_mojibake(stdout, to_string_view(format_str), + vargs); +} +FMT_END_NAMESPACE + +#endif // FMT_CORE_H_ diff --git a/include/vtkdiy2/thirdparty/fmt/format-inl.h b/include/vtkdiy2/thirdparty/fmt/format-inl.h new file mode 100644 index 0000000000000000000000000000000000000000..8f2fe7354a9cef2ee3cf3cbdd10a5678c250a973 --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/format-inl.h @@ -0,0 +1,2801 @@ +// Formatting library for C++ - implementation +// +// Copyright (c) 2012 - 2016, Victor Zverovich +// All rights reserved. +// +// For the license information refer to format.h. + +#ifndef FMT_FORMAT_INL_H_ +#define FMT_FORMAT_INL_H_ + +#include <cassert> +#include <cctype> +#include <climits> +#include <cmath> +#include <cstdarg> +#include <cstring> // std::memmove +#include <cwchar> +#include <exception> + +#ifndef FMT_STATIC_THOUSANDS_SEPARATOR +# include <locale> +#endif + +#ifdef _WIN32 +# include <io.h> // _isatty +#endif + +#include "format.h" + +// Dummy implementations of strerror_r and strerror_s called if corresponding +// system functions are not available. +inline fmt::detail::null<> strerror_r(int, char*, ...) { return {}; } +inline fmt::detail::null<> strerror_s(char*, size_t, ...) { return {}; } + +FMT_BEGIN_NAMESPACE +namespace detail { + +FMT_FUNC void assert_fail(const char* file, int line, const char* message) { + // Use unchecked std::fprintf to avoid triggering another assertion when + // writing to stderr fails + std::fprintf(stderr, "%s:%d: assertion failed: %s", file, line, message); + // Chosen instead of std::abort to satisfy Clang in CUDA mode during device + // code pass. + std::terminate(); +} + +#ifndef _MSC_VER +# define FMT_SNPRINTF snprintf +#else // _MSC_VER +inline int fmt_snprintf(char* buffer, size_t size, const char* format, ...) { + va_list args; + va_start(args, format); + int result = vsnprintf_s(buffer, size, _TRUNCATE, format, args); + va_end(args); + return result; +} +# define FMT_SNPRINTF fmt_snprintf +#endif // _MSC_VER + +// A portable thread-safe version of strerror. +// Sets buffer to point to a string describing the error code. +// This can be either a pointer to a string stored in buffer, +// or a pointer to some static immutable string. +// Returns one of the following values: +// 0 - success +// ERANGE - buffer is not large enough to store the error message +// other - failure +// Buffer should be at least of size 1. +inline int safe_strerror(int error_code, char*& buffer, + size_t buffer_size) FMT_NOEXCEPT { + FMT_ASSERT(buffer != nullptr && buffer_size != 0, "invalid buffer"); + + class dispatcher { + private: + int error_code_; + char*& buffer_; + size_t buffer_size_; + + // A noop assignment operator to avoid bogus warnings. + void operator=(const dispatcher&) {} + + // Handle the result of XSI-compliant version of strerror_r. + int handle(int result) { + // glibc versions before 2.13 return result in errno. + return result == -1 ? errno : result; + } + + // Handle the result of GNU-specific version of strerror_r. + FMT_MAYBE_UNUSED + int handle(char* message) { + // If the buffer is full then the message is probably truncated. + if (message == buffer_ && strlen(buffer_) == buffer_size_ - 1) + return ERANGE; + buffer_ = message; + return 0; + } + + // Handle the case when strerror_r is not available. + FMT_MAYBE_UNUSED + int handle(detail::null<>) { + return fallback(strerror_s(buffer_, buffer_size_, error_code_)); + } + + // Fallback to strerror_s when strerror_r is not available. + FMT_MAYBE_UNUSED + int fallback(int result) { + // If the buffer is full then the message is probably truncated. + return result == 0 && strlen(buffer_) == buffer_size_ - 1 ? ERANGE + : result; + } + +#if !FMT_MSC_VER + // Fallback to strerror if strerror_r and strerror_s are not available. + int fallback(detail::null<>) { + errno = 0; + buffer_ = strerror(error_code_); + return errno; + } +#endif + + public: + dispatcher(int err_code, char*& buf, size_t buf_size) + : error_code_(err_code), buffer_(buf), buffer_size_(buf_size) {} + + int run() { return handle(strerror_r(error_code_, buffer_, buffer_size_)); } + }; + return dispatcher(error_code, buffer, buffer_size).run(); +} + +FMT_FUNC void format_error_code(detail::buffer<char>& out, int error_code, + string_view message) FMT_NOEXCEPT { + // Report error code making sure that the output fits into + // inline_buffer_size to avoid dynamic memory allocation and potential + // bad_alloc. + out.try_resize(0); + static const char SEP[] = ": "; + static const char ERROR_STR[] = "error "; + // Subtract 2 to account for terminating null characters in SEP and ERROR_STR. + size_t error_code_size = sizeof(SEP) + sizeof(ERROR_STR) - 2; + auto abs_value = static_cast<uint32_or_64_or_128_t<int>>(error_code); + if (detail::is_negative(error_code)) { + abs_value = 0 - abs_value; + ++error_code_size; + } + error_code_size += detail::to_unsigned(detail::count_digits(abs_value)); + auto it = buffer_appender<char>(out); + if (message.size() <= inline_buffer_size - error_code_size) + format_to(it, "{}{}", message, SEP); + format_to(it, "{}{}", ERROR_STR, error_code); + assert(out.size() <= inline_buffer_size); +} + +FMT_FUNC void report_error(format_func func, int error_code, + string_view message) FMT_NOEXCEPT { + memory_buffer full_message; + func(full_message, error_code, message); + // Don't use fwrite_fully because the latter may throw. + (void)std::fwrite(full_message.data(), full_message.size(), 1, stderr); + std::fputc('\n', stderr); +} + +// A wrapper around fwrite that throws on error. +inline void fwrite_fully(const void* ptr, size_t size, size_t count, + FILE* stream) { + size_t written = std::fwrite(ptr, size, count, stream); + if (written < count) FMT_THROW(system_error(errno, "cannot write to file")); +} +} // namespace detail + +#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR) +namespace detail { + +template <typename Locale> +locale_ref::locale_ref(const Locale& loc) : locale_(&loc) { + static_assert(std::is_same<Locale, std::locale>::value, ""); +} + +template <typename Locale> Locale locale_ref::get() const { + static_assert(std::is_same<Locale, std::locale>::value, ""); + return locale_ ? *static_cast<const std::locale*>(locale_) : std::locale(); +} + +template <typename Char> FMT_FUNC std::string grouping_impl(locale_ref loc) { + return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()).grouping(); +} +template <typename Char> FMT_FUNC Char thousands_sep_impl(locale_ref loc) { + return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()) + .thousands_sep(); +} +template <typename Char> FMT_FUNC Char decimal_point_impl(locale_ref loc) { + return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()) + .decimal_point(); +} +} // namespace detail +#else +template <typename Char> +FMT_FUNC std::string detail::grouping_impl(locale_ref) { + return "\03"; +} +template <typename Char> FMT_FUNC Char detail::thousands_sep_impl(locale_ref) { + return FMT_STATIC_THOUSANDS_SEPARATOR; +} +template <typename Char> FMT_FUNC Char detail::decimal_point_impl(locale_ref) { + return '.'; +} +#endif + +FMT_API FMT_FUNC format_error::~format_error() FMT_NOEXCEPT = default; +FMT_API FMT_FUNC system_error::~system_error() FMT_NOEXCEPT = default; + +FMT_FUNC void system_error::init(int err_code, string_view format_str, + format_args args) { + error_code_ = err_code; + memory_buffer buffer; + format_system_error(buffer, err_code, vformat(format_str, args)); + std::runtime_error& base = *this; + base = std::runtime_error(to_string(buffer)); +} + +namespace detail { + +template <> FMT_FUNC int count_digits<4>(detail::fallback_uintptr n) { + // fallback_uintptr is always stored in little endian. + int i = static_cast<int>(sizeof(void*)) - 1; + while (i > 0 && n.value[i] == 0) --i; + auto char_digits = std::numeric_limits<unsigned char>::digits / 4; + return i >= 0 ? i * char_digits + count_digits<4, unsigned>(n.value[i]) : 1; +} + +template <typename T> +const typename basic_data<T>::digit_pair basic_data<T>::digits[] = { + {'0', '0'}, {'0', '1'}, {'0', '2'}, {'0', '3'}, {'0', '4'}, {'0', '5'}, + {'0', '6'}, {'0', '7'}, {'0', '8'}, {'0', '9'}, {'1', '0'}, {'1', '1'}, + {'1', '2'}, {'1', '3'}, {'1', '4'}, {'1', '5'}, {'1', '6'}, {'1', '7'}, + {'1', '8'}, {'1', '9'}, {'2', '0'}, {'2', '1'}, {'2', '2'}, {'2', '3'}, + {'2', '4'}, {'2', '5'}, {'2', '6'}, {'2', '7'}, {'2', '8'}, {'2', '9'}, + {'3', '0'}, {'3', '1'}, {'3', '2'}, {'3', '3'}, {'3', '4'}, {'3', '5'}, + {'3', '6'}, {'3', '7'}, {'3', '8'}, {'3', '9'}, {'4', '0'}, {'4', '1'}, + {'4', '2'}, {'4', '3'}, {'4', '4'}, {'4', '5'}, {'4', '6'}, {'4', '7'}, + {'4', '8'}, {'4', '9'}, {'5', '0'}, {'5', '1'}, {'5', '2'}, {'5', '3'}, + {'5', '4'}, {'5', '5'}, {'5', '6'}, {'5', '7'}, {'5', '8'}, {'5', '9'}, + {'6', '0'}, {'6', '1'}, {'6', '2'}, {'6', '3'}, {'6', '4'}, {'6', '5'}, + {'6', '6'}, {'6', '7'}, {'6', '8'}, {'6', '9'}, {'7', '0'}, {'7', '1'}, + {'7', '2'}, {'7', '3'}, {'7', '4'}, {'7', '5'}, {'7', '6'}, {'7', '7'}, + {'7', '8'}, {'7', '9'}, {'8', '0'}, {'8', '1'}, {'8', '2'}, {'8', '3'}, + {'8', '4'}, {'8', '5'}, {'8', '6'}, {'8', '7'}, {'8', '8'}, {'8', '9'}, + {'9', '0'}, {'9', '1'}, {'9', '2'}, {'9', '3'}, {'9', '4'}, {'9', '5'}, + {'9', '6'}, {'9', '7'}, {'9', '8'}, {'9', '9'}}; + +template <typename T> +const char basic_data<T>::hex_digits[] = "0123456789abcdef"; + +#define FMT_POWERS_OF_10(factor) \ + factor * 10, (factor)*100, (factor)*1000, (factor)*10000, (factor)*100000, \ + (factor)*1000000, (factor)*10000000, (factor)*100000000, \ + (factor)*1000000000 + +template <typename T> +const uint64_t basic_data<T>::powers_of_10_64[] = { + 1, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL), + 10000000000000000000ULL}; + +template <typename T> +const uint32_t basic_data<T>::zero_or_powers_of_10_32[] = {0, + FMT_POWERS_OF_10(1)}; +template <typename T> +const uint64_t basic_data<T>::zero_or_powers_of_10_64[] = { + 0, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL), + 10000000000000000000ULL}; + +template <typename T> +const uint32_t basic_data<T>::zero_or_powers_of_10_32_new[] = { + 0, 0, FMT_POWERS_OF_10(1)}; + +template <typename T> +const uint64_t basic_data<T>::zero_or_powers_of_10_64_new[] = { + 0, 0, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL), + 10000000000000000000ULL}; + +// Normalized 64-bit significands of pow(10, k), for k = -348, -340, ..., 340. +// These are generated by support/compute-powers.py. +template <typename T> +const uint64_t basic_data<T>::grisu_pow10_significands[] = { + 0xfa8fd5a0081c0288, 0xbaaee17fa23ebf76, 0x8b16fb203055ac76, + 0xcf42894a5dce35ea, 0x9a6bb0aa55653b2d, 0xe61acf033d1a45df, + 0xab70fe17c79ac6ca, 0xff77b1fcbebcdc4f, 0xbe5691ef416bd60c, + 0x8dd01fad907ffc3c, 0xd3515c2831559a83, 0x9d71ac8fada6c9b5, + 0xea9c227723ee8bcb, 0xaecc49914078536d, 0x823c12795db6ce57, + 0xc21094364dfb5637, 0x9096ea6f3848984f, 0xd77485cb25823ac7, + 0xa086cfcd97bf97f4, 0xef340a98172aace5, 0xb23867fb2a35b28e, + 0x84c8d4dfd2c63f3b, 0xc5dd44271ad3cdba, 0x936b9fcebb25c996, + 0xdbac6c247d62a584, 0xa3ab66580d5fdaf6, 0xf3e2f893dec3f126, + 0xb5b5ada8aaff80b8, 0x87625f056c7c4a8b, 0xc9bcff6034c13053, + 0x964e858c91ba2655, 0xdff9772470297ebd, 0xa6dfbd9fb8e5b88f, + 0xf8a95fcf88747d94, 0xb94470938fa89bcf, 0x8a08f0f8bf0f156b, + 0xcdb02555653131b6, 0x993fe2c6d07b7fac, 0xe45c10c42a2b3b06, + 0xaa242499697392d3, 0xfd87b5f28300ca0e, 0xbce5086492111aeb, + 0x8cbccc096f5088cc, 0xd1b71758e219652c, 0x9c40000000000000, + 0xe8d4a51000000000, 0xad78ebc5ac620000, 0x813f3978f8940984, + 0xc097ce7bc90715b3, 0x8f7e32ce7bea5c70, 0xd5d238a4abe98068, + 0x9f4f2726179a2245, 0xed63a231d4c4fb27, 0xb0de65388cc8ada8, + 0x83c7088e1aab65db, 0xc45d1df942711d9a, 0x924d692ca61be758, + 0xda01ee641a708dea, 0xa26da3999aef774a, 0xf209787bb47d6b85, + 0xb454e4a179dd1877, 0x865b86925b9bc5c2, 0xc83553c5c8965d3d, + 0x952ab45cfa97a0b3, 0xde469fbd99a05fe3, 0xa59bc234db398c25, + 0xf6c69a72a3989f5c, 0xb7dcbf5354e9bece, 0x88fcf317f22241e2, + 0xcc20ce9bd35c78a5, 0x98165af37b2153df, 0xe2a0b5dc971f303a, + 0xa8d9d1535ce3b396, 0xfb9b7cd9a4a7443c, 0xbb764c4ca7a44410, + 0x8bab8eefb6409c1a, 0xd01fef10a657842c, 0x9b10a4e5e9913129, + 0xe7109bfba19c0c9d, 0xac2820d9623bf429, 0x80444b5e7aa7cf85, + 0xbf21e44003acdd2d, 0x8e679c2f5e44ff8f, 0xd433179d9c8cb841, + 0x9e19db92b4e31ba9, 0xeb96bf6ebadf77d9, 0xaf87023b9bf0ee6b, +}; + +// Binary exponents of pow(10, k), for k = -348, -340, ..., 340, corresponding +// to significands above. +template <typename T> +const int16_t basic_data<T>::grisu_pow10_exponents[] = { + -1220, -1193, -1166, -1140, -1113, -1087, -1060, -1034, -1007, -980, -954, + -927, -901, -874, -847, -821, -794, -768, -741, -715, -688, -661, + -635, -608, -582, -555, -529, -502, -475, -449, -422, -396, -369, + -343, -316, -289, -263, -236, -210, -183, -157, -130, -103, -77, + -50, -24, 3, 30, 56, 83, 109, 136, 162, 189, 216, + 242, 269, 295, 322, 348, 375, 402, 428, 455, 481, 508, + 534, 561, 588, 614, 641, 667, 694, 720, 747, 774, 800, + 827, 853, 880, 907, 933, 960, 986, 1013, 1039, 1066}; + +template <typename T> +const divtest_table_entry<uint32_t> basic_data<T>::divtest_table_for_pow5_32[] = + {{0x00000001, 0xffffffff}, {0xcccccccd, 0x33333333}, + {0xc28f5c29, 0x0a3d70a3}, {0x26e978d5, 0x020c49ba}, + {0x3afb7e91, 0x0068db8b}, {0x0bcbe61d, 0x0014f8b5}, + {0x68c26139, 0x000431bd}, {0xae8d46a5, 0x0000d6bf}, + {0x22e90e21, 0x00002af3}, {0x3a2e9c6d, 0x00000897}, + {0x3ed61f49, 0x000001b7}}; + +template <typename T> +const divtest_table_entry<uint64_t> basic_data<T>::divtest_table_for_pow5_64[] = + {{0x0000000000000001, 0xffffffffffffffff}, + {0xcccccccccccccccd, 0x3333333333333333}, + {0x8f5c28f5c28f5c29, 0x0a3d70a3d70a3d70}, + {0x1cac083126e978d5, 0x020c49ba5e353f7c}, + {0xd288ce703afb7e91, 0x0068db8bac710cb2}, + {0x5d4e8fb00bcbe61d, 0x0014f8b588e368f0}, + {0x790fb65668c26139, 0x000431bde82d7b63}, + {0xe5032477ae8d46a5, 0x0000d6bf94d5e57a}, + {0xc767074b22e90e21, 0x00002af31dc46118}, + {0x8e47ce423a2e9c6d, 0x0000089705f4136b}, + {0x4fa7f60d3ed61f49, 0x000001b7cdfd9d7b}, + {0x0fee64690c913975, 0x00000057f5ff85e5}, + {0x3662e0e1cf503eb1, 0x000000119799812d}, + {0xa47a2cf9f6433fbd, 0x0000000384b84d09}, + {0x54186f653140a659, 0x00000000b424dc35}, + {0x7738164770402145, 0x0000000024075f3d}, + {0xe4a4d1417cd9a041, 0x000000000734aca5}, + {0xc75429d9e5c5200d, 0x000000000170ef54}, + {0xc1773b91fac10669, 0x000000000049c977}, + {0x26b172506559ce15, 0x00000000000ec1e4}, + {0xd489e3a9addec2d1, 0x000000000002f394}, + {0x90e860bb892c8d5d, 0x000000000000971d}, + {0x502e79bf1b6f4f79, 0x0000000000001e39}, + {0xdcd618596be30fe5, 0x000000000000060b}}; + +template <typename T> +const uint64_t basic_data<T>::dragonbox_pow10_significands_64[] = { + 0x81ceb32c4b43fcf5, 0xa2425ff75e14fc32, 0xcad2f7f5359a3b3f, + 0xfd87b5f28300ca0e, 0x9e74d1b791e07e49, 0xc612062576589ddb, + 0xf79687aed3eec552, 0x9abe14cd44753b53, 0xc16d9a0095928a28, + 0xf1c90080baf72cb2, 0x971da05074da7bef, 0xbce5086492111aeb, + 0xec1e4a7db69561a6, 0x9392ee8e921d5d08, 0xb877aa3236a4b44a, + 0xe69594bec44de15c, 0x901d7cf73ab0acda, 0xb424dc35095cd810, + 0xe12e13424bb40e14, 0x8cbccc096f5088cc, 0xafebff0bcb24aaff, + 0xdbe6fecebdedd5bf, 0x89705f4136b4a598, 0xabcc77118461cefd, + 0xd6bf94d5e57a42bd, 0x8637bd05af6c69b6, 0xa7c5ac471b478424, + 0xd1b71758e219652c, 0x83126e978d4fdf3c, 0xa3d70a3d70a3d70b, + 0xcccccccccccccccd, 0x8000000000000000, 0xa000000000000000, + 0xc800000000000000, 0xfa00000000000000, 0x9c40000000000000, + 0xc350000000000000, 0xf424000000000000, 0x9896800000000000, + 0xbebc200000000000, 0xee6b280000000000, 0x9502f90000000000, + 0xba43b74000000000, 0xe8d4a51000000000, 0x9184e72a00000000, + 0xb5e620f480000000, 0xe35fa931a0000000, 0x8e1bc9bf04000000, + 0xb1a2bc2ec5000000, 0xde0b6b3a76400000, 0x8ac7230489e80000, + 0xad78ebc5ac620000, 0xd8d726b7177a8000, 0x878678326eac9000, + 0xa968163f0a57b400, 0xd3c21bcecceda100, 0x84595161401484a0, + 0xa56fa5b99019a5c8, 0xcecb8f27f4200f3a, 0x813f3978f8940984, + 0xa18f07d736b90be5, 0xc9f2c9cd04674ede, 0xfc6f7c4045812296, + 0x9dc5ada82b70b59d, 0xc5371912364ce305, 0xf684df56c3e01bc6, + 0x9a130b963a6c115c, 0xc097ce7bc90715b3, 0xf0bdc21abb48db20, + 0x96769950b50d88f4, 0xbc143fa4e250eb31, 0xeb194f8e1ae525fd, + 0x92efd1b8d0cf37be, 0xb7abc627050305ad, 0xe596b7b0c643c719, + 0x8f7e32ce7bea5c6f, 0xb35dbf821ae4f38b, 0xe0352f62a19e306e}; + +template <typename T> +const uint128_wrapper basic_data<T>::dragonbox_pow10_significands_128[] = { +#if FMT_USE_FULL_CACHE_DRAGONBOX + {0xff77b1fcbebcdc4f, 0x25e8e89c13bb0f7b}, + {0x9faacf3df73609b1, 0x77b191618c54e9ad}, + {0xc795830d75038c1d, 0xd59df5b9ef6a2418}, + {0xf97ae3d0d2446f25, 0x4b0573286b44ad1e}, + {0x9becce62836ac577, 0x4ee367f9430aec33}, + {0xc2e801fb244576d5, 0x229c41f793cda740}, + {0xf3a20279ed56d48a, 0x6b43527578c11110}, + {0x9845418c345644d6, 0x830a13896b78aaaa}, + {0xbe5691ef416bd60c, 0x23cc986bc656d554}, + {0xedec366b11c6cb8f, 0x2cbfbe86b7ec8aa9}, + {0x94b3a202eb1c3f39, 0x7bf7d71432f3d6aa}, + {0xb9e08a83a5e34f07, 0xdaf5ccd93fb0cc54}, + {0xe858ad248f5c22c9, 0xd1b3400f8f9cff69}, + {0x91376c36d99995be, 0x23100809b9c21fa2}, + {0xb58547448ffffb2d, 0xabd40a0c2832a78b}, + {0xe2e69915b3fff9f9, 0x16c90c8f323f516d}, + {0x8dd01fad907ffc3b, 0xae3da7d97f6792e4}, + {0xb1442798f49ffb4a, 0x99cd11cfdf41779d}, + {0xdd95317f31c7fa1d, 0x40405643d711d584}, + {0x8a7d3eef7f1cfc52, 0x482835ea666b2573}, + {0xad1c8eab5ee43b66, 0xda3243650005eed0}, + {0xd863b256369d4a40, 0x90bed43e40076a83}, + {0x873e4f75e2224e68, 0x5a7744a6e804a292}, + {0xa90de3535aaae202, 0x711515d0a205cb37}, + {0xd3515c2831559a83, 0x0d5a5b44ca873e04}, + {0x8412d9991ed58091, 0xe858790afe9486c3}, + {0xa5178fff668ae0b6, 0x626e974dbe39a873}, + {0xce5d73ff402d98e3, 0xfb0a3d212dc81290}, + {0x80fa687f881c7f8e, 0x7ce66634bc9d0b9a}, + {0xa139029f6a239f72, 0x1c1fffc1ebc44e81}, + {0xc987434744ac874e, 0xa327ffb266b56221}, + {0xfbe9141915d7a922, 0x4bf1ff9f0062baa9}, + {0x9d71ac8fada6c9b5, 0x6f773fc3603db4aa}, + {0xc4ce17b399107c22, 0xcb550fb4384d21d4}, + {0xf6019da07f549b2b, 0x7e2a53a146606a49}, + {0x99c102844f94e0fb, 0x2eda7444cbfc426e}, + {0xc0314325637a1939, 0xfa911155fefb5309}, + {0xf03d93eebc589f88, 0x793555ab7eba27cb}, + {0x96267c7535b763b5, 0x4bc1558b2f3458df}, + {0xbbb01b9283253ca2, 0x9eb1aaedfb016f17}, + {0xea9c227723ee8bcb, 0x465e15a979c1cadd}, + {0x92a1958a7675175f, 0x0bfacd89ec191eca}, + {0xb749faed14125d36, 0xcef980ec671f667c}, + {0xe51c79a85916f484, 0x82b7e12780e7401b}, + {0x8f31cc0937ae58d2, 0xd1b2ecb8b0908811}, + {0xb2fe3f0b8599ef07, 0x861fa7e6dcb4aa16}, + {0xdfbdcece67006ac9, 0x67a791e093e1d49b}, + {0x8bd6a141006042bd, 0xe0c8bb2c5c6d24e1}, + {0xaecc49914078536d, 0x58fae9f773886e19}, + {0xda7f5bf590966848, 0xaf39a475506a899f}, + {0x888f99797a5e012d, 0x6d8406c952429604}, + {0xaab37fd7d8f58178, 0xc8e5087ba6d33b84}, + {0xd5605fcdcf32e1d6, 0xfb1e4a9a90880a65}, + {0x855c3be0a17fcd26, 0x5cf2eea09a550680}, + {0xa6b34ad8c9dfc06f, 0xf42faa48c0ea481f}, + {0xd0601d8efc57b08b, 0xf13b94daf124da27}, + {0x823c12795db6ce57, 0x76c53d08d6b70859}, + {0xa2cb1717b52481ed, 0x54768c4b0c64ca6f}, + {0xcb7ddcdda26da268, 0xa9942f5dcf7dfd0a}, + {0xfe5d54150b090b02, 0xd3f93b35435d7c4d}, + {0x9efa548d26e5a6e1, 0xc47bc5014a1a6db0}, + {0xc6b8e9b0709f109a, 0x359ab6419ca1091c}, + {0xf867241c8cc6d4c0, 0xc30163d203c94b63}, + {0x9b407691d7fc44f8, 0x79e0de63425dcf1e}, + {0xc21094364dfb5636, 0x985915fc12f542e5}, + {0xf294b943e17a2bc4, 0x3e6f5b7b17b2939e}, + {0x979cf3ca6cec5b5a, 0xa705992ceecf9c43}, + {0xbd8430bd08277231, 0x50c6ff782a838354}, + {0xece53cec4a314ebd, 0xa4f8bf5635246429}, + {0x940f4613ae5ed136, 0x871b7795e136be9a}, + {0xb913179899f68584, 0x28e2557b59846e40}, + {0xe757dd7ec07426e5, 0x331aeada2fe589d0}, + {0x9096ea6f3848984f, 0x3ff0d2c85def7622}, + {0xb4bca50b065abe63, 0x0fed077a756b53aa}, + {0xe1ebce4dc7f16dfb, 0xd3e8495912c62895}, + {0x8d3360f09cf6e4bd, 0x64712dd7abbbd95d}, + {0xb080392cc4349dec, 0xbd8d794d96aacfb4}, + {0xdca04777f541c567, 0xecf0d7a0fc5583a1}, + {0x89e42caaf9491b60, 0xf41686c49db57245}, + {0xac5d37d5b79b6239, 0x311c2875c522ced6}, + {0xd77485cb25823ac7, 0x7d633293366b828c}, + {0x86a8d39ef77164bc, 0xae5dff9c02033198}, + {0xa8530886b54dbdeb, 0xd9f57f830283fdfd}, + {0xd267caa862a12d66, 0xd072df63c324fd7c}, + {0x8380dea93da4bc60, 0x4247cb9e59f71e6e}, + {0xa46116538d0deb78, 0x52d9be85f074e609}, + {0xcd795be870516656, 0x67902e276c921f8c}, + {0x806bd9714632dff6, 0x00ba1cd8a3db53b7}, + {0xa086cfcd97bf97f3, 0x80e8a40eccd228a5}, + {0xc8a883c0fdaf7df0, 0x6122cd128006b2ce}, + {0xfad2a4b13d1b5d6c, 0x796b805720085f82}, + {0x9cc3a6eec6311a63, 0xcbe3303674053bb1}, + {0xc3f490aa77bd60fc, 0xbedbfc4411068a9d}, + {0xf4f1b4d515acb93b, 0xee92fb5515482d45}, + {0x991711052d8bf3c5, 0x751bdd152d4d1c4b}, + {0xbf5cd54678eef0b6, 0xd262d45a78a0635e}, + {0xef340a98172aace4, 0x86fb897116c87c35}, + {0x9580869f0e7aac0e, 0xd45d35e6ae3d4da1}, + {0xbae0a846d2195712, 0x8974836059cca10a}, + {0xe998d258869facd7, 0x2bd1a438703fc94c}, + {0x91ff83775423cc06, 0x7b6306a34627ddd0}, + {0xb67f6455292cbf08, 0x1a3bc84c17b1d543}, + {0xe41f3d6a7377eeca, 0x20caba5f1d9e4a94}, + {0x8e938662882af53e, 0x547eb47b7282ee9d}, + {0xb23867fb2a35b28d, 0xe99e619a4f23aa44}, + {0xdec681f9f4c31f31, 0x6405fa00e2ec94d5}, + {0x8b3c113c38f9f37e, 0xde83bc408dd3dd05}, + {0xae0b158b4738705e, 0x9624ab50b148d446}, + {0xd98ddaee19068c76, 0x3badd624dd9b0958}, + {0x87f8a8d4cfa417c9, 0xe54ca5d70a80e5d7}, + {0xa9f6d30a038d1dbc, 0x5e9fcf4ccd211f4d}, + {0xd47487cc8470652b, 0x7647c32000696720}, + {0x84c8d4dfd2c63f3b, 0x29ecd9f40041e074}, + {0xa5fb0a17c777cf09, 0xf468107100525891}, + {0xcf79cc9db955c2cc, 0x7182148d4066eeb5}, + {0x81ac1fe293d599bf, 0xc6f14cd848405531}, + {0xa21727db38cb002f, 0xb8ada00e5a506a7d}, + {0xca9cf1d206fdc03b, 0xa6d90811f0e4851d}, + {0xfd442e4688bd304a, 0x908f4a166d1da664}, + {0x9e4a9cec15763e2e, 0x9a598e4e043287ff}, + {0xc5dd44271ad3cdba, 0x40eff1e1853f29fe}, + {0xf7549530e188c128, 0xd12bee59e68ef47d}, + {0x9a94dd3e8cf578b9, 0x82bb74f8301958cf}, + {0xc13a148e3032d6e7, 0xe36a52363c1faf02}, + {0xf18899b1bc3f8ca1, 0xdc44e6c3cb279ac2}, + {0x96f5600f15a7b7e5, 0x29ab103a5ef8c0ba}, + {0xbcb2b812db11a5de, 0x7415d448f6b6f0e8}, + {0xebdf661791d60f56, 0x111b495b3464ad22}, + {0x936b9fcebb25c995, 0xcab10dd900beec35}, + {0xb84687c269ef3bfb, 0x3d5d514f40eea743}, + {0xe65829b3046b0afa, 0x0cb4a5a3112a5113}, + {0x8ff71a0fe2c2e6dc, 0x47f0e785eaba72ac}, + {0xb3f4e093db73a093, 0x59ed216765690f57}, + {0xe0f218b8d25088b8, 0x306869c13ec3532d}, + {0x8c974f7383725573, 0x1e414218c73a13fc}, + {0xafbd2350644eeacf, 0xe5d1929ef90898fb}, + {0xdbac6c247d62a583, 0xdf45f746b74abf3a}, + {0x894bc396ce5da772, 0x6b8bba8c328eb784}, + {0xab9eb47c81f5114f, 0x066ea92f3f326565}, + {0xd686619ba27255a2, 0xc80a537b0efefebe}, + {0x8613fd0145877585, 0xbd06742ce95f5f37}, + {0xa798fc4196e952e7, 0x2c48113823b73705}, + {0xd17f3b51fca3a7a0, 0xf75a15862ca504c6}, + {0x82ef85133de648c4, 0x9a984d73dbe722fc}, + {0xa3ab66580d5fdaf5, 0xc13e60d0d2e0ebbb}, + {0xcc963fee10b7d1b3, 0x318df905079926a9}, + {0xffbbcfe994e5c61f, 0xfdf17746497f7053}, + {0x9fd561f1fd0f9bd3, 0xfeb6ea8bedefa634}, + {0xc7caba6e7c5382c8, 0xfe64a52ee96b8fc1}, + {0xf9bd690a1b68637b, 0x3dfdce7aa3c673b1}, + {0x9c1661a651213e2d, 0x06bea10ca65c084f}, + {0xc31bfa0fe5698db8, 0x486e494fcff30a63}, + {0xf3e2f893dec3f126, 0x5a89dba3c3efccfb}, + {0x986ddb5c6b3a76b7, 0xf89629465a75e01d}, + {0xbe89523386091465, 0xf6bbb397f1135824}, + {0xee2ba6c0678b597f, 0x746aa07ded582e2d}, + {0x94db483840b717ef, 0xa8c2a44eb4571cdd}, + {0xba121a4650e4ddeb, 0x92f34d62616ce414}, + {0xe896a0d7e51e1566, 0x77b020baf9c81d18}, + {0x915e2486ef32cd60, 0x0ace1474dc1d122f}, + {0xb5b5ada8aaff80b8, 0x0d819992132456bb}, + {0xe3231912d5bf60e6, 0x10e1fff697ed6c6a}, + {0x8df5efabc5979c8f, 0xca8d3ffa1ef463c2}, + {0xb1736b96b6fd83b3, 0xbd308ff8a6b17cb3}, + {0xddd0467c64bce4a0, 0xac7cb3f6d05ddbdf}, + {0x8aa22c0dbef60ee4, 0x6bcdf07a423aa96c}, + {0xad4ab7112eb3929d, 0x86c16c98d2c953c7}, + {0xd89d64d57a607744, 0xe871c7bf077ba8b8}, + {0x87625f056c7c4a8b, 0x11471cd764ad4973}, + {0xa93af6c6c79b5d2d, 0xd598e40d3dd89bd0}, + {0xd389b47879823479, 0x4aff1d108d4ec2c4}, + {0x843610cb4bf160cb, 0xcedf722a585139bb}, + {0xa54394fe1eedb8fe, 0xc2974eb4ee658829}, + {0xce947a3da6a9273e, 0x733d226229feea33}, + {0x811ccc668829b887, 0x0806357d5a3f5260}, + {0xa163ff802a3426a8, 0xca07c2dcb0cf26f8}, + {0xc9bcff6034c13052, 0xfc89b393dd02f0b6}, + {0xfc2c3f3841f17c67, 0xbbac2078d443ace3}, + {0x9d9ba7832936edc0, 0xd54b944b84aa4c0e}, + {0xc5029163f384a931, 0x0a9e795e65d4df12}, + {0xf64335bcf065d37d, 0x4d4617b5ff4a16d6}, + {0x99ea0196163fa42e, 0x504bced1bf8e4e46}, + {0xc06481fb9bcf8d39, 0xe45ec2862f71e1d7}, + {0xf07da27a82c37088, 0x5d767327bb4e5a4d}, + {0x964e858c91ba2655, 0x3a6a07f8d510f870}, + {0xbbe226efb628afea, 0x890489f70a55368c}, + {0xeadab0aba3b2dbe5, 0x2b45ac74ccea842f}, + {0x92c8ae6b464fc96f, 0x3b0b8bc90012929e}, + {0xb77ada0617e3bbcb, 0x09ce6ebb40173745}, + {0xe55990879ddcaabd, 0xcc420a6a101d0516}, + {0x8f57fa54c2a9eab6, 0x9fa946824a12232e}, + {0xb32df8e9f3546564, 0x47939822dc96abfa}, + {0xdff9772470297ebd, 0x59787e2b93bc56f8}, + {0x8bfbea76c619ef36, 0x57eb4edb3c55b65b}, + {0xaefae51477a06b03, 0xede622920b6b23f2}, + {0xdab99e59958885c4, 0xe95fab368e45ecee}, + {0x88b402f7fd75539b, 0x11dbcb0218ebb415}, + {0xaae103b5fcd2a881, 0xd652bdc29f26a11a}, + {0xd59944a37c0752a2, 0x4be76d3346f04960}, + {0x857fcae62d8493a5, 0x6f70a4400c562ddc}, + {0xa6dfbd9fb8e5b88e, 0xcb4ccd500f6bb953}, + {0xd097ad07a71f26b2, 0x7e2000a41346a7a8}, + {0x825ecc24c873782f, 0x8ed400668c0c28c9}, + {0xa2f67f2dfa90563b, 0x728900802f0f32fb}, + {0xcbb41ef979346bca, 0x4f2b40a03ad2ffba}, + {0xfea126b7d78186bc, 0xe2f610c84987bfa9}, + {0x9f24b832e6b0f436, 0x0dd9ca7d2df4d7ca}, + {0xc6ede63fa05d3143, 0x91503d1c79720dbc}, + {0xf8a95fcf88747d94, 0x75a44c6397ce912b}, + {0x9b69dbe1b548ce7c, 0xc986afbe3ee11abb}, + {0xc24452da229b021b, 0xfbe85badce996169}, + {0xf2d56790ab41c2a2, 0xfae27299423fb9c4}, + {0x97c560ba6b0919a5, 0xdccd879fc967d41b}, + {0xbdb6b8e905cb600f, 0x5400e987bbc1c921}, + {0xed246723473e3813, 0x290123e9aab23b69}, + {0x9436c0760c86e30b, 0xf9a0b6720aaf6522}, + {0xb94470938fa89bce, 0xf808e40e8d5b3e6a}, + {0xe7958cb87392c2c2, 0xb60b1d1230b20e05}, + {0x90bd77f3483bb9b9, 0xb1c6f22b5e6f48c3}, + {0xb4ecd5f01a4aa828, 0x1e38aeb6360b1af4}, + {0xe2280b6c20dd5232, 0x25c6da63c38de1b1}, + {0x8d590723948a535f, 0x579c487e5a38ad0f}, + {0xb0af48ec79ace837, 0x2d835a9df0c6d852}, + {0xdcdb1b2798182244, 0xf8e431456cf88e66}, + {0x8a08f0f8bf0f156b, 0x1b8e9ecb641b5900}, + {0xac8b2d36eed2dac5, 0xe272467e3d222f40}, + {0xd7adf884aa879177, 0x5b0ed81dcc6abb10}, + {0x86ccbb52ea94baea, 0x98e947129fc2b4ea}, + {0xa87fea27a539e9a5, 0x3f2398d747b36225}, + {0xd29fe4b18e88640e, 0x8eec7f0d19a03aae}, + {0x83a3eeeef9153e89, 0x1953cf68300424ad}, + {0xa48ceaaab75a8e2b, 0x5fa8c3423c052dd8}, + {0xcdb02555653131b6, 0x3792f412cb06794e}, + {0x808e17555f3ebf11, 0xe2bbd88bbee40bd1}, + {0xa0b19d2ab70e6ed6, 0x5b6aceaeae9d0ec5}, + {0xc8de047564d20a8b, 0xf245825a5a445276}, + {0xfb158592be068d2e, 0xeed6e2f0f0d56713}, + {0x9ced737bb6c4183d, 0x55464dd69685606c}, + {0xc428d05aa4751e4c, 0xaa97e14c3c26b887}, + {0xf53304714d9265df, 0xd53dd99f4b3066a9}, + {0x993fe2c6d07b7fab, 0xe546a8038efe402a}, + {0xbf8fdb78849a5f96, 0xde98520472bdd034}, + {0xef73d256a5c0f77c, 0x963e66858f6d4441}, + {0x95a8637627989aad, 0xdde7001379a44aa9}, + {0xbb127c53b17ec159, 0x5560c018580d5d53}, + {0xe9d71b689dde71af, 0xaab8f01e6e10b4a7}, + {0x9226712162ab070d, 0xcab3961304ca70e9}, + {0xb6b00d69bb55c8d1, 0x3d607b97c5fd0d23}, + {0xe45c10c42a2b3b05, 0x8cb89a7db77c506b}, + {0x8eb98a7a9a5b04e3, 0x77f3608e92adb243}, + {0xb267ed1940f1c61c, 0x55f038b237591ed4}, + {0xdf01e85f912e37a3, 0x6b6c46dec52f6689}, + {0x8b61313bbabce2c6, 0x2323ac4b3b3da016}, + {0xae397d8aa96c1b77, 0xabec975e0a0d081b}, + {0xd9c7dced53c72255, 0x96e7bd358c904a22}, + {0x881cea14545c7575, 0x7e50d64177da2e55}, + {0xaa242499697392d2, 0xdde50bd1d5d0b9ea}, + {0xd4ad2dbfc3d07787, 0x955e4ec64b44e865}, + {0x84ec3c97da624ab4, 0xbd5af13bef0b113f}, + {0xa6274bbdd0fadd61, 0xecb1ad8aeacdd58f}, + {0xcfb11ead453994ba, 0x67de18eda5814af3}, + {0x81ceb32c4b43fcf4, 0x80eacf948770ced8}, + {0xa2425ff75e14fc31, 0xa1258379a94d028e}, + {0xcad2f7f5359a3b3e, 0x096ee45813a04331}, + {0xfd87b5f28300ca0d, 0x8bca9d6e188853fd}, + {0x9e74d1b791e07e48, 0x775ea264cf55347e}, + {0xc612062576589dda, 0x95364afe032a819e}, + {0xf79687aed3eec551, 0x3a83ddbd83f52205}, + {0x9abe14cd44753b52, 0xc4926a9672793543}, + {0xc16d9a0095928a27, 0x75b7053c0f178294}, + {0xf1c90080baf72cb1, 0x5324c68b12dd6339}, + {0x971da05074da7bee, 0xd3f6fc16ebca5e04}, + {0xbce5086492111aea, 0x88f4bb1ca6bcf585}, + {0xec1e4a7db69561a5, 0x2b31e9e3d06c32e6}, + {0x9392ee8e921d5d07, 0x3aff322e62439fd0}, + {0xb877aa3236a4b449, 0x09befeb9fad487c3}, + {0xe69594bec44de15b, 0x4c2ebe687989a9b4}, + {0x901d7cf73ab0acd9, 0x0f9d37014bf60a11}, + {0xb424dc35095cd80f, 0x538484c19ef38c95}, + {0xe12e13424bb40e13, 0x2865a5f206b06fba}, + {0x8cbccc096f5088cb, 0xf93f87b7442e45d4}, + {0xafebff0bcb24aafe, 0xf78f69a51539d749}, + {0xdbe6fecebdedd5be, 0xb573440e5a884d1c}, + {0x89705f4136b4a597, 0x31680a88f8953031}, + {0xabcc77118461cefc, 0xfdc20d2b36ba7c3e}, + {0xd6bf94d5e57a42bc, 0x3d32907604691b4d}, + {0x8637bd05af6c69b5, 0xa63f9a49c2c1b110}, + {0xa7c5ac471b478423, 0x0fcf80dc33721d54}, + {0xd1b71758e219652b, 0xd3c36113404ea4a9}, + {0x83126e978d4fdf3b, 0x645a1cac083126ea}, + {0xa3d70a3d70a3d70a, 0x3d70a3d70a3d70a4}, + {0xcccccccccccccccc, 0xcccccccccccccccd}, + {0x8000000000000000, 0x0000000000000000}, + {0xa000000000000000, 0x0000000000000000}, + {0xc800000000000000, 0x0000000000000000}, + {0xfa00000000000000, 0x0000000000000000}, + {0x9c40000000000000, 0x0000000000000000}, + {0xc350000000000000, 0x0000000000000000}, + {0xf424000000000000, 0x0000000000000000}, + {0x9896800000000000, 0x0000000000000000}, + {0xbebc200000000000, 0x0000000000000000}, + {0xee6b280000000000, 0x0000000000000000}, + {0x9502f90000000000, 0x0000000000000000}, + {0xba43b74000000000, 0x0000000000000000}, + {0xe8d4a51000000000, 0x0000000000000000}, + {0x9184e72a00000000, 0x0000000000000000}, + {0xb5e620f480000000, 0x0000000000000000}, + {0xe35fa931a0000000, 0x0000000000000000}, + {0x8e1bc9bf04000000, 0x0000000000000000}, + {0xb1a2bc2ec5000000, 0x0000000000000000}, + {0xde0b6b3a76400000, 0x0000000000000000}, + {0x8ac7230489e80000, 0x0000000000000000}, + {0xad78ebc5ac620000, 0x0000000000000000}, + {0xd8d726b7177a8000, 0x0000000000000000}, + {0x878678326eac9000, 0x0000000000000000}, + {0xa968163f0a57b400, 0x0000000000000000}, + {0xd3c21bcecceda100, 0x0000000000000000}, + {0x84595161401484a0, 0x0000000000000000}, + {0xa56fa5b99019a5c8, 0x0000000000000000}, + {0xcecb8f27f4200f3a, 0x0000000000000000}, + {0x813f3978f8940984, 0x4000000000000000}, + {0xa18f07d736b90be5, 0x5000000000000000}, + {0xc9f2c9cd04674ede, 0xa400000000000000}, + {0xfc6f7c4045812296, 0x4d00000000000000}, + {0x9dc5ada82b70b59d, 0xf020000000000000}, + {0xc5371912364ce305, 0x6c28000000000000}, + {0xf684df56c3e01bc6, 0xc732000000000000}, + {0x9a130b963a6c115c, 0x3c7f400000000000}, + {0xc097ce7bc90715b3, 0x4b9f100000000000}, + {0xf0bdc21abb48db20, 0x1e86d40000000000}, + {0x96769950b50d88f4, 0x1314448000000000}, + {0xbc143fa4e250eb31, 0x17d955a000000000}, + {0xeb194f8e1ae525fd, 0x5dcfab0800000000}, + {0x92efd1b8d0cf37be, 0x5aa1cae500000000}, + {0xb7abc627050305ad, 0xf14a3d9e40000000}, + {0xe596b7b0c643c719, 0x6d9ccd05d0000000}, + {0x8f7e32ce7bea5c6f, 0xe4820023a2000000}, + {0xb35dbf821ae4f38b, 0xdda2802c8a800000}, + {0xe0352f62a19e306e, 0xd50b2037ad200000}, + {0x8c213d9da502de45, 0x4526f422cc340000}, + {0xaf298d050e4395d6, 0x9670b12b7f410000}, + {0xdaf3f04651d47b4c, 0x3c0cdd765f114000}, + {0x88d8762bf324cd0f, 0xa5880a69fb6ac800}, + {0xab0e93b6efee0053, 0x8eea0d047a457a00}, + {0xd5d238a4abe98068, 0x72a4904598d6d880}, + {0x85a36366eb71f041, 0x47a6da2b7f864750}, + {0xa70c3c40a64e6c51, 0x999090b65f67d924}, + {0xd0cf4b50cfe20765, 0xfff4b4e3f741cf6d}, + {0x82818f1281ed449f, 0xbff8f10e7a8921a4}, + {0xa321f2d7226895c7, 0xaff72d52192b6a0d}, + {0xcbea6f8ceb02bb39, 0x9bf4f8a69f764490}, + {0xfee50b7025c36a08, 0x02f236d04753d5b4}, + {0x9f4f2726179a2245, 0x01d762422c946590}, + {0xc722f0ef9d80aad6, 0x424d3ad2b7b97ef5}, + {0xf8ebad2b84e0d58b, 0xd2e0898765a7deb2}, + {0x9b934c3b330c8577, 0x63cc55f49f88eb2f}, + {0xc2781f49ffcfa6d5, 0x3cbf6b71c76b25fb}, + {0xf316271c7fc3908a, 0x8bef464e3945ef7a}, + {0x97edd871cfda3a56, 0x97758bf0e3cbb5ac}, + {0xbde94e8e43d0c8ec, 0x3d52eeed1cbea317}, + {0xed63a231d4c4fb27, 0x4ca7aaa863ee4bdd}, + {0x945e455f24fb1cf8, 0x8fe8caa93e74ef6a}, + {0xb975d6b6ee39e436, 0xb3e2fd538e122b44}, + {0xe7d34c64a9c85d44, 0x60dbbca87196b616}, + {0x90e40fbeea1d3a4a, 0xbc8955e946fe31cd}, + {0xb51d13aea4a488dd, 0x6babab6398bdbe41}, + {0xe264589a4dcdab14, 0xc696963c7eed2dd1}, + {0x8d7eb76070a08aec, 0xfc1e1de5cf543ca2}, + {0xb0de65388cc8ada8, 0x3b25a55f43294bcb}, + {0xdd15fe86affad912, 0x49ef0eb713f39ebe}, + {0x8a2dbf142dfcc7ab, 0x6e3569326c784337}, + {0xacb92ed9397bf996, 0x49c2c37f07965404}, + {0xd7e77a8f87daf7fb, 0xdc33745ec97be906}, + {0x86f0ac99b4e8dafd, 0x69a028bb3ded71a3}, + {0xa8acd7c0222311bc, 0xc40832ea0d68ce0c}, + {0xd2d80db02aabd62b, 0xf50a3fa490c30190}, + {0x83c7088e1aab65db, 0x792667c6da79e0fa}, + {0xa4b8cab1a1563f52, 0x577001b891185938}, + {0xcde6fd5e09abcf26, 0xed4c0226b55e6f86}, + {0x80b05e5ac60b6178, 0x544f8158315b05b4}, + {0xa0dc75f1778e39d6, 0x696361ae3db1c721}, + {0xc913936dd571c84c, 0x03bc3a19cd1e38e9}, + {0xfb5878494ace3a5f, 0x04ab48a04065c723}, + {0x9d174b2dcec0e47b, 0x62eb0d64283f9c76}, + {0xc45d1df942711d9a, 0x3ba5d0bd324f8394}, + {0xf5746577930d6500, 0xca8f44ec7ee36479}, + {0x9968bf6abbe85f20, 0x7e998b13cf4e1ecb}, + {0xbfc2ef456ae276e8, 0x9e3fedd8c321a67e}, + {0xefb3ab16c59b14a2, 0xc5cfe94ef3ea101e}, + {0x95d04aee3b80ece5, 0xbba1f1d158724a12}, + {0xbb445da9ca61281f, 0x2a8a6e45ae8edc97}, + {0xea1575143cf97226, 0xf52d09d71a3293bd}, + {0x924d692ca61be758, 0x593c2626705f9c56}, + {0xb6e0c377cfa2e12e, 0x6f8b2fb00c77836c}, + {0xe498f455c38b997a, 0x0b6dfb9c0f956447}, + {0x8edf98b59a373fec, 0x4724bd4189bd5eac}, + {0xb2977ee300c50fe7, 0x58edec91ec2cb657}, + {0xdf3d5e9bc0f653e1, 0x2f2967b66737e3ed}, + {0x8b865b215899f46c, 0xbd79e0d20082ee74}, + {0xae67f1e9aec07187, 0xecd8590680a3aa11}, + {0xda01ee641a708de9, 0xe80e6f4820cc9495}, + {0x884134fe908658b2, 0x3109058d147fdcdd}, + {0xaa51823e34a7eede, 0xbd4b46f0599fd415}, + {0xd4e5e2cdc1d1ea96, 0x6c9e18ac7007c91a}, + {0x850fadc09923329e, 0x03e2cf6bc604ddb0}, + {0xa6539930bf6bff45, 0x84db8346b786151c}, + {0xcfe87f7cef46ff16, 0xe612641865679a63}, + {0x81f14fae158c5f6e, 0x4fcb7e8f3f60c07e}, + {0xa26da3999aef7749, 0xe3be5e330f38f09d}, + {0xcb090c8001ab551c, 0x5cadf5bfd3072cc5}, + {0xfdcb4fa002162a63, 0x73d9732fc7c8f7f6}, + {0x9e9f11c4014dda7e, 0x2867e7fddcdd9afa}, + {0xc646d63501a1511d, 0xb281e1fd541501b8}, + {0xf7d88bc24209a565, 0x1f225a7ca91a4226}, + {0x9ae757596946075f, 0x3375788de9b06958}, + {0xc1a12d2fc3978937, 0x0052d6b1641c83ae}, + {0xf209787bb47d6b84, 0xc0678c5dbd23a49a}, + {0x9745eb4d50ce6332, 0xf840b7ba963646e0}, + {0xbd176620a501fbff, 0xb650e5a93bc3d898}, + {0xec5d3fa8ce427aff, 0xa3e51f138ab4cebe}, + {0x93ba47c980e98cdf, 0xc66f336c36b10137}, + {0xb8a8d9bbe123f017, 0xb80b0047445d4184}, + {0xe6d3102ad96cec1d, 0xa60dc059157491e5}, + {0x9043ea1ac7e41392, 0x87c89837ad68db2f}, + {0xb454e4a179dd1877, 0x29babe4598c311fb}, + {0xe16a1dc9d8545e94, 0xf4296dd6fef3d67a}, + {0x8ce2529e2734bb1d, 0x1899e4a65f58660c}, + {0xb01ae745b101e9e4, 0x5ec05dcff72e7f8f}, + {0xdc21a1171d42645d, 0x76707543f4fa1f73}, + {0x899504ae72497eba, 0x6a06494a791c53a8}, + {0xabfa45da0edbde69, 0x0487db9d17636892}, + {0xd6f8d7509292d603, 0x45a9d2845d3c42b6}, + {0x865b86925b9bc5c2, 0x0b8a2392ba45a9b2}, + {0xa7f26836f282b732, 0x8e6cac7768d7141e}, + {0xd1ef0244af2364ff, 0x3207d795430cd926}, + {0x8335616aed761f1f, 0x7f44e6bd49e807b8}, + {0xa402b9c5a8d3a6e7, 0x5f16206c9c6209a6}, + {0xcd036837130890a1, 0x36dba887c37a8c0f}, + {0x802221226be55a64, 0xc2494954da2c9789}, + {0xa02aa96b06deb0fd, 0xf2db9baa10b7bd6c}, + {0xc83553c5c8965d3d, 0x6f92829494e5acc7}, + {0xfa42a8b73abbf48c, 0xcb772339ba1f17f9}, + {0x9c69a97284b578d7, 0xff2a760414536efb}, + {0xc38413cf25e2d70d, 0xfef5138519684aba}, + {0xf46518c2ef5b8cd1, 0x7eb258665fc25d69}, + {0x98bf2f79d5993802, 0xef2f773ffbd97a61}, + {0xbeeefb584aff8603, 0xaafb550ffacfd8fa}, + {0xeeaaba2e5dbf6784, 0x95ba2a53f983cf38}, + {0x952ab45cfa97a0b2, 0xdd945a747bf26183}, + {0xba756174393d88df, 0x94f971119aeef9e4}, + {0xe912b9d1478ceb17, 0x7a37cd5601aab85d}, + {0x91abb422ccb812ee, 0xac62e055c10ab33a}, + {0xb616a12b7fe617aa, 0x577b986b314d6009}, + {0xe39c49765fdf9d94, 0xed5a7e85fda0b80b}, + {0x8e41ade9fbebc27d, 0x14588f13be847307}, + {0xb1d219647ae6b31c, 0x596eb2d8ae258fc8}, + {0xde469fbd99a05fe3, 0x6fca5f8ed9aef3bb}, + {0x8aec23d680043bee, 0x25de7bb9480d5854}, + {0xada72ccc20054ae9, 0xaf561aa79a10ae6a}, + {0xd910f7ff28069da4, 0x1b2ba1518094da04}, + {0x87aa9aff79042286, 0x90fb44d2f05d0842}, + {0xa99541bf57452b28, 0x353a1607ac744a53}, + {0xd3fa922f2d1675f2, 0x42889b8997915ce8}, + {0x847c9b5d7c2e09b7, 0x69956135febada11}, + {0xa59bc234db398c25, 0x43fab9837e699095}, + {0xcf02b2c21207ef2e, 0x94f967e45e03f4bb}, + {0x8161afb94b44f57d, 0x1d1be0eebac278f5}, + {0xa1ba1ba79e1632dc, 0x6462d92a69731732}, + {0xca28a291859bbf93, 0x7d7b8f7503cfdcfe}, + {0xfcb2cb35e702af78, 0x5cda735244c3d43e}, + {0x9defbf01b061adab, 0x3a0888136afa64a7}, + {0xc56baec21c7a1916, 0x088aaa1845b8fdd0}, + {0xf6c69a72a3989f5b, 0x8aad549e57273d45}, + {0x9a3c2087a63f6399, 0x36ac54e2f678864b}, + {0xc0cb28a98fcf3c7f, 0x84576a1bb416a7dd}, + {0xf0fdf2d3f3c30b9f, 0x656d44a2a11c51d5}, + {0x969eb7c47859e743, 0x9f644ae5a4b1b325}, + {0xbc4665b596706114, 0x873d5d9f0dde1fee}, + {0xeb57ff22fc0c7959, 0xa90cb506d155a7ea}, + {0x9316ff75dd87cbd8, 0x09a7f12442d588f2}, + {0xb7dcbf5354e9bece, 0x0c11ed6d538aeb2f}, + {0xe5d3ef282a242e81, 0x8f1668c8a86da5fa}, + {0x8fa475791a569d10, 0xf96e017d694487bc}, + {0xb38d92d760ec4455, 0x37c981dcc395a9ac}, + {0xe070f78d3927556a, 0x85bbe253f47b1417}, + {0x8c469ab843b89562, 0x93956d7478ccec8e}, + {0xaf58416654a6babb, 0x387ac8d1970027b2}, + {0xdb2e51bfe9d0696a, 0x06997b05fcc0319e}, + {0x88fcf317f22241e2, 0x441fece3bdf81f03}, + {0xab3c2fddeeaad25a, 0xd527e81cad7626c3}, + {0xd60b3bd56a5586f1, 0x8a71e223d8d3b074}, + {0x85c7056562757456, 0xf6872d5667844e49}, + {0xa738c6bebb12d16c, 0xb428f8ac016561db}, + {0xd106f86e69d785c7, 0xe13336d701beba52}, + {0x82a45b450226b39c, 0xecc0024661173473}, + {0xa34d721642b06084, 0x27f002d7f95d0190}, + {0xcc20ce9bd35c78a5, 0x31ec038df7b441f4}, + {0xff290242c83396ce, 0x7e67047175a15271}, + {0x9f79a169bd203e41, 0x0f0062c6e984d386}, + {0xc75809c42c684dd1, 0x52c07b78a3e60868}, + {0xf92e0c3537826145, 0xa7709a56ccdf8a82}, + {0x9bbcc7a142b17ccb, 0x88a66076400bb691}, + {0xc2abf989935ddbfe, 0x6acff893d00ea435}, + {0xf356f7ebf83552fe, 0x0583f6b8c4124d43}, + {0x98165af37b2153de, 0xc3727a337a8b704a}, + {0xbe1bf1b059e9a8d6, 0x744f18c0592e4c5c}, + {0xeda2ee1c7064130c, 0x1162def06f79df73}, + {0x9485d4d1c63e8be7, 0x8addcb5645ac2ba8}, + {0xb9a74a0637ce2ee1, 0x6d953e2bd7173692}, + {0xe8111c87c5c1ba99, 0xc8fa8db6ccdd0437}, + {0x910ab1d4db9914a0, 0x1d9c9892400a22a2}, + {0xb54d5e4a127f59c8, 0x2503beb6d00cab4b}, + {0xe2a0b5dc971f303a, 0x2e44ae64840fd61d}, + {0x8da471a9de737e24, 0x5ceaecfed289e5d2}, + {0xb10d8e1456105dad, 0x7425a83e872c5f47}, + {0xdd50f1996b947518, 0xd12f124e28f77719}, + {0x8a5296ffe33cc92f, 0x82bd6b70d99aaa6f}, + {0xace73cbfdc0bfb7b, 0x636cc64d1001550b}, + {0xd8210befd30efa5a, 0x3c47f7e05401aa4e}, + {0x8714a775e3e95c78, 0x65acfaec34810a71}, + {0xa8d9d1535ce3b396, 0x7f1839a741a14d0d}, + {0xd31045a8341ca07c, 0x1ede48111209a050}, + {0x83ea2b892091e44d, 0x934aed0aab460432}, + {0xa4e4b66b68b65d60, 0xf81da84d5617853f}, + {0xce1de40642e3f4b9, 0x36251260ab9d668e}, + {0x80d2ae83e9ce78f3, 0xc1d72b7c6b426019}, + {0xa1075a24e4421730, 0xb24cf65b8612f81f}, + {0xc94930ae1d529cfc, 0xdee033f26797b627}, + {0xfb9b7cd9a4a7443c, 0x169840ef017da3b1}, + {0x9d412e0806e88aa5, 0x8e1f289560ee864e}, + {0xc491798a08a2ad4e, 0xf1a6f2bab92a27e2}, + {0xf5b5d7ec8acb58a2, 0xae10af696774b1db}, + {0x9991a6f3d6bf1765, 0xacca6da1e0a8ef29}, + {0xbff610b0cc6edd3f, 0x17fd090a58d32af3}, + {0xeff394dcff8a948e, 0xddfc4b4cef07f5b0}, + {0x95f83d0a1fb69cd9, 0x4abdaf101564f98e}, + {0xbb764c4ca7a4440f, 0x9d6d1ad41abe37f1}, + {0xea53df5fd18d5513, 0x84c86189216dc5ed}, + {0x92746b9be2f8552c, 0x32fd3cf5b4e49bb4}, + {0xb7118682dbb66a77, 0x3fbc8c33221dc2a1}, + {0xe4d5e82392a40515, 0x0fabaf3feaa5334a}, + {0x8f05b1163ba6832d, 0x29cb4d87f2a7400e}, + {0xb2c71d5bca9023f8, 0x743e20e9ef511012}, + {0xdf78e4b2bd342cf6, 0x914da9246b255416}, + {0x8bab8eefb6409c1a, 0x1ad089b6c2f7548e}, + {0xae9672aba3d0c320, 0xa184ac2473b529b1}, + {0xda3c0f568cc4f3e8, 0xc9e5d72d90a2741e}, + {0x8865899617fb1871, 0x7e2fa67c7a658892}, + {0xaa7eebfb9df9de8d, 0xddbb901b98feeab7}, + {0xd51ea6fa85785631, 0x552a74227f3ea565}, + {0x8533285c936b35de, 0xd53a88958f87275f}, + {0xa67ff273b8460356, 0x8a892abaf368f137}, + {0xd01fef10a657842c, 0x2d2b7569b0432d85}, + {0x8213f56a67f6b29b, 0x9c3b29620e29fc73}, + {0xa298f2c501f45f42, 0x8349f3ba91b47b8f}, + {0xcb3f2f7642717713, 0x241c70a936219a73}, + {0xfe0efb53d30dd4d7, 0xed238cd383aa0110}, + {0x9ec95d1463e8a506, 0xf4363804324a40aa}, + {0xc67bb4597ce2ce48, 0xb143c6053edcd0d5}, + {0xf81aa16fdc1b81da, 0xdd94b7868e94050a}, + {0x9b10a4e5e9913128, 0xca7cf2b4191c8326}, + {0xc1d4ce1f63f57d72, 0xfd1c2f611f63a3f0}, + {0xf24a01a73cf2dccf, 0xbc633b39673c8cec}, + {0x976e41088617ca01, 0xd5be0503e085d813}, + {0xbd49d14aa79dbc82, 0x4b2d8644d8a74e18}, + {0xec9c459d51852ba2, 0xddf8e7d60ed1219e}, + {0x93e1ab8252f33b45, 0xcabb90e5c942b503}, + {0xb8da1662e7b00a17, 0x3d6a751f3b936243}, + {0xe7109bfba19c0c9d, 0x0cc512670a783ad4}, + {0x906a617d450187e2, 0x27fb2b80668b24c5}, + {0xb484f9dc9641e9da, 0xb1f9f660802dedf6}, + {0xe1a63853bbd26451, 0x5e7873f8a0396973}, + {0x8d07e33455637eb2, 0xdb0b487b6423e1e8}, + {0xb049dc016abc5e5f, 0x91ce1a9a3d2cda62}, + {0xdc5c5301c56b75f7, 0x7641a140cc7810fb}, + {0x89b9b3e11b6329ba, 0xa9e904c87fcb0a9d}, + {0xac2820d9623bf429, 0x546345fa9fbdcd44}, + {0xd732290fbacaf133, 0xa97c177947ad4095}, + {0x867f59a9d4bed6c0, 0x49ed8eabcccc485d}, + {0xa81f301449ee8c70, 0x5c68f256bfff5a74}, + {0xd226fc195c6a2f8c, 0x73832eec6fff3111}, + {0x83585d8fd9c25db7, 0xc831fd53c5ff7eab}, + {0xa42e74f3d032f525, 0xba3e7ca8b77f5e55}, + {0xcd3a1230c43fb26f, 0x28ce1bd2e55f35eb}, + {0x80444b5e7aa7cf85, 0x7980d163cf5b81b3}, + {0xa0555e361951c366, 0xd7e105bcc332621f}, + {0xc86ab5c39fa63440, 0x8dd9472bf3fefaa7}, + {0xfa856334878fc150, 0xb14f98f6f0feb951}, + {0x9c935e00d4b9d8d2, 0x6ed1bf9a569f33d3}, + {0xc3b8358109e84f07, 0x0a862f80ec4700c8}, + {0xf4a642e14c6262c8, 0xcd27bb612758c0fa}, + {0x98e7e9cccfbd7dbd, 0x8038d51cb897789c}, + {0xbf21e44003acdd2c, 0xe0470a63e6bd56c3}, + {0xeeea5d5004981478, 0x1858ccfce06cac74}, + {0x95527a5202df0ccb, 0x0f37801e0c43ebc8}, + {0xbaa718e68396cffd, 0xd30560258f54e6ba}, + {0xe950df20247c83fd, 0x47c6b82ef32a2069}, + {0x91d28b7416cdd27e, 0x4cdc331d57fa5441}, + {0xb6472e511c81471d, 0xe0133fe4adf8e952}, + {0xe3d8f9e563a198e5, 0x58180fddd97723a6}, + {0x8e679c2f5e44ff8f, 0x570f09eaa7ea7648}, + {0xb201833b35d63f73, 0x2cd2cc6551e513da}, + {0xde81e40a034bcf4f, 0xf8077f7ea65e58d1}, + {0x8b112e86420f6191, 0xfb04afaf27faf782}, + {0xadd57a27d29339f6, 0x79c5db9af1f9b563}, + {0xd94ad8b1c7380874, 0x18375281ae7822bc}, + {0x87cec76f1c830548, 0x8f2293910d0b15b5}, + {0xa9c2794ae3a3c69a, 0xb2eb3875504ddb22}, + {0xd433179d9c8cb841, 0x5fa60692a46151eb}, + {0x849feec281d7f328, 0xdbc7c41ba6bcd333}, + {0xa5c7ea73224deff3, 0x12b9b522906c0800}, + {0xcf39e50feae16bef, 0xd768226b34870a00}, + {0x81842f29f2cce375, 0xe6a1158300d46640}, + {0xa1e53af46f801c53, 0x60495ae3c1097fd0}, + {0xca5e89b18b602368, 0x385bb19cb14bdfc4}, + {0xfcf62c1dee382c42, 0x46729e03dd9ed7b5}, + {0x9e19db92b4e31ba9, 0x6c07a2c26a8346d1}, + {0xc5a05277621be293, 0xc7098b7305241885}, + {0xf70867153aa2db38, 0xb8cbee4fc66d1ea7} +#else + {0xff77b1fcbebcdc4f, 0x25e8e89c13bb0f7b}, + {0xce5d73ff402d98e3, 0xfb0a3d212dc81290}, + {0xa6b34ad8c9dfc06f, 0xf42faa48c0ea481f}, + {0x86a8d39ef77164bc, 0xae5dff9c02033198}, + {0xd98ddaee19068c76, 0x3badd624dd9b0958}, + {0xafbd2350644eeacf, 0xe5d1929ef90898fb}, + {0x8df5efabc5979c8f, 0xca8d3ffa1ef463c2}, + {0xe55990879ddcaabd, 0xcc420a6a101d0516}, + {0xb94470938fa89bce, 0xf808e40e8d5b3e6a}, + {0x95a8637627989aad, 0xdde7001379a44aa9}, + {0xf1c90080baf72cb1, 0x5324c68b12dd6339}, + {0xc350000000000000, 0x0000000000000000}, + {0x9dc5ada82b70b59d, 0xf020000000000000}, + {0xfee50b7025c36a08, 0x02f236d04753d5b4}, + {0xcde6fd5e09abcf26, 0xed4c0226b55e6f86}, + {0xa6539930bf6bff45, 0x84db8346b786151c}, + {0x865b86925b9bc5c2, 0x0b8a2392ba45a9b2}, + {0xd910f7ff28069da4, 0x1b2ba1518094da04}, + {0xaf58416654a6babb, 0x387ac8d1970027b2}, + {0x8da471a9de737e24, 0x5ceaecfed289e5d2}, + {0xe4d5e82392a40515, 0x0fabaf3feaa5334a}, + {0xb8da1662e7b00a17, 0x3d6a751f3b936243}, + {0x95527a5202df0ccb, 0x0f37801e0c43ebc8} +#endif +}; + +#if !FMT_USE_FULL_CACHE_DRAGONBOX +template <typename T> +const uint64_t basic_data<T>::powers_of_5_64[] = { + 0x0000000000000001, 0x0000000000000005, 0x0000000000000019, + 0x000000000000007d, 0x0000000000000271, 0x0000000000000c35, + 0x0000000000003d09, 0x000000000001312d, 0x000000000005f5e1, + 0x00000000001dcd65, 0x00000000009502f9, 0x0000000002e90edd, + 0x000000000e8d4a51, 0x0000000048c27395, 0x000000016bcc41e9, + 0x000000071afd498d, 0x0000002386f26fc1, 0x000000b1a2bc2ec5, + 0x000003782dace9d9, 0x00001158e460913d, 0x000056bc75e2d631, + 0x0001b1ae4d6e2ef5, 0x000878678326eac9, 0x002a5a058fc295ed, + 0x00d3c21bcecceda1, 0x0422ca8b0a00a425, 0x14adf4b7320334b9}; + +template <typename T> +const uint32_t basic_data<T>::dragonbox_pow10_recovery_errors[] = { + 0x50001400, 0x54044100, 0x54014555, 0x55954415, 0x54115555, 0x00000001, + 0x50000000, 0x00104000, 0x54010004, 0x05004001, 0x55555544, 0x41545555, + 0x54040551, 0x15445545, 0x51555514, 0x10000015, 0x00101100, 0x01100015, + 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x04450514, 0x45414110, + 0x55555145, 0x50544050, 0x15040155, 0x11054140, 0x50111514, 0x11451454, + 0x00400541, 0x00000000, 0x55555450, 0x10056551, 0x10054011, 0x55551014, + 0x69514555, 0x05151109, 0x00155555}; +#endif + +template <typename T> +const char basic_data<T>::foreground_color[] = "\x1b[38;2;"; +template <typename T> +const char basic_data<T>::background_color[] = "\x1b[48;2;"; +template <typename T> const char basic_data<T>::reset_color[] = "\x1b[0m"; +template <typename T> const wchar_t basic_data<T>::wreset_color[] = L"\x1b[0m"; +template <typename T> const char basic_data<T>::signs[] = {0, '-', '+', ' '}; +template <typename T> +const char basic_data<T>::left_padding_shifts[] = {31, 31, 0, 1, 0}; +template <typename T> +const char basic_data<T>::right_padding_shifts[] = {0, 31, 0, 1, 0}; + +template <typename T> struct bits { + static FMT_CONSTEXPR_DECL const int value = + static_cast<int>(sizeof(T) * std::numeric_limits<unsigned char>::digits); +}; + +class fp; +template <int SHIFT = 0> fp normalize(fp value); + +// Lower (upper) boundary is a value half way between a floating-point value +// and its predecessor (successor). Boundaries have the same exponent as the +// value so only significands are stored. +struct boundaries { + uint64_t lower; + uint64_t upper; +}; + +// A handmade floating-point number f * pow(2, e). +class fp { + private: + using significand_type = uint64_t; + + template <typename Float> + using is_supported_float = bool_constant<sizeof(Float) == sizeof(uint64_t) || + sizeof(Float) == sizeof(uint32_t)>; + + public: + significand_type f; + int e; + + // All sizes are in bits. + // Subtract 1 to account for an implicit most significant bit in the + // normalized form. + static FMT_CONSTEXPR_DECL const int double_significand_size = + std::numeric_limits<double>::digits - 1; + static FMT_CONSTEXPR_DECL const uint64_t implicit_bit = + 1ULL << double_significand_size; + static FMT_CONSTEXPR_DECL const int significand_size = + bits<significand_type>::value; + + fp() : f(0), e(0) {} + fp(uint64_t f_val, int e_val) : f(f_val), e(e_val) {} + + // Constructs fp from an IEEE754 double. It is a template to prevent compile + // errors on platforms where double is not IEEE754. + template <typename Double> explicit fp(Double d) { assign(d); } + + // Assigns d to this and return true iff predecessor is closer than successor. + template <typename Float, FMT_ENABLE_IF(is_supported_float<Float>::value)> + bool assign(Float d) { + // Assume float is in the format [sign][exponent][significand]. + using limits = std::numeric_limits<Float>; + const int float_significand_size = limits::digits - 1; + const int exponent_size = + bits<Float>::value - float_significand_size - 1; // -1 for sign + const uint64_t float_implicit_bit = 1ULL << float_significand_size; + const uint64_t significand_mask = float_implicit_bit - 1; + const uint64_t exponent_mask = (~0ULL >> 1) & ~significand_mask; + const int exponent_bias = (1 << exponent_size) - limits::max_exponent - 1; + constexpr bool is_double = sizeof(Float) == sizeof(uint64_t); + auto u = bit_cast<conditional_t<is_double, uint64_t, uint32_t>>(d); + f = u & significand_mask; + int biased_e = + static_cast<int>((u & exponent_mask) >> float_significand_size); + // Predecessor is closer if d is a normalized power of 2 (f == 0) other than + // the smallest normalized number (biased_e > 1). + bool is_predecessor_closer = f == 0 && biased_e > 1; + if (biased_e != 0) + f += float_implicit_bit; + else + biased_e = 1; // Subnormals use biased exponent 1 (min exponent). + e = biased_e - exponent_bias - float_significand_size; + return is_predecessor_closer; + } + + template <typename Float, FMT_ENABLE_IF(!is_supported_float<Float>::value)> + bool assign(Float) { + *this = fp(); + return false; + } +}; + +// Normalizes the value converted from double and multiplied by (1 << SHIFT). +template <int SHIFT> fp normalize(fp value) { + // Handle subnormals. + const auto shifted_implicit_bit = fp::implicit_bit << SHIFT; + while ((value.f & shifted_implicit_bit) == 0) { + value.f <<= 1; + --value.e; + } + // Subtract 1 to account for hidden bit. + const auto offset = + fp::significand_size - fp::double_significand_size - SHIFT - 1; + value.f <<= offset; + value.e -= offset; + return value; +} + +inline bool operator==(fp x, fp y) { return x.f == y.f && x.e == y.e; } + +// Computes lhs * rhs / pow(2, 64) rounded to nearest with half-up tie breaking. +inline uint64_t multiply(uint64_t lhs, uint64_t rhs) { +#if FMT_USE_INT128 + auto product = static_cast<__uint128_t>(lhs) * rhs; + auto f = static_cast<uint64_t>(product >> 64); + return (static_cast<uint64_t>(product) & (1ULL << 63)) != 0 ? f + 1 : f; +#else + // Multiply 32-bit parts of significands. + uint64_t mask = (1ULL << 32) - 1; + uint64_t a = lhs >> 32, b = lhs & mask; + uint64_t c = rhs >> 32, d = rhs & mask; + uint64_t ac = a * c, bc = b * c, ad = a * d, bd = b * d; + // Compute mid 64-bit of result and round. + uint64_t mid = (bd >> 32) + (ad & mask) + (bc & mask) + (1U << 31); + return ac + (ad >> 32) + (bc >> 32) + (mid >> 32); +#endif +} + +inline fp operator*(fp x, fp y) { return {multiply(x.f, y.f), x.e + y.e + 64}; } + +// Returns a cached power of 10 `c_k = c_k.f * pow(2, c_k.e)` such that its +// (binary) exponent satisfies `min_exponent <= c_k.e <= min_exponent + 28`. +inline fp get_cached_power(int min_exponent, int& pow10_exponent) { + const int shift = 32; + const auto significand = static_cast<int64_t>(data::log10_2_significand); + int index = static_cast<int>( + ((min_exponent + fp::significand_size - 1) * (significand >> shift) + + ((int64_t(1) << shift) - 1)) // ceil + >> 32 // arithmetic shift + ); + // Decimal exponent of the first (smallest) cached power of 10. + const int first_dec_exp = -348; + // Difference between 2 consecutive decimal exponents in cached powers of 10. + const int dec_exp_step = 8; + index = (index - first_dec_exp - 1) / dec_exp_step + 1; + pow10_exponent = first_dec_exp + index * dec_exp_step; + return {data::grisu_pow10_significands[index], + data::grisu_pow10_exponents[index]}; +} + +// A simple accumulator to hold the sums of terms in bigint::square if uint128_t +// is not available. +struct accumulator { + uint64_t lower; + uint64_t upper; + + accumulator() : lower(0), upper(0) {} + explicit operator uint32_t() const { return static_cast<uint32_t>(lower); } + + void operator+=(uint64_t n) { + lower += n; + if (lower < n) ++upper; + } + void operator>>=(int shift) { + assert(shift == 32); + (void)shift; + lower = (upper << 32) | (lower >> 32); + upper >>= 32; + } +}; + +class bigint { + private: + // A bigint is stored as an array of bigits (big digits), with bigit at index + // 0 being the least significant one. + using bigit = uint32_t; + using double_bigit = uint64_t; + enum { bigits_capacity = 32 }; + basic_memory_buffer<bigit, bigits_capacity> bigits_; + int exp_; + + bigit operator[](int index) const { return bigits_[to_unsigned(index)]; } + bigit& operator[](int index) { return bigits_[to_unsigned(index)]; } + + static FMT_CONSTEXPR_DECL const int bigit_bits = bits<bigit>::value; + + friend struct formatter<bigint>; + + void subtract_bigits(int index, bigit other, bigit& borrow) { + auto result = static_cast<double_bigit>((*this)[index]) - other - borrow; + (*this)[index] = static_cast<bigit>(result); + borrow = static_cast<bigit>(result >> (bigit_bits * 2 - 1)); + } + + void remove_leading_zeros() { + int num_bigits = static_cast<int>(bigits_.size()) - 1; + while (num_bigits > 0 && (*this)[num_bigits] == 0) --num_bigits; + bigits_.resize(to_unsigned(num_bigits + 1)); + } + + // Computes *this -= other assuming aligned bigints and *this >= other. + void subtract_aligned(const bigint& other) { + FMT_ASSERT(other.exp_ >= exp_, "unaligned bigints"); + FMT_ASSERT(compare(*this, other) >= 0, ""); + bigit borrow = 0; + int i = other.exp_ - exp_; + for (size_t j = 0, n = other.bigits_.size(); j != n; ++i, ++j) + subtract_bigits(i, other.bigits_[j], borrow); + while (borrow > 0) subtract_bigits(i, 0, borrow); + remove_leading_zeros(); + } + + void multiply(uint32_t value) { + const double_bigit wide_value = value; + bigit carry = 0; + for (size_t i = 0, n = bigits_.size(); i < n; ++i) { + double_bigit result = bigits_[i] * wide_value + carry; + bigits_[i] = static_cast<bigit>(result); + carry = static_cast<bigit>(result >> bigit_bits); + } + if (carry != 0) bigits_.push_back(carry); + } + + void multiply(uint64_t value) { + const bigit mask = ~bigit(0); + const double_bigit lower = value & mask; + const double_bigit upper = value >> bigit_bits; + double_bigit carry = 0; + for (size_t i = 0, n = bigits_.size(); i < n; ++i) { + double_bigit result = bigits_[i] * lower + (carry & mask); + carry = + bigits_[i] * upper + (result >> bigit_bits) + (carry >> bigit_bits); + bigits_[i] = static_cast<bigit>(result); + } + while (carry != 0) { + bigits_.push_back(carry & mask); + carry >>= bigit_bits; + } + } + + public: + bigint() : exp_(0) {} + explicit bigint(uint64_t n) { assign(n); } + ~bigint() { assert(bigits_.capacity() <= bigits_capacity); } + + bigint(const bigint&) = delete; + void operator=(const bigint&) = delete; + + void assign(const bigint& other) { + auto size = other.bigits_.size(); + bigits_.resize(size); + auto data = other.bigits_.data(); + std::copy(data, data + size, make_checked(bigits_.data(), size)); + exp_ = other.exp_; + } + + void assign(uint64_t n) { + size_t num_bigits = 0; + do { + bigits_[num_bigits++] = n & ~bigit(0); + n >>= bigit_bits; + } while (n != 0); + bigits_.resize(num_bigits); + exp_ = 0; + } + + int num_bigits() const { return static_cast<int>(bigits_.size()) + exp_; } + + FMT_NOINLINE bigint& operator<<=(int shift) { + assert(shift >= 0); + exp_ += shift / bigit_bits; + shift %= bigit_bits; + if (shift == 0) return *this; + bigit carry = 0; + for (size_t i = 0, n = bigits_.size(); i < n; ++i) { + bigit c = bigits_[i] >> (bigit_bits - shift); + bigits_[i] = (bigits_[i] << shift) + carry; + carry = c; + } + if (carry != 0) bigits_.push_back(carry); + return *this; + } + + template <typename Int> bigint& operator*=(Int value) { + FMT_ASSERT(value > 0, ""); + multiply(uint32_or_64_or_128_t<Int>(value)); + return *this; + } + + friend int compare(const bigint& lhs, const bigint& rhs) { + int num_lhs_bigits = lhs.num_bigits(), num_rhs_bigits = rhs.num_bigits(); + if (num_lhs_bigits != num_rhs_bigits) + return num_lhs_bigits > num_rhs_bigits ? 1 : -1; + int i = static_cast<int>(lhs.bigits_.size()) - 1; + int j = static_cast<int>(rhs.bigits_.size()) - 1; + int end = i - j; + if (end < 0) end = 0; + for (; i >= end; --i, --j) { + bigit lhs_bigit = lhs[i], rhs_bigit = rhs[j]; + if (lhs_bigit != rhs_bigit) return lhs_bigit > rhs_bigit ? 1 : -1; + } + if (i != j) return i > j ? 1 : -1; + return 0; + } + + // Returns compare(lhs1 + lhs2, rhs). + friend int add_compare(const bigint& lhs1, const bigint& lhs2, + const bigint& rhs) { + int max_lhs_bigits = (std::max)(lhs1.num_bigits(), lhs2.num_bigits()); + int num_rhs_bigits = rhs.num_bigits(); + if (max_lhs_bigits + 1 < num_rhs_bigits) return -1; + if (max_lhs_bigits > num_rhs_bigits) return 1; + auto get_bigit = [](const bigint& n, int i) -> bigit { + return i >= n.exp_ && i < n.num_bigits() ? n[i - n.exp_] : 0; + }; + double_bigit borrow = 0; + int min_exp = (std::min)((std::min)(lhs1.exp_, lhs2.exp_), rhs.exp_); + for (int i = num_rhs_bigits - 1; i >= min_exp; --i) { + double_bigit sum = + static_cast<double_bigit>(get_bigit(lhs1, i)) + get_bigit(lhs2, i); + bigit rhs_bigit = get_bigit(rhs, i); + if (sum > rhs_bigit + borrow) return 1; + borrow = rhs_bigit + borrow - sum; + if (borrow > 1) return -1; + borrow <<= bigit_bits; + } + return borrow != 0 ? -1 : 0; + } + + // Assigns pow(10, exp) to this bigint. + void assign_pow10(int exp) { + assert(exp >= 0); + if (exp == 0) return assign(1); + // Find the top bit. + int bitmask = 1; + while (exp >= bitmask) bitmask <<= 1; + bitmask >>= 1; + // pow(10, exp) = pow(5, exp) * pow(2, exp). First compute pow(5, exp) by + // repeated squaring and multiplication. + assign(5); + bitmask >>= 1; + while (bitmask != 0) { + square(); + if ((exp & bitmask) != 0) *this *= 5; + bitmask >>= 1; + } + *this <<= exp; // Multiply by pow(2, exp) by shifting. + } + + void square() { + basic_memory_buffer<bigit, bigits_capacity> n(std::move(bigits_)); + int num_bigits = static_cast<int>(bigits_.size()); + int num_result_bigits = 2 * num_bigits; + bigits_.resize(to_unsigned(num_result_bigits)); + using accumulator_t = conditional_t<FMT_USE_INT128, uint128_t, accumulator>; + auto sum = accumulator_t(); + for (int bigit_index = 0; bigit_index < num_bigits; ++bigit_index) { + // Compute bigit at position bigit_index of the result by adding + // cross-product terms n[i] * n[j] such that i + j == bigit_index. + for (int i = 0, j = bigit_index; j >= 0; ++i, --j) { + // Most terms are multiplied twice which can be optimized in the future. + sum += static_cast<double_bigit>(n[i]) * n[j]; + } + (*this)[bigit_index] = static_cast<bigit>(sum); + sum >>= bits<bigit>::value; // Compute the carry. + } + // Do the same for the top half. + for (int bigit_index = num_bigits; bigit_index < num_result_bigits; + ++bigit_index) { + for (int j = num_bigits - 1, i = bigit_index - j; i < num_bigits;) + sum += static_cast<double_bigit>(n[i++]) * n[j--]; + (*this)[bigit_index] = static_cast<bigit>(sum); + sum >>= bits<bigit>::value; + } + --num_result_bigits; + remove_leading_zeros(); + exp_ *= 2; + } + + // If this bigint has a bigger exponent than other, adds trailing zero to make + // exponents equal. This simplifies some operations such as subtraction. + void align(const bigint& other) { + int exp_difference = exp_ - other.exp_; + if (exp_difference <= 0) return; + int num_bigits = static_cast<int>(bigits_.size()); + bigits_.resize(to_unsigned(num_bigits + exp_difference)); + for (int i = num_bigits - 1, j = i + exp_difference; i >= 0; --i, --j) + bigits_[j] = bigits_[i]; + std::uninitialized_fill_n(bigits_.data(), exp_difference, 0); + exp_ -= exp_difference; + } + + // Divides this bignum by divisor, assigning the remainder to this and + // returning the quotient. + int divmod_assign(const bigint& divisor) { + FMT_ASSERT(this != &divisor, ""); + if (compare(*this, divisor) < 0) return 0; + FMT_ASSERT(divisor.bigits_[divisor.bigits_.size() - 1u] != 0, ""); + align(divisor); + int quotient = 0; + do { + subtract_aligned(divisor); + ++quotient; + } while (compare(*this, divisor) >= 0); + return quotient; + } +}; + +enum class round_direction { unknown, up, down }; + +// Given the divisor (normally a power of 10), the remainder = v % divisor for +// some number v and the error, returns whether v should be rounded up, down, or +// whether the rounding direction can't be determined due to error. +// error should be less than divisor / 2. +inline round_direction get_round_direction(uint64_t divisor, uint64_t remainder, + uint64_t error) { + FMT_ASSERT(remainder < divisor, ""); // divisor - remainder won't overflow. + FMT_ASSERT(error < divisor, ""); // divisor - error won't overflow. + FMT_ASSERT(error < divisor - error, ""); // error * 2 won't overflow. + // Round down if (remainder + error) * 2 <= divisor. + if (remainder <= divisor - remainder && error * 2 <= divisor - remainder * 2) + return round_direction::down; + // Round up if (remainder - error) * 2 >= divisor. + if (remainder >= error && + remainder - error >= divisor - (remainder - error)) { + return round_direction::up; + } + return round_direction::unknown; +} + +namespace digits { +enum result { + more, // Generate more digits. + done, // Done generating digits. + error // Digit generation cancelled due to an error. +}; +} + +// Generates output using the Grisu digit-gen algorithm. +// error: the size of the region (lower, upper) outside of which numbers +// definitely do not round to value (Delta in Grisu3). +template <typename Handler> +FMT_ALWAYS_INLINE digits::result grisu_gen_digits(fp value, uint64_t error, + int& exp, Handler& handler) { + const fp one(1ULL << -value.e, value.e); + // The integral part of scaled value (p1 in Grisu) = value / one. It cannot be + // zero because it contains a product of two 64-bit numbers with MSB set (due + // to normalization) - 1, shifted right by at most 60 bits. + auto integral = static_cast<uint32_t>(value.f >> -one.e); + FMT_ASSERT(integral != 0, ""); + FMT_ASSERT(integral == value.f >> -one.e, ""); + // The fractional part of scaled value (p2 in Grisu) c = value % one. + uint64_t fractional = value.f & (one.f - 1); + exp = count_digits(integral); // kappa in Grisu. + // Divide by 10 to prevent overflow. + auto result = handler.on_start(data::powers_of_10_64[exp - 1] << -one.e, + value.f / 10, error * 10, exp); + if (result != digits::more) return result; + // Generate digits for the integral part. This can produce up to 10 digits. + do { + uint32_t digit = 0; + auto divmod_integral = [&](uint32_t divisor) { + digit = integral / divisor; + integral %= divisor; + }; + // This optimization by Milo Yip reduces the number of integer divisions by + // one per iteration. + switch (exp) { + case 10: + divmod_integral(1000000000); + break; + case 9: + divmod_integral(100000000); + break; + case 8: + divmod_integral(10000000); + break; + case 7: + divmod_integral(1000000); + break; + case 6: + divmod_integral(100000); + break; + case 5: + divmod_integral(10000); + break; + case 4: + divmod_integral(1000); + break; + case 3: + divmod_integral(100); + break; + case 2: + divmod_integral(10); + break; + case 1: + digit = integral; + integral = 0; + break; + default: + FMT_ASSERT(false, "invalid number of digits"); + } + --exp; + auto remainder = (static_cast<uint64_t>(integral) << -one.e) + fractional; + result = handler.on_digit(static_cast<char>('0' + digit), + data::powers_of_10_64[exp] << -one.e, remainder, + error, exp, true); + if (result != digits::more) return result; + } while (exp > 0); + // Generate digits for the fractional part. + for (;;) { + fractional *= 10; + error *= 10; + char digit = static_cast<char>('0' + (fractional >> -one.e)); + fractional &= one.f - 1; + --exp; + result = handler.on_digit(digit, one.f, fractional, error, exp, false); + if (result != digits::more) return result; + } +} + +// The fixed precision digit handler. +struct fixed_handler { + char* buf; + int size; + int precision; + int exp10; + bool fixed; + + digits::result on_start(uint64_t divisor, uint64_t remainder, uint64_t error, + int& exp) { + // Non-fixed formats require at least one digit and no precision adjustment. + if (!fixed) return digits::more; + // Adjust fixed precision by exponent because it is relative to decimal + // point. + precision += exp + exp10; + // Check if precision is satisfied just by leading zeros, e.g. + // format("{:.2f}", 0.001) gives "0.00" without generating any digits. + if (precision > 0) return digits::more; + if (precision < 0) return digits::done; + auto dir = get_round_direction(divisor, remainder, error); + if (dir == round_direction::unknown) return digits::error; + buf[size++] = dir == round_direction::up ? '1' : '0'; + return digits::done; + } + + digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder, + uint64_t error, int, bool integral) { + FMT_ASSERT(remainder < divisor, ""); + buf[size++] = digit; + if (!integral && error >= remainder) return digits::error; + if (size < precision) return digits::more; + if (!integral) { + // Check if error * 2 < divisor with overflow prevention. + // The check is not needed for the integral part because error = 1 + // and divisor > (1 << 32) there. + if (error >= divisor || error >= divisor - error) return digits::error; + } else { + FMT_ASSERT(error == 1 && divisor > 2, ""); + } + auto dir = get_round_direction(divisor, remainder, error); + if (dir != round_direction::up) + return dir == round_direction::down ? digits::done : digits::error; + ++buf[size - 1]; + for (int i = size - 1; i > 0 && buf[i] > '9'; --i) { + buf[i] = '0'; + ++buf[i - 1]; + } + if (buf[0] > '9') { + buf[0] = '1'; + if (fixed) + buf[size++] = '0'; + else + ++exp10; + } + return digits::done; + } +}; + +// Implementation of Dragonbox algorithm: https://github.com/jk-jeon/dragonbox. +namespace dragonbox { +// Computes 128-bit result of multiplication of two 64-bit unsigned integers. +FMT_SAFEBUFFERS inline uint128_wrapper umul128(uint64_t x, + uint64_t y) FMT_NOEXCEPT { +#if FMT_USE_INT128 + return static_cast<uint128_t>(x) * static_cast<uint128_t>(y); +#elif defined(_MSC_VER) && defined(_M_X64) + uint128_wrapper result; + result.low_ = _umul128(x, y, &result.high_); + return result; +#else + const uint64_t mask = (uint64_t(1) << 32) - uint64_t(1); + + uint64_t a = x >> 32; + uint64_t b = x & mask; + uint64_t c = y >> 32; + uint64_t d = y & mask; + + uint64_t ac = a * c; + uint64_t bc = b * c; + uint64_t ad = a * d; + uint64_t bd = b * d; + + uint64_t intermediate = (bd >> 32) + (ad & mask) + (bc & mask); + + return {ac + (intermediate >> 32) + (ad >> 32) + (bc >> 32), + (intermediate << 32) + (bd & mask)}; +#endif +} + +// Computes upper 64 bits of multiplication of two 64-bit unsigned integers. +FMT_SAFEBUFFERS inline uint64_t umul128_upper64(uint64_t x, + uint64_t y) FMT_NOEXCEPT { +#if FMT_USE_INT128 + auto p = static_cast<uint128_t>(x) * static_cast<uint128_t>(y); + return static_cast<uint64_t>(p >> 64); +#elif defined(_MSC_VER) && defined(_M_X64) + return __umulh(x, y); +#else + return umul128(x, y).high(); +#endif +} + +// Computes upper 64 bits of multiplication of a 64-bit unsigned integer and a +// 128-bit unsigned integer. +FMT_SAFEBUFFERS inline uint64_t umul192_upper64(uint64_t x, uint128_wrapper y) + FMT_NOEXCEPT { + uint128_wrapper g0 = umul128(x, y.high()); + g0 += umul128_upper64(x, y.low()); + return g0.high(); +} + +// Computes upper 32 bits of multiplication of a 32-bit unsigned integer and a +// 64-bit unsigned integer. +inline uint32_t umul96_upper32(uint32_t x, uint64_t y) FMT_NOEXCEPT { + return static_cast<uint32_t>(umul128_upper64(x, y)); +} + +// Computes middle 64 bits of multiplication of a 64-bit unsigned integer and a +// 128-bit unsigned integer. +FMT_SAFEBUFFERS inline uint64_t umul192_middle64(uint64_t x, uint128_wrapper y) + FMT_NOEXCEPT { + uint64_t g01 = x * y.high(); + uint64_t g10 = umul128_upper64(x, y.low()); + return g01 + g10; +} + +// Computes lower 64 bits of multiplication of a 32-bit unsigned integer and a +// 64-bit unsigned integer. +inline uint64_t umul96_lower64(uint32_t x, uint64_t y) FMT_NOEXCEPT { + return x * y; +} + +// Computes floor(log10(pow(2, e))) for e in [-1700, 1700] using the method from +// https://fmt.dev/papers/Grisu-Exact.pdf#page=5, section 3.4. +inline int floor_log10_pow2(int e) FMT_NOEXCEPT { + FMT_ASSERT(e <= 1700 && e >= -1700, "too large exponent"); + const int shift = 22; + return (e * static_cast<int>(data::log10_2_significand >> (64 - shift))) >> + shift; +} + +// Various fast log computations. +inline int floor_log2_pow10(int e) FMT_NOEXCEPT { + FMT_ASSERT(e <= 1233 && e >= -1233, "too large exponent"); + const uint64_t log2_10_integer_part = 3; + const uint64_t log2_10_fractional_digits = 0x5269e12f346e2bf9; + const int shift_amount = 19; + return (e * static_cast<int>( + (log2_10_integer_part << shift_amount) | + (log2_10_fractional_digits >> (64 - shift_amount)))) >> + shift_amount; +} +inline int floor_log10_pow2_minus_log10_4_over_3(int e) FMT_NOEXCEPT { + FMT_ASSERT(e <= 1700 && e >= -1700, "too large exponent"); + const uint64_t log10_4_over_3_fractional_digits = 0x1ffbfc2bbc780375; + const int shift_amount = 22; + return (e * static_cast<int>(data::log10_2_significand >> + (64 - shift_amount)) - + static_cast<int>(log10_4_over_3_fractional_digits >> + (64 - shift_amount))) >> + shift_amount; +} + +// Returns true iff x is divisible by pow(2, exp). +inline bool divisible_by_power_of_2(uint32_t x, int exp) FMT_NOEXCEPT { + FMT_ASSERT(exp >= 1, ""); + FMT_ASSERT(x != 0, ""); +#ifdef FMT_BUILTIN_CTZ + return FMT_BUILTIN_CTZ(x) >= exp; +#else + return exp < num_bits<uint32_t>() && x == ((x >> exp) << exp); +#endif +} +inline bool divisible_by_power_of_2(uint64_t x, int exp) FMT_NOEXCEPT { + FMT_ASSERT(exp >= 1, ""); + FMT_ASSERT(x != 0, ""); +#ifdef FMT_BUILTIN_CTZLL + return FMT_BUILTIN_CTZLL(x) >= exp; +#else + return exp < num_bits<uint64_t>() && x == ((x >> exp) << exp); +#endif +} + +// Returns true iff x is divisible by pow(5, exp). +inline bool divisible_by_power_of_5(uint32_t x, int exp) FMT_NOEXCEPT { + FMT_ASSERT(exp <= 10, "too large exponent"); + return x * data::divtest_table_for_pow5_32[exp].mod_inv <= + data::divtest_table_for_pow5_32[exp].max_quotient; +} +inline bool divisible_by_power_of_5(uint64_t x, int exp) FMT_NOEXCEPT { + FMT_ASSERT(exp <= 23, "too large exponent"); + return x * data::divtest_table_for_pow5_64[exp].mod_inv <= + data::divtest_table_for_pow5_64[exp].max_quotient; +} + +// Replaces n by floor(n / pow(5, N)) returning true if and only if n is +// divisible by pow(5, N). +// Precondition: n <= 2 * pow(5, N + 1). +template <int N> +bool check_divisibility_and_divide_by_pow5(uint32_t& n) FMT_NOEXCEPT { + static constexpr struct { + uint32_t magic_number; + int bits_for_comparison; + uint32_t threshold; + int shift_amount; + } infos[] = {{0xcccd, 16, 0x3333, 18}, {0xa429, 8, 0x0a, 20}}; + constexpr auto info = infos[N - 1]; + n *= info.magic_number; + const uint32_t comparison_mask = (1u << info.bits_for_comparison) - 1; + bool result = (n & comparison_mask) <= info.threshold; + n >>= info.shift_amount; + return result; +} + +// Computes floor(n / pow(10, N)) for small n and N. +// Precondition: n <= pow(10, N + 1). +template <int N> uint32_t small_division_by_pow10(uint32_t n) FMT_NOEXCEPT { + static constexpr struct { + uint32_t magic_number; + int shift_amount; + uint32_t divisor_times_10; + } infos[] = {{0xcccd, 19, 100}, {0xa3d8, 22, 1000}}; + constexpr auto info = infos[N - 1]; + FMT_ASSERT(n <= info.divisor_times_10, "n is too large"); + return n * info.magic_number >> info.shift_amount; +} + +// Computes floor(n / 10^(kappa + 1)) (float) +inline uint32_t divide_by_10_to_kappa_plus_1(uint32_t n) FMT_NOEXCEPT { + return n / float_info<float>::big_divisor; +} +// Computes floor(n / 10^(kappa + 1)) (double) +inline uint64_t divide_by_10_to_kappa_plus_1(uint64_t n) FMT_NOEXCEPT { + return umul128_upper64(n, 0x83126e978d4fdf3c) >> 9; +} + +// Various subroutines using pow10 cache +template <class T> struct cache_accessor; + +template <> struct cache_accessor<float> { + using carrier_uint = float_info<float>::carrier_uint; + using cache_entry_type = uint64_t; + + static uint64_t get_cached_power(int k) FMT_NOEXCEPT { + FMT_ASSERT(k >= float_info<float>::min_k && k <= float_info<float>::max_k, + "k is out of range"); + return data::dragonbox_pow10_significands_64[k - float_info<float>::min_k]; + } + + static carrier_uint compute_mul(carrier_uint u, + const cache_entry_type& cache) FMT_NOEXCEPT { + return umul96_upper32(u, cache); + } + + static uint32_t compute_delta(const cache_entry_type& cache, + int beta_minus_1) FMT_NOEXCEPT { + return static_cast<uint32_t>(cache >> (64 - 1 - beta_minus_1)); + } + + static bool compute_mul_parity(carrier_uint two_f, + const cache_entry_type& cache, + int beta_minus_1) FMT_NOEXCEPT { + FMT_ASSERT(beta_minus_1 >= 1, ""); + FMT_ASSERT(beta_minus_1 < 64, ""); + + return ((umul96_lower64(two_f, cache) >> (64 - beta_minus_1)) & 1) != 0; + } + + static carrier_uint compute_left_endpoint_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return static_cast<carrier_uint>( + (cache - (cache >> (float_info<float>::significand_bits + 2))) >> + (64 - float_info<float>::significand_bits - 1 - beta_minus_1)); + } + + static carrier_uint compute_right_endpoint_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return static_cast<carrier_uint>( + (cache + (cache >> (float_info<float>::significand_bits + 1))) >> + (64 - float_info<float>::significand_bits - 1 - beta_minus_1)); + } + + static carrier_uint compute_round_up_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return (static_cast<carrier_uint>( + cache >> + (64 - float_info<float>::significand_bits - 2 - beta_minus_1)) + + 1) / + 2; + } +}; + +template <> struct cache_accessor<double> { + using carrier_uint = float_info<double>::carrier_uint; + using cache_entry_type = uint128_wrapper; + + static uint128_wrapper get_cached_power(int k) FMT_NOEXCEPT { + FMT_ASSERT(k >= float_info<double>::min_k && k <= float_info<double>::max_k, + "k is out of range"); + +#if FMT_USE_FULL_CACHE_DRAGONBOX + return data::dragonbox_pow10_significands_128[k - + float_info<double>::min_k]; +#else + static const int compression_ratio = 27; + + // Compute base index. + int cache_index = (k - float_info<double>::min_k) / compression_ratio; + int kb = cache_index * compression_ratio + float_info<double>::min_k; + int offset = k - kb; + + // Get base cache. + uint128_wrapper base_cache = + data::dragonbox_pow10_significands_128[cache_index]; + if (offset == 0) return base_cache; + + // Compute the required amount of bit-shift. + int alpha = floor_log2_pow10(kb + offset) - floor_log2_pow10(kb) - offset; + FMT_ASSERT(alpha > 0 && alpha < 64, "shifting error detected"); + + // Try to recover the real cache. + uint64_t pow5 = data::powers_of_5_64[offset]; + uint128_wrapper recovered_cache = umul128(base_cache.high(), pow5); + uint128_wrapper middle_low = + umul128(base_cache.low() - (kb < 0 ? 1u : 0u), pow5); + + recovered_cache += middle_low.high(); + + uint64_t high_to_middle = recovered_cache.high() << (64 - alpha); + uint64_t middle_to_low = recovered_cache.low() << (64 - alpha); + + recovered_cache = + uint128_wrapper{(recovered_cache.low() >> alpha) | high_to_middle, + ((middle_low.low() >> alpha) | middle_to_low)}; + + if (kb < 0) recovered_cache += 1; + + // Get error. + int error_idx = (k - float_info<double>::min_k) / 16; + uint32_t error = (data::dragonbox_pow10_recovery_errors[error_idx] >> + ((k - float_info<double>::min_k) % 16) * 2) & + 0x3; + + // Add the error back. + FMT_ASSERT(recovered_cache.low() + error >= recovered_cache.low(), ""); + return {recovered_cache.high(), recovered_cache.low() + error}; +#endif + } + + static carrier_uint compute_mul(carrier_uint u, + const cache_entry_type& cache) FMT_NOEXCEPT { + return umul192_upper64(u, cache); + } + + static uint32_t compute_delta(cache_entry_type const& cache, + int beta_minus_1) FMT_NOEXCEPT { + return static_cast<uint32_t>(cache.high() >> (64 - 1 - beta_minus_1)); + } + + static bool compute_mul_parity(carrier_uint two_f, + const cache_entry_type& cache, + int beta_minus_1) FMT_NOEXCEPT { + FMT_ASSERT(beta_minus_1 >= 1, ""); + FMT_ASSERT(beta_minus_1 < 64, ""); + + return ((umul192_middle64(two_f, cache) >> (64 - beta_minus_1)) & 1) != 0; + } + + static carrier_uint compute_left_endpoint_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return (cache.high() - + (cache.high() >> (float_info<double>::significand_bits + 2))) >> + (64 - float_info<double>::significand_bits - 1 - beta_minus_1); + } + + static carrier_uint compute_right_endpoint_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return (cache.high() + + (cache.high() >> (float_info<double>::significand_bits + 1))) >> + (64 - float_info<double>::significand_bits - 1 - beta_minus_1); + } + + static carrier_uint compute_round_up_for_shorter_interval_case( + const cache_entry_type& cache, int beta_minus_1) FMT_NOEXCEPT { + return ((cache.high() >> + (64 - float_info<double>::significand_bits - 2 - beta_minus_1)) + + 1) / + 2; + } +}; + +// Various integer checks +template <class T> +bool is_left_endpoint_integer_shorter_interval(int exponent) FMT_NOEXCEPT { + return exponent >= + float_info< + T>::case_shorter_interval_left_endpoint_lower_threshold && + exponent <= + float_info<T>::case_shorter_interval_left_endpoint_upper_threshold; +} +template <class T> +bool is_endpoint_integer(typename float_info<T>::carrier_uint two_f, + int exponent, int minus_k) FMT_NOEXCEPT { + if (exponent < float_info<T>::case_fc_pm_half_lower_threshold) return false; + // For k >= 0. + if (exponent <= float_info<T>::case_fc_pm_half_upper_threshold) return true; + // For k < 0. + if (exponent > float_info<T>::divisibility_check_by_5_threshold) return false; + return divisible_by_power_of_5(two_f, minus_k); +} + +template <class T> +bool is_center_integer(typename float_info<T>::carrier_uint two_f, int exponent, + int minus_k) FMT_NOEXCEPT { + // Exponent for 5 is negative. + if (exponent > float_info<T>::divisibility_check_by_5_threshold) return false; + if (exponent > float_info<T>::case_fc_upper_threshold) + return divisible_by_power_of_5(two_f, minus_k); + // Both exponents are nonnegative. + if (exponent >= float_info<T>::case_fc_lower_threshold) return true; + // Exponent for 2 is negative. + return divisible_by_power_of_2(two_f, minus_k - exponent + 1); +} + +// Remove trailing zeros from n and return the number of zeros removed (float) +FMT_ALWAYS_INLINE int remove_trailing_zeros(uint32_t& n) FMT_NOEXCEPT { +#ifdef FMT_BUILTIN_CTZ + int t = FMT_BUILTIN_CTZ(n); +#else + int t = ctz(n); +#endif + if (t > float_info<float>::max_trailing_zeros) + t = float_info<float>::max_trailing_zeros; + + const uint32_t mod_inv1 = 0xcccccccd; + const uint32_t max_quotient1 = 0x33333333; + const uint32_t mod_inv2 = 0xc28f5c29; + const uint32_t max_quotient2 = 0x0a3d70a3; + + int s = 0; + for (; s < t - 1; s += 2) { + if (n * mod_inv2 > max_quotient2) break; + n *= mod_inv2; + } + if (s < t && n * mod_inv1 <= max_quotient1) { + n *= mod_inv1; + ++s; + } + n >>= s; + return s; +} + +// Removes trailing zeros and returns the number of zeros removed (double) +FMT_ALWAYS_INLINE int remove_trailing_zeros(uint64_t& n) FMT_NOEXCEPT { +#ifdef FMT_BUILTIN_CTZLL + int t = FMT_BUILTIN_CTZLL(n); +#else + int t = ctzll(n); +#endif + if (t > float_info<double>::max_trailing_zeros) + t = float_info<double>::max_trailing_zeros; + // Divide by 10^8 and reduce to 32-bits + // Since ret_value.significand <= (2^64 - 1) / 1000 < 10^17, + // both of the quotient and the r should fit in 32-bits + + const uint32_t mod_inv1 = 0xcccccccd; + const uint32_t max_quotient1 = 0x33333333; + const uint64_t mod_inv8 = 0xc767074b22e90e21; + const uint64_t max_quotient8 = 0x00002af31dc46118; + + // If the number is divisible by 1'0000'0000, work with the quotient + if (t >= 8) { + auto quotient_candidate = n * mod_inv8; + + if (quotient_candidate <= max_quotient8) { + auto quotient = static_cast<uint32_t>(quotient_candidate >> 8); + + int s = 8; + for (; s < t; ++s) { + if (quotient * mod_inv1 > max_quotient1) break; + quotient *= mod_inv1; + } + quotient >>= (s - 8); + n = quotient; + return s; + } + } + + // Otherwise, work with the remainder + auto quotient = static_cast<uint32_t>(n / 100000000); + auto remainder = static_cast<uint32_t>(n - 100000000 * quotient); + + if (t == 0 || remainder * mod_inv1 > max_quotient1) { + return 0; + } + remainder *= mod_inv1; + + if (t == 1 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 1) + quotient * 10000000ull; + return 1; + } + remainder *= mod_inv1; + + if (t == 2 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 2) + quotient * 1000000ull; + return 2; + } + remainder *= mod_inv1; + + if (t == 3 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 3) + quotient * 100000ull; + return 3; + } + remainder *= mod_inv1; + + if (t == 4 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 4) + quotient * 10000ull; + return 4; + } + remainder *= mod_inv1; + + if (t == 5 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 5) + quotient * 1000ull; + return 5; + } + remainder *= mod_inv1; + + if (t == 6 || remainder * mod_inv1 > max_quotient1) { + n = (remainder >> 6) + quotient * 100ull; + return 6; + } + remainder *= mod_inv1; + + n = (remainder >> 7) + quotient * 10ull; + return 7; +} + +// The main algorithm for shorter interval case +template <class T> +FMT_ALWAYS_INLINE FMT_SAFEBUFFERS decimal_fp<T> shorter_interval_case( + int exponent) FMT_NOEXCEPT { + decimal_fp<T> ret_value; + // Compute k and beta + const int minus_k = floor_log10_pow2_minus_log10_4_over_3(exponent); + const int beta_minus_1 = exponent + floor_log2_pow10(-minus_k); + + // Compute xi and zi + using cache_entry_type = typename cache_accessor<T>::cache_entry_type; + const cache_entry_type cache = cache_accessor<T>::get_cached_power(-minus_k); + + auto xi = cache_accessor<T>::compute_left_endpoint_for_shorter_interval_case( + cache, beta_minus_1); + auto zi = cache_accessor<T>::compute_right_endpoint_for_shorter_interval_case( + cache, beta_minus_1); + + // If the left endpoint is not an integer, increase it + if (!is_left_endpoint_integer_shorter_interval<T>(exponent)) ++xi; + + // Try bigger divisor + ret_value.significand = zi / 10; + + // If succeed, remove trailing zeros if necessary and return + if (ret_value.significand * 10 >= xi) { + ret_value.exponent = minus_k + 1; + ret_value.exponent += remove_trailing_zeros(ret_value.significand); + return ret_value; + } + + // Otherwise, compute the round-up of y + ret_value.significand = + cache_accessor<T>::compute_round_up_for_shorter_interval_case( + cache, beta_minus_1); + ret_value.exponent = minus_k; + + // When tie occurs, choose one of them according to the rule + if (exponent >= float_info<T>::shorter_interval_tie_lower_threshold && + exponent <= float_info<T>::shorter_interval_tie_upper_threshold) { + ret_value.significand = ret_value.significand % 2 == 0 + ? ret_value.significand + : ret_value.significand - 1; + } else if (ret_value.significand < xi) { + ++ret_value.significand; + } + return ret_value; +} + +template <typename T> +FMT_SAFEBUFFERS decimal_fp<T> to_decimal(T x) FMT_NOEXCEPT { + // Step 1: integer promotion & Schubfach multiplier calculation. + + using carrier_uint = typename float_info<T>::carrier_uint; + using cache_entry_type = typename cache_accessor<T>::cache_entry_type; + auto br = bit_cast<carrier_uint>(x); + + // Extract significand bits and exponent bits. + const carrier_uint significand_mask = + (static_cast<carrier_uint>(1) << float_info<T>::significand_bits) - 1; + carrier_uint significand = (br & significand_mask); + int exponent = static_cast<int>((br & exponent_mask<T>()) >> + float_info<T>::significand_bits); + + if (exponent != 0) { // Check if normal. + exponent += float_info<T>::exponent_bias - float_info<T>::significand_bits; + + // Shorter interval case; proceed like Schubfach. + if (significand == 0) return shorter_interval_case<T>(exponent); + + significand |= + (static_cast<carrier_uint>(1) << float_info<T>::significand_bits); + } else { + // Subnormal case; the interval is always regular. + if (significand == 0) return {0, 0}; + exponent = float_info<T>::min_exponent - float_info<T>::significand_bits; + } + + const bool include_left_endpoint = (significand % 2 == 0); + const bool include_right_endpoint = include_left_endpoint; + + // Compute k and beta. + const int minus_k = floor_log10_pow2(exponent) - float_info<T>::kappa; + const cache_entry_type cache = cache_accessor<T>::get_cached_power(-minus_k); + const int beta_minus_1 = exponent + floor_log2_pow10(-minus_k); + + // Compute zi and deltai + // 10^kappa <= deltai < 10^(kappa + 1) + const uint32_t deltai = cache_accessor<T>::compute_delta(cache, beta_minus_1); + const carrier_uint two_fc = significand << 1; + const carrier_uint two_fr = two_fc | 1; + const carrier_uint zi = + cache_accessor<T>::compute_mul(two_fr << beta_minus_1, cache); + + // Step 2: Try larger divisor; remove trailing zeros if necessary + + // Using an upper bound on zi, we might be able to optimize the division + // better than the compiler; we are computing zi / big_divisor here + decimal_fp<T> ret_value; + ret_value.significand = divide_by_10_to_kappa_plus_1(zi); + uint32_t r = static_cast<uint32_t>(zi - float_info<T>::big_divisor * + ret_value.significand); + + if (r > deltai) { + goto small_divisor_case_label; + } else if (r < deltai) { + // Exclude the right endpoint if necessary + if (r == 0 && !include_right_endpoint && + is_endpoint_integer<T>(two_fr, exponent, minus_k)) { + --ret_value.significand; + r = float_info<T>::big_divisor; + goto small_divisor_case_label; + } + } else { + // r == deltai; compare fractional parts + // Check conditions in the order different from the paper + // to take advantage of short-circuiting + const carrier_uint two_fl = two_fc - 1; + if ((!include_left_endpoint || + !is_endpoint_integer<T>(two_fl, exponent, minus_k)) && + !cache_accessor<T>::compute_mul_parity(two_fl, cache, beta_minus_1)) { + goto small_divisor_case_label; + } + } + ret_value.exponent = minus_k + float_info<T>::kappa + 1; + + // We may need to remove trailing zeros + ret_value.exponent += remove_trailing_zeros(ret_value.significand); + return ret_value; + + // Step 3: Find the significand with the smaller divisor + +small_divisor_case_label: + ret_value.significand *= 10; + ret_value.exponent = minus_k + float_info<T>::kappa; + + const uint32_t mask = (1u << float_info<T>::kappa) - 1; + auto dist = r - (deltai / 2) + (float_info<T>::small_divisor / 2); + + // Is dist divisible by 2^kappa? + if ((dist & mask) == 0) { + const bool approx_y_parity = + ((dist ^ (float_info<T>::small_divisor / 2)) & 1) != 0; + dist >>= float_info<T>::kappa; + + // Is dist divisible by 5^kappa? + if (check_divisibility_and_divide_by_pow5<float_info<T>::kappa>(dist)) { + ret_value.significand += dist; + + // Check z^(f) >= epsilon^(f) + // We have either yi == zi - epsiloni or yi == (zi - epsiloni) - 1, + // where yi == zi - epsiloni if and only if z^(f) >= epsilon^(f) + // Since there are only 2 possibilities, we only need to care about the + // parity. Also, zi and r should have the same parity since the divisor + // is an even number + if (cache_accessor<T>::compute_mul_parity(two_fc, cache, beta_minus_1) != + approx_y_parity) { + --ret_value.significand; + } else { + // If z^(f) >= epsilon^(f), we might have a tie + // when z^(f) == epsilon^(f), or equivalently, when y is an integer + if (is_center_integer<T>(two_fc, exponent, minus_k)) { + ret_value.significand = ret_value.significand % 2 == 0 + ? ret_value.significand + : ret_value.significand - 1; + } + } + } + // Is dist not divisible by 5^kappa? + else { + ret_value.significand += dist; + } + } + // Is dist not divisible by 2^kappa? + else { + // Since we know dist is small, we might be able to optimize the division + // better than the compiler; we are computing dist / small_divisor here + ret_value.significand += + small_division_by_pow10<float_info<T>::kappa>(dist); + } + return ret_value; +} +} // namespace dragonbox + +// Formats value using a variation of the Fixed-Precision Positive +// Floating-Point Printout ((FPP)^2) algorithm by Steele & White: +// https://fmt.dev/p372-steele.pdf. +template <typename Double> +void fallback_format(Double d, int num_digits, bool binary32, buffer<char>& buf, + int& exp10) { + bigint numerator; // 2 * R in (FPP)^2. + bigint denominator; // 2 * S in (FPP)^2. + // lower and upper are differences between value and corresponding boundaries. + bigint lower; // (M^- in (FPP)^2). + bigint upper_store; // upper's value if different from lower. + bigint* upper = nullptr; // (M^+ in (FPP)^2). + fp value; + // Shift numerator and denominator by an extra bit or two (if lower boundary + // is closer) to make lower and upper integers. This eliminates multiplication + // by 2 during later computations. + const bool is_predecessor_closer = + binary32 ? value.assign(static_cast<float>(d)) : value.assign(d); + int shift = is_predecessor_closer ? 2 : 1; + uint64_t significand = value.f << shift; + if (value.e >= 0) { + numerator.assign(significand); + numerator <<= value.e; + lower.assign(1); + lower <<= value.e; + if (shift != 1) { + upper_store.assign(1); + upper_store <<= value.e + 1; + upper = &upper_store; + } + denominator.assign_pow10(exp10); + denominator <<= shift; + } else if (exp10 < 0) { + numerator.assign_pow10(-exp10); + lower.assign(numerator); + if (shift != 1) { + upper_store.assign(numerator); + upper_store <<= 1; + upper = &upper_store; + } + numerator *= significand; + denominator.assign(1); + denominator <<= shift - value.e; + } else { + numerator.assign(significand); + denominator.assign_pow10(exp10); + denominator <<= shift - value.e; + lower.assign(1); + if (shift != 1) { + upper_store.assign(1ULL << 1); + upper = &upper_store; + } + } + // Invariant: value == (numerator / denominator) * pow(10, exp10). + if (num_digits < 0) { + // Generate the shortest representation. + if (!upper) upper = &lower; + bool even = (value.f & 1) == 0; + num_digits = 0; + char* data = buf.data(); + for (;;) { + int digit = numerator.divmod_assign(denominator); + bool low = compare(numerator, lower) - even < 0; // numerator <[=] lower. + // numerator + upper >[=] pow10: + bool high = add_compare(numerator, *upper, denominator) + even > 0; + data[num_digits++] = static_cast<char>('0' + digit); + if (low || high) { + if (!low) { + ++data[num_digits - 1]; + } else if (high) { + int result = add_compare(numerator, numerator, denominator); + // Round half to even. + if (result > 0 || (result == 0 && (digit % 2) != 0)) + ++data[num_digits - 1]; + } + buf.try_resize(to_unsigned(num_digits)); + exp10 -= num_digits - 1; + return; + } + numerator *= 10; + lower *= 10; + if (upper != &lower) *upper *= 10; + } + } + // Generate the given number of digits. + exp10 -= num_digits - 1; + if (num_digits == 0) { + buf.try_resize(1); + denominator *= 10; + buf[0] = add_compare(numerator, numerator, denominator) > 0 ? '1' : '0'; + return; + } + buf.try_resize(to_unsigned(num_digits)); + for (int i = 0; i < num_digits - 1; ++i) { + int digit = numerator.divmod_assign(denominator); + buf[i] = static_cast<char>('0' + digit); + numerator *= 10; + } + int digit = numerator.divmod_assign(denominator); + auto result = add_compare(numerator, numerator, denominator); + if (result > 0 || (result == 0 && (digit % 2) != 0)) { + if (digit == 9) { + const auto overflow = '0' + 10; + buf[num_digits - 1] = overflow; + // Propagate the carry. + for (int i = num_digits - 1; i > 0 && buf[i] == overflow; --i) { + buf[i] = '0'; + ++buf[i - 1]; + } + if (buf[0] == overflow) { + buf[0] = '1'; + ++exp10; + } + return; + } + ++digit; + } + buf[num_digits - 1] = static_cast<char>('0' + digit); +} + +template <typename T> +int format_float(T value, int precision, float_specs specs, buffer<char>& buf) { + static_assert(!std::is_same<T, float>::value, ""); + FMT_ASSERT(value >= 0, "value is negative"); + + const bool fixed = specs.format == float_format::fixed; + if (value <= 0) { // <= instead of == to silence a warning. + if (precision <= 0 || !fixed) { + buf.push_back('0'); + return 0; + } + buf.try_resize(to_unsigned(precision)); + std::uninitialized_fill_n(buf.data(), precision, '0'); + return -precision; + } + + if (!specs.use_grisu) return snprintf_float(value, precision, specs, buf); + + if (precision < 0) { + // Use Dragonbox for the shortest format. + if (specs.binary32) { + auto dec = dragonbox::to_decimal(static_cast<float>(value)); + write<char>(buffer_appender<char>(buf), dec.significand); + return dec.exponent; + } + auto dec = dragonbox::to_decimal(static_cast<double>(value)); + write<char>(buffer_appender<char>(buf), dec.significand); + return dec.exponent; + } + + // Use Grisu + Dragon4 for the given precision: + // https://www.cs.tufts.edu/~nr/cs257/archive/florian-loitsch/printf.pdf. + int exp = 0; + const int min_exp = -60; // alpha in Grisu. + int cached_exp10 = 0; // K in Grisu. + fp normalized = normalize(fp(value)); + const auto cached_pow = get_cached_power( + min_exp - (normalized.e + fp::significand_size), cached_exp10); + normalized = normalized * cached_pow; + // Limit precision to the maximum possible number of significant digits in an + // IEEE754 double because we don't need to generate zeros. + const int max_double_digits = 767; + if (precision > max_double_digits) precision = max_double_digits; + fixed_handler handler{buf.data(), 0, precision, -cached_exp10, fixed}; + if (grisu_gen_digits(normalized, 1, exp, handler) == digits::error) { + exp += handler.size - cached_exp10 - 1; + fallback_format(value, handler.precision, specs.binary32, buf, exp); + } else { + exp += handler.exp10; + buf.try_resize(to_unsigned(handler.size)); + } + if (!fixed && !specs.showpoint) { + // Remove trailing zeros. + auto num_digits = buf.size(); + while (num_digits > 0 && buf[num_digits - 1] == '0') { + --num_digits; + ++exp; + } + buf.try_resize(num_digits); + } + return exp; +} // namespace detail + +template <typename T> +int snprintf_float(T value, int precision, float_specs specs, + buffer<char>& buf) { + // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail. + FMT_ASSERT(buf.capacity() > buf.size(), "empty buffer"); + static_assert(!std::is_same<T, float>::value, ""); + + // Subtract 1 to account for the difference in precision since we use %e for + // both general and exponent format. + if (specs.format == float_format::general || + specs.format == float_format::exp) + precision = (precision >= 0 ? precision : 6) - 1; + + // Build the format string. + enum { max_format_size = 7 }; // The longest format is "%#.*Le". + char format[max_format_size]; + char* format_ptr = format; + *format_ptr++ = '%'; + if (specs.showpoint && specs.format == float_format::hex) *format_ptr++ = '#'; + if (precision >= 0) { + *format_ptr++ = '.'; + *format_ptr++ = '*'; + } + if (std::is_same<T, long double>()) *format_ptr++ = 'L'; + *format_ptr++ = specs.format != float_format::hex + ? (specs.format == float_format::fixed ? 'f' : 'e') + : (specs.upper ? 'A' : 'a'); + *format_ptr = '\0'; + + // Format using snprintf. + auto offset = buf.size(); + for (;;) { + auto begin = buf.data() + offset; + auto capacity = buf.capacity() - offset; +#ifdef FMT_FUZZ + if (precision > 100000) + throw std::runtime_error( + "fuzz mode - avoid large allocation inside snprintf"); +#endif + // Suppress the warning about a nonliteral format string. + // Cannot use auto because of a bug in MinGW (#1532). + int (*snprintf_ptr)(char*, size_t, const char*, ...) = FMT_SNPRINTF; + int result = precision >= 0 + ? snprintf_ptr(begin, capacity, format, precision, value) + : snprintf_ptr(begin, capacity, format, value); + if (result < 0) { + // The buffer will grow exponentially. + buf.try_reserve(buf.capacity() + 1); + continue; + } + auto size = to_unsigned(result); + // Size equal to capacity means that the last character was truncated. + if (size >= capacity) { + buf.try_reserve(size + offset + 1); // Add 1 for the terminating '\0'. + continue; + } + auto is_digit = [](char c) { return c >= '0' && c <= '9'; }; + if (specs.format == float_format::fixed) { + if (precision == 0) { + buf.try_resize(size); + return 0; + } + // Find and remove the decimal point. + auto end = begin + size, p = end; + do { + --p; + } while (is_digit(*p)); + int fraction_size = static_cast<int>(end - p - 1); + std::memmove(p, p + 1, to_unsigned(fraction_size)); + buf.try_resize(size - 1); + return -fraction_size; + } + if (specs.format == float_format::hex) { + buf.try_resize(size + offset); + return 0; + } + // Find and parse the exponent. + auto end = begin + size, exp_pos = end; + do { + --exp_pos; + } while (*exp_pos != 'e'); + char sign = exp_pos[1]; + assert(sign == '+' || sign == '-'); + int exp = 0; + auto p = exp_pos + 2; // Skip 'e' and sign. + do { + assert(is_digit(*p)); + exp = exp * 10 + (*p++ - '0'); + } while (p != end); + if (sign == '-') exp = -exp; + int fraction_size = 0; + if (exp_pos != begin + 1) { + // Remove trailing zeros. + auto fraction_end = exp_pos - 1; + while (*fraction_end == '0') --fraction_end; + // Move the fractional part left to get rid of the decimal point. + fraction_size = static_cast<int>(fraction_end - begin - 1); + std::memmove(begin + 1, begin + 2, to_unsigned(fraction_size)); + } + buf.try_resize(to_unsigned(fraction_size) + offset + 1); + return exp - fraction_size; + } +} + +// A public domain branchless UTF-8 decoder by Christopher Wellons: +// https://github.com/skeeto/branchless-utf8 +/* Decode the next character, c, from buf, reporting errors in e. + * + * Since this is a branchless decoder, four bytes will be read from the + * buffer regardless of the actual length of the next character. This + * means the buffer _must_ have at least three bytes of zero padding + * following the end of the data stream. + * + * Errors are reported in e, which will be non-zero if the parsed + * character was somehow invalid: invalid byte sequence, non-canonical + * encoding, or a surrogate half. + * + * The function returns a pointer to the next character. When an error + * occurs, this pointer will be a guess that depends on the particular + * error, but it will always advance at least one byte. + */ +inline const char* utf8_decode(const char* buf, uint32_t* c, int* e) { + static const int masks[] = {0x00, 0x7f, 0x1f, 0x0f, 0x07}; + static const uint32_t mins[] = {4194304, 0, 128, 2048, 65536}; + static const int shiftc[] = {0, 18, 12, 6, 0}; + static const int shifte[] = {0, 6, 4, 2, 0}; + + int len = code_point_length(buf); + const char* next = buf + len; + + // Assume a four-byte character and load four bytes. Unused bits are + // shifted out. + auto s = reinterpret_cast<const unsigned char*>(buf); + *c = uint32_t(s[0] & masks[len]) << 18; + *c |= uint32_t(s[1] & 0x3f) << 12; + *c |= uint32_t(s[2] & 0x3f) << 6; + *c |= uint32_t(s[3] & 0x3f) << 0; + *c >>= shiftc[len]; + + // Accumulate the various error conditions. + *e = (*c < mins[len]) << 6; // non-canonical encoding + *e |= ((*c >> 11) == 0x1b) << 7; // surrogate half? + *e |= (*c > 0x10FFFF) << 8; // out of range? + *e |= (s[1] & 0xc0) >> 2; + *e |= (s[2] & 0xc0) >> 4; + *e |= (s[3]) >> 6; + *e ^= 0x2a; // top two bits of each tail byte correct? + *e >>= shifte[len]; + + return next; +} + +struct stringifier { + template <typename T> FMT_INLINE std::string operator()(T value) const { + return to_string(value); + } + std::string operator()(basic_format_arg<format_context>::handle h) const { + memory_buffer buf; + format_parse_context parse_ctx({}); + format_context format_ctx(buffer_appender<char>(buf), {}, {}); + h.format(parse_ctx, format_ctx); + return to_string(buf); + } +}; +} // namespace detail + +template <> struct formatter<detail::bigint> { + format_parse_context::iterator parse(format_parse_context& ctx) { + return ctx.begin(); + } + + format_context::iterator format(const detail::bigint& n, + format_context& ctx) { + auto out = ctx.out(); + bool first = true; + for (auto i = n.bigits_.size(); i > 0; --i) { + auto value = n.bigits_[i - 1u]; + if (first) { + out = format_to(out, "{:x}", value); + first = false; + continue; + } + out = format_to(out, "{:08x}", value); + } + if (n.exp_ > 0) + out = format_to(out, "p{}", n.exp_ * detail::bigint::bigit_bits); + return out; + } +}; + +FMT_FUNC detail::utf8_to_utf16::utf8_to_utf16(string_view s) { + auto transcode = [this](const char* p) { + auto cp = uint32_t(); + auto error = 0; + p = utf8_decode(p, &cp, &error); + if (error != 0) FMT_THROW(std::runtime_error("invalid utf8")); + if (cp <= 0xFFFF) { + buffer_.push_back(static_cast<wchar_t>(cp)); + } else { + cp -= 0x10000; + buffer_.push_back(static_cast<wchar_t>(0xD800 + (cp >> 10))); + buffer_.push_back(static_cast<wchar_t>(0xDC00 + (cp & 0x3FF))); + } + return p; + }; + auto p = s.data(); + const size_t block_size = 4; // utf8_decode always reads blocks of 4 chars. + if (s.size() >= block_size) { + for (auto end = p + s.size() - block_size + 1; p < end;) p = transcode(p); + } + if (auto num_chars_left = s.data() + s.size() - p) { + char buf[2 * block_size - 1] = {}; + memcpy(buf, p, to_unsigned(num_chars_left)); + p = buf; + do { + p = transcode(p); + } while (p - buf < num_chars_left); + } + buffer_.push_back(0); +} + +FMT_FUNC void format_system_error(detail::buffer<char>& out, int error_code, + string_view message) FMT_NOEXCEPT { + FMT_TRY { + memory_buffer buf; + buf.resize(inline_buffer_size); + for (;;) { + char* system_message = &buf[0]; + int result = + detail::safe_strerror(error_code, system_message, buf.size()); + if (result == 0) { + format_to(detail::buffer_appender<char>(out), "{}: {}", message, + system_message); + return; + } + if (result != ERANGE) + break; // Can't get error message, report error code instead. + buf.resize(buf.size() * 2); + } + } + FMT_CATCH(...) {} + format_error_code(out, error_code, message); +} + +FMT_FUNC void detail::error_handler::on_error(const char* message) { + FMT_THROW(format_error(message)); +} + +FMT_FUNC void report_system_error(int error_code, + fmt::string_view message) FMT_NOEXCEPT { + report_error(format_system_error, error_code, message); +} + +FMT_FUNC std::string detail::vformat(string_view format_str, format_args args) { + if (format_str.size() == 2 && equal2(format_str.data(), "{}")) { + auto arg = args.get(0); + if (!arg) error_handler().on_error("argument not found"); + return visit_format_arg(stringifier(), arg); + } + memory_buffer buffer; + detail::vformat_to(buffer, format_str, args); + return to_string(buffer); +} + +#ifdef _WIN32 +namespace detail { +using dword = conditional_t<sizeof(long) == 4, unsigned long, unsigned>; +extern "C" __declspec(dllimport) int __stdcall WriteConsoleW( // + void*, const void*, dword, dword*, void*); +} // namespace detail +#endif + +FMT_FUNC void vprint(std::FILE* f, string_view format_str, format_args args) { + memory_buffer buffer; + detail::vformat_to(buffer, format_str, + basic_format_args<buffer_context<char>>(args)); +#ifdef _WIN32 + auto fd = _fileno(f); + if (_isatty(fd)) { + detail::utf8_to_utf16 u16(string_view(buffer.data(), buffer.size())); + auto written = detail::dword(); + if (!detail::WriteConsoleW(reinterpret_cast<void*>(_get_osfhandle(fd)), + u16.c_str(), static_cast<uint32_t>(u16.size()), + &written, nullptr)) { + FMT_THROW(format_error("failed to write to console")); + } + return; + } +#endif + detail::fwrite_fully(buffer.data(), 1, buffer.size(), f); +} + +#ifdef _WIN32 +// Print assuming legacy (non-Unicode) encoding. +FMT_FUNC void detail::vprint_mojibake(std::FILE* f, string_view format_str, + format_args args) { + memory_buffer buffer; + detail::vformat_to(buffer, format_str, + basic_format_args<buffer_context<char>>(args)); + fwrite_fully(buffer.data(), 1, buffer.size(), f); +} +#endif + +FMT_FUNC void vprint(string_view format_str, format_args args) { + vprint(stdout, format_str, args); +} + +FMT_END_NAMESPACE + +#endif // FMT_FORMAT_INL_H_ diff --git a/include/vtkdiy2/fmt/format.cc b/include/vtkdiy2/thirdparty/fmt/format.cc similarity index 98% rename from include/vtkdiy2/fmt/format.cc rename to include/vtkdiy2/thirdparty/fmt/format.cc index 41076f1633ceaf2e661b19e987a69991a5a9ef4f..679ac799a439b5c1162fc6e8f7f0d56ff9b5e2b5 100644 --- a/include/vtkdiy2/fmt/format.cc +++ b/include/vtkdiy2/thirdparty/fmt/format.cc @@ -5,7 +5,7 @@ // // For the license information refer to format.h. -#include "fmt/format-inl.h" +#include "format-inl.h" FMT_BEGIN_NAMESPACE template struct FMT_API internal::basic_data<void>; diff --git a/include/vtkdiy2/thirdparty/fmt/format.h b/include/vtkdiy2/thirdparty/fmt/format.h new file mode 100644 index 0000000000000000000000000000000000000000..1de9c387998b0b67cc63172884590821656d502b --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/format.h @@ -0,0 +1,3962 @@ +/* + Formatting library for C++ + + Copyright (c) 2012 - present, Victor Zverovich + + Permission is hereby granted, free of charge, to any person obtaining + a copy of this software and associated documentation files (the + "Software"), to deal in the Software without restriction, including + without limitation the rights to use, copy, modify, merge, publish, + distribute, sublicense, and/or sell copies of the Software, and to + permit persons to whom the Software is furnished to do so, subject to + the following conditions: + + The above copyright notice and this permission notice shall be + included in all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE + LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION + OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + + --- Optional exception to the license --- + + As an exception, if, as a result of your compiling your source code, portions + of this Software are embedded into a machine-executable object form of such + source code, you may redistribute such embedded portions in such object form + without including the above copyright and permission notices. + */ + +#ifndef FMT_FORMAT_H_ +#define FMT_FORMAT_H_ + +#define FMT_HEADER_ONLY // Added by diy for header-only usage + +#include <algorithm> +#include <cerrno> +#include <cmath> +#include <cstdint> +#include <limits> +#include <memory> +#include <stdexcept> + +#include "core.h" + +#ifdef __INTEL_COMPILER +# define FMT_ICC_VERSION __INTEL_COMPILER +#elif defined(__ICL) +# define FMT_ICC_VERSION __ICL +#else +# define FMT_ICC_VERSION 0 +#endif + +#ifdef __NVCC__ +# define FMT_CUDA_VERSION (__CUDACC_VER_MAJOR__ * 100 + __CUDACC_VER_MINOR__) +#else +# define FMT_CUDA_VERSION 0 +#endif + +#ifdef __has_builtin +# define FMT_HAS_BUILTIN(x) __has_builtin(x) +#else +# define FMT_HAS_BUILTIN(x) 0 +#endif + +#if FMT_GCC_VERSION || FMT_CLANG_VERSION +# define FMT_NOINLINE __attribute__((noinline)) +#else +# define FMT_NOINLINE +#endif + +#if __cplusplus == 201103L || __cplusplus == 201402L +# if defined(__INTEL_COMPILER) || defined(__PGI) +# define FMT_FALLTHROUGH +# elif defined(__clang__) +# define FMT_FALLTHROUGH [[clang::fallthrough]] +# elif FMT_GCC_VERSION >= 700 && \ + (!defined(__EDG_VERSION__) || __EDG_VERSION__ >= 520) +# define FMT_FALLTHROUGH [[gnu::fallthrough]] +# else +# define FMT_FALLTHROUGH +# endif +#elif FMT_HAS_CPP17_ATTRIBUTE(fallthrough) || \ + (defined(_MSVC_LANG) && _MSVC_LANG >= 201703L) +# define FMT_FALLTHROUGH [[fallthrough]] +#else +# define FMT_FALLTHROUGH +#endif + +#ifndef FMT_MAYBE_UNUSED +# if FMT_HAS_CPP17_ATTRIBUTE(maybe_unused) +# define FMT_MAYBE_UNUSED [[maybe_unused]] +# else +# define FMT_MAYBE_UNUSED +# endif +#endif + +#ifndef FMT_THROW +# if FMT_EXCEPTIONS +# if FMT_MSC_VER || FMT_NVCC +FMT_BEGIN_NAMESPACE +namespace detail { +template <typename Exception> inline void do_throw(const Exception& x) { + // Silence unreachable code warnings in MSVC and NVCC because these + // are nearly impossible to fix in a generic code. + volatile bool b = true; + if (b) throw x; +} +} // namespace detail +FMT_END_NAMESPACE +# define FMT_THROW(x) detail::do_throw(x) +# else +# define FMT_THROW(x) throw x +# endif +# else +# define FMT_THROW(x) \ + do { \ + static_cast<void>(sizeof(x)); \ + FMT_ASSERT(false, ""); \ + } while (false) +# endif +#endif + +#if FMT_EXCEPTIONS +# define FMT_TRY try +# define FMT_CATCH(x) catch (x) +#else +# define FMT_TRY if (true) +# define FMT_CATCH(x) if (false) +#endif + +#ifndef FMT_USE_USER_DEFINED_LITERALS +// EDG based compilers (Intel, NVIDIA, Elbrus, etc), GCC and MSVC support UDLs. +# if (FMT_HAS_FEATURE(cxx_user_literals) || FMT_GCC_VERSION >= 407 || \ + FMT_MSC_VER >= 1900) && \ + (!defined(__EDG_VERSION__) || __EDG_VERSION__ >= /* UDL feature */ 480) +# define FMT_USE_USER_DEFINED_LITERALS 1 +# else +# define FMT_USE_USER_DEFINED_LITERALS 0 +# endif +#endif + +#ifndef FMT_USE_UDL_TEMPLATE +// EDG frontend based compilers (icc, nvcc, PGI, etc) and GCC < 6.4 do not +// properly support UDL templates and GCC >= 9 warns about them. +# if FMT_USE_USER_DEFINED_LITERALS && \ + (!defined(__EDG_VERSION__) || __EDG_VERSION__ >= 501) && \ + ((FMT_GCC_VERSION >= 604 && __cplusplus >= 201402L) || \ + FMT_CLANG_VERSION >= 304) && \ + !defined(__PGI) && !defined(__NVCC__) +# define FMT_USE_UDL_TEMPLATE 1 +# else +# define FMT_USE_UDL_TEMPLATE 0 +# endif +#endif + +#ifndef FMT_USE_FLOAT +# define FMT_USE_FLOAT 1 +#endif + +#ifndef FMT_USE_DOUBLE +# define FMT_USE_DOUBLE 1 +#endif + +#ifndef FMT_USE_LONG_DOUBLE +# define FMT_USE_LONG_DOUBLE 1 +#endif + +// Defining FMT_REDUCE_INT_INSTANTIATIONS to 1, will reduce the number of +// int_writer template instances to just one by only using the largest integer +// type. This results in a reduction in binary size but will cause a decrease in +// integer formatting performance. +#if !defined(FMT_REDUCE_INT_INSTANTIATIONS) +# define FMT_REDUCE_INT_INSTANTIATIONS 0 +#endif + +// __builtin_clz is broken in clang with Microsoft CodeGen: +// https://github.com/fmtlib/fmt/issues/519 +#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clz)) && !FMT_MSC_VER +# define FMT_BUILTIN_CLZ(n) __builtin_clz(n) +#endif +#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clzll)) && !FMT_MSC_VER +# define FMT_BUILTIN_CLZLL(n) __builtin_clzll(n) +#endif +#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_ctz)) +# define FMT_BUILTIN_CTZ(n) __builtin_ctz(n) +#endif +#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_ctzll)) +# define FMT_BUILTIN_CTZLL(n) __builtin_ctzll(n) +#endif + +#if FMT_MSC_VER +# include <intrin.h> // _BitScanReverse[64], _BitScanForward[64], _umul128 +#endif + +// Some compilers masquerade as both MSVC and GCC-likes or otherwise support +// __builtin_clz and __builtin_clzll, so only define FMT_BUILTIN_CLZ using the +// MSVC intrinsics if the clz and clzll builtins are not available. +#if FMT_MSC_VER && !defined(FMT_BUILTIN_CLZLL) && \ + !defined(FMT_BUILTIN_CTZLL) && !defined(_MANAGED) +FMT_BEGIN_NAMESPACE +namespace detail { +// Avoid Clang with Microsoft CodeGen's -Wunknown-pragmas warning. +# ifndef __clang__ +# pragma intrinsic(_BitScanForward) +# pragma intrinsic(_BitScanReverse) +# endif +# if defined(_WIN64) && !defined(__clang__) +# pragma intrinsic(_BitScanForward64) +# pragma intrinsic(_BitScanReverse64) +# endif + +inline int clz(uint32_t x) { + unsigned long r = 0; + _BitScanReverse(&r, x); + FMT_ASSERT(x != 0, ""); + // Static analysis complains about using uninitialized data + // "r", but the only way that can happen is if "x" is 0, + // which the callers guarantee to not happen. + FMT_SUPPRESS_MSC_WARNING(6102) + return 31 ^ static_cast<int>(r); +} +# define FMT_BUILTIN_CLZ(n) detail::clz(n) + +inline int clzll(uint64_t x) { + unsigned long r = 0; +# ifdef _WIN64 + _BitScanReverse64(&r, x); +# else + // Scan the high 32 bits. + if (_BitScanReverse(&r, static_cast<uint32_t>(x >> 32))) return 63 ^ (r + 32); + // Scan the low 32 bits. + _BitScanReverse(&r, static_cast<uint32_t>(x)); +# endif + FMT_ASSERT(x != 0, ""); + FMT_SUPPRESS_MSC_WARNING(6102) // Suppress a bogus static analysis warning. + return 63 ^ static_cast<int>(r); +} +# define FMT_BUILTIN_CLZLL(n) detail::clzll(n) + +inline int ctz(uint32_t x) { + unsigned long r = 0; + _BitScanForward(&r, x); + FMT_ASSERT(x != 0, ""); + FMT_SUPPRESS_MSC_WARNING(6102) // Suppress a bogus static analysis warning. + return static_cast<int>(r); +} +# define FMT_BUILTIN_CTZ(n) detail::ctz(n) + +inline int ctzll(uint64_t x) { + unsigned long r = 0; + FMT_ASSERT(x != 0, ""); + FMT_SUPPRESS_MSC_WARNING(6102) // Suppress a bogus static analysis warning. +# ifdef _WIN64 + _BitScanForward64(&r, x); +# else + // Scan the low 32 bits. + if (_BitScanForward(&r, static_cast<uint32_t>(x))) return static_cast<int>(r); + // Scan the high 32 bits. + _BitScanForward(&r, static_cast<uint32_t>(x >> 32)); + r += 32; +# endif + return static_cast<int>(r); +} +# define FMT_BUILTIN_CTZLL(n) detail::ctzll(n) +} // namespace detail +FMT_END_NAMESPACE +#endif + +// Enable the deprecated numeric alignment. +#ifndef FMT_DEPRECATED_NUMERIC_ALIGN +# define FMT_DEPRECATED_NUMERIC_ALIGN 0 +#endif + +FMT_BEGIN_NAMESPACE +namespace detail { + +// An equivalent of `*reinterpret_cast<Dest*>(&source)` that doesn't have +// undefined behavior (e.g. due to type aliasing). +// Example: uint64_t d = bit_cast<uint64_t>(2.718); +template <typename Dest, typename Source> +inline Dest bit_cast(const Source& source) { + static_assert(sizeof(Dest) == sizeof(Source), "size mismatch"); + Dest dest; + std::memcpy(&dest, &source, sizeof(dest)); + return dest; +} + +inline bool is_big_endian() { + const auto u = 1u; + struct bytes { + char data[sizeof(u)]; + }; + return bit_cast<bytes>(u).data[0] == 0; +} + +// A fallback implementation of uintptr_t for systems that lack it. +struct fallback_uintptr { + unsigned char value[sizeof(void*)]; + + fallback_uintptr() = default; + explicit fallback_uintptr(const void* p) { + *this = bit_cast<fallback_uintptr>(p); + if (is_big_endian()) { + for (size_t i = 0, j = sizeof(void*) - 1; i < j; ++i, --j) + std::swap(value[i], value[j]); + } + } +}; +#ifdef UINTPTR_MAX +using uintptr_t = ::uintptr_t; +inline uintptr_t to_uintptr(const void* p) { return bit_cast<uintptr_t>(p); } +#else +using uintptr_t = fallback_uintptr; +inline fallback_uintptr to_uintptr(const void* p) { + return fallback_uintptr(p); +} +#endif + +// Returns the largest possible value for type T. Same as +// std::numeric_limits<T>::max() but shorter and not affected by the max macro. +template <typename T> constexpr T max_value() { + return (std::numeric_limits<T>::max)(); +} +template <typename T> constexpr int num_bits() { + return std::numeric_limits<T>::digits; +} +// std::numeric_limits<T>::digits may return 0 for 128-bit ints. +template <> constexpr int num_bits<int128_t>() { return 128; } +template <> constexpr int num_bits<uint128_t>() { return 128; } +template <> constexpr int num_bits<fallback_uintptr>() { + return static_cast<int>(sizeof(void*) * + std::numeric_limits<unsigned char>::digits); +} + +FMT_INLINE void assume(bool condition) { + (void)condition; +#if FMT_HAS_BUILTIN(__builtin_assume) + __builtin_assume(condition); +#endif +} + +// An approximation of iterator_t for pre-C++20 systems. +template <typename T> +using iterator_t = decltype(std::begin(std::declval<T&>())); +template <typename T> using sentinel_t = decltype(std::end(std::declval<T&>())); + +// A workaround for std::string not having mutable data() until C++17. +template <typename Char> inline Char* get_data(std::basic_string<Char>& s) { + return &s[0]; +} +template <typename Container> +inline typename Container::value_type* get_data(Container& c) { + return c.data(); +} + +#if defined(_SECURE_SCL) && _SECURE_SCL +// Make a checked iterator to avoid MSVC warnings. +template <typename T> using checked_ptr = stdext::checked_array_iterator<T*>; +template <typename T> checked_ptr<T> make_checked(T* p, size_t size) { + return {p, size}; +} +#else +template <typename T> using checked_ptr = T*; +template <typename T> inline T* make_checked(T* p, size_t) { return p; } +#endif + +template <typename Container, FMT_ENABLE_IF(is_contiguous<Container>::value)> +#if FMT_CLANG_VERSION +__attribute__((no_sanitize("undefined"))) +#endif +inline checked_ptr<typename Container::value_type> +reserve(std::back_insert_iterator<Container> it, size_t n) { + Container& c = get_container(it); + size_t size = c.size(); + c.resize(size + n); + return make_checked(get_data(c) + size, n); +} + +template <typename T> +inline buffer_appender<T> reserve(buffer_appender<T> it, size_t n) { + buffer<T>& buf = get_container(it); + buf.try_reserve(buf.size() + n); + return it; +} + +template <typename Iterator> inline Iterator& reserve(Iterator& it, size_t) { + return it; +} + +template <typename T, typename OutputIt> +constexpr T* to_pointer(OutputIt, size_t) { + return nullptr; +} +template <typename T> T* to_pointer(buffer_appender<T> it, size_t n) { + buffer<T>& buf = get_container(it); + auto size = buf.size(); + if (buf.capacity() < size + n) return nullptr; + buf.try_resize(size + n); + return buf.data() + size; +} + +template <typename Container, FMT_ENABLE_IF(is_contiguous<Container>::value)> +inline std::back_insert_iterator<Container> base_iterator( + std::back_insert_iterator<Container>& it, + checked_ptr<typename Container::value_type>) { + return it; +} + +template <typename Iterator> +inline Iterator base_iterator(Iterator, Iterator it) { + return it; +} + +// An output iterator that counts the number of objects written to it and +// discards them. +class counting_iterator { + private: + size_t count_; + + public: + using iterator_category = std::output_iterator_tag; + using difference_type = std::ptrdiff_t; + using pointer = void; + using reference = void; + using _Unchecked_type = counting_iterator; // Mark iterator as checked. + + struct value_type { + template <typename T> void operator=(const T&) {} + }; + + counting_iterator() : count_(0) {} + + size_t count() const { return count_; } + + counting_iterator& operator++() { + ++count_; + return *this; + } + counting_iterator operator++(int) { + auto it = *this; + ++*this; + return it; + } + + friend counting_iterator operator+(counting_iterator it, difference_type n) { + it.count_ += static_cast<size_t>(n); + return it; + } + + value_type operator*() const { return {}; } +}; + +template <typename OutputIt> class truncating_iterator_base { + protected: + OutputIt out_; + size_t limit_; + size_t count_; + + truncating_iterator_base(OutputIt out, size_t limit) + : out_(out), limit_(limit), count_(0) {} + + public: + using iterator_category = std::output_iterator_tag; + using value_type = typename std::iterator_traits<OutputIt>::value_type; + using difference_type = void; + using pointer = void; + using reference = void; + using _Unchecked_type = + truncating_iterator_base; // Mark iterator as checked. + + OutputIt base() const { return out_; } + size_t count() const { return count_; } +}; + +// An output iterator that truncates the output and counts the number of objects +// written to it. +template <typename OutputIt, + typename Enable = typename std::is_void< + typename std::iterator_traits<OutputIt>::value_type>::type> +class truncating_iterator; + +template <typename OutputIt> +class truncating_iterator<OutputIt, std::false_type> + : public truncating_iterator_base<OutputIt> { + mutable typename truncating_iterator_base<OutputIt>::value_type blackhole_; + + public: + using value_type = typename truncating_iterator_base<OutputIt>::value_type; + + truncating_iterator(OutputIt out, size_t limit) + : truncating_iterator_base<OutputIt>(out, limit) {} + + truncating_iterator& operator++() { + if (this->count_++ < this->limit_) ++this->out_; + return *this; + } + + truncating_iterator operator++(int) { + auto it = *this; + ++*this; + return it; + } + + value_type& operator*() const { + return this->count_ < this->limit_ ? *this->out_ : blackhole_; + } +}; + +template <typename OutputIt> +class truncating_iterator<OutputIt, std::true_type> + : public truncating_iterator_base<OutputIt> { + public: + truncating_iterator(OutputIt out, size_t limit) + : truncating_iterator_base<OutputIt>(out, limit) {} + + template <typename T> truncating_iterator& operator=(T val) { + if (this->count_++ < this->limit_) *this->out_++ = val; + return *this; + } + + truncating_iterator& operator++() { return *this; } + truncating_iterator& operator++(int) { return *this; } + truncating_iterator& operator*() { return *this; } +}; + +template <typename Char> +inline size_t count_code_points(basic_string_view<Char> s) { + return s.size(); +} + +// Counts the number of code points in a UTF-8 string. +inline size_t count_code_points(basic_string_view<char> s) { + const char* data = s.data(); + size_t num_code_points = 0; + for (size_t i = 0, size = s.size(); i != size; ++i) { + if ((data[i] & 0xc0) != 0x80) ++num_code_points; + } + return num_code_points; +} + +inline size_t count_code_points(basic_string_view<char8_type> s) { + return count_code_points(basic_string_view<char>( + reinterpret_cast<const char*>(s.data()), s.size())); +} + +template <typename Char> +inline size_t code_point_index(basic_string_view<Char> s, size_t n) { + size_t size = s.size(); + return n < size ? n : size; +} + +// Calculates the index of the nth code point in a UTF-8 string. +inline size_t code_point_index(basic_string_view<char8_type> s, size_t n) { + const char8_type* data = s.data(); + size_t num_code_points = 0; + for (size_t i = 0, size = s.size(); i != size; ++i) { + if ((data[i] & 0xc0) != 0x80 && ++num_code_points > n) { + return i; + } + } + return s.size(); +} + +template <typename InputIt, typename OutChar> +using needs_conversion = bool_constant< + std::is_same<typename std::iterator_traits<InputIt>::value_type, + char>::value && + std::is_same<OutChar, char8_type>::value>; + +template <typename OutChar, typename InputIt, typename OutputIt, + FMT_ENABLE_IF(!needs_conversion<InputIt, OutChar>::value)> +OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) { + return std::copy(begin, end, it); +} + +template <typename OutChar, typename InputIt, typename OutputIt, + FMT_ENABLE_IF(needs_conversion<InputIt, OutChar>::value)> +OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) { + return std::transform(begin, end, it, + [](char c) { return static_cast<char8_type>(c); }); +} + +template <typename Char, typename InputIt> +inline counting_iterator copy_str(InputIt begin, InputIt end, + counting_iterator it) { + return it + (end - begin); +} + +template <typename T> +using is_fast_float = bool_constant<std::numeric_limits<T>::is_iec559 && + sizeof(T) <= sizeof(double)>; + +#ifndef FMT_USE_FULL_CACHE_DRAGONBOX +# define FMT_USE_FULL_CACHE_DRAGONBOX 0 +#endif + +template <typename T> +template <typename U> +void buffer<T>::append(const U* begin, const U* end) { + do { + auto count = to_unsigned(end - begin); + try_reserve(size_ + count); + auto free_cap = capacity_ - size_; + if (free_cap < count) count = free_cap; + std::uninitialized_copy_n(begin, count, make_checked(ptr_ + size_, count)); + size_ += count; + begin += count; + } while (begin != end); +} + +template <typename OutputIt, typename T, typename Traits> +void iterator_buffer<OutputIt, T, Traits>::flush() { + out_ = std::copy_n(data_, this->limit(this->size()), out_); + this->clear(); +} +} // namespace detail + +// The number of characters to store in the basic_memory_buffer object itself +// to avoid dynamic memory allocation. +enum { inline_buffer_size = 500 }; + +/** + \rst + A dynamically growing memory buffer for trivially copyable/constructible types + with the first ``SIZE`` elements stored in the object itself. + + You can use one of the following type aliases for common character types: + + +----------------+------------------------------+ + | Type | Definition | + +================+==============================+ + | memory_buffer | basic_memory_buffer<char> | + +----------------+------------------------------+ + | wmemory_buffer | basic_memory_buffer<wchar_t> | + +----------------+------------------------------+ + + **Example**:: + + fmt::memory_buffer out; + format_to(out, "The answer is {}.", 42); + + This will append the following output to the ``out`` object: + + .. code-block:: none + + The answer is 42. + + The output can be converted to an ``std::string`` with ``to_string(out)``. + \endrst + */ +template <typename T, size_t SIZE = inline_buffer_size, + typename Allocator = std::allocator<T>> +class basic_memory_buffer final : public detail::buffer<T> { + private: + T store_[SIZE]; + + // Don't inherit from Allocator avoid generating type_info for it. + Allocator alloc_; + + // Deallocate memory allocated by the buffer. + void deallocate() { + T* data = this->data(); + if (data != store_) alloc_.deallocate(data, this->capacity()); + } + + protected: + void grow(size_t size) final FMT_OVERRIDE; + + public: + using value_type = T; + using const_reference = const T&; + + explicit basic_memory_buffer(const Allocator& alloc = Allocator()) + : alloc_(alloc) { + this->set(store_, SIZE); + } + ~basic_memory_buffer() { deallocate(); } + + private: + // Move data from other to this buffer. + void move(basic_memory_buffer& other) { + alloc_ = std::move(other.alloc_); + T* data = other.data(); + size_t size = other.size(), capacity = other.capacity(); + if (data == other.store_) { + this->set(store_, capacity); + std::uninitialized_copy(other.store_, other.store_ + size, + detail::make_checked(store_, capacity)); + } else { + this->set(data, capacity); + // Set pointer to the inline array so that delete is not called + // when deallocating. + other.set(other.store_, 0); + } + this->resize(size); + } + + public: + /** + \rst + Constructs a :class:`fmt::basic_memory_buffer` object moving the content + of the other object to it. + \endrst + */ + basic_memory_buffer(basic_memory_buffer&& other) FMT_NOEXCEPT { move(other); } + + /** + \rst + Moves the content of the other ``basic_memory_buffer`` object to this one. + \endrst + */ + basic_memory_buffer& operator=(basic_memory_buffer&& other) FMT_NOEXCEPT { + FMT_ASSERT(this != &other, ""); + deallocate(); + move(other); + return *this; + } + + // Returns a copy of the allocator associated with this buffer. + Allocator get_allocator() const { return alloc_; } + + /** + Resizes the buffer to contain *count* elements. If T is a POD type new + elements may not be initialized. + */ + void resize(size_t count) { this->try_resize(count); } + + /** Increases the buffer capacity to *new_capacity*. */ + void reserve(size_t new_capacity) { this->try_reserve(new_capacity); } + + // Directly append data into the buffer + using detail::buffer<T>::append; + template <typename ContiguousRange> + void append(const ContiguousRange& range) { + append(range.data(), range.data() + range.size()); + } +}; + +template <typename T, size_t SIZE, typename Allocator> +void basic_memory_buffer<T, SIZE, Allocator>::grow(size_t size) { +#ifdef FMT_FUZZ + if (size > 5000) throw std::runtime_error("fuzz mode - won't grow that much"); +#endif + size_t old_capacity = this->capacity(); + size_t new_capacity = old_capacity + old_capacity / 2; + if (size > new_capacity) new_capacity = size; + T* old_data = this->data(); + T* new_data = + std::allocator_traits<Allocator>::allocate(alloc_, new_capacity); + // The following code doesn't throw, so the raw pointer above doesn't leak. + std::uninitialized_copy(old_data, old_data + this->size(), + detail::make_checked(new_data, new_capacity)); + this->set(new_data, new_capacity); + // deallocate must not throw according to the standard, but even if it does, + // the buffer already uses the new storage and will deallocate it in + // destructor. + if (old_data != store_) alloc_.deallocate(old_data, old_capacity); +} + +using memory_buffer = basic_memory_buffer<char>; +using wmemory_buffer = basic_memory_buffer<wchar_t>; + +template <typename T, size_t SIZE, typename Allocator> +struct is_contiguous<basic_memory_buffer<T, SIZE, Allocator>> : std::true_type { +}; + +/** A formatting error such as invalid format string. */ +FMT_CLASS_API +class FMT_API format_error : public std::runtime_error { + public: + explicit format_error(const char* message) : std::runtime_error(message) {} + explicit format_error(const std::string& message) + : std::runtime_error(message) {} + format_error(const format_error&) = default; + format_error& operator=(const format_error&) = default; + format_error(format_error&&) = default; + format_error& operator=(format_error&&) = default; + ~format_error() FMT_NOEXCEPT FMT_OVERRIDE; +}; + +namespace detail { + +template <typename T> +using is_signed = + std::integral_constant<bool, std::numeric_limits<T>::is_signed || + std::is_same<T, int128_t>::value>; + +// Returns true if value is negative, false otherwise. +// Same as `value < 0` but doesn't produce warnings if T is an unsigned type. +template <typename T, FMT_ENABLE_IF(is_signed<T>::value)> +FMT_CONSTEXPR bool is_negative(T value) { + return value < 0; +} +template <typename T, FMT_ENABLE_IF(!is_signed<T>::value)> +FMT_CONSTEXPR bool is_negative(T) { + return false; +} + +template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)> +FMT_CONSTEXPR bool is_supported_floating_point(T) { + return (std::is_same<T, float>::value && FMT_USE_FLOAT) || + (std::is_same<T, double>::value && FMT_USE_DOUBLE) || + (std::is_same<T, long double>::value && FMT_USE_LONG_DOUBLE); +} + +// Smallest of uint32_t, uint64_t, uint128_t that is large enough to +// represent all values of an integral type T. +template <typename T> +using uint32_or_64_or_128_t = + conditional_t<num_bits<T>() <= 32 && !FMT_REDUCE_INT_INSTANTIATIONS, + uint32_t, + conditional_t<num_bits<T>() <= 64, uint64_t, uint128_t>>; + +// 128-bit integer type used internally +struct FMT_EXTERN_TEMPLATE_API uint128_wrapper { + uint128_wrapper() = default; + +#if FMT_USE_INT128 + uint128_t internal_; + + uint128_wrapper(uint64_t high, uint64_t low) FMT_NOEXCEPT + : internal_{static_cast<uint128_t>(low) | + (static_cast<uint128_t>(high) << 64)} {} + + uint128_wrapper(uint128_t u) : internal_{u} {} + + uint64_t high() const FMT_NOEXCEPT { return uint64_t(internal_ >> 64); } + uint64_t low() const FMT_NOEXCEPT { return uint64_t(internal_); } + + uint128_wrapper& operator+=(uint64_t n) FMT_NOEXCEPT { + internal_ += n; + return *this; + } +#else + uint64_t high_; + uint64_t low_; + + uint128_wrapper(uint64_t high, uint64_t low) FMT_NOEXCEPT : high_{high}, + low_{low} {} + + uint64_t high() const FMT_NOEXCEPT { return high_; } + uint64_t low() const FMT_NOEXCEPT { return low_; } + + uint128_wrapper& operator+=(uint64_t n) FMT_NOEXCEPT { +# if defined(_MSC_VER) && defined(_M_X64) + unsigned char carry = _addcarry_u64(0, low_, n, &low_); + _addcarry_u64(carry, high_, 0, &high_); + return *this; +# else + uint64_t sum = low_ + n; + high_ += (sum < low_ ? 1 : 0); + low_ = sum; + return *this; +# endif + } +#endif +}; + +// Table entry type for divisibility test used internally +template <typename T> struct FMT_EXTERN_TEMPLATE_API divtest_table_entry { + T mod_inv; + T max_quotient; +}; + +// Static data is placed in this class template for the header-only config. +template <typename T = void> struct FMT_EXTERN_TEMPLATE_API basic_data { + static const uint64_t powers_of_10_64[]; + static const uint32_t zero_or_powers_of_10_32_new[]; + static const uint64_t zero_or_powers_of_10_64_new[]; + static const uint64_t grisu_pow10_significands[]; + static const int16_t grisu_pow10_exponents[]; + static const divtest_table_entry<uint32_t> divtest_table_for_pow5_32[]; + static const divtest_table_entry<uint64_t> divtest_table_for_pow5_64[]; + static const uint64_t dragonbox_pow10_significands_64[]; + static const uint128_wrapper dragonbox_pow10_significands_128[]; + // log10(2) = 0x0.4d104d427de7fbcc... + static const uint64_t log10_2_significand = 0x4d104d427de7fbcc; +#if !FMT_USE_FULL_CACHE_DRAGONBOX + static const uint64_t powers_of_5_64[]; + static const uint32_t dragonbox_pow10_recovery_errors[]; +#endif + // GCC generates slightly better code for pairs than chars. + using digit_pair = char[2]; + static const digit_pair digits[]; + static const char hex_digits[]; + static const char foreground_color[]; + static const char background_color[]; + static const char reset_color[5]; + static const wchar_t wreset_color[5]; + static const char signs[]; + static const char left_padding_shifts[5]; + static const char right_padding_shifts[5]; + + // DEPRECATED! These are for ABI compatibility. + static const uint32_t zero_or_powers_of_10_32[]; + static const uint64_t zero_or_powers_of_10_64[]; +}; + +// Maps bsr(n) to ceil(log10(pow(2, bsr(n) + 1) - 1)). +// This is a function instead of an array to workaround a bug in GCC10 (#1810). +FMT_INLINE uint16_t bsr2log10(int bsr) { + static constexpr uint16_t data[] = { + 1, 1, 1, 2, 2, 2, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, + 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 9, 9, 9, 10, 10, 10, + 10, 11, 11, 11, 12, 12, 12, 13, 13, 13, 13, 14, 14, 14, 15, 15, + 15, 16, 16, 16, 16, 17, 17, 17, 18, 18, 18, 19, 19, 19, 19, 20}; + return data[bsr]; +} + +#ifndef FMT_EXPORTED +FMT_EXTERN template struct basic_data<void>; +#endif + +// This is a struct rather than an alias to avoid shadowing warnings in gcc. +struct data : basic_data<> {}; + +#ifdef FMT_BUILTIN_CLZLL +// Returns the number of decimal digits in n. Leading zeros are not counted +// except for n == 0 in which case count_digits returns 1. +inline int count_digits(uint64_t n) { + // https://github.com/fmtlib/format-benchmark/blob/master/digits10 + auto t = bsr2log10(FMT_BUILTIN_CLZLL(n | 1) ^ 63); + return t - (n < data::zero_or_powers_of_10_64_new[t]); +} +#else +// Fallback version of count_digits used when __builtin_clz is not available. +inline int count_digits(uint64_t n) { + int count = 1; + for (;;) { + // Integer division is slow so do it for a group of four digits instead + // of for every digit. The idea comes from the talk by Alexandrescu + // "Three Optimization Tips for C++". See speed-test for a comparison. + if (n < 10) return count; + if (n < 100) return count + 1; + if (n < 1000) return count + 2; + if (n < 10000) return count + 3; + n /= 10000u; + count += 4; + } +} +#endif + +#if FMT_USE_INT128 +inline int count_digits(uint128_t n) { + int count = 1; + for (;;) { + // Integer division is slow so do it for a group of four digits instead + // of for every digit. The idea comes from the talk by Alexandrescu + // "Three Optimization Tips for C++". See speed-test for a comparison. + if (n < 10) return count; + if (n < 100) return count + 1; + if (n < 1000) return count + 2; + if (n < 10000) return count + 3; + n /= 10000U; + count += 4; + } +} +#endif + +// Counts the number of digits in n. BITS = log2(radix). +template <unsigned BITS, typename UInt> inline int count_digits(UInt n) { + int num_digits = 0; + do { + ++num_digits; + } while ((n >>= BITS) != 0); + return num_digits; +} + +template <> int count_digits<4>(detail::fallback_uintptr n); + +#if FMT_GCC_VERSION || FMT_CLANG_VERSION +# define FMT_ALWAYS_INLINE inline __attribute__((always_inline)) +#elif FMT_MSC_VER +# define FMT_ALWAYS_INLINE __forceinline +#else +# define FMT_ALWAYS_INLINE inline +#endif + +// To suppress unnecessary security cookie checks +#if FMT_MSC_VER && !FMT_CLANG_VERSION +# define FMT_SAFEBUFFERS __declspec(safebuffers) +#else +# define FMT_SAFEBUFFERS +#endif + +#ifdef FMT_BUILTIN_CLZ +// Optional version of count_digits for better performance on 32-bit platforms. +inline int count_digits(uint32_t n) { + auto t = bsr2log10(FMT_BUILTIN_CLZ(n | 1) ^ 31); + return t - (n < data::zero_or_powers_of_10_32_new[t]); +} +#endif + +template <typename Int> constexpr int digits10() FMT_NOEXCEPT { + return std::numeric_limits<Int>::digits10; +} +template <> constexpr int digits10<int128_t>() FMT_NOEXCEPT { return 38; } +template <> constexpr int digits10<uint128_t>() FMT_NOEXCEPT { return 38; } + +template <typename Char> FMT_API std::string grouping_impl(locale_ref loc); +template <typename Char> inline std::string grouping(locale_ref loc) { + return grouping_impl<char>(loc); +} +template <> inline std::string grouping<wchar_t>(locale_ref loc) { + return grouping_impl<wchar_t>(loc); +} + +template <typename Char> FMT_API Char thousands_sep_impl(locale_ref loc); +template <typename Char> inline Char thousands_sep(locale_ref loc) { + return Char(thousands_sep_impl<char>(loc)); +} +template <> inline wchar_t thousands_sep(locale_ref loc) { + return thousands_sep_impl<wchar_t>(loc); +} + +template <typename Char> FMT_API Char decimal_point_impl(locale_ref loc); +template <typename Char> inline Char decimal_point(locale_ref loc) { + return Char(decimal_point_impl<char>(loc)); +} +template <> inline wchar_t decimal_point(locale_ref loc) { + return decimal_point_impl<wchar_t>(loc); +} + +// Compares two characters for equality. +template <typename Char> bool equal2(const Char* lhs, const char* rhs) { + return lhs[0] == rhs[0] && lhs[1] == rhs[1]; +} +inline bool equal2(const char* lhs, const char* rhs) { + return memcmp(lhs, rhs, 2) == 0; +} + +// Copies two characters from src to dst. +template <typename Char> void copy2(Char* dst, const char* src) { + *dst++ = static_cast<Char>(*src++); + *dst = static_cast<Char>(*src); +} +FMT_INLINE void copy2(char* dst, const char* src) { memcpy(dst, src, 2); } + +template <typename Iterator> struct format_decimal_result { + Iterator begin; + Iterator end; +}; + +// Formats a decimal unsigned integer value writing into out pointing to a +// buffer of specified size. The caller must ensure that the buffer is large +// enough. +template <typename Char, typename UInt> +inline format_decimal_result<Char*> format_decimal(Char* out, UInt value, + int size) { + FMT_ASSERT(size >= count_digits(value), "invalid digit count"); + out += size; + Char* end = out; + while (value >= 100) { + // Integer division is slow so do it for a group of two digits instead + // of for every digit. The idea comes from the talk by Alexandrescu + // "Three Optimization Tips for C++". See speed-test for a comparison. + out -= 2; + copy2(out, data::digits[value % 100]); + value /= 100; + } + if (value < 10) { + *--out = static_cast<Char>('0' + value); + return {out, end}; + } + out -= 2; + copy2(out, data::digits[value]); + return {out, end}; +} + +template <typename Char, typename UInt, typename Iterator, + FMT_ENABLE_IF(!std::is_pointer<remove_cvref_t<Iterator>>::value)> +inline format_decimal_result<Iterator> format_decimal(Iterator out, UInt value, + int size) { + // Buffer is large enough to hold all digits (digits10 + 1). + Char buffer[digits10<UInt>() + 1]; + auto end = format_decimal(buffer, value, size).end; + return {out, detail::copy_str<Char>(buffer, end, out)}; +} + +template <unsigned BASE_BITS, typename Char, typename UInt> +inline Char* format_uint(Char* buffer, UInt value, int num_digits, + bool upper = false) { + buffer += num_digits; + Char* end = buffer; + do { + const char* digits = upper ? "0123456789ABCDEF" : "0123456789abcdef"; + unsigned digit = (value & ((1 << BASE_BITS) - 1)); + *--buffer = static_cast<Char>(BASE_BITS < 4 ? static_cast<char>('0' + digit) + : digits[digit]); + } while ((value >>= BASE_BITS) != 0); + return end; +} + +template <unsigned BASE_BITS, typename Char> +Char* format_uint(Char* buffer, detail::fallback_uintptr n, int num_digits, + bool = false) { + auto char_digits = std::numeric_limits<unsigned char>::digits / 4; + int start = (num_digits + char_digits - 1) / char_digits - 1; + if (int start_digits = num_digits % char_digits) { + unsigned value = n.value[start--]; + buffer = format_uint<BASE_BITS>(buffer, value, start_digits); + } + for (; start >= 0; --start) { + unsigned value = n.value[start]; + buffer += char_digits; + auto p = buffer; + for (int i = 0; i < char_digits; ++i) { + unsigned digit = (value & ((1 << BASE_BITS) - 1)); + *--p = static_cast<Char>(data::hex_digits[digit]); + value >>= BASE_BITS; + } + } + return buffer; +} + +template <unsigned BASE_BITS, typename Char, typename It, typename UInt> +inline It format_uint(It out, UInt value, int num_digits, bool upper = false) { + if (auto ptr = to_pointer<Char>(out, to_unsigned(num_digits))) { + format_uint<BASE_BITS>(ptr, value, num_digits, upper); + return out; + } + // Buffer should be large enough to hold all digits (digits / BASE_BITS + 1). + char buffer[num_bits<UInt>() / BASE_BITS + 1]; + format_uint<BASE_BITS>(buffer, value, num_digits, upper); + return detail::copy_str<Char>(buffer, buffer + num_digits, out); +} + +// A converter from UTF-8 to UTF-16. +class utf8_to_utf16 { + private: + wmemory_buffer buffer_; + + public: + FMT_API explicit utf8_to_utf16(string_view s); + operator wstring_view() const { return {&buffer_[0], size()}; } + size_t size() const { return buffer_.size() - 1; } + const wchar_t* c_str() const { return &buffer_[0]; } + std::wstring str() const { return {&buffer_[0], size()}; } +}; + +template <typename T = void> struct null {}; + +// Workaround an array initialization issue in gcc 4.8. +template <typename Char> struct fill_t { + private: + enum { max_size = 4 }; + Char data_[max_size] = {Char(' '), Char(0), Char(0), Char(0)}; + unsigned char size_ = 1; + + public: + FMT_CONSTEXPR void operator=(basic_string_view<Char> s) { + auto size = s.size(); + if (size > max_size) { + FMT_THROW(format_error("invalid fill")); + return; + } + for (size_t i = 0; i < size; ++i) data_[i] = s[i]; + size_ = static_cast<unsigned char>(size); + } + + size_t size() const { return size_; } + const Char* data() const { return data_; } + + FMT_CONSTEXPR Char& operator[](size_t index) { return data_[index]; } + FMT_CONSTEXPR const Char& operator[](size_t index) const { + return data_[index]; + } +}; +} // namespace detail + +// We cannot use enum classes as bit fields because of a gcc bug +// https://gcc.gnu.org/bugzilla/show_bug.cgi?id=61414. +namespace align { +enum type { none, left, right, center, numeric }; +} +using align_t = align::type; + +namespace sign { +enum type { none, minus, plus, space }; +} +using sign_t = sign::type; + +// Format specifiers for built-in and string types. +template <typename Char> struct basic_format_specs { + int width; + int precision; + char type; + align_t align : 4; + sign_t sign : 3; + bool alt : 1; // Alternate form ('#'). + detail::fill_t<Char> fill; + + constexpr basic_format_specs() + : width(0), + precision(-1), + type(0), + align(align::none), + sign(sign::none), + alt(false) {} +}; + +using format_specs = basic_format_specs<char>; + +namespace detail { +namespace dragonbox { + +// Type-specific information that Dragonbox uses. +template <class T> struct float_info; + +template <> struct float_info<float> { + using carrier_uint = uint32_t; + static const int significand_bits = 23; + static const int exponent_bits = 8; + static const int min_exponent = -126; + static const int max_exponent = 127; + static const int exponent_bias = -127; + static const int decimal_digits = 9; + static const int kappa = 1; + static const int big_divisor = 100; + static const int small_divisor = 10; + static const int min_k = -31; + static const int max_k = 46; + static const int cache_bits = 64; + static const int divisibility_check_by_5_threshold = 39; + static const int case_fc_pm_half_lower_threshold = -1; + static const int case_fc_pm_half_upper_threshold = 6; + static const int case_fc_lower_threshold = -2; + static const int case_fc_upper_threshold = 6; + static const int case_shorter_interval_left_endpoint_lower_threshold = 2; + static const int case_shorter_interval_left_endpoint_upper_threshold = 3; + static const int shorter_interval_tie_lower_threshold = -35; + static const int shorter_interval_tie_upper_threshold = -35; + static const int max_trailing_zeros = 7; +}; + +template <> struct float_info<double> { + using carrier_uint = uint64_t; + static const int significand_bits = 52; + static const int exponent_bits = 11; + static const int min_exponent = -1022; + static const int max_exponent = 1023; + static const int exponent_bias = -1023; + static const int decimal_digits = 17; + static const int kappa = 2; + static const int big_divisor = 1000; + static const int small_divisor = 100; + static const int min_k = -292; + static const int max_k = 326; + static const int cache_bits = 128; + static const int divisibility_check_by_5_threshold = 86; + static const int case_fc_pm_half_lower_threshold = -2; + static const int case_fc_pm_half_upper_threshold = 9; + static const int case_fc_lower_threshold = -4; + static const int case_fc_upper_threshold = 9; + static const int case_shorter_interval_left_endpoint_lower_threshold = 2; + static const int case_shorter_interval_left_endpoint_upper_threshold = 3; + static const int shorter_interval_tie_lower_threshold = -77; + static const int shorter_interval_tie_upper_threshold = -77; + static const int max_trailing_zeros = 16; +}; + +template <typename T> struct decimal_fp { + using significand_type = typename float_info<T>::carrier_uint; + significand_type significand; + int exponent; +}; + +template <typename T> FMT_API decimal_fp<T> to_decimal(T x) FMT_NOEXCEPT; +} // namespace dragonbox + +template <typename T> +constexpr typename dragonbox::float_info<T>::carrier_uint exponent_mask() { + using uint = typename dragonbox::float_info<T>::carrier_uint; + return ((uint(1) << dragonbox::float_info<T>::exponent_bits) - 1) + << dragonbox::float_info<T>::significand_bits; +} + +// A floating-point presentation format. +enum class float_format : unsigned char { + general, // General: exponent notation or fixed point based on magnitude. + exp, // Exponent notation with the default precision of 6, e.g. 1.2e-3. + fixed, // Fixed point with the default precision of 6, e.g. 0.0012. + hex +}; + +struct float_specs { + int precision; + float_format format : 8; + sign_t sign : 8; + bool upper : 1; + bool locale : 1; + bool binary32 : 1; + bool use_grisu : 1; + bool showpoint : 1; +}; + +// Writes the exponent exp in the form "[+-]d{2,3}" to buffer. +template <typename Char, typename It> It write_exponent(int exp, It it) { + FMT_ASSERT(-10000 < exp && exp < 10000, "exponent out of range"); + if (exp < 0) { + *it++ = static_cast<Char>('-'); + exp = -exp; + } else { + *it++ = static_cast<Char>('+'); + } + if (exp >= 100) { + const char* top = data::digits[exp / 100]; + if (exp >= 1000) *it++ = static_cast<Char>(top[0]); + *it++ = static_cast<Char>(top[1]); + exp %= 100; + } + const char* d = data::digits[exp]; + *it++ = static_cast<Char>(d[0]); + *it++ = static_cast<Char>(d[1]); + return it; +} + +template <typename T> +int format_float(T value, int precision, float_specs specs, buffer<char>& buf); + +// Formats a floating-point number with snprintf. +template <typename T> +int snprintf_float(T value, int precision, float_specs specs, + buffer<char>& buf); + +template <typename T> T promote_float(T value) { return value; } +inline double promote_float(float value) { return static_cast<double>(value); } + +template <typename Handler> +FMT_CONSTEXPR void handle_int_type_spec(char spec, Handler&& handler) { + switch (spec) { + case 0: + case 'd': + handler.on_dec(); + break; + case 'x': + case 'X': + handler.on_hex(); + break; + case 'b': + case 'B': + handler.on_bin(); + break; + case 'o': + handler.on_oct(); + break; +#ifdef FMT_DEPRECATED_N_SPECIFIER + case 'n': +#endif + case 'L': + handler.on_num(); + break; + case 'c': + handler.on_chr(); + break; + default: + handler.on_error(); + } +} + +template <typename ErrorHandler = error_handler, typename Char> +FMT_CONSTEXPR float_specs parse_float_type_spec( + const basic_format_specs<Char>& specs, ErrorHandler&& eh = {}) { + auto result = float_specs(); + result.showpoint = specs.alt; + switch (specs.type) { + case 0: + result.format = float_format::general; + result.showpoint |= specs.precision > 0; + break; + case 'G': + result.upper = true; + FMT_FALLTHROUGH; + case 'g': + result.format = float_format::general; + break; + case 'E': + result.upper = true; + FMT_FALLTHROUGH; + case 'e': + result.format = float_format::exp; + result.showpoint |= specs.precision != 0; + break; + case 'F': + result.upper = true; + FMT_FALLTHROUGH; + case 'f': + result.format = float_format::fixed; + result.showpoint |= specs.precision != 0; + break; + case 'A': + result.upper = true; + FMT_FALLTHROUGH; + case 'a': + result.format = float_format::hex; + break; +#ifdef FMT_DEPRECATED_N_SPECIFIER + case 'n': +#endif + case 'L': + result.locale = true; + break; + default: + eh.on_error("invalid type specifier"); + break; + } + return result; +} + +template <typename Char, typename Handler> +FMT_CONSTEXPR void handle_char_specs(const basic_format_specs<Char>* specs, + Handler&& handler) { + if (!specs) return handler.on_char(); + if (specs->type && specs->type != 'c') return handler.on_int(); + if (specs->align == align::numeric || specs->sign != sign::none || specs->alt) + handler.on_error("invalid format specifier for char"); + handler.on_char(); +} + +template <typename Char, typename Handler> +FMT_CONSTEXPR void handle_cstring_type_spec(Char spec, Handler&& handler) { + if (spec == 0 || spec == 's') + handler.on_string(); + else if (spec == 'p') + handler.on_pointer(); + else + handler.on_error("invalid type specifier"); +} + +template <typename Char, typename ErrorHandler> +FMT_CONSTEXPR void check_string_type_spec(Char spec, ErrorHandler&& eh) { + if (spec != 0 && spec != 's') eh.on_error("invalid type specifier"); +} + +template <typename Char, typename ErrorHandler> +FMT_CONSTEXPR void check_pointer_type_spec(Char spec, ErrorHandler&& eh) { + if (spec != 0 && spec != 'p') eh.on_error("invalid type specifier"); +} + +template <typename ErrorHandler> class int_type_checker : private ErrorHandler { + public: + FMT_CONSTEXPR explicit int_type_checker(ErrorHandler eh) : ErrorHandler(eh) {} + + FMT_CONSTEXPR void on_dec() {} + FMT_CONSTEXPR void on_hex() {} + FMT_CONSTEXPR void on_bin() {} + FMT_CONSTEXPR void on_oct() {} + FMT_CONSTEXPR void on_num() {} + FMT_CONSTEXPR void on_chr() {} + + FMT_CONSTEXPR void on_error() { + ErrorHandler::on_error("invalid type specifier"); + } +}; + +template <typename ErrorHandler> +class char_specs_checker : public ErrorHandler { + private: + char type_; + + public: + FMT_CONSTEXPR char_specs_checker(char type, ErrorHandler eh) + : ErrorHandler(eh), type_(type) {} + + FMT_CONSTEXPR void on_int() { + handle_int_type_spec(type_, int_type_checker<ErrorHandler>(*this)); + } + FMT_CONSTEXPR void on_char() {} +}; + +template <typename ErrorHandler> +class cstring_type_checker : public ErrorHandler { + public: + FMT_CONSTEXPR explicit cstring_type_checker(ErrorHandler eh) + : ErrorHandler(eh) {} + + FMT_CONSTEXPR void on_string() {} + FMT_CONSTEXPR void on_pointer() {} +}; + +template <typename OutputIt, typename Char> +FMT_NOINLINE OutputIt fill(OutputIt it, size_t n, const fill_t<Char>& fill) { + auto fill_size = fill.size(); + if (fill_size == 1) return std::fill_n(it, n, fill[0]); + for (size_t i = 0; i < n; ++i) it = std::copy_n(fill.data(), fill_size, it); + return it; +} + +// Writes the output of f, padded according to format specifications in specs. +// size: output size in code units. +// width: output display width in (terminal) column positions. +template <align::type align = align::left, typename OutputIt, typename Char, + typename F> +inline OutputIt write_padded(OutputIt out, + const basic_format_specs<Char>& specs, size_t size, + size_t width, F&& f) { + static_assert(align == align::left || align == align::right, ""); + unsigned spec_width = to_unsigned(specs.width); + size_t padding = spec_width > width ? spec_width - width : 0; + auto* shifts = align == align::left ? data::left_padding_shifts + : data::right_padding_shifts; + size_t left_padding = padding >> shifts[specs.align]; + auto it = reserve(out, size + padding * specs.fill.size()); + it = fill(it, left_padding, specs.fill); + it = f(it); + it = fill(it, padding - left_padding, specs.fill); + return base_iterator(out, it); +} + +template <align::type align = align::left, typename OutputIt, typename Char, + typename F> +inline OutputIt write_padded(OutputIt out, + const basic_format_specs<Char>& specs, size_t size, + F&& f) { + return write_padded<align>(out, specs, size, size, f); +} + +template <typename Char, typename OutputIt> +OutputIt write_bytes(OutputIt out, string_view bytes, + const basic_format_specs<Char>& specs) { + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + return write_padded(out, specs, bytes.size(), [bytes](iterator it) { + const char* data = bytes.data(); + return copy_str<Char>(data, data + bytes.size(), it); + }); +} + +// Data for write_int that doesn't depend on output iterator type. It is used to +// avoid template code bloat. +template <typename Char> struct write_int_data { + size_t size; + size_t padding; + + write_int_data(int num_digits, string_view prefix, + const basic_format_specs<Char>& specs) + : size(prefix.size() + to_unsigned(num_digits)), padding(0) { + if (specs.align == align::numeric) { + auto width = to_unsigned(specs.width); + if (width > size) { + padding = width - size; + size = width; + } + } else if (specs.precision > num_digits) { + size = prefix.size() + to_unsigned(specs.precision); + padding = to_unsigned(specs.precision - num_digits); + } + } +}; + +// Writes an integer in the format +// <left-padding><prefix><numeric-padding><digits><right-padding> +// where <digits> are written by f(it). +template <typename OutputIt, typename Char, typename F> +OutputIt write_int(OutputIt out, int num_digits, string_view prefix, + const basic_format_specs<Char>& specs, F f) { + auto data = write_int_data<Char>(num_digits, prefix, specs); + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + return write_padded<align::right>(out, specs, data.size, [=](iterator it) { + if (prefix.size() != 0) + it = copy_str<Char>(prefix.begin(), prefix.end(), it); + it = std::fill_n(it, data.padding, static_cast<Char>('0')); + return f(it); + }); +} + +template <typename StrChar, typename Char, typename OutputIt> +OutputIt write(OutputIt out, basic_string_view<StrChar> s, + const basic_format_specs<Char>& specs) { + auto data = s.data(); + auto size = s.size(); + if (specs.precision >= 0 && to_unsigned(specs.precision) < size) + size = code_point_index(s, to_unsigned(specs.precision)); + auto width = specs.width != 0 + ? count_code_points(basic_string_view<StrChar>(data, size)) + : 0; + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + return write_padded(out, specs, size, width, [=](iterator it) { + return copy_str<Char>(data, data + size, it); + }); +} + +// The handle_int_type_spec handler that writes an integer. +template <typename OutputIt, typename Char, typename UInt> struct int_writer { + OutputIt out; + locale_ref locale; + const basic_format_specs<Char>& specs; + UInt abs_value; + char prefix[4]; + unsigned prefix_size; + + using iterator = + remove_reference_t<decltype(reserve(std::declval<OutputIt&>(), 0))>; + + string_view get_prefix() const { return string_view(prefix, prefix_size); } + + template <typename Int> + int_writer(OutputIt output, locale_ref loc, Int value, + const basic_format_specs<Char>& s) + : out(output), + locale(loc), + specs(s), + abs_value(static_cast<UInt>(value)), + prefix_size(0) { + static_assert(std::is_same<uint32_or_64_or_128_t<Int>, UInt>::value, ""); + if (is_negative(value)) { + prefix[0] = '-'; + ++prefix_size; + abs_value = 0 - abs_value; + } else if (specs.sign != sign::none && specs.sign != sign::minus) { + prefix[0] = specs.sign == sign::plus ? '+' : ' '; + ++prefix_size; + } + } + + void on_dec() { + auto num_digits = count_digits(abs_value); + out = write_int( + out, num_digits, get_prefix(), specs, [this, num_digits](iterator it) { + return format_decimal<Char>(it, abs_value, num_digits).end; + }); + } + + void on_hex() { + if (specs.alt) { + prefix[prefix_size++] = '0'; + prefix[prefix_size++] = specs.type; + } + int num_digits = count_digits<4>(abs_value); + out = write_int(out, num_digits, get_prefix(), specs, + [this, num_digits](iterator it) { + return format_uint<4, Char>(it, abs_value, num_digits, + specs.type != 'x'); + }); + } + + void on_bin() { + if (specs.alt) { + prefix[prefix_size++] = '0'; + prefix[prefix_size++] = static_cast<char>(specs.type); + } + int num_digits = count_digits<1>(abs_value); + out = write_int(out, num_digits, get_prefix(), specs, + [this, num_digits](iterator it) { + return format_uint<1, Char>(it, abs_value, num_digits); + }); + } + + void on_oct() { + int num_digits = count_digits<3>(abs_value); + if (specs.alt && specs.precision <= num_digits && abs_value != 0) { + // Octal prefix '0' is counted as a digit, so only add it if precision + // is not greater than the number of digits. + prefix[prefix_size++] = '0'; + } + out = write_int(out, num_digits, get_prefix(), specs, + [this, num_digits](iterator it) { + return format_uint<3, Char>(it, abs_value, num_digits); + }); + } + + enum { sep_size = 1 }; + + void on_num() { + std::string groups = grouping<Char>(locale); + if (groups.empty()) return on_dec(); + auto sep = thousands_sep<Char>(locale); + if (!sep) return on_dec(); + int num_digits = count_digits(abs_value); + int size = num_digits, n = num_digits; + std::string::const_iterator group = groups.cbegin(); + while (group != groups.cend() && n > *group && *group > 0 && + *group != max_value<char>()) { + size += sep_size; + n -= *group; + ++group; + } + if (group == groups.cend()) size += sep_size * ((n - 1) / groups.back()); + char digits[40]; + format_decimal(digits, abs_value, num_digits); + basic_memory_buffer<Char> buffer; + size += static_cast<int>(prefix_size); + const auto usize = to_unsigned(size); + buffer.resize(usize); + basic_string_view<Char> s(&sep, sep_size); + // Index of a decimal digit with the least significant digit having index 0. + int digit_index = 0; + group = groups.cbegin(); + auto p = buffer.data() + size - 1; + for (int i = num_digits - 1; i > 0; --i) { + *p-- = static_cast<Char>(digits[i]); + if (*group <= 0 || ++digit_index % *group != 0 || + *group == max_value<char>()) + continue; + if (group + 1 != groups.cend()) { + digit_index = 0; + ++group; + } + std::uninitialized_copy(s.data(), s.data() + s.size(), + make_checked(p, s.size())); + p -= s.size(); + } + *p-- = static_cast<Char>(*digits); + if (prefix_size != 0) *p = static_cast<Char>('-'); + auto data = buffer.data(); + out = write_padded<align::right>( + out, specs, usize, usize, + [=](iterator it) { return copy_str<Char>(data, data + size, it); }); + } + + void on_chr() { *out++ = static_cast<Char>(abs_value); } + + FMT_NORETURN void on_error() { + FMT_THROW(format_error("invalid type specifier")); + } +}; + +template <typename Char, typename OutputIt> +OutputIt write_nonfinite(OutputIt out, bool isinf, + const basic_format_specs<Char>& specs, + const float_specs& fspecs) { + auto str = + isinf ? (fspecs.upper ? "INF" : "inf") : (fspecs.upper ? "NAN" : "nan"); + constexpr size_t str_size = 3; + auto sign = fspecs.sign; + auto size = str_size + (sign ? 1 : 0); + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + return write_padded(out, specs, size, [=](iterator it) { + if (sign) *it++ = static_cast<Char>(data::signs[sign]); + return copy_str<Char>(str, str + str_size, it); + }); +} + +// A decimal floating-point number significand * pow(10, exp). +struct big_decimal_fp { + const char* significand; + int significand_size; + int exponent; +}; + +inline int get_significand_size(const big_decimal_fp& fp) { + return fp.significand_size; +} +template <typename T> +inline int get_significand_size(const dragonbox::decimal_fp<T>& fp) { + return count_digits(fp.significand); +} + +template <typename Char, typename OutputIt> +inline OutputIt write_significand(OutputIt out, const char* significand, + int& significand_size) { + return copy_str<Char>(significand, significand + significand_size, out); +} +template <typename Char, typename OutputIt, typename UInt> +inline OutputIt write_significand(OutputIt out, UInt significand, + int significand_size) { + return format_decimal<Char>(out, significand, significand_size).end; +} + +template <typename Char, typename UInt, + FMT_ENABLE_IF(std::is_integral<UInt>::value)> +inline Char* write_significand(Char* out, UInt significand, + int significand_size, int integral_size, + Char decimal_point) { + if (!decimal_point) + return format_decimal(out, significand, significand_size).end; + auto end = format_decimal(out + 1, significand, significand_size).end; + if (integral_size == 1) + out[0] = out[1]; + else + std::copy_n(out + 1, integral_size, out); + out[integral_size] = decimal_point; + return end; +} + +template <typename OutputIt, typename UInt, typename Char, + FMT_ENABLE_IF(!std::is_pointer<remove_cvref_t<OutputIt>>::value)> +inline OutputIt write_significand(OutputIt out, UInt significand, + int significand_size, int integral_size, + Char decimal_point) { + // Buffer is large enough to hold digits (digits10 + 1) and a decimal point. + Char buffer[digits10<UInt>() + 2]; + auto end = write_significand(buffer, significand, significand_size, + integral_size, decimal_point); + return detail::copy_str<Char>(buffer, end, out); +} + +template <typename OutputIt, typename Char> +inline OutputIt write_significand(OutputIt out, const char* significand, + int significand_size, int integral_size, + Char decimal_point) { + out = detail::copy_str<Char>(significand, significand + integral_size, out); + if (!decimal_point) return out; + *out++ = decimal_point; + return detail::copy_str<Char>(significand + integral_size, + significand + significand_size, out); +} + +template <typename OutputIt, typename DecimalFP, typename Char> +OutputIt write_float(OutputIt out, const DecimalFP& fp, + const basic_format_specs<Char>& specs, float_specs fspecs, + Char decimal_point) { + auto significand = fp.significand; + int significand_size = get_significand_size(fp); + static const Char zero = static_cast<Char>('0'); + auto sign = fspecs.sign; + size_t size = to_unsigned(significand_size) + (sign ? 1 : 0); + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + + int output_exp = fp.exponent + significand_size - 1; + auto use_exp_format = [=]() { + if (fspecs.format == float_format::exp) return true; + if (fspecs.format != float_format::general) return false; + // Use the fixed notation if the exponent is in [exp_lower, exp_upper), + // e.g. 0.0001 instead of 1e-04. Otherwise use the exponent notation. + const int exp_lower = -4, exp_upper = 16; + return output_exp < exp_lower || + output_exp >= (fspecs.precision > 0 ? fspecs.precision : exp_upper); + }; + if (use_exp_format()) { + int num_zeros = 0; + if (fspecs.showpoint) { + num_zeros = (std::max)(fspecs.precision - significand_size, 0); + size += to_unsigned(num_zeros); + } else if (significand_size == 1) { + decimal_point = Char(); + } + auto abs_output_exp = output_exp >= 0 ? output_exp : -output_exp; + int exp_digits = 2; + if (abs_output_exp >= 100) exp_digits = abs_output_exp >= 1000 ? 4 : 3; + + size += to_unsigned((decimal_point ? 1 : 0) + 2 + exp_digits); + char exp_char = fspecs.upper ? 'E' : 'e'; + auto write = [=](iterator it) { + if (sign) *it++ = static_cast<Char>(data::signs[sign]); + // Insert a decimal point after the first digit and add an exponent. + it = write_significand(it, significand, significand_size, 1, + decimal_point); + if (num_zeros > 0) it = std::fill_n(it, num_zeros, zero); + *it++ = static_cast<Char>(exp_char); + return write_exponent<Char>(output_exp, it); + }; + return specs.width > 0 ? write_padded<align::right>(out, specs, size, write) + : base_iterator(out, write(reserve(out, size))); + } + + int exp = fp.exponent + significand_size; + if (fp.exponent >= 0) { + // 1234e5 -> 123400000[.0+] + size += to_unsigned(fp.exponent); + int num_zeros = fspecs.precision - exp; +#ifdef FMT_FUZZ + if (num_zeros > 5000) + throw std::runtime_error("fuzz mode - avoiding excessive cpu use"); +#endif + if (fspecs.showpoint) { + if (num_zeros <= 0 && fspecs.format != float_format::fixed) num_zeros = 1; + if (num_zeros > 0) size += to_unsigned(num_zeros); + } + return write_padded<align::right>(out, specs, size, [&](iterator it) { + if (sign) *it++ = static_cast<Char>(data::signs[sign]); + it = write_significand<Char>(it, significand, significand_size); + it = std::fill_n(it, fp.exponent, zero); + if (!fspecs.showpoint) return it; + *it++ = decimal_point; + return num_zeros > 0 ? std::fill_n(it, num_zeros, zero) : it; + }); + } else if (exp > 0) { + // 1234e-2 -> 12.34[0+] + int num_zeros = fspecs.showpoint ? fspecs.precision - significand_size : 0; + size += 1 + to_unsigned(num_zeros > 0 ? num_zeros : 0); + return write_padded<align::right>(out, specs, size, [&](iterator it) { + if (sign) *it++ = static_cast<Char>(data::signs[sign]); + it = write_significand(it, significand, significand_size, exp, + decimal_point); + return num_zeros > 0 ? std::fill_n(it, num_zeros, zero) : it; + }); + } + // 1234e-6 -> 0.001234 + int num_zeros = -exp; + if (significand_size == 0 && fspecs.precision >= 0 && + fspecs.precision < num_zeros) { + num_zeros = fspecs.precision; + } + size += 2 + to_unsigned(num_zeros); + return write_padded<align::right>(out, specs, size, [&](iterator it) { + if (sign) *it++ = static_cast<Char>(data::signs[sign]); + *it++ = zero; + if (num_zeros == 0 && significand_size == 0 && !fspecs.showpoint) return it; + *it++ = decimal_point; + it = std::fill_n(it, num_zeros, zero); + return write_significand<Char>(it, significand, significand_size); + }); +} + +template <typename Char, typename OutputIt, typename T, + FMT_ENABLE_IF(std::is_floating_point<T>::value)> +OutputIt write(OutputIt out, T value, basic_format_specs<Char> specs, + locale_ref loc = {}) { + if (const_check(!is_supported_floating_point(value))) return out; + float_specs fspecs = parse_float_type_spec(specs); + fspecs.sign = specs.sign; + if (std::signbit(value)) { // value < 0 is false for NaN so use signbit. + fspecs.sign = sign::minus; + value = -value; + } else if (fspecs.sign == sign::minus) { + fspecs.sign = sign::none; + } + + if (!std::isfinite(value)) + return write_nonfinite(out, std::isinf(value), specs, fspecs); + + if (specs.align == align::numeric && fspecs.sign) { + auto it = reserve(out, 1); + *it++ = static_cast<Char>(data::signs[fspecs.sign]); + out = base_iterator(out, it); + fspecs.sign = sign::none; + if (specs.width != 0) --specs.width; + } + + memory_buffer buffer; + if (fspecs.format == float_format::hex) { + if (fspecs.sign) buffer.push_back(data::signs[fspecs.sign]); + snprintf_float(promote_float(value), specs.precision, fspecs, buffer); + return write_bytes(out, {buffer.data(), buffer.size()}, specs); + } + int precision = specs.precision >= 0 || !specs.type ? specs.precision : 6; + if (fspecs.format == float_format::exp) { + if (precision == max_value<int>()) + FMT_THROW(format_error("number is too big")); + else + ++precision; + } + if (const_check(std::is_same<T, float>())) fspecs.binary32 = true; + fspecs.use_grisu = is_fast_float<T>(); + int exp = format_float(promote_float(value), precision, fspecs, buffer); + fspecs.precision = precision; + Char point = + fspecs.locale ? decimal_point<Char>(loc) : static_cast<Char>('.'); + auto fp = big_decimal_fp{buffer.data(), static_cast<int>(buffer.size()), exp}; + return write_float(out, fp, specs, fspecs, point); +} + +template <typename Char, typename OutputIt, typename T, + FMT_ENABLE_IF(is_fast_float<T>::value)> +OutputIt write(OutputIt out, T value) { + if (const_check(!is_supported_floating_point(value))) return out; + + using floaty = conditional_t<std::is_same<T, long double>::value, double, T>; + using uint = typename dragonbox::float_info<floaty>::carrier_uint; + auto bits = bit_cast<uint>(value); + + auto fspecs = float_specs(); + auto sign_bit = bits & (uint(1) << (num_bits<uint>() - 1)); + if (sign_bit != 0) { + fspecs.sign = sign::minus; + value = -value; + } + + static const auto specs = basic_format_specs<Char>(); + uint mask = exponent_mask<floaty>(); + if ((bits & mask) == mask) + return write_nonfinite(out, std::isinf(value), specs, fspecs); + + auto dec = dragonbox::to_decimal(static_cast<floaty>(value)); + return write_float(out, dec, specs, fspecs, static_cast<Char>('.')); +} + +template <typename Char, typename OutputIt, typename T, + FMT_ENABLE_IF(std::is_floating_point<T>::value && + !is_fast_float<T>::value)> +inline OutputIt write(OutputIt out, T value) { + return write(out, value, basic_format_specs<Char>()); +} + +template <typename Char, typename OutputIt> +OutputIt write_char(OutputIt out, Char value, + const basic_format_specs<Char>& specs) { + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + return write_padded(out, specs, 1, [=](iterator it) { + *it++ = value; + return it; + }); +} + +template <typename Char, typename OutputIt, typename UIntPtr> +OutputIt write_ptr(OutputIt out, UIntPtr value, + const basic_format_specs<Char>* specs) { + int num_digits = count_digits<4>(value); + auto size = to_unsigned(num_digits) + size_t(2); + using iterator = remove_reference_t<decltype(reserve(out, 0))>; + auto write = [=](iterator it) { + *it++ = static_cast<Char>('0'); + *it++ = static_cast<Char>('x'); + return format_uint<4, Char>(it, value, num_digits); + }; + return specs ? write_padded<align::right>(out, *specs, size, write) + : base_iterator(out, write(reserve(out, size))); +} + +template <typename T> struct is_integral : std::is_integral<T> {}; +template <> struct is_integral<int128_t> : std::true_type {}; +template <> struct is_integral<uint128_t> : std::true_type {}; + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, monostate) { + FMT_ASSERT(false, ""); + return out; +} + +template <typename Char, typename OutputIt, + FMT_ENABLE_IF(!std::is_same<Char, char>::value)> +OutputIt write(OutputIt out, string_view value) { + auto it = reserve(out, value.size()); + it = copy_str<Char>(value.begin(), value.end(), it); + return base_iterator(out, it); +} + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, basic_string_view<Char> value) { + auto it = reserve(out, value.size()); + it = std::copy(value.begin(), value.end(), it); + return base_iterator(out, it); +} + +template <typename Char> +buffer_appender<Char> write(buffer_appender<Char> out, + basic_string_view<Char> value) { + get_container(out).append(value.begin(), value.end()); + return out; +} + +template <typename Char, typename OutputIt, typename T, + FMT_ENABLE_IF(is_integral<T>::value && + !std::is_same<T, bool>::value && + !std::is_same<T, Char>::value)> +OutputIt write(OutputIt out, T value) { + auto abs_value = static_cast<uint32_or_64_or_128_t<T>>(value); + bool negative = is_negative(value); + // Don't do -abs_value since it trips unsigned-integer-overflow sanitizer. + if (negative) abs_value = ~abs_value + 1; + int num_digits = count_digits(abs_value); + auto size = (negative ? 1 : 0) + static_cast<size_t>(num_digits); + auto it = reserve(out, size); + if (auto ptr = to_pointer<Char>(it, size)) { + if (negative) *ptr++ = static_cast<Char>('-'); + format_decimal<Char>(ptr, abs_value, num_digits); + return out; + } + if (negative) *it++ = static_cast<Char>('-'); + it = format_decimal<Char>(it, abs_value, num_digits).end; + return base_iterator(out, it); +} + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, bool value) { + return write<Char>(out, string_view(value ? "true" : "false")); +} + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, Char value) { + auto it = reserve(out, 1); + *it++ = value; + return base_iterator(out, it); +} + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, const Char* value) { + if (!value) { + FMT_THROW(format_error("string pointer is null")); + } else { + auto length = std::char_traits<Char>::length(value); + out = write(out, basic_string_view<Char>(value, length)); + } + return out; +} + +template <typename Char, typename OutputIt> +OutputIt write(OutputIt out, const void* value) { + return write_ptr<Char>(out, to_uintptr(value), nullptr); +} + +template <typename Char, typename OutputIt, typename T> +auto write(OutputIt out, const T& value) -> typename std::enable_if< + mapped_type_constant<T, basic_format_context<OutputIt, Char>>::value == + type::custom_type, + OutputIt>::type { + using context_type = basic_format_context<OutputIt, Char>; + using formatter_type = + conditional_t<has_formatter<T, context_type>::value, + typename context_type::template formatter_type<T>, + fallback_formatter<T, Char>>; + context_type ctx(out, {}, {}); + return formatter_type().format(value, ctx); +} + +// An argument visitor that formats the argument and writes it via the output +// iterator. It's a class and not a generic lambda for compatibility with C++11. +template <typename OutputIt, typename Char> struct default_arg_formatter { + using context = basic_format_context<OutputIt, Char>; + + OutputIt out; + basic_format_args<context> args; + locale_ref loc; + + template <typename T> OutputIt operator()(T value) { + return write<Char>(out, value); + } + + OutputIt operator()(typename basic_format_arg<context>::handle handle) { + basic_format_parse_context<Char> parse_ctx({}); + basic_format_context<OutputIt, Char> format_ctx(out, args, loc); + handle.format(parse_ctx, format_ctx); + return format_ctx.out(); + } +}; + +template <typename OutputIt, typename Char, + typename ErrorHandler = error_handler> +class arg_formatter_base { + public: + using iterator = OutputIt; + using char_type = Char; + using format_specs = basic_format_specs<Char>; + + private: + iterator out_; + locale_ref locale_; + format_specs* specs_; + + // Attempts to reserve space for n extra characters in the output range. + // Returns a pointer to the reserved range or a reference to out_. + auto reserve(size_t n) -> decltype(detail::reserve(out_, n)) { + return detail::reserve(out_, n); + } + + using reserve_iterator = remove_reference_t<decltype( + detail::reserve(std::declval<iterator&>(), 0))>; + + template <typename T> void write_int(T value, const format_specs& spec) { + using uint_type = uint32_or_64_or_128_t<T>; + int_writer<iterator, Char, uint_type> w(out_, locale_, value, spec); + handle_int_type_spec(spec.type, w); + out_ = w.out; + } + + void write(char value) { + auto&& it = reserve(1); + *it++ = value; + } + + template <typename Ch, FMT_ENABLE_IF(std::is_same<Ch, Char>::value)> + void write(Ch value) { + out_ = detail::write<Char>(out_, value); + } + + void write(string_view value) { + auto&& it = reserve(value.size()); + it = copy_str<Char>(value.begin(), value.end(), it); + } + void write(wstring_view value) { + static_assert(std::is_same<Char, wchar_t>::value, ""); + auto&& it = reserve(value.size()); + it = std::copy(value.begin(), value.end(), it); + } + + template <typename Ch> + void write(const Ch* s, size_t size, const format_specs& specs) { + auto width = specs.width != 0 + ? count_code_points(basic_string_view<Ch>(s, size)) + : 0; + out_ = write_padded(out_, specs, size, width, [=](reserve_iterator it) { + return copy_str<Char>(s, s + size, it); + }); + } + + template <typename Ch> + void write(basic_string_view<Ch> s, const format_specs& specs = {}) { + out_ = detail::write(out_, s, specs); + } + + void write_pointer(const void* p) { + out_ = write_ptr<char_type>(out_, to_uintptr(p), specs_); + } + + struct char_spec_handler : ErrorHandler { + arg_formatter_base& formatter; + Char value; + + char_spec_handler(arg_formatter_base& f, Char val) + : formatter(f), value(val) {} + + void on_int() { + // char is only formatted as int if there are specs. + formatter.write_int(static_cast<int>(value), *formatter.specs_); + } + void on_char() { + if (formatter.specs_) + formatter.out_ = write_char(formatter.out_, value, *formatter.specs_); + else + formatter.write(value); + } + }; + + struct cstring_spec_handler : error_handler { + arg_formatter_base& formatter; + const Char* value; + + cstring_spec_handler(arg_formatter_base& f, const Char* val) + : formatter(f), value(val) {} + + void on_string() { formatter.write(value); } + void on_pointer() { formatter.write_pointer(value); } + }; + + protected: + iterator out() { return out_; } + format_specs* specs() { return specs_; } + + void write(bool value) { + if (specs_) + write(string_view(value ? "true" : "false"), *specs_); + else + out_ = detail::write<Char>(out_, value); + } + + void write(const Char* value) { + if (!value) { + FMT_THROW(format_error("string pointer is null")); + } else { + auto length = std::char_traits<char_type>::length(value); + basic_string_view<char_type> sv(value, length); + specs_ ? write(sv, *specs_) : write(sv); + } + } + + public: + arg_formatter_base(OutputIt out, format_specs* s, locale_ref loc) + : out_(out), locale_(loc), specs_(s) {} + + iterator operator()(monostate) { + FMT_ASSERT(false, "invalid argument type"); + return out_; + } + + template <typename T, FMT_ENABLE_IF(is_integral<T>::value)> + FMT_INLINE iterator operator()(T value) { + if (specs_) + write_int(value, *specs_); + else + out_ = detail::write<Char>(out_, value); + return out_; + } + + iterator operator()(Char value) { + handle_char_specs(specs_, + char_spec_handler(*this, static_cast<Char>(value))); + return out_; + } + + iterator operator()(bool value) { + if (specs_ && specs_->type) return (*this)(value ? 1 : 0); + write(value != 0); + return out_; + } + + template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)> + iterator operator()(T value) { + auto specs = specs_ ? *specs_ : format_specs(); + if (const_check(is_supported_floating_point(value))) + out_ = detail::write(out_, value, specs, locale_); + else + FMT_ASSERT(false, "unsupported float argument type"); + return out_; + } + + iterator operator()(const Char* value) { + if (!specs_) return write(value), out_; + handle_cstring_type_spec(specs_->type, cstring_spec_handler(*this, value)); + return out_; + } + + iterator operator()(basic_string_view<Char> value) { + if (specs_) { + check_string_type_spec(specs_->type, error_handler()); + write(value, *specs_); + } else { + write(value); + } + return out_; + } + + iterator operator()(const void* value) { + if (specs_) check_pointer_type_spec(specs_->type, error_handler()); + write_pointer(value); + return out_; + } +}; + +/** The default argument formatter. */ +template <typename OutputIt, typename Char> +class arg_formatter : public arg_formatter_base<OutputIt, Char> { + private: + using char_type = Char; + using base = arg_formatter_base<OutputIt, Char>; + using context_type = basic_format_context<OutputIt, Char>; + + context_type& ctx_; + basic_format_parse_context<char_type>* parse_ctx_; + const Char* ptr_; + + public: + using iterator = typename base::iterator; + using format_specs = typename base::format_specs; + + /** + \rst + Constructs an argument formatter object. + *ctx* is a reference to the formatting context, + *specs* contains format specifier information for standard argument types. + \endrst + */ + explicit arg_formatter( + context_type& ctx, + basic_format_parse_context<char_type>* parse_ctx = nullptr, + format_specs* specs = nullptr, const Char* ptr = nullptr) + : base(ctx.out(), specs, ctx.locale()), + ctx_(ctx), + parse_ctx_(parse_ctx), + ptr_(ptr) {} + + using base::operator(); + + /** Formats an argument of a user-defined type. */ + iterator operator()(typename basic_format_arg<context_type>::handle handle) { + if (ptr_) advance_to(*parse_ctx_, ptr_); + handle.format(*parse_ctx_, ctx_); + return ctx_.out(); + } +}; + +template <typename Char> FMT_CONSTEXPR bool is_name_start(Char c) { + return ('a' <= c && c <= 'z') || ('A' <= c && c <= 'Z') || '_' == c; +} + +// Parses the range [begin, end) as an unsigned integer. This function assumes +// that the range is non-empty and the first character is a digit. +template <typename Char, typename ErrorHandler> +FMT_CONSTEXPR int parse_nonnegative_int(const Char*& begin, const Char* end, + ErrorHandler&& eh) { + FMT_ASSERT(begin != end && '0' <= *begin && *begin <= '9', ""); + unsigned value = 0; + // Convert to unsigned to prevent a warning. + constexpr unsigned max_int = max_value<int>(); + unsigned big = max_int / 10; + do { + // Check for overflow. + if (value > big) { + value = max_int + 1; + break; + } + value = value * 10 + unsigned(*begin - '0'); + ++begin; + } while (begin != end && '0' <= *begin && *begin <= '9'); + if (value > max_int) eh.on_error("number is too big"); + return static_cast<int>(value); +} + +template <typename Context> class custom_formatter { + private: + using char_type = typename Context::char_type; + + basic_format_parse_context<char_type>& parse_ctx_; + Context& ctx_; + + public: + explicit custom_formatter(basic_format_parse_context<char_type>& parse_ctx, + Context& ctx) + : parse_ctx_(parse_ctx), ctx_(ctx) {} + + void operator()(typename basic_format_arg<Context>::handle h) const { + h.format(parse_ctx_, ctx_); + } + + template <typename T> void operator()(T) const {} +}; + +template <typename T> +using is_integer = + bool_constant<is_integral<T>::value && !std::is_same<T, bool>::value && + !std::is_same<T, char>::value && + !std::is_same<T, wchar_t>::value>; + +template <typename ErrorHandler> class width_checker { + public: + explicit FMT_CONSTEXPR width_checker(ErrorHandler& eh) : handler_(eh) {} + + template <typename T, FMT_ENABLE_IF(is_integer<T>::value)> + FMT_CONSTEXPR unsigned long long operator()(T value) { + if (is_negative(value)) handler_.on_error("negative width"); + return static_cast<unsigned long long>(value); + } + + template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)> + FMT_CONSTEXPR unsigned long long operator()(T) { + handler_.on_error("width is not integer"); + return 0; + } + + private: + ErrorHandler& handler_; +}; + +template <typename ErrorHandler> class precision_checker { + public: + explicit FMT_CONSTEXPR precision_checker(ErrorHandler& eh) : handler_(eh) {} + + template <typename T, FMT_ENABLE_IF(is_integer<T>::value)> + FMT_CONSTEXPR unsigned long long operator()(T value) { + if (is_negative(value)) handler_.on_error("negative precision"); + return static_cast<unsigned long long>(value); + } + + template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)> + FMT_CONSTEXPR unsigned long long operator()(T) { + handler_.on_error("precision is not integer"); + return 0; + } + + private: + ErrorHandler& handler_; +}; + +// A format specifier handler that sets fields in basic_format_specs. +template <typename Char> class specs_setter { + public: + explicit FMT_CONSTEXPR specs_setter(basic_format_specs<Char>& specs) + : specs_(specs) {} + + FMT_CONSTEXPR specs_setter(const specs_setter& other) + : specs_(other.specs_) {} + + FMT_CONSTEXPR void on_align(align_t align) { specs_.align = align; } + FMT_CONSTEXPR void on_fill(basic_string_view<Char> fill) { + specs_.fill = fill; + } + FMT_CONSTEXPR void on_plus() { specs_.sign = sign::plus; } + FMT_CONSTEXPR void on_minus() { specs_.sign = sign::minus; } + FMT_CONSTEXPR void on_space() { specs_.sign = sign::space; } + FMT_CONSTEXPR void on_hash() { specs_.alt = true; } + + FMT_CONSTEXPR void on_zero() { + specs_.align = align::numeric; + specs_.fill[0] = Char('0'); + } + + FMT_CONSTEXPR void on_width(int width) { specs_.width = width; } + FMT_CONSTEXPR void on_precision(int precision) { + specs_.precision = precision; + } + FMT_CONSTEXPR void end_precision() {} + + FMT_CONSTEXPR void on_type(Char type) { + specs_.type = static_cast<char>(type); + } + + protected: + basic_format_specs<Char>& specs_; +}; + +template <typename ErrorHandler> class numeric_specs_checker { + public: + FMT_CONSTEXPR numeric_specs_checker(ErrorHandler& eh, detail::type arg_type) + : error_handler_(eh), arg_type_(arg_type) {} + + FMT_CONSTEXPR void require_numeric_argument() { + if (!is_arithmetic_type(arg_type_)) + error_handler_.on_error("format specifier requires numeric argument"); + } + + FMT_CONSTEXPR void check_sign() { + require_numeric_argument(); + if (is_integral_type(arg_type_) && arg_type_ != type::int_type && + arg_type_ != type::long_long_type && arg_type_ != type::char_type) { + error_handler_.on_error("format specifier requires signed argument"); + } + } + + FMT_CONSTEXPR void check_precision() { + if (is_integral_type(arg_type_) || arg_type_ == type::pointer_type) + error_handler_.on_error("precision not allowed for this argument type"); + } + + private: + ErrorHandler& error_handler_; + detail::type arg_type_; +}; + +// A format specifier handler that checks if specifiers are consistent with the +// argument type. +template <typename Handler> class specs_checker : public Handler { + private: + numeric_specs_checker<Handler> checker_; + + // Suppress an MSVC warning about using this in initializer list. + FMT_CONSTEXPR Handler& error_handler() { return *this; } + + public: + FMT_CONSTEXPR specs_checker(const Handler& handler, detail::type arg_type) + : Handler(handler), checker_(error_handler(), arg_type) {} + + FMT_CONSTEXPR specs_checker(const specs_checker& other) + : Handler(other), checker_(error_handler(), other.arg_type_) {} + + FMT_CONSTEXPR void on_align(align_t align) { + if (align == align::numeric) checker_.require_numeric_argument(); + Handler::on_align(align); + } + + FMT_CONSTEXPR void on_plus() { + checker_.check_sign(); + Handler::on_plus(); + } + + FMT_CONSTEXPR void on_minus() { + checker_.check_sign(); + Handler::on_minus(); + } + + FMT_CONSTEXPR void on_space() { + checker_.check_sign(); + Handler::on_space(); + } + + FMT_CONSTEXPR void on_hash() { + checker_.require_numeric_argument(); + Handler::on_hash(); + } + + FMT_CONSTEXPR void on_zero() { + checker_.require_numeric_argument(); + Handler::on_zero(); + } + + FMT_CONSTEXPR void end_precision() { checker_.check_precision(); } +}; + +template <template <typename> class Handler, typename FormatArg, + typename ErrorHandler> +FMT_CONSTEXPR int get_dynamic_spec(FormatArg arg, ErrorHandler eh) { + unsigned long long value = visit_format_arg(Handler<ErrorHandler>(eh), arg); + if (value > to_unsigned(max_value<int>())) eh.on_error("number is too big"); + return static_cast<int>(value); +} + +struct auto_id {}; + +template <typename Context, typename ID> +FMT_CONSTEXPR typename Context::format_arg get_arg(Context& ctx, ID id) { + auto arg = ctx.arg(id); + if (!arg) ctx.on_error("argument not found"); + return arg; +} + +// The standard format specifier handler with checking. +template <typename ParseContext, typename Context> +class specs_handler : public specs_setter<typename Context::char_type> { + public: + using char_type = typename Context::char_type; + + FMT_CONSTEXPR specs_handler(basic_format_specs<char_type>& specs, + ParseContext& parse_ctx, Context& ctx) + : specs_setter<char_type>(specs), + parse_context_(parse_ctx), + context_(ctx) {} + + template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) { + this->specs_.width = get_dynamic_spec<width_checker>( + get_arg(arg_id), context_.error_handler()); + } + + template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) { + this->specs_.precision = get_dynamic_spec<precision_checker>( + get_arg(arg_id), context_.error_handler()); + } + + void on_error(const char* message) { context_.on_error(message); } + + private: + // This is only needed for compatibility with gcc 4.4. + using format_arg = typename Context::format_arg; + + FMT_CONSTEXPR format_arg get_arg(auto_id) { + return detail::get_arg(context_, parse_context_.next_arg_id()); + } + + FMT_CONSTEXPR format_arg get_arg(int arg_id) { + parse_context_.check_arg_id(arg_id); + return detail::get_arg(context_, arg_id); + } + + FMT_CONSTEXPR format_arg get_arg(basic_string_view<char_type> arg_id) { + parse_context_.check_arg_id(arg_id); + return detail::get_arg(context_, arg_id); + } + + ParseContext& parse_context_; + Context& context_; +}; + +enum class arg_id_kind { none, index, name }; + +// An argument reference. +template <typename Char> struct arg_ref { + FMT_CONSTEXPR arg_ref() : kind(arg_id_kind::none), val() {} + + FMT_CONSTEXPR explicit arg_ref(int index) + : kind(arg_id_kind::index), val(index) {} + FMT_CONSTEXPR explicit arg_ref(basic_string_view<Char> name) + : kind(arg_id_kind::name), val(name) {} + + FMT_CONSTEXPR arg_ref& operator=(int idx) { + kind = arg_id_kind::index; + val.index = idx; + return *this; + } + + arg_id_kind kind; + union value { + FMT_CONSTEXPR value(int id = 0) : index{id} {} + FMT_CONSTEXPR value(basic_string_view<Char> n) : name(n) {} + + int index; + basic_string_view<Char> name; + } val; +}; + +// Format specifiers with width and precision resolved at formatting rather +// than parsing time to allow re-using the same parsed specifiers with +// different sets of arguments (precompilation of format strings). +template <typename Char> +struct dynamic_format_specs : basic_format_specs<Char> { + arg_ref<Char> width_ref; + arg_ref<Char> precision_ref; +}; + +// Format spec handler that saves references to arguments representing dynamic +// width and precision to be resolved at formatting time. +template <typename ParseContext> +class dynamic_specs_handler + : public specs_setter<typename ParseContext::char_type> { + public: + using char_type = typename ParseContext::char_type; + + FMT_CONSTEXPR dynamic_specs_handler(dynamic_format_specs<char_type>& specs, + ParseContext& ctx) + : specs_setter<char_type>(specs), specs_(specs), context_(ctx) {} + + FMT_CONSTEXPR dynamic_specs_handler(const dynamic_specs_handler& other) + : specs_setter<char_type>(other), + specs_(other.specs_), + context_(other.context_) {} + + template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) { + specs_.width_ref = make_arg_ref(arg_id); + } + + template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) { + specs_.precision_ref = make_arg_ref(arg_id); + } + + FMT_CONSTEXPR void on_error(const char* message) { + context_.on_error(message); + } + + private: + using arg_ref_type = arg_ref<char_type>; + + FMT_CONSTEXPR arg_ref_type make_arg_ref(int arg_id) { + context_.check_arg_id(arg_id); + return arg_ref_type(arg_id); + } + + FMT_CONSTEXPR arg_ref_type make_arg_ref(auto_id) { + return arg_ref_type(context_.next_arg_id()); + } + + FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<char_type> arg_id) { + context_.check_arg_id(arg_id); + basic_string_view<char_type> format_str( + context_.begin(), to_unsigned(context_.end() - context_.begin())); + return arg_ref_type(arg_id); + } + + dynamic_format_specs<char_type>& specs_; + ParseContext& context_; +}; + +template <typename Char, typename IDHandler> +FMT_CONSTEXPR const Char* parse_arg_id(const Char* begin, const Char* end, + IDHandler&& handler) { + FMT_ASSERT(begin != end, ""); + Char c = *begin; + if (c == '}' || c == ':') { + handler(); + return begin; + } + if (c >= '0' && c <= '9') { + int index = 0; + if (c != '0') + index = parse_nonnegative_int(begin, end, handler); + else + ++begin; + if (begin == end || (*begin != '}' && *begin != ':')) + handler.on_error("invalid format string"); + else + handler(index); + return begin; + } + if (!is_name_start(c)) { + handler.on_error("invalid format string"); + return begin; + } + auto it = begin; + do { + ++it; + } while (it != end && (is_name_start(c = *it) || ('0' <= c && c <= '9'))); + handler(basic_string_view<Char>(begin, to_unsigned(it - begin))); + return it; +} + +// Adapts SpecHandler to IDHandler API for dynamic width. +template <typename SpecHandler, typename Char> struct width_adapter { + explicit FMT_CONSTEXPR width_adapter(SpecHandler& h) : handler(h) {} + + FMT_CONSTEXPR void operator()() { handler.on_dynamic_width(auto_id()); } + FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_width(id); } + FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { + handler.on_dynamic_width(id); + } + + FMT_CONSTEXPR void on_error(const char* message) { + handler.on_error(message); + } + + SpecHandler& handler; +}; + +// Adapts SpecHandler to IDHandler API for dynamic precision. +template <typename SpecHandler, typename Char> struct precision_adapter { + explicit FMT_CONSTEXPR precision_adapter(SpecHandler& h) : handler(h) {} + + FMT_CONSTEXPR void operator()() { handler.on_dynamic_precision(auto_id()); } + FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_precision(id); } + FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { + handler.on_dynamic_precision(id); + } + + FMT_CONSTEXPR void on_error(const char* message) { + handler.on_error(message); + } + + SpecHandler& handler; +}; + +template <typename Char> +FMT_CONSTEXPR int code_point_length(const Char* begin) { + if (const_check(sizeof(Char) != 1)) return 1; + constexpr char lengths[] = {1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + 0, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 2, 3, 3, 4, 0}; + int len = lengths[static_cast<unsigned char>(*begin) >> 3]; + + // Compute the pointer to the next character early so that the next + // iteration can start working on the next character. Neither Clang + // nor GCC figure out this reordering on their own. + return len + !len; +} + +template <typename Char> constexpr bool is_ascii_letter(Char c) { + return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z'); +} + +// Converts a character to ASCII. Returns a number > 127 on conversion failure. +template <typename Char, FMT_ENABLE_IF(std::is_integral<Char>::value)> +constexpr Char to_ascii(Char value) { + return value; +} +template <typename Char, FMT_ENABLE_IF(std::is_enum<Char>::value)> +constexpr typename std::underlying_type<Char>::type to_ascii(Char value) { + return value; +} + +// Parses fill and alignment. +template <typename Char, typename Handler> +FMT_CONSTEXPR const Char* parse_align(const Char* begin, const Char* end, + Handler&& handler) { + FMT_ASSERT(begin != end, ""); + auto align = align::none; + auto p = begin + code_point_length(begin); + if (p >= end) p = begin; + for (;;) { + switch (to_ascii(*p)) { + case '<': + align = align::left; + break; + case '>': + align = align::right; + break; +#if FMT_DEPRECATED_NUMERIC_ALIGN + case '=': + align = align::numeric; + break; +#endif + case '^': + align = align::center; + break; + } + if (align != align::none) { + if (p != begin) { + auto c = *begin; + if (c == '{') + return handler.on_error("invalid fill character '{'"), begin; + handler.on_fill(basic_string_view<Char>(begin, to_unsigned(p - begin))); + begin = p + 1; + } else + ++begin; + handler.on_align(align); + break; + } else if (p == begin) { + break; + } + p = begin; + } + return begin; +} + +template <typename Char, typename Handler> +FMT_CONSTEXPR const Char* parse_width(const Char* begin, const Char* end, + Handler&& handler) { + FMT_ASSERT(begin != end, ""); + if ('0' <= *begin && *begin <= '9') { + handler.on_width(parse_nonnegative_int(begin, end, handler)); + } else if (*begin == '{') { + ++begin; + if (begin != end) + begin = parse_arg_id(begin, end, width_adapter<Handler, Char>(handler)); + if (begin == end || *begin != '}') + return handler.on_error("invalid format string"), begin; + ++begin; + } + return begin; +} + +template <typename Char, typename Handler> +FMT_CONSTEXPR const Char* parse_precision(const Char* begin, const Char* end, + Handler&& handler) { + ++begin; + auto c = begin != end ? *begin : Char(); + if ('0' <= c && c <= '9') { + handler.on_precision(parse_nonnegative_int(begin, end, handler)); + } else if (c == '{') { + ++begin; + if (begin != end) { + begin = + parse_arg_id(begin, end, precision_adapter<Handler, Char>(handler)); + } + if (begin == end || *begin++ != '}') + return handler.on_error("invalid format string"), begin; + } else { + return handler.on_error("missing precision specifier"), begin; + } + handler.end_precision(); + return begin; +} + +// Parses standard format specifiers and sends notifications about parsed +// components to handler. +template <typename Char, typename SpecHandler> +FMT_CONSTEXPR const Char* parse_format_specs(const Char* begin, const Char* end, + SpecHandler&& handler) { + if (begin == end) return begin; + + begin = parse_align(begin, end, handler); + if (begin == end) return begin; + + // Parse sign. + switch (to_ascii(*begin)) { + case '+': + handler.on_plus(); + ++begin; + break; + case '-': + handler.on_minus(); + ++begin; + break; + case ' ': + handler.on_space(); + ++begin; + break; + } + if (begin == end) return begin; + + if (*begin == '#') { + handler.on_hash(); + if (++begin == end) return begin; + } + + // Parse zero flag. + if (*begin == '0') { + handler.on_zero(); + if (++begin == end) return begin; + } + + begin = parse_width(begin, end, handler); + if (begin == end) return begin; + + // Parse precision. + if (*begin == '.') { + begin = parse_precision(begin, end, handler); + } + + // Parse type. + if (begin != end && *begin != '}') handler.on_type(*begin++); + return begin; +} + +// Return the result via the out param to workaround gcc bug 77539. +template <bool IS_CONSTEXPR, typename T, typename Ptr = const T*> +FMT_CONSTEXPR bool find(Ptr first, Ptr last, T value, Ptr& out) { + for (out = first; out != last; ++out) { + if (*out == value) return true; + } + return false; +} + +template <> +inline bool find<false, char>(const char* first, const char* last, char value, + const char*& out) { + out = static_cast<const char*>( + std::memchr(first, value, detail::to_unsigned(last - first))); + return out != nullptr; +} + +template <typename Handler, typename Char> struct id_adapter { + Handler& handler; + int arg_id; + + FMT_CONSTEXPR void operator()() { arg_id = handler.on_arg_id(); } + FMT_CONSTEXPR void operator()(int id) { arg_id = handler.on_arg_id(id); } + FMT_CONSTEXPR void operator()(basic_string_view<Char> id) { + arg_id = handler.on_arg_id(id); + } + FMT_CONSTEXPR void on_error(const char* message) { + handler.on_error(message); + } +}; + +template <typename Char, typename Handler> +FMT_CONSTEXPR const Char* parse_replacement_field(const Char* begin, + const Char* end, + Handler&& handler) { + ++begin; + if (begin == end) return handler.on_error("invalid format string"), end; + if (*begin == '}') { + handler.on_replacement_field(handler.on_arg_id(), begin); + } else if (*begin == '{') { + handler.on_text(begin, begin + 1); + } else { + auto adapter = id_adapter<Handler, Char>{handler, 0}; + begin = parse_arg_id(begin, end, adapter); + Char c = begin != end ? *begin : Char(); + if (c == '}') { + handler.on_replacement_field(adapter.arg_id, begin); + } else if (c == ':') { + begin = handler.on_format_specs(adapter.arg_id, begin + 1, end); + if (begin == end || *begin != '}') + return handler.on_error("unknown format specifier"), end; + } else { + return handler.on_error("missing '}' in format string"), end; + } + } + return begin + 1; +} + +template <bool IS_CONSTEXPR, typename Char, typename Handler> +FMT_CONSTEXPR_DECL FMT_INLINE void parse_format_string( + basic_string_view<Char> format_str, Handler&& handler) { + auto begin = format_str.data(); + auto end = begin + format_str.size(); + if (end - begin < 32) { + // Use a simple loop instead of memchr for small strings. + const Char* p = begin; + while (p != end) { + auto c = *p++; + if (c == '{') { + handler.on_text(begin, p - 1); + begin = p = parse_replacement_field(p - 1, end, handler); + } else if (c == '}') { + if (p == end || *p != '}') + return handler.on_error("unmatched '}' in format string"); + handler.on_text(begin, p); + begin = ++p; + } + } + handler.on_text(begin, end); + return; + } + struct pfs_writer { + FMT_CONSTEXPR void operator()(const Char* pbegin, const Char* pend) { + if (pbegin == pend) return; + for (;;) { + const Char* p = nullptr; + if (!find<IS_CONSTEXPR>(pbegin, pend, '}', p)) + return handler_.on_text(pbegin, pend); + ++p; + if (p == pend || *p != '}') + return handler_.on_error("unmatched '}' in format string"); + handler_.on_text(pbegin, p); + pbegin = p + 1; + } + } + Handler& handler_; + } write{handler}; + while (begin != end) { + // Doing two passes with memchr (one for '{' and another for '}') is up to + // 2.5x faster than the naive one-pass implementation on big format strings. + const Char* p = begin; + if (*begin != '{' && !find<IS_CONSTEXPR>(begin + 1, end, '{', p)) + return write(begin, end); + write(begin, p); + begin = parse_replacement_field(p, end, handler); + } +} + +template <typename T, typename ParseContext> +FMT_CONSTEXPR const typename ParseContext::char_type* parse_format_specs( + ParseContext& ctx) { + using char_type = typename ParseContext::char_type; + using context = buffer_context<char_type>; + using mapped_type = + conditional_t<detail::mapped_type_constant<T, context>::value != + type::custom_type, + decltype(arg_mapper<context>().map(std::declval<T>())), T>; + auto f = conditional_t<has_formatter<mapped_type, context>::value, + formatter<mapped_type, char_type>, + detail::fallback_formatter<T, char_type>>(); + return f.parse(ctx); +} + +template <typename OutputIt, typename Char, typename Context> +struct format_handler : detail::error_handler { + basic_format_parse_context<Char> parse_context; + Context context; + + format_handler(OutputIt out, basic_string_view<Char> str, + basic_format_args<Context> format_args, detail::locale_ref loc) + : parse_context(str), context(out, format_args, loc) {} + + void on_text(const Char* begin, const Char* end) { + auto size = to_unsigned(end - begin); + auto out = context.out(); + auto&& it = reserve(out, size); + it = std::copy_n(begin, size, it); + context.advance_to(out); + } + + int on_arg_id() { return parse_context.next_arg_id(); } + int on_arg_id(int id) { return parse_context.check_arg_id(id), id; } + int on_arg_id(basic_string_view<Char> id) { + int arg_id = context.arg_id(id); + if (arg_id < 0) on_error("argument not found"); + return arg_id; + } + + FMT_INLINE void on_replacement_field(int id, const Char*) { + auto arg = get_arg(context, id); + context.advance_to(visit_format_arg( + default_arg_formatter<OutputIt, Char>{context.out(), context.args(), + context.locale()}, + arg)); + } + + const Char* on_format_specs(int id, const Char* begin, const Char* end) { + auto arg = get_arg(context, id); + if (arg.type() == type::custom_type) { + advance_to(parse_context, begin); + visit_format_arg(custom_formatter<Context>(parse_context, context), arg); + return parse_context.begin(); + } + auto specs = basic_format_specs<Char>(); + if (begin + 1 < end && begin[1] == '}' && is_ascii_letter(*begin)) { + specs.type = static_cast<char>(*begin++); + } else { + using parse_context_t = basic_format_parse_context<Char>; + specs_checker<specs_handler<parse_context_t, Context>> handler( + specs_handler<parse_context_t, Context>(specs, parse_context, + context), + arg.type()); + begin = parse_format_specs(begin, end, handler); + if (begin == end || *begin != '}') + on_error("missing '}' in format string"); + } + context.advance_to(visit_format_arg( + arg_formatter<OutputIt, Char>(context, &parse_context, &specs), arg)); + return begin; + } +}; + +// A parse context with extra argument id checks. It is only used at compile +// time because adding checks at runtime would introduce substantial overhead +// and would be redundant since argument ids are checked when arguments are +// retrieved anyway. +template <typename Char, typename ErrorHandler = error_handler> +class compile_parse_context + : public basic_format_parse_context<Char, ErrorHandler> { + private: + int num_args_; + using base = basic_format_parse_context<Char, ErrorHandler>; + + public: + explicit FMT_CONSTEXPR compile_parse_context( + basic_string_view<Char> format_str, int num_args = max_value<int>(), + ErrorHandler eh = {}) + : base(format_str, eh), num_args_(num_args) {} + + FMT_CONSTEXPR int next_arg_id() { + int id = base::next_arg_id(); + if (id >= num_args_) this->on_error("argument not found"); + return id; + } + + FMT_CONSTEXPR void check_arg_id(int id) { + base::check_arg_id(id); + if (id >= num_args_) this->on_error("argument not found"); + } + using base::check_arg_id; +}; + +template <typename Char, typename ErrorHandler, typename... Args> +class format_string_checker { + public: + explicit FMT_CONSTEXPR format_string_checker( + basic_string_view<Char> format_str, ErrorHandler eh) + : context_(format_str, num_args, eh), + parse_funcs_{&parse_format_specs<Args, parse_context_type>...} {} + + FMT_CONSTEXPR void on_text(const Char*, const Char*) {} + + FMT_CONSTEXPR int on_arg_id() { return context_.next_arg_id(); } + FMT_CONSTEXPR int on_arg_id(int id) { return context_.check_arg_id(id), id; } + FMT_CONSTEXPR int on_arg_id(basic_string_view<Char>) { + on_error("compile-time checks don't support named arguments"); + return 0; + } + + FMT_CONSTEXPR void on_replacement_field(int, const Char*) {} + + FMT_CONSTEXPR const Char* on_format_specs(int id, const Char* begin, + const Char*) { + advance_to(context_, begin); + return id < num_args ? parse_funcs_[id](context_) : begin; + } + + FMT_CONSTEXPR void on_error(const char* message) { + context_.on_error(message); + } + + private: + using parse_context_type = compile_parse_context<Char, ErrorHandler>; + enum { num_args = sizeof...(Args) }; + + // Format specifier parsing function. + using parse_func = const Char* (*)(parse_context_type&); + + parse_context_type context_; + parse_func parse_funcs_[num_args > 0 ? num_args : 1]; +}; + +// Converts string literals to basic_string_view. +template <typename Char, size_t N> +FMT_CONSTEXPR basic_string_view<Char> compile_string_to_view( + const Char (&s)[N]) { + // Remove trailing null character if needed. Won't be present if this is used + // with raw character array (i.e. not defined as a string). + return {s, + N - ((std::char_traits<Char>::to_int_type(s[N - 1]) == 0) ? 1 : 0)}; +} + +// Converts string_view to basic_string_view. +template <typename Char> +FMT_CONSTEXPR basic_string_view<Char> compile_string_to_view( + const std_string_view<Char>& s) { + return {s.data(), s.size()}; +} + +#define FMT_STRING_IMPL(s, base) \ + [] { \ + /* Use a macro-like name to avoid shadowing warnings. */ \ + struct FMT_COMPILE_STRING : base { \ + using char_type = fmt::remove_cvref_t<decltype(s[0])>; \ + FMT_MAYBE_UNUSED FMT_CONSTEXPR \ + operator fmt::basic_string_view<char_type>() const { \ + return fmt::detail::compile_string_to_view<char_type>(s); \ + } \ + }; \ + return FMT_COMPILE_STRING(); \ + }() + +/** + \rst + Constructs a compile-time format string from a string literal *s*. + + **Example**:: + + // A compile-time error because 'd' is an invalid specifier for strings. + std::string s = fmt::format(FMT_STRING("{:d}"), "foo"); + \endrst + */ +#define FMT_STRING(s) FMT_STRING_IMPL(s, fmt::compile_string) + +template <typename... Args, typename S, + enable_if_t<(is_compile_string<S>::value), int>> +void check_format_string(S format_str) { + FMT_CONSTEXPR_DECL auto s = to_string_view(format_str); + using checker = format_string_checker<typename S::char_type, error_handler, + remove_cvref_t<Args>...>; + FMT_CONSTEXPR_DECL bool invalid_format = + (parse_format_string<true>(s, checker(s, {})), true); + (void)invalid_format; +} + +template <template <typename> class Handler, typename Context> +void handle_dynamic_spec(int& value, arg_ref<typename Context::char_type> ref, + Context& ctx) { + switch (ref.kind) { + case arg_id_kind::none: + break; + case arg_id_kind::index: + value = detail::get_dynamic_spec<Handler>(ctx.arg(ref.val.index), + ctx.error_handler()); + break; + case arg_id_kind::name: + value = detail::get_dynamic_spec<Handler>(ctx.arg(ref.val.name), + ctx.error_handler()); + break; + } +} + +using format_func = void (*)(detail::buffer<char>&, int, string_view); + +FMT_API void format_error_code(buffer<char>& out, int error_code, + string_view message) FMT_NOEXCEPT; + +FMT_API void report_error(format_func func, int error_code, + string_view message) FMT_NOEXCEPT; +} // namespace detail + +template <typename OutputIt, typename Char> +using arg_formatter FMT_DEPRECATED_ALIAS = + detail::arg_formatter<OutputIt, Char>; + +/** + An error returned by an operating system or a language runtime, + for example a file opening error. +*/ +FMT_CLASS_API +class FMT_API system_error : public std::runtime_error { + private: + void init(int err_code, string_view format_str, format_args args); + + protected: + int error_code_; + + system_error() : std::runtime_error(""), error_code_(0) {} + + public: + /** + \rst + Constructs a :class:`fmt::system_error` object with a description + formatted with `fmt::format_system_error`. *message* and additional + arguments passed into the constructor are formatted similarly to + `fmt::format`. + + **Example**:: + + // This throws a system_error with the description + // cannot open file 'madeup': No such file or directory + // or similar (system message may vary). + const char *filename = "madeup"; + std::FILE *file = std::fopen(filename, "r"); + if (!file) + throw fmt::system_error(errno, "cannot open file '{}'", filename); + \endrst + */ + template <typename... Args> + system_error(int error_code, string_view message, const Args&... args) + : std::runtime_error("") { + init(error_code, message, make_format_args(args...)); + } + system_error(const system_error&) = default; + system_error& operator=(const system_error&) = default; + system_error(system_error&&) = default; + system_error& operator=(system_error&&) = default; + ~system_error() FMT_NOEXCEPT FMT_OVERRIDE; + + int error_code() const { return error_code_; } +}; + +/** + \rst + Formats an error returned by an operating system or a language runtime, + for example a file opening error, and writes it to *out* in the following + form: + + .. parsed-literal:: + *<message>*: *<system-message>* + + where *<message>* is the passed message and *<system-message>* is + the system message corresponding to the error code. + *error_code* is a system error code as given by ``errno``. + If *error_code* is not a valid error code such as -1, the system message + may look like "Unknown error -1" and is platform-dependent. + \endrst + */ +FMT_API void format_system_error(detail::buffer<char>& out, int error_code, + string_view message) FMT_NOEXCEPT; + +// Reports a system error without throwing an exception. +// Can be used to report errors from destructors. +FMT_API void report_system_error(int error_code, + string_view message) FMT_NOEXCEPT; + +/** Fast integer formatter. */ +class format_int { + private: + // Buffer should be large enough to hold all digits (digits10 + 1), + // a sign and a null character. + enum { buffer_size = std::numeric_limits<unsigned long long>::digits10 + 3 }; + mutable char buffer_[buffer_size]; + char* str_; + + template <typename UInt> char* format_unsigned(UInt value) { + auto n = static_cast<detail::uint32_or_64_or_128_t<UInt>>(value); + return detail::format_decimal(buffer_, n, buffer_size - 1).begin; + } + + template <typename Int> char* format_signed(Int value) { + auto abs_value = static_cast<detail::uint32_or_64_or_128_t<Int>>(value); + bool negative = value < 0; + if (negative) abs_value = 0 - abs_value; + auto begin = format_unsigned(abs_value); + if (negative) *--begin = '-'; + return begin; + } + + public: + explicit format_int(int value) : str_(format_signed(value)) {} + explicit format_int(long value) : str_(format_signed(value)) {} + explicit format_int(long long value) : str_(format_signed(value)) {} + explicit format_int(unsigned value) : str_(format_unsigned(value)) {} + explicit format_int(unsigned long value) : str_(format_unsigned(value)) {} + explicit format_int(unsigned long long value) + : str_(format_unsigned(value)) {} + + /** Returns the number of characters written to the output buffer. */ + size_t size() const { + return detail::to_unsigned(buffer_ - str_ + buffer_size - 1); + } + + /** + Returns a pointer to the output buffer content. No terminating null + character is appended. + */ + const char* data() const { return str_; } + + /** + Returns a pointer to the output buffer content with terminating null + character appended. + */ + const char* c_str() const { + buffer_[buffer_size - 1] = '\0'; + return str_; + } + + /** + \rst + Returns the content of the output buffer as an ``std::string``. + \endrst + */ + std::string str() const { return std::string(str_, size()); } +}; + +// A formatter specialization for the core types corresponding to detail::type +// constants. +template <typename T, typename Char> +struct formatter<T, Char, + enable_if_t<detail::type_constant<T, Char>::value != + detail::type::custom_type>> { + FMT_CONSTEXPR formatter() = default; + + // Parses format specifiers stopping either at the end of the range or at the + // terminating '}'. + template <typename ParseContext> + FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { + using handler_type = detail::dynamic_specs_handler<ParseContext>; + auto type = detail::type_constant<T, Char>::value; + detail::specs_checker<handler_type> handler(handler_type(specs_, ctx), + type); + auto it = parse_format_specs(ctx.begin(), ctx.end(), handler); + auto eh = ctx.error_handler(); + switch (type) { + case detail::type::none_type: + FMT_ASSERT(false, "invalid argument type"); + break; + case detail::type::int_type: + case detail::type::uint_type: + case detail::type::long_long_type: + case detail::type::ulong_long_type: + case detail::type::int128_type: + case detail::type::uint128_type: + case detail::type::bool_type: + handle_int_type_spec(specs_.type, + detail::int_type_checker<decltype(eh)>(eh)); + break; + case detail::type::char_type: + handle_char_specs( + &specs_, detail::char_specs_checker<decltype(eh)>(specs_.type, eh)); + break; + case detail::type::float_type: + if (detail::const_check(FMT_USE_FLOAT)) + detail::parse_float_type_spec(specs_, eh); + else + FMT_ASSERT(false, "float support disabled"); + break; + case detail::type::double_type: + if (detail::const_check(FMT_USE_DOUBLE)) + detail::parse_float_type_spec(specs_, eh); + else + FMT_ASSERT(false, "double support disabled"); + break; + case detail::type::long_double_type: + if (detail::const_check(FMT_USE_LONG_DOUBLE)) + detail::parse_float_type_spec(specs_, eh); + else + FMT_ASSERT(false, "long double support disabled"); + break; + case detail::type::cstring_type: + detail::handle_cstring_type_spec( + specs_.type, detail::cstring_type_checker<decltype(eh)>(eh)); + break; + case detail::type::string_type: + detail::check_string_type_spec(specs_.type, eh); + break; + case detail::type::pointer_type: + detail::check_pointer_type_spec(specs_.type, eh); + break; + case detail::type::custom_type: + // Custom format specifiers should be checked in parse functions of + // formatter specializations. + break; + } + return it; + } + + template <typename FormatContext> + auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) { + detail::handle_dynamic_spec<detail::width_checker>(specs_.width, + specs_.width_ref, ctx); + detail::handle_dynamic_spec<detail::precision_checker>( + specs_.precision, specs_.precision_ref, ctx); + using af = detail::arg_formatter<typename FormatContext::iterator, + typename FormatContext::char_type>; + return visit_format_arg(af(ctx, nullptr, &specs_), + detail::make_arg<FormatContext>(val)); + } + + private: + detail::dynamic_format_specs<Char> specs_; +}; + +#define FMT_FORMAT_AS(Type, Base) \ + template <typename Char> \ + struct formatter<Type, Char> : formatter<Base, Char> { \ + template <typename FormatContext> \ + auto format(Type const& val, FormatContext& ctx) -> decltype(ctx.out()) { \ + return formatter<Base, Char>::format(val, ctx); \ + } \ + } + +FMT_FORMAT_AS(signed char, int); +FMT_FORMAT_AS(unsigned char, unsigned); +FMT_FORMAT_AS(short, int); +FMT_FORMAT_AS(unsigned short, unsigned); +FMT_FORMAT_AS(long, long long); +FMT_FORMAT_AS(unsigned long, unsigned long long); +FMT_FORMAT_AS(Char*, const Char*); +FMT_FORMAT_AS(std::basic_string<Char>, basic_string_view<Char>); +FMT_FORMAT_AS(std::nullptr_t, const void*); +FMT_FORMAT_AS(detail::std_string_view<Char>, basic_string_view<Char>); + +template <typename Char> +struct formatter<void*, Char> : formatter<const void*, Char> { + template <typename FormatContext> + auto format(void* val, FormatContext& ctx) -> decltype(ctx.out()) { + return formatter<const void*, Char>::format(val, ctx); + } +}; + +template <typename Char, size_t N> +struct formatter<Char[N], Char> : formatter<basic_string_view<Char>, Char> { + template <typename FormatContext> + auto format(const Char* val, FormatContext& ctx) -> decltype(ctx.out()) { + return formatter<basic_string_view<Char>, Char>::format(val, ctx); + } +}; + +// A formatter for types known only at run time such as variant alternatives. +// +// Usage: +// using variant = std::variant<int, std::string>; +// template <> +// struct formatter<variant>: dynamic_formatter<> { +// auto format(const variant& v, format_context& ctx) { +// return visit([&](const auto& val) { +// return dynamic_formatter<>::format(val, ctx); +// }, v); +// } +// }; +template <typename Char = char> class dynamic_formatter { + private: + struct null_handler : detail::error_handler { + void on_align(align_t) {} + void on_plus() {} + void on_minus() {} + void on_space() {} + void on_hash() {} + }; + + public: + template <typename ParseContext> + auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { + format_str_ = ctx.begin(); + // Checks are deferred to formatting time when the argument type is known. + detail::dynamic_specs_handler<ParseContext> handler(specs_, ctx); + return parse_format_specs(ctx.begin(), ctx.end(), handler); + } + + template <typename T, typename FormatContext> + auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) { + handle_specs(ctx); + detail::specs_checker<null_handler> checker( + null_handler(), detail::mapped_type_constant<T, FormatContext>::value); + checker.on_align(specs_.align); + switch (specs_.sign) { + case sign::none: + break; + case sign::plus: + checker.on_plus(); + break; + case sign::minus: + checker.on_minus(); + break; + case sign::space: + checker.on_space(); + break; + } + if (specs_.alt) checker.on_hash(); + if (specs_.precision >= 0) checker.end_precision(); + using af = detail::arg_formatter<typename FormatContext::iterator, + typename FormatContext::char_type>; + visit_format_arg(af(ctx, nullptr, &specs_), + detail::make_arg<FormatContext>(val)); + return ctx.out(); + } + + private: + template <typename Context> void handle_specs(Context& ctx) { + detail::handle_dynamic_spec<detail::width_checker>(specs_.width, + specs_.width_ref, ctx); + detail::handle_dynamic_spec<detail::precision_checker>( + specs_.precision, specs_.precision_ref, ctx); + } + + detail::dynamic_format_specs<Char> specs_; + const Char* format_str_; +}; + +template <typename Char, typename ErrorHandler> +FMT_CONSTEXPR void advance_to( + basic_format_parse_context<Char, ErrorHandler>& ctx, const Char* p) { + ctx.advance_to(ctx.begin() + (p - &*ctx.begin())); +} + +/** + \rst + Converts ``p`` to ``const void*`` for pointer formatting. + + **Example**:: + + auto s = fmt::format("{}", fmt::ptr(p)); + \endrst + */ +template <typename T> inline const void* ptr(const T* p) { return p; } +template <typename T> inline const void* ptr(const std::unique_ptr<T>& p) { + return p.get(); +} +template <typename T> inline const void* ptr(const std::shared_ptr<T>& p) { + return p.get(); +} + +class bytes { + private: + string_view data_; + friend struct formatter<bytes>; + + public: + explicit bytes(string_view data) : data_(data) {} +}; + +template <> struct formatter<bytes> { + private: + detail::dynamic_format_specs<char> specs_; + + public: + template <typename ParseContext> + FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { + using handler_type = detail::dynamic_specs_handler<ParseContext>; + detail::specs_checker<handler_type> handler(handler_type(specs_, ctx), + detail::type::string_type); + auto it = parse_format_specs(ctx.begin(), ctx.end(), handler); + detail::check_string_type_spec(specs_.type, ctx.error_handler()); + return it; + } + + template <typename FormatContext> + auto format(bytes b, FormatContext& ctx) -> decltype(ctx.out()) { + detail::handle_dynamic_spec<detail::width_checker>(specs_.width, + specs_.width_ref, ctx); + detail::handle_dynamic_spec<detail::precision_checker>( + specs_.precision, specs_.precision_ref, ctx); + return detail::write_bytes(ctx.out(), b.data_, specs_); + } +}; + +template <typename It, typename Sentinel, typename Char> +struct arg_join : detail::view { + It begin; + Sentinel end; + basic_string_view<Char> sep; + + arg_join(It b, Sentinel e, basic_string_view<Char> s) + : begin(b), end(e), sep(s) {} +}; + +template <typename It, typename Sentinel, typename Char> +struct formatter<arg_join<It, Sentinel, Char>, Char> + : formatter<typename std::iterator_traits<It>::value_type, Char> { + template <typename FormatContext> + auto format(const arg_join<It, Sentinel, Char>& value, FormatContext& ctx) + -> decltype(ctx.out()) { + using base = formatter<typename std::iterator_traits<It>::value_type, Char>; + auto it = value.begin; + auto out = ctx.out(); + if (it != value.end) { + out = base::format(*it++, ctx); + while (it != value.end) { + out = std::copy(value.sep.begin(), value.sep.end(), out); + ctx.advance_to(out); + out = base::format(*it++, ctx); + } + } + return out; + } +}; + +/** + Returns an object that formats the iterator range `[begin, end)` with elements + separated by `sep`. + */ +template <typename It, typename Sentinel> +arg_join<It, Sentinel, char> join(It begin, Sentinel end, string_view sep) { + return {begin, end, sep}; +} + +template <typename It, typename Sentinel> +arg_join<It, Sentinel, wchar_t> join(It begin, Sentinel end, wstring_view sep) { + return {begin, end, sep}; +} + +/** + \rst + Returns an object that formats `range` with elements separated by `sep`. + + **Example**:: + + std::vector<int> v = {1, 2, 3}; + fmt::print("{}", fmt::join(v, ", ")); + // Output: "1, 2, 3" + + ``fmt::join`` applies passed format specifiers to the range elements:: + + fmt::print("{:02}", fmt::join(v, ", ")); + // Output: "01, 02, 03" + \endrst + */ +template <typename Range> +arg_join<detail::iterator_t<Range>, detail::sentinel_t<Range>, char> join( + Range&& range, string_view sep) { + return join(std::begin(range), std::end(range), sep); +} + +template <typename Range> +arg_join<detail::iterator_t<Range>, detail::sentinel_t<Range>, wchar_t> join( + Range&& range, wstring_view sep) { + return join(std::begin(range), std::end(range), sep); +} + +/** + \rst + Converts *value* to ``std::string`` using the default format for type *T*. + + **Example**:: + + #include <fmt/format.h> + + std::string answer = fmt::to_string(42); + \endrst + */ +template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)> +inline std::string to_string(const T& value) { + std::string result; + detail::write<char>(std::back_inserter(result), value); + return result; +} + +template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> +inline std::string to_string(T value) { + // The buffer should be large enough to store the number including the sign or + // "false" for bool. + constexpr int max_size = detail::digits10<T>() + 2; + char buffer[max_size > 5 ? static_cast<unsigned>(max_size) : 5]; + char* begin = buffer; + return std::string(begin, detail::write<char>(begin, value)); +} + +/** + Converts *value* to ``std::wstring`` using the default format for type *T*. + */ +template <typename T> inline std::wstring to_wstring(const T& value) { + return format(L"{}", value); +} + +template <typename Char, size_t SIZE> +std::basic_string<Char> to_string(const basic_memory_buffer<Char, SIZE>& buf) { + auto size = buf.size(); + detail::assume(size < std::basic_string<Char>().max_size()); + return std::basic_string<Char>(buf.data(), size); +} + +template <typename Char> +void detail::vformat_to( + detail::buffer<Char>& buf, basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args, + detail::locale_ref loc) { + using iterator = typename buffer_context<Char>::iterator; + auto out = buffer_appender<Char>(buf); + if (format_str.size() == 2 && equal2(format_str.data(), "{}")) { + auto arg = args.get(0); + if (!arg) error_handler().on_error("argument not found"); + visit_format_arg(default_arg_formatter<iterator, Char>{out, args, loc}, + arg); + return; + } + format_handler<iterator, Char, buffer_context<Char>> h(out, format_str, args, + loc); + parse_format_string<false>(format_str, h); +} + +#ifndef FMT_HEADER_ONLY +extern template void detail::vformat_to(detail::buffer<char>&, string_view, + basic_format_args<format_context>, + detail::locale_ref); +namespace detail { + +extern template FMT_API std::string grouping_impl<char>(locale_ref loc); +extern template FMT_API std::string grouping_impl<wchar_t>(locale_ref loc); +extern template FMT_API char thousands_sep_impl<char>(locale_ref loc); +extern template FMT_API wchar_t thousands_sep_impl<wchar_t>(locale_ref loc); +extern template FMT_API char decimal_point_impl(locale_ref loc); +extern template FMT_API wchar_t decimal_point_impl(locale_ref loc); +extern template int format_float<double>(double value, int precision, + float_specs specs, buffer<char>& buf); +extern template int format_float<long double>(long double value, int precision, + float_specs specs, + buffer<char>& buf); +int snprintf_float(float value, int precision, float_specs specs, + buffer<char>& buf) = delete; +extern template int snprintf_float<double>(double value, int precision, + float_specs specs, + buffer<char>& buf); +extern template int snprintf_float<long double>(long double value, + int precision, + float_specs specs, + buffer<char>& buf); +} // namespace detail +#endif + +template <typename S, typename Char = char_t<S>, + FMT_ENABLE_IF(detail::is_string<S>::value)> +inline void vformat_to( + detail::buffer<Char>& buf, const S& format_str, + basic_format_args<FMT_BUFFER_CONTEXT(type_identity_t<Char>)> args) { + return detail::vformat_to(buf, to_string_view(format_str), args); +} + +template <typename S, typename... Args, size_t SIZE = inline_buffer_size, + typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>> +inline typename buffer_context<Char>::iterator format_to( + basic_memory_buffer<Char, SIZE>& buf, const S& format_str, Args&&... args) { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + detail::vformat_to(buf, to_string_view(format_str), vargs); + return detail::buffer_appender<Char>(buf); +} + +template <typename OutputIt, typename Char = char> +using format_context_t = basic_format_context<OutputIt, Char>; + +template <typename OutputIt, typename Char = char> +using format_args_t = basic_format_args<format_context_t<OutputIt, Char>>; + +template <typename OutputIt, typename Char = typename OutputIt::value_type> +using format_to_n_context FMT_DEPRECATED_ALIAS = buffer_context<Char>; + +template <typename OutputIt, typename Char = typename OutputIt::value_type> +using format_to_n_args FMT_DEPRECATED_ALIAS = + basic_format_args<buffer_context<Char>>; + +template <typename OutputIt, typename Char, typename... Args> +FMT_DEPRECATED format_arg_store<buffer_context<Char>, Args...> +make_format_to_n_args(const Args&... args) { + return format_arg_store<buffer_context<Char>, Args...>(args...); +} + +template <typename Char, enable_if_t<(!std::is_same<Char, char>::value), int>> +std::basic_string<Char> detail::vformat( + basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + basic_memory_buffer<Char> buffer; + detail::vformat_to(buffer, format_str, args); + return to_string(buffer); +} + +template <typename Char, FMT_ENABLE_IF(std::is_same<Char, wchar_t>::value)> +void vprint(std::FILE* f, basic_string_view<Char> format_str, + wformat_args args) { + wmemory_buffer buffer; + detail::vformat_to(buffer, format_str, args); + buffer.push_back(L'\0'); + if (std::fputws(buffer.data(), f) == -1) + FMT_THROW(system_error(errno, "cannot write to file")); +} + +template <typename Char, FMT_ENABLE_IF(std::is_same<Char, wchar_t>::value)> +void vprint(basic_string_view<Char> format_str, wformat_args args) { + vprint(stdout, format_str, args); +} + +#if FMT_USE_USER_DEFINED_LITERALS +namespace detail { + +# if FMT_USE_UDL_TEMPLATE +template <typename Char, Char... CHARS> class udl_formatter { + public: + template <typename... Args> + std::basic_string<Char> operator()(Args&&... args) const { + static FMT_CONSTEXPR_DECL Char s[] = {CHARS..., '\0'}; + return format(FMT_STRING(s), std::forward<Args>(args)...); + } +}; +# else +template <typename Char> struct udl_formatter { + basic_string_view<Char> str; + + template <typename... Args> + std::basic_string<Char> operator()(Args&&... args) const { + return format(str, std::forward<Args>(args)...); + } +}; +# endif // FMT_USE_UDL_TEMPLATE + +template <typename Char> struct udl_arg { + const Char* str; + + template <typename T> named_arg<Char, T> operator=(T&& value) const { + return {str, std::forward<T>(value)}; + } +}; +} // namespace detail + +inline namespace literals { +# if FMT_USE_UDL_TEMPLATE +# pragma GCC diagnostic push +# pragma GCC diagnostic ignored "-Wpedantic" +# if FMT_CLANG_VERSION +# pragma GCC diagnostic ignored "-Wgnu-string-literal-operator-template" +# endif +template <typename Char, Char... CHARS> +FMT_CONSTEXPR detail::udl_formatter<Char, CHARS...> operator""_format() { + return {}; +} +# pragma GCC diagnostic pop +# else +/** + \rst + User-defined literal equivalent of :func:`fmt::format`. + + **Example**:: + + using namespace fmt::literals; + std::string message = "The answer is {}"_format(42); + \endrst + */ +FMT_CONSTEXPR detail::udl_formatter<char> operator"" _format(const char* s, + size_t n) { + return {{s, n}}; +} +FMT_CONSTEXPR detail::udl_formatter<wchar_t> operator"" _format( + const wchar_t* s, size_t n) { + return {{s, n}}; +} +# endif // FMT_USE_UDL_TEMPLATE + +/** + \rst + User-defined literal equivalent of :func:`fmt::arg`. + + **Example**:: + + using namespace fmt::literals; + fmt::print("Elapsed time: {s:.2f} seconds", "s"_a=1.23); + \endrst + */ +FMT_CONSTEXPR detail::udl_arg<char> operator"" _a(const char* s, size_t) { + return {s}; +} +FMT_CONSTEXPR detail::udl_arg<wchar_t> operator"" _a(const wchar_t* s, size_t) { + return {s}; +} +} // namespace literals +#endif // FMT_USE_USER_DEFINED_LITERALS +FMT_END_NAMESPACE + +#ifdef FMT_HEADER_ONLY +# define FMT_FUNC inline +# include "format-inl.h" +#else +# define FMT_FUNC +#endif + +#endif // FMT_FORMAT_H_ diff --git a/include/vtkdiy2/thirdparty/fmt/locale.h b/include/vtkdiy2/thirdparty/fmt/locale.h new file mode 100644 index 0000000000000000000000000000000000000000..7301bf92a2432975cd759de8b60aa1e61fe36607 --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/locale.h @@ -0,0 +1,64 @@ +// Formatting library for C++ - std::locale support +// +// Copyright (c) 2012 - present, Victor Zverovich +// All rights reserved. +// +// For the license information refer to format.h. + +#ifndef FMT_LOCALE_H_ +#define FMT_LOCALE_H_ + +#include <locale> + +#include "format.h" + +FMT_BEGIN_NAMESPACE + +namespace detail { +template <typename Char> +std::basic_string<Char> vformat( + const std::locale& loc, basic_string_view<Char> format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + basic_memory_buffer<Char> buffer; + detail::vformat_to(buffer, format_str, args, detail::locale_ref(loc)); + return fmt::to_string(buffer); +} +} // namespace detail + +template <typename S, typename Char = char_t<S>> +inline std::basic_string<Char> vformat( + const std::locale& loc, const S& format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + return detail::vformat(loc, to_string_view(format_str), args); +} + +template <typename S, typename... Args, typename Char = char_t<S>> +inline std::basic_string<Char> format(const std::locale& loc, + const S& format_str, Args&&... args) { + return detail::vformat(loc, to_string_view(format_str), + fmt::make_args_checked<Args...>(format_str, args...)); +} + +template <typename S, typename OutputIt, typename... Args, + typename Char = char_t<S>, + FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value)> +inline OutputIt vformat_to( + OutputIt out, const std::locale& loc, const S& format_str, + basic_format_args<buffer_context<type_identity_t<Char>>> args) { + decltype(detail::get_buffer<Char>(out)) buf(detail::get_buffer_init(out)); + vformat_to(buf, to_string_view(format_str), args, detail::locale_ref(loc)); + return detail::get_iterator(buf); +} + +template <typename OutputIt, typename S, typename... Args, + bool enable = detail::is_output_iterator<OutputIt, char_t<S>>::value> +inline auto format_to(OutputIt out, const std::locale& loc, + const S& format_str, Args&&... args) -> + typename std::enable_if<enable, OutputIt>::type { + const auto& vargs = fmt::make_args_checked<Args...>(format_str, args...); + return vformat_to(out, loc, to_string_view(format_str), vargs); +} + +FMT_END_NAMESPACE + +#endif // FMT_LOCALE_H_ diff --git a/include/vtkdiy2/fmt/posix.h b/include/vtkdiy2/thirdparty/fmt/os.h similarity index 55% rename from include/vtkdiy2/fmt/posix.h rename to include/vtkdiy2/thirdparty/fmt/os.h index 6b2d7f8e4c4c63c317e94ea6a90b8a2198d8867b..d44ea0c904ddf73ffb6c94aeb9c0d4734f8220aa 100644 --- a/include/vtkdiy2/fmt/posix.h +++ b/include/vtkdiy2/thirdparty/fmt/os.h @@ -1,25 +1,23 @@ -// A C++ interface to POSIX functions. +// Formatting library for C++ - optional OS-specific functionality // -// Copyright (c) 2012 - 2016, Victor Zverovich +// Copyright (c) 2012 - present, Victor Zverovich // All rights reserved. // // For the license information refer to format.h. -#ifndef FMT_POSIX_H_ -#define FMT_POSIX_H_ +#ifndef FMT_OS_H_ +#define FMT_OS_H_ #if defined(__MINGW32__) || defined(__CYGWIN__) // Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/. # undef __STRICT_ANSI__ #endif -#include <errno.h> -#include <fcntl.h> // for O_RDONLY -#include <locale.h> // for locale_t -#include <stdio.h> -#include <stdlib.h> // for strtod_l - +#include <cerrno> +#include <clocale> // for locale_t #include <cstddef> +#include <cstdio> +#include <cstdlib> // for strtod_l #if defined __APPLE__ || defined(__FreeBSD__) # include <xlocale.h> // for LC_NUMERIC_MASK on OS X @@ -27,6 +25,19 @@ #include "format.h" +// UWP doesn't provide _pipe. +#if FMT_HAS_INCLUDE("winapifamily.h") +# include <winapifamily.h> +#endif +#if (FMT_HAS_INCLUDE(<fcntl.h>) || defined(__APPLE__) || \ + defined(__linux__)) && \ + (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP)) +# include <fcntl.h> // for O_RDONLY +# define FMT_USE_FCNTL 1 +#else +# define FMT_USE_FCNTL 0 +#endif + #ifndef FMT_POSIX # if defined(_WIN32) && !defined(__MINGW32__) // Fix warnings about deprecated symbols. @@ -40,7 +51,7 @@ #ifdef FMT_SYSTEM # define FMT_POSIX_CALL(call) FMT_SYSTEM(call) #else -# define FMT_SYSTEM(call) call +# define FMT_SYSTEM(call) ::call # ifdef _WIN32 // Fix warnings about deprecated symbols. # define FMT_POSIX_CALL(call) ::_##call @@ -54,8 +65,8 @@ #ifndef _WIN32 # define FMT_RETRY_VAL(result, expression, error_result) \ do { \ - result = (expression); \ - } while (result == error_result && errno == EINTR) + (result) = (expression); \ + } while ((result) == (error_result) && errno == EINTR) #else # define FMT_RETRY_VAL(result, expression, error_result) result = (expression) #endif @@ -122,6 +133,78 @@ class error_code { int get() const FMT_NOEXCEPT { return value_; } }; +#ifdef _WIN32 +namespace detail { +// A converter from UTF-16 to UTF-8. +// It is only provided for Windows since other systems support UTF-8 natively. +class utf16_to_utf8 { + private: + memory_buffer buffer_; + + public: + utf16_to_utf8() {} + FMT_API explicit utf16_to_utf8(wstring_view s); + operator string_view() const { return string_view(&buffer_[0], size()); } + size_t size() const { return buffer_.size() - 1; } + const char* c_str() const { return &buffer_[0]; } + std::string str() const { return std::string(&buffer_[0], size()); } + + // Performs conversion returning a system error code instead of + // throwing exception on conversion error. This method may still throw + // in case of memory allocation error. + FMT_API int convert(wstring_view s); +}; + +FMT_API void format_windows_error(buffer<char>& out, int error_code, + string_view message) FMT_NOEXCEPT; +} // namespace detail + +/** A Windows error. */ +class windows_error : public system_error { + private: + FMT_API void init(int error_code, string_view format_str, format_args args); + + public: + /** + \rst + Constructs a :class:`fmt::windows_error` object with the description + of the form + + .. parsed-literal:: + *<message>*: *<system-message>* + + where *<message>* is the formatted message and *<system-message>* is the + system message corresponding to the error code. + *error_code* is a Windows error code as given by ``GetLastError``. + If *error_code* is not a valid error code such as -1, the system message + will look like "error -1". + + **Example**:: + + // This throws a windows_error with the description + // cannot open file 'madeup': The system cannot find the file specified. + // or similar (system message may vary). + const char *filename = "madeup"; + LPOFSTRUCT of = LPOFSTRUCT(); + HFILE file = OpenFile(filename, &of, OF_READ); + if (file == HFILE_ERROR) { + throw fmt::windows_error(GetLastError(), + "cannot open file '{}'", filename); + } + \endrst + */ + template <typename... Args> + windows_error(int error_code, string_view message, const Args&... args) { + init(error_code, message, make_format_args(args...)); + } +}; + +// Reports a Windows error without throwing an exception. +// Can be used to report errors from destructors. +FMT_API void report_windows_error(int error_code, + string_view message) FMT_NOEXCEPT; +#endif // _WIN32 + // A buffered file. class buffered_file { private: @@ -132,16 +215,15 @@ class buffered_file { explicit buffered_file(FILE* f) : file_(f) {} public: + buffered_file(const buffered_file&) = delete; + void operator=(const buffered_file&) = delete; + // Constructs a buffered_file object which doesn't represent any file. buffered_file() FMT_NOEXCEPT : file_(nullptr) {} // Destroys the object closing the file it represents if any. FMT_API ~buffered_file() FMT_NOEXCEPT; - private: - buffered_file(const buffered_file&) = delete; - void operator=(const buffered_file&) = delete; - public: buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) { other.file_ = nullptr; @@ -177,6 +259,7 @@ class buffered_file { } }; +#if FMT_USE_FCNTL // A file. Closed file is represented by a file object with descriptor -1. // Methods that are not declared with FMT_NOEXCEPT may throw // fmt::system_error in case of failure. Note that some errors such as @@ -195,7 +278,9 @@ class file { enum { RDONLY = FMT_POSIX(O_RDONLY), // Open for reading only. WRONLY = FMT_POSIX(O_WRONLY), // Open for writing only. - RDWR = FMT_POSIX(O_RDWR) // Open for reading and writing. + RDWR = FMT_POSIX(O_RDWR), // Open for reading and writing. + CREATE = FMT_POSIX(O_CREAT), // Create if the file doesn't exist. + APPEND = FMT_POSIX(O_APPEND) // Open in append mode. }; // Constructs a file object which doesn't represent any file. @@ -204,14 +289,13 @@ class file { // Opens a file and constructs a file object representing this file. FMT_API file(cstring_view path, int oflag); - private: + public: file(const file&) = delete; void operator=(const file&) = delete; - public: file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; } - file& operator=(file&& other) { + file& operator=(file&& other) FMT_NOEXCEPT { close(); fd_ = other.fd_; other.fd_ = -1; @@ -232,10 +316,10 @@ class file { FMT_API long long size() const; // Attempts to read count bytes from the file into the specified buffer. - FMT_API std::size_t read(void* buffer, std::size_t count); + FMT_API size_t read(void* buffer, size_t count); // Attempts to write count bytes from the specified buffer to the file. - FMT_API std::size_t write(const void* buffer, std::size_t count); + FMT_API size_t write(const void* buffer, size_t count); // Duplicates a file descriptor with the dup function and returns // the duplicate as a file object. @@ -261,38 +345,122 @@ class file { // Returns the memory page size. long getpagesize(); +namespace detail { + +struct buffer_size { + size_t value = 0; + buffer_size operator=(size_t val) const { + auto bs = buffer_size(); + bs.value = val; + return bs; + } +}; + +struct ostream_params { + int oflag = file::WRONLY | file::CREATE; + size_t buffer_size = BUFSIZ > 32768 ? BUFSIZ : 32768; + + ostream_params() {} + + template <typename... T> + ostream_params(T... params, int oflag) : ostream_params(params...) { + this->oflag = oflag; + } + + template <typename... T> + ostream_params(T... params, detail::buffer_size bs) + : ostream_params(params...) { + this->buffer_size = bs.value; + } +}; +} // namespace detail + +static constexpr detail::buffer_size buffer_size; + +// A fast output stream which is not thread-safe. +class ostream final : private detail::buffer<char> { + private: + file file_; + + void flush() { + if (size() == 0) return; + file_.write(data(), size()); + clear(); + } + + FMT_API void grow(size_t) override final; + + ostream(cstring_view path, const detail::ostream_params& params) + : file_(path, params.oflag) { + set(new char[params.buffer_size], params.buffer_size); + } + + public: + ostream(ostream&& other) + : detail::buffer<char>(other.data(), other.size(), other.capacity()), + file_(std::move(other.file_)) { + other.set(nullptr, 0); + } + ~ostream() { + flush(); + delete[] data(); + } + + template <typename... T> + friend ostream output_file(cstring_view path, T... params); + + void close() { + flush(); + file_.close(); + } + + template <typename S, typename... Args> + void print(const S& format_str, const Args&... args) { + format_to(detail::buffer_appender<char>(*this), format_str, args...); + } +}; + +/** + Opens a file for writing. Supported parameters passed in `params`: + * ``<integer>``: Output flags (``file::WRONLY | file::CREATE`` by default) + * ``buffer_size=<integer>``: Output buffer size + */ +template <typename... T> +inline ostream output_file(cstring_view path, T... params) { + return {path, detail::ostream_params(params...)}; +} +#endif // FMT_USE_FCNTL + #ifdef FMT_LOCALE // A "C" numeric locale. -class Locale { +class locale { private: # ifdef _WIN32 using locale_t = _locale_t; - enum { LC_NUMERIC_MASK = LC_NUMERIC }; - - static locale_t newlocale(int category_mask, const char* locale, locale_t) { - return _create_locale(category_mask, locale); - } - - static void freelocale(locale_t locale) { _free_locale(locale); } + static void freelocale(locale_t loc) { _free_locale(loc); } - static double strtod_l(const char* nptr, char** endptr, _locale_t locale) { - return _strtod_l(nptr, endptr, locale); + static double strtod_l(const char* nptr, char** endptr, _locale_t loc) { + return _strtod_l(nptr, endptr, loc); } # endif locale_t locale_; - Locale(const Locale&) = delete; - void operator=(const Locale&) = delete; - public: using type = locale_t; + locale(const locale&) = delete; + void operator=(const locale&) = delete; - Locale() : locale_(newlocale(LC_NUMERIC_MASK, "C", nullptr)) { + locale() { +# ifndef _WIN32 + locale_ = FMT_SYSTEM(newlocale(LC_NUMERIC_MASK, "C", nullptr)); +# else + locale_ = _create_locale(LC_NUMERIC, "C"); +# endif if (!locale_) FMT_THROW(system_error(errno, "cannot create locale")); } - ~Locale() { freelocale(locale_); } + ~locale() { freelocale(locale_); } type get() const { return locale_; } @@ -305,7 +473,8 @@ class Locale { return result; } }; +using Locale FMT_DEPRECATED_ALIAS = locale; #endif // FMT_LOCALE FMT_END_NAMESPACE -#endif // FMT_POSIX_H_ +#endif // FMT_OS_H_ diff --git a/include/vtkdiy2/fmt/ostream.h b/include/vtkdiy2/thirdparty/fmt/ostream.h similarity index 55% rename from include/vtkdiy2/fmt/ostream.h rename to include/vtkdiy2/thirdparty/fmt/ostream.h index 69bac0e24a13eade0d00dc027962da5757d1041f..29c58ec13b156c0dbd75abf9e0492b2722907889 100644 --- a/include/vtkdiy2/fmt/ostream.h +++ b/include/vtkdiy2/thirdparty/fmt/ostream.h @@ -9,10 +9,15 @@ #define FMT_OSTREAM_H_ #include <ostream> + #include "format.h" FMT_BEGIN_NAMESPACE -namespace internal { + +template <typename Char> class basic_printf_parse_context; +template <typename OutputIt, typename Char> class basic_printf_context; + +namespace detail { template <class Char> class formatbuf : public std::basic_streambuf<Char> { private: @@ -44,21 +49,35 @@ template <class Char> class formatbuf : public std::basic_streambuf<Char> { } }; +struct converter { + template <typename T, FMT_ENABLE_IF(is_integral<T>::value)> converter(T); +}; + template <typename Char> struct test_stream : std::basic_ostream<Char> { private: - struct null; - // Hide all operator<< from std::basic_ostream<Char>. - void operator<<(null); + void_t<> operator<<(converter); }; +// Hide insertion operators for built-in types. +template <typename Char, typename Traits> +void_t<> operator<<(std::basic_ostream<Char, Traits>&, Char); +template <typename Char, typename Traits> +void_t<> operator<<(std::basic_ostream<Char, Traits>&, char); +template <typename Traits> +void_t<> operator<<(std::basic_ostream<char, Traits>&, char); +template <typename Traits> +void_t<> operator<<(std::basic_ostream<char, Traits>&, signed char); +template <typename Traits> +void_t<> operator<<(std::basic_ostream<char, Traits>&, unsigned char); + // Checks if T has a user-defined operator<< (e.g. not a member of // std::ostream). template <typename T, typename Char> class is_streamable { private: template <typename U> - static decltype((void)(std::declval<test_stream<Char>&>() - << std::declval<U>()), - std::true_type()) + static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>() + << std::declval<U>()), + void_t<>>::value> test(int); template <typename> static std::false_type test(...); @@ -71,12 +90,11 @@ template <typename T, typename Char> class is_streamable { // Write the content of buf to os. template <typename Char> -void write(std::basic_ostream<Char>& os, buffer<Char>& buf) { +void write_buffer(std::basic_ostream<Char>& os, buffer<Char>& buf) { const Char* buf_data = buf.data(); using unsigned_streamsize = std::make_unsigned<std::streamsize>::type; unsigned_streamsize size = buf.size(); - unsigned_streamsize max_size = - to_unsigned((std::numeric_limits<std::streamsize>::max)()); + unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>()); do { unsigned_streamsize n = size <= max_size ? size : max_size; os.write(buf_data, static_cast<std::streamsize>(n)); @@ -86,34 +104,57 @@ void write(std::basic_ostream<Char>& os, buffer<Char>& buf) { } template <typename Char, typename T> -void format_value(buffer<Char>& buf, const T& value) { +void format_value(buffer<Char>& buf, const T& value, + locale_ref loc = locale_ref()) { formatbuf<Char> format_buf(buf); std::basic_ostream<Char> output(&format_buf); - output.exceptions(std::ios_base::failbit | std::ios_base::badbit); +#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR) + if (loc) output.imbue(loc.get<std::locale>()); +#endif output << value; - buf.resize(buf.size()); + output.exceptions(std::ios_base::failbit | std::ios_base::badbit); + buf.try_resize(buf.size()); } // Formats an object of type T that has an overloaded ostream operator<<. template <typename T, typename Char> struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>> - : formatter<basic_string_view<Char>, Char> { - template <typename Context> - auto format(const T& value, Context& ctx) -> decltype(ctx.out()) { + : private formatter<basic_string_view<Char>, Char> { + FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx) + -> decltype(ctx.begin()) { + return formatter<basic_string_view<Char>, Char>::parse(ctx); + } + template <typename ParseCtx, + FMT_ENABLE_IF(std::is_same< + ParseCtx, basic_printf_parse_context<Char>>::value)> + auto parse(ParseCtx& ctx) -> decltype(ctx.begin()) { + return ctx.begin(); + } + + template <typename OutputIt> + auto format(const T& value, basic_format_context<OutputIt, Char>& ctx) + -> OutputIt { basic_memory_buffer<Char> buffer; - format_value(buffer, value); + format_value(buffer, value, ctx.locale()); basic_string_view<Char> str(buffer.data(), buffer.size()); return formatter<basic_string_view<Char>, Char>::format(str, ctx); } + template <typename OutputIt> + auto format(const T& value, basic_printf_context<OutputIt, Char>& ctx) + -> OutputIt { + basic_memory_buffer<Char> buffer; + format_value(buffer, value, ctx.locale()); + return std::copy(buffer.begin(), buffer.end(), ctx.out()); + } }; -} // namespace internal +} // namespace detail template <typename Char> void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str, - basic_format_args<buffer_context<Char>> args) { + basic_format_args<buffer_context<type_identity_t<Char>>> args) { basic_memory_buffer<Char> buffer; - internal::vformat_to(buffer, format_str, args); - internal::write(os, buffer); + detail::vformat_to(buffer, format_str, args); + detail::write_buffer(os, buffer); } /** @@ -126,10 +167,10 @@ void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str, \endrst */ template <typename S, typename... Args, - typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>> + typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>> void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) { vprint(os, to_string_view(format_str), - {internal::make_args_checked<Args...>(format_str, args...)}); + fmt::make_args_checked<Args...>(format_str, args...)); } FMT_END_NAMESPACE diff --git a/include/vtkdiy2/fmt/posix.cc b/include/vtkdiy2/thirdparty/fmt/posix.cc similarity index 99% rename from include/vtkdiy2/fmt/posix.cc rename to include/vtkdiy2/thirdparty/fmt/posix.cc index 69c27819d2b3768e260c27a0f6b73b66f2a132b8..f565e8c26a56061089f1bd92763f096680697ceb 100644 --- a/include/vtkdiy2/fmt/posix.cc +++ b/include/vtkdiy2/thirdparty/fmt/posix.cc @@ -10,7 +10,7 @@ # define _CRT_SECURE_NO_WARNINGS #endif -#include "fmt/posix.h" +#include "posix.h" #include <limits.h> #include <sys/stat.h> diff --git a/include/vtkdiy2/thirdparty/fmt/posix.h b/include/vtkdiy2/thirdparty/fmt/posix.h new file mode 100644 index 0000000000000000000000000000000000000000..da19e9d530c994b4dba77b0b453018f2c5665062 --- /dev/null +++ b/include/vtkdiy2/thirdparty/fmt/posix.h @@ -0,0 +1,2 @@ +#include "os.h" +#warning "fmt/posix.h is deprecated; use fmt/os.h instead" diff --git a/include/vtkdiy2/fmt/printf.h b/include/vtkdiy2/thirdparty/fmt/printf.h similarity index 71% rename from include/vtkdiy2/fmt/printf.h rename to include/vtkdiy2/thirdparty/fmt/printf.h index c803aa952bf78de96b97895a2fecb27a7746e10c..8c28ac2327271b840a91818ce08aa79e86351986 100644 --- a/include/vtkdiy2/fmt/printf.h +++ b/include/vtkdiy2/thirdparty/fmt/printf.h @@ -1,4 +1,4 @@ -// Formatting library for C++ +// Formatting library for C++ - legacy printf implementation // // Copyright (c) 2012 - 2016, Victor Zverovich // All rights reserved. @@ -8,23 +8,19 @@ #ifndef FMT_PRINTF_H_ #define FMT_PRINTF_H_ -#include <algorithm> // std::fill_n +#include <algorithm> // std::max #include <limits> // std::numeric_limits #include "ostream.h" FMT_BEGIN_NAMESPACE -namespace internal { - -// A helper function to suppress bogus "conditional expression is constant" -// warnings. -template <typename T> inline T const_check(T value) { return value; } +namespace detail { // Checks if a value fits in int - used to avoid warnings about comparing // signed and unsigned integers. template <bool IsSigned> struct int_checker { template <typename T> static bool fits_in_int(T value) { - unsigned max = std::numeric_limits<int>::max(); + unsigned max = max_value<int>(); return value <= max; } static bool fits_in_int(bool) { return true; } @@ -32,8 +28,8 @@ template <bool IsSigned> struct int_checker { template <> struct int_checker<true> { template <typename T> static bool fits_in_int(T value) { - return value >= std::numeric_limits<int>::min() && - value <= std::numeric_limits<int>::max(); + return value >= (std::numeric_limits<int>::min)() && + value <= max_value<int>(); } static bool fits_in_int(int) { return true; } }; @@ -94,11 +90,11 @@ template <typename T, typename Context> class arg_converter { if (const_check(sizeof(target_type) <= sizeof(int))) { // Extra casts are used to silence warnings. if (is_signed) { - arg_ = internal::make_arg<Context>( + arg_ = detail::make_arg<Context>( static_cast<int>(static_cast<target_type>(value))); } else { using unsigned_type = typename make_unsigned_or_bool<target_type>::type; - arg_ = internal::make_arg<Context>( + arg_ = detail::make_arg<Context>( static_cast<unsigned>(static_cast<unsigned_type>(value))); } } else { @@ -106,9 +102,9 @@ template <typename T, typename Context> class arg_converter { // glibc's printf doesn't sign extend arguments of smaller types: // std::printf("%lld", -42); // prints "4294967254" // but we don't have to do the same because it's a UB. - arg_ = internal::make_arg<Context>(static_cast<long long>(value)); + arg_ = detail::make_arg<Context>(static_cast<long long>(value)); } else { - arg_ = internal::make_arg<Context>( + arg_ = detail::make_arg<Context>( static_cast<typename make_unsigned_or_bool<U>::type>(value)); } } @@ -137,7 +133,7 @@ template <typename Context> class char_converter { template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> void operator()(T value) { - arg_ = internal::make_arg<Context>( + arg_ = detail::make_arg<Context>( static_cast<typename Context::char_type>(value)); } @@ -145,6 +141,13 @@ template <typename Context> class char_converter { void operator()(T) {} // No conversion needed for non-integral types. }; +// An argument visitor that return a pointer to a C string if argument is a +// string or null otherwise. +template <typename Char> struct get_cstring { + template <typename T> const Char* operator()(T) { return nullptr; } + const Char* operator()(const Char* s) { return s; } +}; + // Checks if an argument is a valid printf width specifier and sets // left alignment if it is negative. template <typename Char> class printf_width_handler { @@ -158,12 +161,12 @@ template <typename Char> class printf_width_handler { template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> unsigned operator()(T value) { - auto width = static_cast<uint32_or_64_t<T>>(value); - if (internal::is_negative(value)) { + auto width = static_cast<uint32_or_64_or_128_t<T>>(value); + if (detail::is_negative(value)) { specs_.align = align::left; width = 0 - width; } - unsigned int_max = std::numeric_limits<int>::max(); + unsigned int_max = max_value<int>(); if (width > int_max) FMT_THROW(format_error("number is too big")); return static_cast<unsigned>(width); } @@ -176,23 +179,25 @@ template <typename Char> class printf_width_handler { }; template <typename Char, typename Context> -void printf(buffer<Char>& buf, basic_string_view<Char> format, - basic_format_args<Context> args) { - Context(std::back_inserter(buf), format, args).format(); +void vprintf(buffer<Char>& buf, basic_string_view<Char> format, + basic_format_args<Context> args) { + Context(buffer_appender<Char>(buf), format, args).format(); } +} // namespace detail -template <typename OutputIt, typename Char, typename Context> -internal::truncating_iterator<OutputIt> printf( - internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format, - basic_format_args<Context> args) { - return Context(it, format, args).format(); +// For printing into memory_buffer. +template <typename Char, typename Context> +FMT_DEPRECATED void printf(detail::buffer<Char>& buf, + basic_string_view<Char> format, + basic_format_args<Context> args) { + return detail::vprintf(buf, format, args); } -} // namespace internal - -using internal::printf; // For printing into memory_buffer. - -template <typename Range> class printf_arg_formatter; +using detail::vprintf; +template <typename Char> +class basic_printf_parse_context : public basic_format_parse_context<Char> { + using basic_format_parse_context<Char>::basic_format_parse_context; +}; template <typename OutputIt, typename Char> class basic_printf_context; /** @@ -200,15 +205,15 @@ template <typename OutputIt, typename Char> class basic_printf_context; The ``printf`` argument formatter. \endrst */ -template <typename Range> -class printf_arg_formatter : public internal::arg_formatter_base<Range> { +template <typename OutputIt, typename Char> +class printf_arg_formatter : public detail::arg_formatter_base<OutputIt, Char> { public: - using iterator = typename Range::iterator; + using iterator = OutputIt; private: - using char_type = typename Range::value_type; - using base = internal::arg_formatter_base<Range>; - using context_type = basic_printf_context<iterator, char_type>; + using char_type = Char; + using base = detail::arg_formatter_base<OutputIt, Char>; + using context_type = basic_printf_context<OutputIt, Char>; context_type& context_; @@ -233,9 +238,9 @@ class printf_arg_formatter : public internal::arg_formatter_base<Range> { \endrst */ printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx) - : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {} + : base(iter, &specs, detail::locale_ref()), context_(ctx) {} - template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)> + template <typename T, FMT_ENABLE_IF(fmt::detail::is_integral<T>::value)> iterator operator()(T value) { // MSVC2013 fails to compile separate overloads for bool and char_type so // use std::is_same instead. @@ -250,7 +255,11 @@ class printf_arg_formatter : public internal::arg_formatter_base<Range> { return (*this)(static_cast<int>(value)); fmt_specs.sign = sign::none; fmt_specs.alt = false; - fmt_specs.align = align::right; + fmt_specs.fill[0] = ' '; // Ignore '0' flag for char types. + // align::numeric needs to be overwritten here since the '0' flag is + // ignored for non-numeric types + if (fmt_specs.align == align::none || fmt_specs.align == align::numeric) + fmt_specs.align = align::right; return base::operator()(value); } else { return base::operator()(value); @@ -307,6 +316,8 @@ class printf_arg_formatter : public internal::arg_formatter_base<Range> { }; template <typename T> struct printf_formatter { + printf_formatter() = delete; + template <typename ParseContext> auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { return ctx.begin(); @@ -314,17 +325,21 @@ template <typename T> struct printf_formatter { template <typename FormatContext> auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) { - internal::format_value(internal::get_container(ctx.out()), value); + detail::format_value(detail::get_container(ctx.out()), value); return ctx.out(); } }; -/** This template formats data and writes the output to a writer. */ +/** + This template formats data and writes the output through an output iterator. + */ template <typename OutputIt, typename Char> class basic_printf_context { public: /** The character type for the output. */ using char_type = Char; + using iterator = OutputIt; using format_arg = basic_format_arg<basic_printf_context>; + using parse_context_type = basic_printf_parse_context<Char>; template <typename T> using formatter_type = printf_formatter<T>; private: @@ -332,24 +347,23 @@ template <typename OutputIt, typename Char> class basic_printf_context { OutputIt out_; basic_format_args<basic_printf_context> args_; - basic_parse_context<Char> parse_ctx_; + parse_context_type parse_ctx_; static void parse_flags(format_specs& specs, const Char*& it, const Char* end); - // Returns the argument with specified index or, if arg_index is equal - // to the maximum unsigned value, the next argument. - format_arg get_arg(unsigned arg_index = std::numeric_limits<unsigned>::max()); + // Returns the argument with specified index or, if arg_index is -1, the next + // argument. + format_arg get_arg(int arg_index = -1); // Parses argument index, flags and width and returns the argument index. - unsigned parse_header(const Char*& it, const Char* end, format_specs& specs); + int parse_header(const Char*& it, const Char* end, format_specs& specs); public: /** \rst - Constructs a ``printf_context`` object. References to the arguments and - the writer are stored in the context object so make sure they have - appropriate lifetimes. + Constructs a ``printf_context`` object. References to the arguments are + stored in the context object so make sure they have appropriate lifetimes. \endrst */ basic_printf_context(OutputIt out, basic_string_view<char_type> format_str, @@ -359,17 +373,18 @@ template <typename OutputIt, typename Char> class basic_printf_context { OutputIt out() { return out_; } void advance_to(OutputIt it) { out_ = it; } - format_arg arg(unsigned id) const { return args_.get(id); } + detail::locale_ref locale() { return {}; } + + format_arg arg(int id) const { return args_.get(id); } - basic_parse_context<Char>& parse_context() { return parse_ctx_; } + parse_context_type& parse_context() { return parse_ctx_; } FMT_CONSTEXPR void on_error(const char* message) { parse_ctx_.on_error(message); } /** Formats stored arguments and writes the output to the range. */ - template <typename ArgFormatter = - printf_arg_formatter<internal::buffer_range<Char>>> + template <typename ArgFormatter = printf_arg_formatter<OutputIt, Char>> OutputIt format(); }; @@ -389,7 +404,9 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs, specs.fill[0] = '0'; break; case ' ': - specs.sign = sign::space; + if (specs.sign != sign::plus) { + specs.sign = sign::space; + } break; case '#': specs.alt = true; @@ -402,24 +419,25 @@ void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs, template <typename OutputIt, typename Char> typename basic_printf_context<OutputIt, Char>::format_arg -basic_printf_context<OutputIt, Char>::get_arg(unsigned arg_index) { - if (arg_index == std::numeric_limits<unsigned>::max()) +basic_printf_context<OutputIt, Char>::get_arg(int arg_index) { + if (arg_index < 0) arg_index = parse_ctx_.next_arg_id(); else parse_ctx_.check_arg_id(--arg_index); - return internal::get_arg(*this, arg_index); + return detail::get_arg(*this, arg_index); } template <typename OutputIt, typename Char> -unsigned basic_printf_context<OutputIt, Char>::parse_header( - const Char*& it, const Char* end, format_specs& specs) { - unsigned arg_index = std::numeric_limits<unsigned>::max(); +int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it, + const Char* end, + format_specs& specs) { + int arg_index = -1; char_type c = *it; if (c >= '0' && c <= '9') { // Parse an argument index (if followed by '$') or a width possibly // preceded with '0' flag(s). - internal::error_handler eh; - unsigned value = parse_nonnegative_int(it, end, eh); + detail::error_handler eh; + int value = parse_nonnegative_int(it, end, eh); if (it != end && *it == '$') { // value is an argument index ++it; arg_index = value; @@ -437,12 +455,12 @@ unsigned basic_printf_context<OutputIt, Char>::parse_header( // Parse width. if (it != end) { if (*it >= '0' && *it <= '9') { - internal::error_handler eh; + detail::error_handler eh; specs.width = parse_nonnegative_int(it, end, eh); } else if (*it == '*') { ++it; - specs.width = visit_format_arg( - internal::printf_width_handler<char_type>(specs), get_arg()); + specs.width = static_cast<int>(visit_format_arg( + detail::printf_width_handler<char_type>(specs), get_arg())); } } return arg_index; @@ -469,38 +487,53 @@ OutputIt basic_printf_context<OutputIt, Char>::format() { specs.align = align::right; // Parse argument index, flags and width. - unsigned arg_index = parse_header(it, end, specs); + int arg_index = parse_header(it, end, specs); + if (arg_index == 0) on_error("argument not found"); // Parse precision. if (it != end && *it == '.') { ++it; c = it != end ? *it : 0; if ('0' <= c && c <= '9') { - internal::error_handler eh; - specs.precision = static_cast<int>(parse_nonnegative_int(it, end, eh)); + detail::error_handler eh; + specs.precision = parse_nonnegative_int(it, end, eh); } else if (c == '*') { ++it; - specs.precision = - visit_format_arg(internal::printf_precision_handler(), get_arg()); + specs.precision = static_cast<int>( + visit_format_arg(detail::printf_precision_handler(), get_arg())); } else { specs.precision = 0; } } format_arg arg = get_arg(arg_index); - if (specs.alt && visit_format_arg(internal::is_zero_int(), arg)) + // For d, i, o, u, x, and X conversion specifiers, if a precision is + // specified, the '0' flag is ignored + if (specs.precision >= 0 && arg.is_integral()) + specs.fill[0] = + ' '; // Ignore '0' flag for non-numeric types or if '-' present. + if (specs.precision >= 0 && arg.type() == detail::type::cstring_type) { + auto str = visit_format_arg(detail::get_cstring<Char>(), arg); + auto str_end = str + specs.precision; + auto nul = std::find(str, str_end, Char()); + arg = detail::make_arg<basic_printf_context>(basic_string_view<Char>( + str, + detail::to_unsigned(nul != str_end ? nul - str : specs.precision))); + } + if (specs.alt && visit_format_arg(detail::is_zero_int(), arg)) specs.alt = false; if (specs.fill[0] == '0') { - if (arg.is_arithmetic()) + if (arg.is_arithmetic() && specs.align != align::left) specs.align = align::numeric; else - specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types. + specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types or if '-' + // flag is also present. } // Parse length and convert the argument to the required type. c = it != end ? *it++ : 0; char_type t = it != end ? *it : 0; - using internal::convert_arg; + using detail::convert_arg; switch (c) { case 'h': if (t == 'h') { @@ -524,7 +557,7 @@ OutputIt basic_printf_context<OutputIt, Char>::format() { convert_arg<intmax_t>(arg, t); break; case 'z': - convert_arg<std::size_t>(arg, t); + convert_arg<size_t>(arg, t); break; case 't': convert_arg<std::ptrdiff_t>(arg, t); @@ -549,7 +582,7 @@ OutputIt basic_printf_context<OutputIt, Char>::format() { specs.type = 'd'; break; case 'c': - visit_format_arg(internal::char_converter<basic_printf_context>(arg), + visit_format_arg(detail::char_converter<basic_printf_context>(arg), arg); break; } @@ -558,15 +591,14 @@ OutputIt basic_printf_context<OutputIt, Char>::format() { start = it; // Format argument. - visit_format_arg(ArgFormatter(out, specs, *this), arg); + out = visit_format_arg(ArgFormatter(out, specs, *this), arg); } return std::copy(start, it, out); } template <typename Char> using basic_printf_context_t = - basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>, - Char>; + basic_printf_context<detail::buffer_appender<Char>, Char>; using printf_context = basic_printf_context_t<char>; using wprintf_context = basic_printf_context_t<wchar_t>; @@ -600,9 +632,10 @@ inline format_arg_store<wprintf_context, Args...> make_wprintf_args( template <typename S, typename Char = char_t<S>> inline std::basic_string<Char> vsprintf( - const S& format, basic_format_args<basic_printf_context_t<Char>> args) { + const S& format, + basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) { basic_memory_buffer<Char> buffer; - printf(buffer, to_string_view(format), args); + vprintf(buffer, to_string_view(format), args); return to_string(buffer); } @@ -616,18 +649,19 @@ inline std::basic_string<Char> vsprintf( \endrst */ template <typename S, typename... Args, - typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>> + typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>> inline std::basic_string<Char> sprintf(const S& format, const Args&... args) { using context = basic_printf_context_t<Char>; - return vsprintf(to_string_view(format), {make_format_args<context>(args...)}); + return vsprintf(to_string_view(format), make_format_args<context>(args...)); } template <typename S, typename Char = char_t<S>> -inline int vfprintf(std::FILE* f, const S& format, - basic_format_args<basic_printf_context_t<Char>> args) { +inline int vfprintf( + std::FILE* f, const S& format, + basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) { basic_memory_buffer<Char> buffer; - printf(buffer, to_string_view(format), args); - std::size_t size = buffer.size(); + vprintf(buffer, to_string_view(format), args); + size_t size = buffer.size(); return std::fwrite(buffer.data(), sizeof(Char), size, f) < size ? -1 : static_cast<int>(size); @@ -643,16 +677,17 @@ inline int vfprintf(std::FILE* f, const S& format, \endrst */ template <typename S, typename... Args, - typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>> + typename Char = enable_if_t<detail::is_string<S>::value, char_t<S>>> inline int fprintf(std::FILE* f, const S& format, const Args&... args) { using context = basic_printf_context_t<Char>; return vfprintf(f, to_string_view(format), - {make_format_args<context>(args...)}); + make_format_args<context>(args...)); } template <typename S, typename Char = char_t<S>> -inline int vprintf(const S& format, - basic_format_args<basic_printf_context_t<Char>> args) { +inline int vprintf( + const S& format, + basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) { return vfprintf(stdout, to_string_view(format), args); } @@ -666,19 +701,20 @@ inline int vprintf(const S& format, \endrst */ template <typename S, typename... Args, - FMT_ENABLE_IF(internal::is_string<S>::value)> + FMT_ENABLE_IF(detail::is_string<S>::value)> inline int printf(const S& format_str, const Args&... args) { using context = basic_printf_context_t<char_t<S>>; return vprintf(to_string_view(format_str), - {make_format_args<context>(args...)}); + make_format_args<context>(args...)); } template <typename S, typename Char = char_t<S>> -inline int vfprintf(std::basic_ostream<Char>& os, const S& format, - basic_format_args<basic_printf_context_t<Char>> args) { +inline int vfprintf( + std::basic_ostream<Char>& os, const S& format, + basic_format_args<basic_printf_context_t<type_identity_t<Char>>> args) { basic_memory_buffer<Char> buffer; - printf(buffer, to_string_view(format), args); - internal::write(os, buffer); + vprintf(buffer, to_string_view(format), args); + detail::write_buffer(os, buffer); return static_cast<int>(buffer.size()); } @@ -686,9 +722,9 @@ inline int vfprintf(std::basic_ostream<Char>& os, const S& format, template <typename ArgFormatter, typename Char, typename Context = basic_printf_context<typename ArgFormatter::iterator, Char>> -typename ArgFormatter::iterator vprintf(internal::buffer<Char>& out, - basic_string_view<Char> format_str, - basic_format_args<Context> args) { +typename ArgFormatter::iterator vprintf( + detail::buffer<Char>& out, basic_string_view<Char> format_str, + basic_format_args<type_identity_t<Context>> args) { typename ArgFormatter::iterator iter(out); Context(iter, format_str, args).template format<ArgFormatter>(); return iter; @@ -708,7 +744,7 @@ inline int fprintf(std::basic_ostream<Char>& os, const S& format_str, const Args&... args) { using context = basic_printf_context_t<Char>; return vfprintf(os, to_string_view(format_str), - {make_format_args<context>(args...)}); + make_format_args<context>(args...)); } FMT_END_NAMESPACE diff --git a/include/vtkdiy2/fmt/ranges.h b/include/vtkdiy2/thirdparty/fmt/ranges.h similarity index 58% rename from include/vtkdiy2/fmt/ranges.h rename to include/vtkdiy2/thirdparty/fmt/ranges.h index cf0d41aaa5eec1077dec1105008af83475b95cb3..632f04949c86c023cd9c389a31665eca5ae2bf8d 100644 --- a/include/vtkdiy2/fmt/ranges.h +++ b/include/vtkdiy2/thirdparty/fmt/ranges.h @@ -12,7 +12,9 @@ #ifndef FMT_RANGES_H_ #define FMT_RANGES_H_ +#include <initializer_list> #include <type_traits> + #include "format.h" // output only up to N items from the range. @@ -31,7 +33,7 @@ template <typename Char> struct formatting_base { template <typename Char, typename Enable = void> struct formatting_range : formatting_base<Char> { - static FMT_CONSTEXPR_DECL const std::size_t range_length_limit = + static FMT_CONSTEXPR_DECL const size_t range_length_limit = FMT_RANGE_OUTPUT_LENGTH_LIMIT; // output only up to N items from the // range. Char prefix; @@ -52,7 +54,7 @@ struct formatting_tuple : formatting_base<Char> { static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false; }; -namespace internal { +namespace detail { template <typename RangeT, typename OutputIterator> OutputIterator copy(const RangeT& range, OutputIterator out) { @@ -104,10 +106,7 @@ struct is_range_< /// tuple_size and tuple_element check. template <typename T> class is_tuple_like_ { template <typename U> - static auto check(U* p) - -> decltype(std::tuple_size<U>::value, - (void)std::declval<typename std::tuple_element<0, U>::type>(), - int()); + static auto check(U* p) -> decltype(std::tuple_size<U>::value, int()); template <typename> static void check(...); public: @@ -119,26 +118,24 @@ template <typename T> class is_tuple_like_ { #if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900 template <typename T, T... N> using integer_sequence = std::integer_sequence<T, N...>; -template <std::size_t... N> using index_sequence = std::index_sequence<N...>; -template <std::size_t N> -using make_index_sequence = std::make_index_sequence<N>; +template <size_t... N> using index_sequence = std::index_sequence<N...>; +template <size_t N> using make_index_sequence = std::make_index_sequence<N>; #else template <typename T, T... N> struct integer_sequence { using value_type = T; - static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); } + static FMT_CONSTEXPR size_t size() { return sizeof...(N); } }; -template <std::size_t... N> -using index_sequence = integer_sequence<std::size_t, N...>; +template <size_t... N> using index_sequence = integer_sequence<size_t, N...>; -template <typename T, std::size_t N, T... Ns> +template <typename T, size_t N, T... Ns> struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {}; template <typename T, T... Ns> struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {}; -template <std::size_t N> -using make_index_sequence = make_integer_sequence<std::size_t, N>; +template <size_t N> +using make_index_sequence = make_integer_sequence<size_t, N>; #endif template <class Tuple, class F, size_t... Is> @@ -160,6 +157,9 @@ template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) { for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f)); } +template <typename Range> +using value_type = remove_cvref_t<decltype(*std::declval<Range>().begin())>; + template <typename Arg, FMT_ENABLE_IF(!is_like_std_string< typename std::decay<Arg>::type>::value)> FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) { @@ -185,12 +185,11 @@ FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) { FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) { return add_space ? L" '{}'" : L"'{}'"; } - -} // namespace internal +} // namespace detail template <typename T> struct is_tuple_like { static FMT_CONSTEXPR_DECL const bool value = - internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value; + detail::is_tuple_like_<T>::value && !detail::is_range_<T>::value; }; template <typename TupleT, typename Char> @@ -203,17 +202,17 @@ struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> { if (formatting.add_prepostfix_space) { *out++ = ' '; } - out = internal::copy(formatting.delimiter, out); + out = detail::copy(formatting.delimiter, out); } out = format_to(out, - internal::format_str_quoted( + detail::format_str_quoted( (formatting.add_delimiter_spaces && i > 0), v), v); ++i; } formatting_tuple<Char>& formatting; - std::size_t& i; + size_t& i; typename std::add_lvalue_reference<decltype( std::declval<FormatContext>().out())>::type out; }; @@ -229,14 +228,14 @@ struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> { template <typename FormatContext = format_context> auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) { auto out = ctx.out(); - std::size_t i = 0; - internal::copy(formatting.prefix, out); + size_t i = 0; + detail::copy(formatting.prefix, out); - internal::for_each(values, format_each<FormatContext>{formatting, i, out}); + detail::for_each(values, format_each<FormatContext>{formatting, i, out}); if (formatting.add_prepostfix_space) { *out++ = ' '; } - internal::copy(formatting.postfix, out); + detail::copy(formatting.postfix, out); return ctx.out(); } @@ -244,14 +243,23 @@ struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> { template <typename T, typename Char> struct is_range { static FMT_CONSTEXPR_DECL const bool value = - internal::is_range_<T>::value && - !internal::is_like_std_string<T>::value && - !std::is_convertible<T, std::basic_string<Char>>::value; + detail::is_range_<T>::value && !detail::is_like_std_string<T>::value && + !std::is_convertible<T, std::basic_string<Char>>::value && + !std::is_constructible<detail::std_string_view<Char>, T>::value; }; -template <typename RangeT, typename Char> -struct formatter<RangeT, Char, - enable_if_t<fmt::is_range<RangeT, Char>::value>> { +template <typename T, typename Char> +struct formatter< + T, Char, + enable_if_t<fmt::is_range<T, Char>::value +// Workaround a bug in MSVC 2017 and earlier. +#if !FMT_MSC_VER || FMT_MSC_VER >= 1927 + && + (has_formatter<detail::value_type<T>, format_context>::value || + detail::has_fallback_formatter<detail::value_type<T>, + format_context>::value) +#endif + >> { formatting_range<Char> formatting; template <typename ParseContext> @@ -260,17 +268,18 @@ struct formatter<RangeT, Char, } template <typename FormatContext> - typename FormatContext::iterator format(const RangeT& values, - FormatContext& ctx) { - auto out = internal::copy(formatting.prefix, ctx.out()); - std::size_t i = 0; - for (auto it = values.begin(), end = values.end(); it != end; ++it) { + typename FormatContext::iterator format(const T& values, FormatContext& ctx) { + auto out = detail::copy(formatting.prefix, ctx.out()); + size_t i = 0; + auto it = values.begin(); + auto end = values.end(); + for (; it != end; ++it) { if (i > 0) { if (formatting.add_prepostfix_space) *out++ = ' '; - out = internal::copy(formatting.delimiter, out); + out = detail::copy(formatting.delimiter, out); } out = format_to(out, - internal::format_str_quoted( + detail::format_str_quoted( (formatting.add_delimiter_spaces && i > 0), *it), *it); if (++i > formatting.range_length_limit) { @@ -279,10 +288,109 @@ struct formatter<RangeT, Char, } } if (formatting.add_prepostfix_space) *out++ = ' '; - return internal::copy(formatting.postfix, out); + return detail::copy(formatting.postfix, out); + } +}; + +template <typename Char, typename... T> struct tuple_arg_join : detail::view { + const std::tuple<T...>& tuple; + basic_string_view<Char> sep; + + tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s) + : tuple{t}, sep{s} {} +}; + +template <typename Char, typename... T> +struct formatter<tuple_arg_join<Char, T...>, Char> { + template <typename ParseContext> + FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) { + return ctx.begin(); + } + + template <typename FormatContext> + typename FormatContext::iterator format( + const tuple_arg_join<Char, T...>& value, FormatContext& ctx) { + return format(value, ctx, detail::make_index_sequence<sizeof...(T)>{}); + } + + private: + template <typename FormatContext, size_t... N> + typename FormatContext::iterator format( + const tuple_arg_join<Char, T...>& value, FormatContext& ctx, + detail::index_sequence<N...>) { + return format_args(value, ctx, std::get<N>(value.tuple)...); + } + + template <typename FormatContext> + typename FormatContext::iterator format_args( + const tuple_arg_join<Char, T...>&, FormatContext& ctx) { + // NOTE: for compilers that support C++17, this empty function instantiation + // can be replaced with a constexpr branch in the variadic overload. + return ctx.out(); + } + + template <typename FormatContext, typename Arg, typename... Args> + typename FormatContext::iterator format_args( + const tuple_arg_join<Char, T...>& value, FormatContext& ctx, + const Arg& arg, const Args&... args) { + using base = formatter<typename std::decay<Arg>::type, Char>; + auto out = ctx.out(); + out = base{}.format(arg, ctx); + if (sizeof...(Args) > 0) { + out = std::copy(value.sep.begin(), value.sep.end(), out); + ctx.advance_to(out); + return format_args(value, ctx, args...); + } + return out; } }; +/** + \rst + Returns an object that formats `tuple` with elements separated by `sep`. + + **Example**:: + + std::tuple<int, char> t = {1, 'a'}; + fmt::print("{}", fmt::join(t, ", ")); + // Output: "1, a" + \endrst + */ +template <typename... T> +FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple, + string_view sep) { + return {tuple, sep}; +} + +template <typename... T> +FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple, + wstring_view sep) { + return {tuple, sep}; +} + +/** + \rst + Returns an object that formats `initializer_list` with elements separated by + `sep`. + + **Example**:: + + fmt::print("{}", fmt::join({1, 2, 3}, ", ")); + // Output: "1, 2, 3" + \endrst + */ +template <typename T> +arg_join<const T*, const T*, char> join(std::initializer_list<T> list, + string_view sep) { + return join(std::begin(list), std::end(list), sep); +} + +template <typename T> +arg_join<const T*, const T*, wchar_t> join(std::initializer_list<T> list, + wstring_view sep) { + return join(std::begin(list), std::end(list), sep); +} + FMT_END_NAMESPACE #endif // FMT_RANGES_H_ diff --git a/include/vtkdiy2/fmt/safe-duration-cast.h b/include/vtkdiy2/thirdparty/fmt/safe-duration-cast.h similarity index 100% rename from include/vtkdiy2/fmt/safe-duration-cast.h rename to include/vtkdiy2/thirdparty/fmt/safe-duration-cast.h diff --git a/include/vtkdiy2/itlib/small_vector.hpp b/include/vtkdiy2/thirdparty/itlib/small_vector.hpp similarity index 100% rename from include/vtkdiy2/itlib/small_vector.hpp rename to include/vtkdiy2/thirdparty/itlib/small_vector.hpp diff --git a/include/vtkdiy2/thread/fast_mutex.h b/include/vtkdiy2/thirdparty/thread/fast_mutex.h similarity index 100% rename from include/vtkdiy2/thread/fast_mutex.h rename to include/vtkdiy2/thirdparty/thread/fast_mutex.h diff --git a/include/vtkdiy2/thread.hpp b/include/vtkdiy2/thread.hpp index 1c9149a42e31715d53d3eff7ce4739d9af05c525..f48ee7e1acdc2d76b9824a59b9fa4639bb658b6a 100644 --- a/include/vtkdiy2/thread.hpp +++ b/include/vtkdiy2/thread.hpp @@ -1,11 +1,15 @@ #ifndef DIY_THREAD_H #define DIY_THREAD_H +#include <map> + #ifdef DIY_NO_THREADS #include "no-thread.hpp" #else -#include "thread/fast_mutex.h" +#if !defined(_MSC_VER) +#include "thirdparty/thread/fast_mutex.h" +#endif #include <thread> #include <mutex> @@ -17,15 +21,74 @@ namespace diy using std::recursive_mutex; namespace this_thread = std::this_thread; +#if defined(_MSC_VER) + // fast_mutex implementation has issues on MSVC. Just use std::mutex + using fast_mutex = std::mutex; +#else // TODO: replace with our own implementation using std::atomic_flag using fast_mutex = tthread::fast_mutex; +#endif template<class Mutex> using lock_guard = std::unique_lock<Mutex>; + + template<class T, class U> + struct concurrent_map; } -#endif +#endif // DIY_NO_THREADS #include "critical-resource.hpp" +#if !defined(DIY_NO_THREADS) + +#include <memory> // for shared_ptr + +template<class T, class U> +struct diy::concurrent_map +{ + using Map = std::map<T,U>; + using SharedPtr = std::shared_ptr<lock_guard<fast_mutex>>; + + template<class MapIterator> + struct iterator_ + { + MapIterator it; + SharedPtr lock_ptr; + + iterator_(const MapIterator& it_, const SharedPtr& lock_ptr_ = SharedPtr()): + it(it_), lock_ptr(lock_ptr_) {} + + iterator_& operator++() { ++it; return *this; } + iterator_ operator++(int) { iterator_ retval = *this; ++(*this); return retval; } + + bool operator==(const iterator_& other) const { return it == other.it;} + bool operator!=(const iterator_& other) const { return !(*this == other); } + + decltype(*it) operator*() const { return *it; } + decltype(it.operator->()) operator->() const { return it.operator->(); } + }; + + using iterator = iterator_<typename Map::iterator>; + using const_iterator = iterator_<typename Map::const_iterator>; + + U& operator[](const T& x) { lock_guard<fast_mutex> l(mutex_); return map_[x]; } + + iterator begin() { auto p = std::make_shared<lock_guard<fast_mutex>>(mutex_); return iterator(map_.begin(), p); } + iterator end() { return iterator(map_.end()); } + + const_iterator begin() const { auto p = std::make_shared<lock_guard<fast_mutex>>(mutex_); return const_iterator(map_.begin(), p); } + const_iterator end() const { return const_iterator(map_.end()); } + + iterator find(const T& x) { auto p = std::make_shared<lock_guard<fast_mutex>>(mutex_); return iterator(map_.find(x), p); } + const_iterator find(const T& x) const { auto p = std::make_shared<lock_guard<fast_mutex>>(mutex_); return const_iterator(map_.find(x), p); } + + void clear() { lock_guard<fast_mutex> l(mutex_); map_.clear(); } + bool empty() { lock_guard<fast_mutex> l(mutex_); return map_.empty(); } + + Map map_; + mutable fast_mutex mutex_; +}; +#endif // !defined(DIY_NO_THREADS) + #endif diff --git a/include/vtkdiy2/time.hpp b/include/vtkdiy2/time.hpp index 692cf3673103af5e641aaeb7ca9f210516fc258e..671e69ddf390565a462727571fb729910c5b0ad2 100644 --- a/include/vtkdiy2/time.hpp +++ b/include/vtkdiy2/time.hpp @@ -3,10 +3,10 @@ #ifndef _WIN32 #include <sys/time.h> -#ifdef __MACH__ +#if defined(__MACH__) && defined(__APPLE__) #include <mach/clock.h> #include <mach/mach.h> -#endif // __MACH__ +#endif // __MACH__ && __APPLE__ #endif // ifndef _WIN32 namespace diy @@ -16,7 +16,7 @@ typedef unsigned long time_type; inline time_type get_time() { -#ifdef __MACH__ // OS X does not have clock_gettime, use clock_get_time +#if defined(__MACH__) && defined(__APPLE__) // OS X does not have clock_gettime, use clock_get_time clock_serv_t cclock; mach_timespec_t ts; host_get_clock_service(mach_host_self(), CALENDAR_CLOCK, &cclock); diff --git a/include/vtkdiy2/types.hpp b/include/vtkdiy2/types.hpp index 28a1a05824ba63dc5fbe46ecc45f8fc2f6022f69..1dc380bb4152f74c6fbedf9050e1133b25abe761 100644 --- a/include/vtkdiy2/types.hpp +++ b/include/vtkdiy2/types.hpp @@ -4,9 +4,12 @@ #include <iostream> #include "constants.h" #include "dynamic-point.hpp" +#include "point.hpp" namespace diy { + using Work = unsigned int; + struct BlockID { int gid, proc; @@ -23,11 +26,44 @@ namespace diy Point min, max; - DEPRECATED("Default Bounds constructor should not be used; old behavior is preserved for compatibility. Pass explicitly the dimension of the Bounds instead.") - Bounds(): - Bounds(DIY_MAX_DIM) {} Bounds(int dim): min(dim), max(dim) {} Bounds(const Point& _min, const Point& _max) : min(_min), max(_max) {} + + bool contains(const Point& p) const + { + assert(p.dimension() == min.dimension()); + + for(unsigned i = 0; i < min.dimension(); ++i) + if (p[i] < min[i] || p[i] > max[i]) + return false; + return true; + } + + template<unsigned int D> + bool contains(const diy::Point<Coordinate_, D>& p) const + { + assert(p.dimension() == min.dimension()); + + for(unsigned i = 0; i < min.dimension(); ++i) + if (p[i] < min[i] || p[i] > max[i]) + return false; + return true; + } + + inline friend std::ostream& operator<<(std::ostream& out, const Bounds& b) + { + out << "Bounds(min=" << b.min << ", max=" << b.max << ")"; + return out; + } + + private: + // make default constructor private to explicitly break old deprecated behavior; + // any call to the default constructor should be replaced by a call to Bounds(0) + Bounds(): + Bounds(0) {} + + template<class T> friend struct diy::Serialization; + }; using DiscreteBounds = Bounds<int>; using ContinuousBounds = Bounds<float>; @@ -66,11 +102,7 @@ namespace diy if (dim > 3 && dir & DIY_T1) (*this)[3] += 1; } - DEPRECATED("Direction without dimension is deprecated") - Direction(int dir): - Direction(DIY_MAX_DIM, dir) // if we are decoding the old constants, we assume DIY_MAX_DIM dimensional space - { - } + static Direction from_bits(int dir, int dim = DIY_MAX_DIM) { return Direction(dim, dir); } bool operator==(const diy::Direction& y) const diff --git a/include/vtkdiy2/utils.hpp b/include/vtkdiy2/utils.hpp new file mode 100644 index 0000000000000000000000000000000000000000..7a9ad0d10218494014b4aee51ad8851d19f37917 --- /dev/null +++ b/include/vtkdiy2/utils.hpp @@ -0,0 +1,15 @@ +#ifndef DIY_UTILS_HPP +#define DIY_UTILS_HPP + +#include <memory> + +namespace diy +{ + template<typename T, typename... Args> + std::unique_ptr<T> make_unique(Args&&... args) + { + return std::unique_ptr<T>(new T(std::forward<Args>(args)...)); + } +} + +#endif